/**
 * Owl Carousel v2.3.4
 * Copyright 2013-2018 David Deutsch
 * Licensed under: SEE LICENSE IN https://github.com/OwlCarousel2/OwlCarousel2/blob/master/LICENSE
 */
/*
 *  Owl Carousel - Core
 */
.owl-carousel {
  display: none;
  width: 100%;
  -webkit-tap-highlight-color: transparent;
  /* position relative and z-index fix webkit rendering fonts issue */
  position: relative;
  z-index: 1; }
  .owl-carousel .owl-stage {
    position: relative;
    -ms-touch-action: pan-Y;
    touch-action: manipulation;
    -moz-backface-visibility: hidden;
    /* fix firefox animation glitch */ }
  .owl-carousel .owl-stage:after {
    content: ".";
    display: block;
    clear: both;
    visibility: hidden;
    line-height: 0;
    height: 0; }
  .owl-carousel .owl-stage-outer {
    position: relative;
    overflow: hidden;
    /* fix for flashing background */
    -webkit-transform: translate3d(0px, 0px, 0px); }
  .owl-carousel .owl-wrapper,
  .owl-carousel .owl-item {
    -webkit-backface-visibility: hidden;
    -moz-backface-visibility: hidden;
    -ms-backface-visibility: hidden;
    -webkit-transform: translate3d(0, 0, 0);
    -moz-transform: translate3d(0, 0, 0);
    -ms-transform: translate3d(0, 0, 0); }
  .owl-carousel .owl-item {
    position: relative;
    min-height: 1px;
    float: left;
    -webkit-backface-visibility: hidden;
    -webkit-tap-highlight-color: transparent;
    -webkit-touch-callout: none; }
  .owl-carousel .owl-item img {
    display: block;
    width: 100%; }
  .owl-carousel .owl-nav.disabled,
  .owl-carousel .owl-dots.disabled {
    display: none; }
  .owl-carousel .owl-nav .owl-prev,
  .owl-carousel .owl-nav .owl-next,
  .owl-carousel .owl-dot {
    cursor: pointer;
    -webkit-user-select: none;
    -khtml-user-select: none;
    -moz-user-select: none;
    -ms-user-select: none;
    user-select: none; }
  .owl-carousel .owl-nav button.owl-prev,
  .owl-carousel .owl-nav button.owl-next,
  .owl-carousel button.owl-dot {
    background: none;
    color: inherit;
    border: none;
    padding: 0 !important;
    font: inherit; }
  .owl-carousel.owl-loaded {
    display: block; }
  .owl-carousel.owl-loading {
    opacity: 0;
    display: block; }
  .owl-carousel.owl-hidden {
    opacity: 0; }
  .owl-carousel.owl-refresh .owl-item {
    visibility: hidden; }
  .owl-carousel.owl-drag .owl-item {
    -ms-touch-action: pan-y;
        touch-action: pan-y;
    -webkit-user-select: none;
    -moz-user-select: none;
    -ms-user-select: none;
    user-select: none; }
  .owl-carousel.owl-grab {
    cursor: move;
    cursor: grab; }
  .owl-carousel.owl-rtl {
    direction: rtl; }
  .owl-carousel.owl-rtl .owl-item {
    float: right; }

/* No Js */
.no-js .owl-carousel {
  display: block; }

/*
 *  Owl Carousel - Animate Plugin
 */
.owl-carousel .animated {
  animation-duration: 1000ms;
  animation-fill-mode: both; }

.owl-carousel .owl-animated-in {
  z-index: 0; }

.owl-carousel .owl-animated-out {
  z-index: 1; }

.owl-carousel .fadeOut {
  animation-name: fadeOut; }

@keyframes fadeOut {
  0% {
    opacity: 1; }
  100% {
    opacity: 0; } }

/*
 * 	Owl Carousel - Auto Height Plugin
 */
.owl-height {
  transition: height 500ms ease-in-out; }

/*
 * 	Owl Carousel - Lazy Load Plugin
 */
.owl-carousel .owl-item {
  /**
			This is introduced due to a bug in IE11 where lazy loading combined with autoheight plugin causes a wrong
			calculation of the height of the owl-item that breaks page layouts
		 */ }
  .owl-carousel .owl-item .owl-lazy {
    opacity: 0;
    transition: opacity 400ms ease; }
  .owl-carousel .owl-item .owl-lazy[src^=""], .owl-carousel .owl-item .owl-lazy:not([src]) {
    max-height: 0; }
  .owl-carousel .owl-item img.owl-lazy {
    transform-style: preserve-3d; }

/*
 * 	Owl Carousel - Video Plugin
 */
.owl-carousel .owl-video-wrapper {
  position: relative;
  height: 100%;
  background: #000; }

.owl-carousel .owl-video-play-icon {
  position: absolute;
  height: 80px;
  width: 80px;
  left: 50%;
  top: 50%;
  margin-left: -40px;
  margin-top: -40px;
  background: url("owl.video.play.png") no-repeat;
  cursor: pointer;
  z-index: 1;
  -webkit-backface-visibility: hidden;
  transition: transform 100ms ease; }

.owl-carousel .owl-video-play-icon:hover {
  -ms-transform: scale(1.3, 1.3);
      transform: scale(1.3, 1.3); }

.owl-carousel .owl-video-playing .owl-video-tn,
.owl-carousel .owl-video-playing .owl-video-play-icon {
  display: none; }

.owl-carousel .owl-video-tn {
  opacity: 0;
  height: 100%;
  background-position: center center;
  background-repeat: no-repeat;
  background-size: contain;
  transition: opacity 400ms ease; }

.owl-carousel .owl-video-frame {
  position: relative;
  z-index: 1;
  height: 100%;
  width: 100%; }

/*!
 * Bootstrap Icons v1.11.1 (https://icons.getbootstrap.com/)
 * Copyright 2019-2023 The Bootstrap Authors
 * Licensed under MIT (https://github.com/twbs/icons/blob/main/LICENSE)
 */

@font-face {
  font-display: block;
  font-family: "bootstrap-icons";
  src: url("./fonts/bootstrap-icons.woff2?2820a3852bdb9a5832199cc61cec4e65") format("woff2"),
url("./fonts/bootstrap-icons.woff?2820a3852bdb9a5832199cc61cec4e65") format("woff");
}

.bi::before,
[class^="bi-"]::before,
[class*=" bi-"]::before {
  display: inline-block;
  font-family: bootstrap-icons !important;
  font-style: normal;
  font-weight: normal !important;
  font-variant: normal;
  text-transform: none;
  line-height: 1;
  vertical-align: -.125em;
  -webkit-font-smoothing: antialiased;
  -moz-osx-font-smoothing: grayscale;
}

.bi-123::before { content: "\f67f"; }
.bi-alarm-fill::before { content: "\f101"; }
.bi-alarm::before { content: "\f102"; }
.bi-align-bottom::before { content: "\f103"; }
.bi-align-center::before { content: "\f104"; }
.bi-align-end::before { content: "\f105"; }
.bi-align-middle::before { content: "\f106"; }
.bi-align-start::before { content: "\f107"; }
.bi-align-top::before { content: "\f108"; }
.bi-alt::before { content: "\f109"; }
.bi-app-indicator::before { content: "\f10a"; }
.bi-app::before { content: "\f10b"; }
.bi-archive-fill::before { content: "\f10c"; }
.bi-archive::before { content: "\f10d"; }
.bi-arrow-90deg-down::before { content: "\f10e"; }
.bi-arrow-90deg-left::before { content: "\f10f"; }
.bi-arrow-90deg-right::before { content: "\f110"; }
.bi-arrow-90deg-up::before { content: "\f111"; }
.bi-arrow-bar-down::before { content: "\f112"; }
.bi-arrow-bar-left::before { content: "\f113"; }
.bi-arrow-bar-right::before { content: "\f114"; }
.bi-arrow-bar-up::before { content: "\f115"; }
.bi-arrow-clockwise::before { content: "\f116"; }
.bi-arrow-counterclockwise::before { content: "\f117"; }
.bi-arrow-down-circle-fill::before { content: "\f118"; }
.bi-arrow-down-circle::before { content: "\f119"; }
.bi-arrow-down-left-circle-fill::before { content: "\f11a"; }
.bi-arrow-down-left-circle::before { content: "\f11b"; }
.bi-arrow-down-left-square-fill::before { content: "\f11c"; }
.bi-arrow-down-left-square::before { content: "\f11d"; }
.bi-arrow-down-left::before { content: "\f11e"; }
.bi-arrow-down-right-circle-fill::before { content: "\f11f"; }
.bi-arrow-down-right-circle::before { content: "\f120"; }
.bi-arrow-down-right-square-fill::before { content: "\f121"; }
.bi-arrow-down-right-square::before { content: "\f122"; }
.bi-arrow-down-right::before { content: "\f123"; }
.bi-arrow-down-short::before { content: "\f124"; }
.bi-arrow-down-square-fill::before { content: "\f125"; }
.bi-arrow-down-square::before { content: "\f126"; }
.bi-arrow-down-up::before { content: "\f127"; }
.bi-arrow-down::before { content: "\f128"; }
.bi-arrow-left-circle-fill::before { content: "\f129"; }
.bi-arrow-left-circle::before { content: "\f12a"; }
.bi-arrow-left-right::before { content: "\f12b"; }
.bi-arrow-left-short::before { content: "\f12c"; }
.bi-arrow-left-square-fill::before { content: "\f12d"; }
.bi-arrow-left-square::before { content: "\f12e"; }
.bi-arrow-left::before { content: "\f12f"; }
.bi-arrow-repeat::before { content: "\f130"; }
.bi-arrow-return-left::before { content: "\f131"; }
.bi-arrow-return-right::before { content: "\f132"; }
.bi-arrow-right-circle-fill::before { content: "\f133"; }
.bi-arrow-right-circle::before { content: "\f134"; }
.bi-arrow-right-short::before { content: "\f135"; }
.bi-arrow-right-square-fill::before { content: "\f136"; }
.bi-arrow-right-square::before { content: "\f137"; }
.bi-arrow-right::before { content: "\f138"; }
.bi-arrow-up-circle-fill::before { content: "\f139"; }
.bi-arrow-up-circle::before { content: "\f13a"; }
.bi-arrow-up-left-circle-fill::before { content: "\f13b"; }
.bi-arrow-up-left-circle::before { content: "\f13c"; }
.bi-arrow-up-left-square-fill::before { content: "\f13d"; }
.bi-arrow-up-left-square::before { content: "\f13e"; }
.bi-arrow-up-left::before { content: "\f13f"; }
.bi-arrow-up-right-circle-fill::before { content: "\f140"; }
.bi-arrow-up-right-circle::before { content: "\f141"; }
.bi-arrow-up-right-square-fill::before { content: "\f142"; }
.bi-arrow-up-right-square::before { content: "\f143"; }
.bi-arrow-up-right::before { content: "\f144"; }
.bi-arrow-up-short::before { content: "\f145"; }
.bi-arrow-up-square-fill::before { content: "\f146"; }
.bi-arrow-up-square::before { content: "\f147"; }
.bi-arrow-up::before { content: "\f148"; }
.bi-arrows-angle-contract::before { content: "\f149"; }
.bi-arrows-angle-expand::before { content: "\f14a"; }
.bi-arrows-collapse::before { content: "\f14b"; }
.bi-arrows-expand::before { content: "\f14c"; }
.bi-arrows-fullscreen::before { content: "\f14d"; }
.bi-arrows-move::before { content: "\f14e"; }
.bi-aspect-ratio-fill::before { content: "\f14f"; }
.bi-aspect-ratio::before { content: "\f150"; }
.bi-asterisk::before { content: "\f151"; }
.bi-at::before { content: "\f152"; }
.bi-award-fill::before { content: "\f153"; }
.bi-award::before { content: "\f154"; }
.bi-back::before { content: "\f155"; }
.bi-backspace-fill::before { content: "\f156"; }
.bi-backspace-reverse-fill::before { content: "\f157"; }
.bi-backspace-reverse::before { content: "\f158"; }
.bi-backspace::before { content: "\f159"; }
.bi-badge-3d-fill::before { content: "\f15a"; }
.bi-badge-3d::before { content: "\f15b"; }
.bi-badge-4k-fill::before { content: "\f15c"; }
.bi-badge-4k::before { content: "\f15d"; }
.bi-badge-8k-fill::before { content: "\f15e"; }
.bi-badge-8k::before { content: "\f15f"; }
.bi-badge-ad-fill::before { content: "\f160"; }
.bi-badge-ad::before { content: "\f161"; }
.bi-badge-ar-fill::before { content: "\f162"; }
.bi-badge-ar::before { content: "\f163"; }
.bi-badge-cc-fill::before { content: "\f164"; }
.bi-badge-cc::before { content: "\f165"; }
.bi-badge-hd-fill::before { content: "\f166"; }
.bi-badge-hd::before { content: "\f167"; }
.bi-badge-tm-fill::before { content: "\f168"; }
.bi-badge-tm::before { content: "\f169"; }
.bi-badge-vo-fill::before { content: "\f16a"; }
.bi-badge-vo::before { content: "\f16b"; }
.bi-badge-vr-fill::before { content: "\f16c"; }
.bi-badge-vr::before { content: "\f16d"; }
.bi-badge-wc-fill::before { content: "\f16e"; }
.bi-badge-wc::before { content: "\f16f"; }
.bi-bag-check-fill::before { content: "\f170"; }
.bi-bag-check::before { content: "\f171"; }
.bi-bag-dash-fill::before { content: "\f172"; }
.bi-bag-dash::before { content: "\f173"; }
.bi-bag-fill::before { content: "\f174"; }
.bi-bag-plus-fill::before { content: "\f175"; }
.bi-bag-plus::before { content: "\f176"; }
.bi-bag-x-fill::before { content: "\f177"; }
.bi-bag-x::before { content: "\f178"; }
.bi-bag::before { content: "\f179"; }
.bi-bar-chart-fill::before { content: "\f17a"; }
.bi-bar-chart-line-fill::before { content: "\f17b"; }
.bi-bar-chart-line::before { content: "\f17c"; }
.bi-bar-chart-steps::before { content: "\f17d"; }
.bi-bar-chart::before { content: "\f17e"; }
.bi-basket-fill::before { content: "\f17f"; }
.bi-basket::before { content: "\f180"; }
.bi-basket2-fill::before { content: "\f181"; }
.bi-basket2::before { content: "\f182"; }
.bi-basket3-fill::before { content: "\f183"; }
.bi-basket3::before { content: "\f184"; }
.bi-battery-charging::before { content: "\f185"; }
.bi-battery-full::before { content: "\f186"; }
.bi-battery-half::before { content: "\f187"; }
.bi-battery::before { content: "\f188"; }
.bi-bell-fill::before { content: "\f189"; }
.bi-bell::before { content: "\f18a"; }
.bi-bezier::before { content: "\f18b"; }
.bi-bezier2::before { content: "\f18c"; }
.bi-bicycle::before { content: "\f18d"; }
.bi-binoculars-fill::before { content: "\f18e"; }
.bi-binoculars::before { content: "\f18f"; }
.bi-blockquote-left::before { content: "\f190"; }
.bi-blockquote-right::before { content: "\f191"; }
.bi-book-fill::before { content: "\f192"; }
.bi-book-half::before { content: "\f193"; }
.bi-book::before { content: "\f194"; }
.bi-bookmark-check-fill::before { content: "\f195"; }
.bi-bookmark-check::before { content: "\f196"; }
.bi-bookmark-dash-fill::before { content: "\f197"; }
.bi-bookmark-dash::before { content: "\f198"; }
.bi-bookmark-fill::before { content: "\f199"; }
.bi-bookmark-heart-fill::before { content: "\f19a"; }
.bi-bookmark-heart::before { content: "\f19b"; }
.bi-bookmark-plus-fill::before { content: "\f19c"; }
.bi-bookmark-plus::before { content: "\f19d"; }
.bi-bookmark-star-fill::before { content: "\f19e"; }
.bi-bookmark-star::before { content: "\f19f"; }
.bi-bookmark-x-fill::before { content: "\f1a0"; }
.bi-bookmark-x::before { content: "\f1a1"; }
.bi-bookmark::before { content: "\f1a2"; }
.bi-bookmarks-fill::before { content: "\f1a3"; }
.bi-bookmarks::before { content: "\f1a4"; }
.bi-bookshelf::before { content: "\f1a5"; }
.bi-bootstrap-fill::before { content: "\f1a6"; }
.bi-bootstrap-reboot::before { content: "\f1a7"; }
.bi-bootstrap::before { content: "\f1a8"; }
.bi-border-all::before { content: "\f1a9"; }
.bi-border-bottom::before { content: "\f1aa"; }
.bi-border-center::before { content: "\f1ab"; }
.bi-border-inner::before { content: "\f1ac"; }
.bi-border-left::before { content: "\f1ad"; }
.bi-border-middle::before { content: "\f1ae"; }
.bi-border-outer::before { content: "\f1af"; }
.bi-border-right::before { content: "\f1b0"; }
.bi-border-style::before { content: "\f1b1"; }
.bi-border-top::before { content: "\f1b2"; }
.bi-border-width::before { content: "\f1b3"; }
.bi-border::before { content: "\f1b4"; }
.bi-bounding-box-circles::before { content: "\f1b5"; }
.bi-bounding-box::before { content: "\f1b6"; }
.bi-box-arrow-down-left::before { content: "\f1b7"; }
.bi-box-arrow-down-right::before { content: "\f1b8"; }
.bi-box-arrow-down::before { content: "\f1b9"; }
.bi-box-arrow-in-down-left::before { content: "\f1ba"; }
.bi-box-arrow-in-down-right::before { content: "\f1bb"; }
.bi-box-arrow-in-down::before { content: "\f1bc"; }
.bi-box-arrow-in-left::before { content: "\f1bd"; }
.bi-box-arrow-in-right::before { content: "\f1be"; }
.bi-box-arrow-in-up-left::before { content: "\f1bf"; }
.bi-box-arrow-in-up-right::before { content: "\f1c0"; }
.bi-box-arrow-in-up::before { content: "\f1c1"; }
.bi-box-arrow-left::before { content: "\f1c2"; }
.bi-box-arrow-right::before { content: "\f1c3"; }
.bi-box-arrow-up-left::before { content: "\f1c4"; }
.bi-box-arrow-up-right::before { content: "\f1c5"; }
.bi-box-arrow-up::before { content: "\f1c6"; }
.bi-box-seam::before { content: "\f1c7"; }
.bi-box::before { content: "\f1c8"; }
.bi-braces::before { content: "\f1c9"; }
.bi-bricks::before { content: "\f1ca"; }
.bi-briefcase-fill::before { content: "\f1cb"; }
.bi-briefcase::before { content: "\f1cc"; }
.bi-brightness-alt-high-fill::before { content: "\f1cd"; }
.bi-brightness-alt-high::before { content: "\f1ce"; }
.bi-brightness-alt-low-fill::before { content: "\f1cf"; }
.bi-brightness-alt-low::before { content: "\f1d0"; }
.bi-brightness-high-fill::before { content: "\f1d1"; }
.bi-brightness-high::before { content: "\f1d2"; }
.bi-brightness-low-fill::before { content: "\f1d3"; }
.bi-brightness-low::before { content: "\f1d4"; }
.bi-broadcast-pin::before { content: "\f1d5"; }
.bi-broadcast::before { content: "\f1d6"; }
.bi-brush-fill::before { content: "\f1d7"; }
.bi-brush::before { content: "\f1d8"; }
.bi-bucket-fill::before { content: "\f1d9"; }
.bi-bucket::before { content: "\f1da"; }
.bi-bug-fill::before { content: "\f1db"; }
.bi-bug::before { content: "\f1dc"; }
.bi-building::before { content: "\f1dd"; }
.bi-bullseye::before { content: "\f1de"; }
.bi-calculator-fill::before { content: "\f1df"; }
.bi-calculator::before { content: "\f1e0"; }
.bi-calendar-check-fill::before { content: "\f1e1"; }
.bi-calendar-check::before { content: "\f1e2"; }
.bi-calendar-date-fill::before { content: "\f1e3"; }
.bi-calendar-date::before { content: "\f1e4"; }
.bi-calendar-day-fill::before { content: "\f1e5"; }
.bi-calendar-day::before { content: "\f1e6"; }
.bi-calendar-event-fill::before { content: "\f1e7"; }
.bi-calendar-event::before { content: "\f1e8"; }
.bi-calendar-fill::before { content: "\f1e9"; }
.bi-calendar-minus-fill::before { content: "\f1ea"; }
.bi-calendar-minus::before { content: "\f1eb"; }
.bi-calendar-month-fill::before { content: "\f1ec"; }
.bi-calendar-month::before { content: "\f1ed"; }
.bi-calendar-plus-fill::before { content: "\f1ee"; }
.bi-calendar-plus::before { content: "\f1ef"; }
.bi-calendar-range-fill::before { content: "\f1f0"; }
.bi-calendar-range::before { content: "\f1f1"; }
.bi-calendar-week-fill::before { content: "\f1f2"; }
.bi-calendar-week::before { content: "\f1f3"; }
.bi-calendar-x-fill::before { content: "\f1f4"; }
.bi-calendar-x::before { content: "\f1f5"; }
.bi-calendar::before { content: "\f1f6"; }
.bi-calendar2-check-fill::before { content: "\f1f7"; }
.bi-calendar2-check::before { content: "\f1f8"; }
.bi-calendar2-date-fill::before { content: "\f1f9"; }
.bi-calendar2-date::before { content: "\f1fa"; }
.bi-calendar2-day-fill::before { content: "\f1fb"; }
.bi-calendar2-day::before { content: "\f1fc"; }
.bi-calendar2-event-fill::before { content: "\f1fd"; }
.bi-calendar2-event::before { content: "\f1fe"; }
.bi-calendar2-fill::before { content: "\f1ff"; }
.bi-calendar2-minus-fill::before { content: "\f200"; }
.bi-calendar2-minus::before { content: "\f201"; }
.bi-calendar2-month-fill::before { content: "\f202"; }
.bi-calendar2-month::before { content: "\f203"; }
.bi-calendar2-plus-fill::before { content: "\f204"; }
.bi-calendar2-plus::before { content: "\f205"; }
.bi-calendar2-range-fill::before { content: "\f206"; }
.bi-calendar2-range::before { content: "\f207"; }
.bi-calendar2-week-fill::before { content: "\f208"; }
.bi-calendar2-week::before { content: "\f209"; }
.bi-calendar2-x-fill::before { content: "\f20a"; }
.bi-calendar2-x::before { content: "\f20b"; }
.bi-calendar2::before { content: "\f20c"; }
.bi-calendar3-event-fill::before { content: "\f20d"; }
.bi-calendar3-event::before { content: "\f20e"; }
.bi-calendar3-fill::before { content: "\f20f"; }
.bi-calendar3-range-fill::before { content: "\f210"; }
.bi-calendar3-range::before { content: "\f211"; }
.bi-calendar3-week-fill::before { content: "\f212"; }
.bi-calendar3-week::before { content: "\f213"; }
.bi-calendar3::before { content: "\f214"; }
.bi-calendar4-event::before { content: "\f215"; }
.bi-calendar4-range::before { content: "\f216"; }
.bi-calendar4-week::before { content: "\f217"; }
.bi-calendar4::before { content: "\f218"; }
.bi-camera-fill::before { content: "\f219"; }
.bi-camera-reels-fill::before { content: "\f21a"; }
.bi-camera-reels::before { content: "\f21b"; }
.bi-camera-video-fill::before { content: "\f21c"; }
.bi-camera-video-off-fill::before { content: "\f21d"; }
.bi-camera-video-off::before { content: "\f21e"; }
.bi-camera-video::before { content: "\f21f"; }
.bi-camera::before { content: "\f220"; }
.bi-camera2::before { content: "\f221"; }
.bi-capslock-fill::before { content: "\f222"; }
.bi-capslock::before { content: "\f223"; }
.bi-card-checklist::before { content: "\f224"; }
.bi-card-heading::before { content: "\f225"; }
.bi-card-image::before { content: "\f226"; }
.bi-card-list::before { content: "\f227"; }
.bi-card-text::before { content: "\f228"; }
.bi-caret-down-fill::before { content: "\f229"; }
.bi-caret-down-square-fill::before { content: "\f22a"; }
.bi-caret-down-square::before { content: "\f22b"; }
.bi-caret-down::before { content: "\f22c"; }
.bi-caret-left-fill::before { content: "\f22d"; }
.bi-caret-left-square-fill::before { content: "\f22e"; }
.bi-caret-left-square::before { content: "\f22f"; }
.bi-caret-left::before { content: "\f230"; }
.bi-caret-right-fill::before { content: "\f231"; }
.bi-caret-right-square-fill::before { content: "\f232"; }
.bi-caret-right-square::before { content: "\f233"; }
.bi-caret-right::before { content: "\f234"; }
.bi-caret-up-fill::before { content: "\f235"; }
.bi-caret-up-square-fill::before { content: "\f236"; }
.bi-caret-up-square::before { content: "\f237"; }
.bi-caret-up::before { content: "\f238"; }
.bi-cart-check-fill::before { content: "\f239"; }
.bi-cart-check::before { content: "\f23a"; }
.bi-cart-dash-fill::before { content: "\f23b"; }
.bi-cart-dash::before { content: "\f23c"; }
.bi-cart-fill::before { content: "\f23d"; }
.bi-cart-plus-fill::before { content: "\f23e"; }
.bi-cart-plus::before { content: "\f23f"; }
.bi-cart-x-fill::before { content: "\f240"; }
.bi-cart-x::before { content: "\f241"; }
.bi-cart::before { content: "\f242"; }
.bi-cart2::before { content: "\f243"; }
.bi-cart3::before { content: "\f244"; }
.bi-cart4::before { content: "\f245"; }
.bi-cash-stack::before { content: "\f246"; }
.bi-cash::before { content: "\f247"; }
.bi-cast::before { content: "\f248"; }
.bi-chat-dots-fill::before { content: "\f249"; }
.bi-chat-dots::before { content: "\f24a"; }
.bi-chat-fill::before { content: "\f24b"; }
.bi-chat-left-dots-fill::before { content: "\f24c"; }
.bi-chat-left-dots::before { content: "\f24d"; }
.bi-chat-left-fill::before { content: "\f24e"; }
.bi-chat-left-quote-fill::before { content: "\f24f"; }
.bi-chat-left-quote::before { content: "\f250"; }
.bi-chat-left-text-fill::before { content: "\f251"; }
.bi-chat-left-text::before { content: "\f252"; }
.bi-chat-left::before { content: "\f253"; }
.bi-chat-quote-fill::before { content: "\f254"; }
.bi-chat-quote::before { content: "\f255"; }
.bi-chat-right-dots-fill::before { content: "\f256"; }
.bi-chat-right-dots::before { content: "\f257"; }
.bi-chat-right-fill::before { content: "\f258"; }
.bi-chat-right-quote-fill::before { content: "\f259"; }
.bi-chat-right-quote::before { content: "\f25a"; }
.bi-chat-right-text-fill::before { content: "\f25b"; }
.bi-chat-right-text::before { content: "\f25c"; }
.bi-chat-right::before { content: "\f25d"; }
.bi-chat-square-dots-fill::before { content: "\f25e"; }
.bi-chat-square-dots::before { content: "\f25f"; }
.bi-chat-square-fill::before { content: "\f260"; }
.bi-chat-square-quote-fill::before { content: "\f261"; }
.bi-chat-square-quote::before { content: "\f262"; }
.bi-chat-square-text-fill::before { content: "\f263"; }
.bi-chat-square-text::before { content: "\f264"; }
.bi-chat-square::before { content: "\f265"; }
.bi-chat-text-fill::before { content: "\f266"; }
.bi-chat-text::before { content: "\f267"; }
.bi-chat::before { content: "\f268"; }
.bi-check-all::before { content: "\f269"; }
.bi-check-circle-fill::before { content: "\f26a"; }
.bi-check-circle::before { content: "\f26b"; }
.bi-check-square-fill::before { content: "\f26c"; }
.bi-check-square::before { content: "\f26d"; }
.bi-check::before { content: "\f26e"; }
.bi-check2-all::before { content: "\f26f"; }
.bi-check2-circle::before { content: "\f270"; }
.bi-check2-square::before { content: "\f271"; }
.bi-check2::before { content: "\f272"; }
.bi-chevron-bar-contract::before { content: "\f273"; }
.bi-chevron-bar-down::before { content: "\f274"; }
.bi-chevron-bar-expand::before { content: "\f275"; }
.bi-chevron-bar-left::before { content: "\f276"; }
.bi-chevron-bar-right::before { content: "\f277"; }
.bi-chevron-bar-up::before { content: "\f278"; }
.bi-chevron-compact-down::before { content: "\f279"; }
.bi-chevron-compact-left::before { content: "\f27a"; }
.bi-chevron-compact-right::before { content: "\f27b"; }
.bi-chevron-compact-up::before { content: "\f27c"; }
.bi-chevron-contract::before { content: "\f27d"; }
.bi-chevron-double-down::before { content: "\f27e"; }
.bi-chevron-double-left::before { content: "\f27f"; }
.bi-chevron-double-right::before { content: "\f280"; }
.bi-chevron-double-up::before { content: "\f281"; }
.bi-chevron-down::before { content: "\f282"; }
.bi-chevron-expand::before { content: "\f283"; }
.bi-chevron-left::before { content: "\f284"; }
.bi-chevron-right::before { content: "\f285"; }
.bi-chevron-up::before { content: "\f286"; }
.bi-circle-fill::before { content: "\f287"; }
.bi-circle-half::before { content: "\f288"; }
.bi-circle-square::before { content: "\f289"; }
.bi-circle::before { content: "\f28a"; }
.bi-clipboard-check::before { content: "\f28b"; }
.bi-clipboard-data::before { content: "\f28c"; }
.bi-clipboard-minus::before { content: "\f28d"; }
.bi-clipboard-plus::before { content: "\f28e"; }
.bi-clipboard-x::before { content: "\f28f"; }
.bi-clipboard::before { content: "\f290"; }
.bi-clock-fill::before { content: "\f291"; }
.bi-clock-history::before { content: "\f292"; }
.bi-clock::before { content: "\f293"; }
.bi-cloud-arrow-down-fill::before { content: "\f294"; }
.bi-cloud-arrow-down::before { content: "\f295"; }
.bi-cloud-arrow-up-fill::before { content: "\f296"; }
.bi-cloud-arrow-up::before { content: "\f297"; }
.bi-cloud-check-fill::before { content: "\f298"; }
.bi-cloud-check::before { content: "\f299"; }
.bi-cloud-download-fill::before { content: "\f29a"; }
.bi-cloud-download::before { content: "\f29b"; }
.bi-cloud-drizzle-fill::before { content: "\f29c"; }
.bi-cloud-drizzle::before { content: "\f29d"; }
.bi-cloud-fill::before { content: "\f29e"; }
.bi-cloud-fog-fill::before { content: "\f29f"; }
.bi-cloud-fog::before { content: "\f2a0"; }
.bi-cloud-fog2-fill::before { content: "\f2a1"; }
.bi-cloud-fog2::before { content: "\f2a2"; }
.bi-cloud-hail-fill::before { content: "\f2a3"; }
.bi-cloud-hail::before { content: "\f2a4"; }
.bi-cloud-haze-fill::before { content: "\f2a6"; }
.bi-cloud-haze::before { content: "\f2a7"; }
.bi-cloud-haze2-fill::before { content: "\f2a8"; }
.bi-cloud-lightning-fill::before { content: "\f2a9"; }
.bi-cloud-lightning-rain-fill::before { content: "\f2aa"; }
.bi-cloud-lightning-rain::before { content: "\f2ab"; }
.bi-cloud-lightning::before { content: "\f2ac"; }
.bi-cloud-minus-fill::before { content: "\f2ad"; }
.bi-cloud-minus::before { content: "\f2ae"; }
.bi-cloud-moon-fill::before { content: "\f2af"; }
.bi-cloud-moon::before { content: "\f2b0"; }
.bi-cloud-plus-fill::before { content: "\f2b1"; }
.bi-cloud-plus::before { content: "\f2b2"; }
.bi-cloud-rain-fill::before { content: "\f2b3"; }
.bi-cloud-rain-heavy-fill::before { content: "\f2b4"; }
.bi-cloud-rain-heavy::before { content: "\f2b5"; }
.bi-cloud-rain::before { content: "\f2b6"; }
.bi-cloud-slash-fill::before { content: "\f2b7"; }
.bi-cloud-slash::before { content: "\f2b8"; }
.bi-cloud-sleet-fill::before { content: "\f2b9"; }
.bi-cloud-sleet::before { content: "\f2ba"; }
.bi-cloud-snow-fill::before { content: "\f2bb"; }
.bi-cloud-snow::before { content: "\f2bc"; }
.bi-cloud-sun-fill::before { content: "\f2bd"; }
.bi-cloud-sun::before { content: "\f2be"; }
.bi-cloud-upload-fill::before { content: "\f2bf"; }
.bi-cloud-upload::before { content: "\f2c0"; }
.bi-cloud::before { content: "\f2c1"; }
.bi-clouds-fill::before { content: "\f2c2"; }
.bi-clouds::before { content: "\f2c3"; }
.bi-cloudy-fill::before { content: "\f2c4"; }
.bi-cloudy::before { content: "\f2c5"; }
.bi-code-slash::before { content: "\f2c6"; }
.bi-code-square::before { content: "\f2c7"; }
.bi-code::before { content: "\f2c8"; }
.bi-collection-fill::before { content: "\f2c9"; }
.bi-collection-play-fill::before { content: "\f2ca"; }
.bi-collection-play::before { content: "\f2cb"; }
.bi-collection::before { content: "\f2cc"; }
.bi-columns-gap::before { content: "\f2cd"; }
.bi-columns::before { content: "\f2ce"; }
.bi-command::before { content: "\f2cf"; }
.bi-compass-fill::before { content: "\f2d0"; }
.bi-compass::before { content: "\f2d1"; }
.bi-cone-striped::before { content: "\f2d2"; }
.bi-cone::before { content: "\f2d3"; }
.bi-controller::before { content: "\f2d4"; }
.bi-cpu-fill::before { content: "\f2d5"; }
.bi-cpu::before { content: "\f2d6"; }
.bi-credit-card-2-back-fill::before { content: "\f2d7"; }
.bi-credit-card-2-back::before { content: "\f2d8"; }
.bi-credit-card-2-front-fill::before { content: "\f2d9"; }
.bi-credit-card-2-front::before { content: "\f2da"; }
.bi-credit-card-fill::before { content: "\f2db"; }
.bi-credit-card::before { content: "\f2dc"; }
.bi-crop::before { content: "\f2dd"; }
.bi-cup-fill::before { content: "\f2de"; }
.bi-cup-straw::before { content: "\f2df"; }
.bi-cup::before { content: "\f2e0"; }
.bi-cursor-fill::before { content: "\f2e1"; }
.bi-cursor-text::before { content: "\f2e2"; }
.bi-cursor::before { content: "\f2e3"; }
.bi-dash-circle-dotted::before { content: "\f2e4"; }
.bi-dash-circle-fill::before { content: "\f2e5"; }
.bi-dash-circle::before { content: "\f2e6"; }
.bi-dash-square-dotted::before { content: "\f2e7"; }
.bi-dash-square-fill::before { content: "\f2e8"; }
.bi-dash-square::before { content: "\f2e9"; }
.bi-dash::before { content: "\f2ea"; }
.bi-diagram-2-fill::before { content: "\f2eb"; }
.bi-diagram-2::before { content: "\f2ec"; }
.bi-diagram-3-fill::before { content: "\f2ed"; }
.bi-diagram-3::before { content: "\f2ee"; }
.bi-diamond-fill::before { content: "\f2ef"; }
.bi-diamond-half::before { content: "\f2f0"; }
.bi-diamond::before { content: "\f2f1"; }
.bi-dice-1-fill::before { content: "\f2f2"; }
.bi-dice-1::before { content: "\f2f3"; }
.bi-dice-2-fill::before { content: "\f2f4"; }
.bi-dice-2::before { content: "\f2f5"; }
.bi-dice-3-fill::before { content: "\f2f6"; }
.bi-dice-3::before { content: "\f2f7"; }
.bi-dice-4-fill::before { content: "\f2f8"; }
.bi-dice-4::before { content: "\f2f9"; }
.bi-dice-5-fill::before { content: "\f2fa"; }
.bi-dice-5::before { content: "\f2fb"; }
.bi-dice-6-fill::before { content: "\f2fc"; }
.bi-dice-6::before { content: "\f2fd"; }
.bi-disc-fill::before { content: "\f2fe"; }
.bi-disc::before { content: "\f2ff"; }
.bi-discord::before { content: "\f300"; }
.bi-display-fill::before { content: "\f301"; }
.bi-display::before { content: "\f302"; }
.bi-distribute-horizontal::before { content: "\f303"; }
.bi-distribute-vertical::before { content: "\f304"; }
.bi-door-closed-fill::before { content: "\f305"; }
.bi-door-closed::before { content: "\f306"; }
.bi-door-open-fill::before { content: "\f307"; }
.bi-door-open::before { content: "\f308"; }
.bi-dot::before { content: "\f309"; }
.bi-download::before { content: "\f30a"; }
.bi-droplet-fill::before { content: "\f30b"; }
.bi-droplet-half::before { content: "\f30c"; }
.bi-droplet::before { content: "\f30d"; }
.bi-earbuds::before { content: "\f30e"; }
.bi-easel-fill::before { content: "\f30f"; }
.bi-easel::before { content: "\f310"; }
.bi-egg-fill::before { content: "\f311"; }
.bi-egg-fried::before { content: "\f312"; }
.bi-egg::before { content: "\f313"; }
.bi-eject-fill::before { content: "\f314"; }
.bi-eject::before { content: "\f315"; }
.bi-emoji-angry-fill::before { content: "\f316"; }
.bi-emoji-angry::before { content: "\f317"; }
.bi-emoji-dizzy-fill::before { content: "\f318"; }
.bi-emoji-dizzy::before { content: "\f319"; }
.bi-emoji-expressionless-fill::before { content: "\f31a"; }
.bi-emoji-expressionless::before { content: "\f31b"; }
.bi-emoji-frown-fill::before { content: "\f31c"; }
.bi-emoji-frown::before { content: "\f31d"; }
.bi-emoji-heart-eyes-fill::before { content: "\f31e"; }
.bi-emoji-heart-eyes::before { content: "\f31f"; }
.bi-emoji-laughing-fill::before { content: "\f320"; }
.bi-emoji-laughing::before { content: "\f321"; }
.bi-emoji-neutral-fill::before { content: "\f322"; }
.bi-emoji-neutral::before { content: "\f323"; }
.bi-emoji-smile-fill::before { content: "\f324"; }
.bi-emoji-smile-upside-down-fill::before { content: "\f325"; }
.bi-emoji-smile-upside-down::before { content: "\f326"; }
.bi-emoji-smile::before { content: "\f327"; }
.bi-emoji-sunglasses-fill::before { content: "\f328"; }
.bi-emoji-sunglasses::before { content: "\f329"; }
.bi-emoji-wink-fill::before { content: "\f32a"; }
.bi-emoji-wink::before { content: "\f32b"; }
.bi-envelope-fill::before { content: "\f32c"; }
.bi-envelope-open-fill::before { content: "\f32d"; }
.bi-envelope-open::before { content: "\f32e"; }
.bi-envelope::before { content: "\f32f"; }
.bi-eraser-fill::before { content: "\f330"; }
.bi-eraser::before { content: "\f331"; }
.bi-exclamation-circle-fill::before { content: "\f332"; }
.bi-exclamation-circle::before { content: "\f333"; }
.bi-exclamation-diamond-fill::before { content: "\f334"; }
.bi-exclamation-diamond::before { content: "\f335"; }
.bi-exclamation-octagon-fill::before { content: "\f336"; }
.bi-exclamation-octagon::before { content: "\f337"; }
.bi-exclamation-square-fill::before { content: "\f338"; }
.bi-exclamation-square::before { content: "\f339"; }
.bi-exclamation-triangle-fill::before { content: "\f33a"; }
.bi-exclamation-triangle::before { content: "\f33b"; }
.bi-exclamation::before { content: "\f33c"; }
.bi-exclude::before { content: "\f33d"; }
.bi-eye-fill::before { content: "\f33e"; }
.bi-eye-slash-fill::before { content: "\f33f"; }
.bi-eye-slash::before { content: "\f340"; }
.bi-eye::before { content: "\f341"; }
.bi-eyedropper::before { content: "\f342"; }
.bi-eyeglasses::before { content: "\f343"; }
.bi-facebook::before { content: "\f344"; }
.bi-file-arrow-down-fill::before { content: "\f345"; }
.bi-file-arrow-down::before { content: "\f346"; }
.bi-file-arrow-up-fill::before { content: "\f347"; }
.bi-file-arrow-up::before { content: "\f348"; }
.bi-file-bar-graph-fill::before { content: "\f349"; }
.bi-file-bar-graph::before { content: "\f34a"; }
.bi-file-binary-fill::before { content: "\f34b"; }
.bi-file-binary::before { content: "\f34c"; }
.bi-file-break-fill::before { content: "\f34d"; }
.bi-file-break::before { content: "\f34e"; }
.bi-file-check-fill::before { content: "\f34f"; }
.bi-file-check::before { content: "\f350"; }
.bi-file-code-fill::before { content: "\f351"; }
.bi-file-code::before { content: "\f352"; }
.bi-file-diff-fill::before { content: "\f353"; }
.bi-file-diff::before { content: "\f354"; }
.bi-file-earmark-arrow-down-fill::before { content: "\f355"; }
.bi-file-earmark-arrow-down::before { content: "\f356"; }
.bi-file-earmark-arrow-up-fill::before { content: "\f357"; }
.bi-file-earmark-arrow-up::before { content: "\f358"; }
.bi-file-earmark-bar-graph-fill::before { content: "\f359"; }
.bi-file-earmark-bar-graph::before { content: "\f35a"; }
.bi-file-earmark-binary-fill::before { content: "\f35b"; }
.bi-file-earmark-binary::before { content: "\f35c"; }
.bi-file-earmark-break-fill::before { content: "\f35d"; }
.bi-file-earmark-break::before { content: "\f35e"; }
.bi-file-earmark-check-fill::before { content: "\f35f"; }
.bi-file-earmark-check::before { content: "\f360"; }
.bi-file-earmark-code-fill::before { content: "\f361"; }
.bi-file-earmark-code::before { content: "\f362"; }
.bi-file-earmark-diff-fill::before { content: "\f363"; }
.bi-file-earmark-diff::before { content: "\f364"; }
.bi-file-earmark-easel-fill::before { content: "\f365"; }
.bi-file-earmark-easel::before { content: "\f366"; }
.bi-file-earmark-excel-fill::before { content: "\f367"; }
.bi-file-earmark-excel::before { content: "\f368"; }
.bi-file-earmark-fill::before { content: "\f369"; }
.bi-file-earmark-font-fill::before { content: "\f36a"; }
.bi-file-earmark-font::before { content: "\f36b"; }
.bi-file-earmark-image-fill::before { content: "\f36c"; }
.bi-file-earmark-image::before { content: "\f36d"; }
.bi-file-earmark-lock-fill::before { content: "\f36e"; }
.bi-file-earmark-lock::before { content: "\f36f"; }
.bi-file-earmark-lock2-fill::before { content: "\f370"; }
.bi-file-earmark-lock2::before { content: "\f371"; }
.bi-file-earmark-medical-fill::before { content: "\f372"; }
.bi-file-earmark-medical::before { content: "\f373"; }
.bi-file-earmark-minus-fill::before { content: "\f374"; }
.bi-file-earmark-minus::before { content: "\f375"; }
.bi-file-earmark-music-fill::before { content: "\f376"; }
.bi-file-earmark-music::before { content: "\f377"; }
.bi-file-earmark-person-fill::before { content: "\f378"; }
.bi-file-earmark-person::before { content: "\f379"; }
.bi-file-earmark-play-fill::before { content: "\f37a"; }
.bi-file-earmark-play::before { content: "\f37b"; }
.bi-file-earmark-plus-fill::before { content: "\f37c"; }
.bi-file-earmark-plus::before { content: "\f37d"; }
.bi-file-earmark-post-fill::before { content: "\f37e"; }
.bi-file-earmark-post::before { content: "\f37f"; }
.bi-file-earmark-ppt-fill::before { content: "\f380"; }
.bi-file-earmark-ppt::before { content: "\f381"; }
.bi-file-earmark-richtext-fill::before { content: "\f382"; }
.bi-file-earmark-richtext::before { content: "\f383"; }
.bi-file-earmark-ruled-fill::before { content: "\f384"; }
.bi-file-earmark-ruled::before { content: "\f385"; }
.bi-file-earmark-slides-fill::before { content: "\f386"; }
.bi-file-earmark-slides::before { content: "\f387"; }
.bi-file-earmark-spreadsheet-fill::before { content: "\f388"; }
.bi-file-earmark-spreadsheet::before { content: "\f389"; }
.bi-file-earmark-text-fill::before { content: "\f38a"; }
.bi-file-earmark-text::before { content: "\f38b"; }
.bi-file-earmark-word-fill::before { content: "\f38c"; }
.bi-file-earmark-word::before { content: "\f38d"; }
.bi-file-earmark-x-fill::before { content: "\f38e"; }
.bi-file-earmark-x::before { content: "\f38f"; }
.bi-file-earmark-zip-fill::before { content: "\f390"; }
.bi-file-earmark-zip::before { content: "\f391"; }
.bi-file-earmark::before { content: "\f392"; }
.bi-file-easel-fill::before { content: "\f393"; }
.bi-file-easel::before { content: "\f394"; }
.bi-file-excel-fill::before { content: "\f395"; }
.bi-file-excel::before { content: "\f396"; }
.bi-file-fill::before { content: "\f397"; }
.bi-file-font-fill::before { content: "\f398"; }
.bi-file-font::before { content: "\f399"; }
.bi-file-image-fill::before { content: "\f39a"; }
.bi-file-image::before { content: "\f39b"; }
.bi-file-lock-fill::before { content: "\f39c"; }
.bi-file-lock::before { content: "\f39d"; }
.bi-file-lock2-fill::before { content: "\f39e"; }
.bi-file-lock2::before { content: "\f39f"; }
.bi-file-medical-fill::before { content: "\f3a0"; }
.bi-file-medical::before { content: "\f3a1"; }
.bi-file-minus-fill::before { content: "\f3a2"; }
.bi-file-minus::before { content: "\f3a3"; }
.bi-file-music-fill::before { content: "\f3a4"; }
.bi-file-music::before { content: "\f3a5"; }
.bi-file-person-fill::before { content: "\f3a6"; }
.bi-file-person::before { content: "\f3a7"; }
.bi-file-play-fill::before { content: "\f3a8"; }
.bi-file-play::before { content: "\f3a9"; }
.bi-file-plus-fill::before { content: "\f3aa"; }
.bi-file-plus::before { content: "\f3ab"; }
.bi-file-post-fill::before { content: "\f3ac"; }
.bi-file-post::before { content: "\f3ad"; }
.bi-file-ppt-fill::before { content: "\f3ae"; }
.bi-file-ppt::before { content: "\f3af"; }
.bi-file-richtext-fill::before { content: "\f3b0"; }
.bi-file-richtext::before { content: "\f3b1"; }
.bi-file-ruled-fill::before { content: "\f3b2"; }
.bi-file-ruled::before { content: "\f3b3"; }
.bi-file-slides-fill::before { content: "\f3b4"; }
.bi-file-slides::before { content: "\f3b5"; }
.bi-file-spreadsheet-fill::before { content: "\f3b6"; }
.bi-file-spreadsheet::before { content: "\f3b7"; }
.bi-file-text-fill::before { content: "\f3b8"; }
.bi-file-text::before { content: "\f3b9"; }
.bi-file-word-fill::before { content: "\f3ba"; }
.bi-file-word::before { content: "\f3bb"; }
.bi-file-x-fill::before { content: "\f3bc"; }
.bi-file-x::before { content: "\f3bd"; }
.bi-file-zip-fill::before { content: "\f3be"; }
.bi-file-zip::before { content: "\f3bf"; }
.bi-file::before { content: "\f3c0"; }
.bi-files-alt::before { content: "\f3c1"; }
.bi-files::before { content: "\f3c2"; }
.bi-film::before { content: "\f3c3"; }
.bi-filter-circle-fill::before { content: "\f3c4"; }
.bi-filter-circle::before { content: "\f3c5"; }
.bi-filter-left::before { content: "\f3c6"; }
.bi-filter-right::before { content: "\f3c7"; }
.bi-filter-square-fill::before { content: "\f3c8"; }
.bi-filter-square::before { content: "\f3c9"; }
.bi-filter::before { content: "\f3ca"; }
.bi-flag-fill::before { content: "\f3cb"; }
.bi-flag::before { content: "\f3cc"; }
.bi-flower1::before { content: "\f3cd"; }
.bi-flower2::before { content: "\f3ce"; }
.bi-flower3::before { content: "\f3cf"; }
.bi-folder-check::before { content: "\f3d0"; }
.bi-folder-fill::before { content: "\f3d1"; }
.bi-folder-minus::before { content: "\f3d2"; }
.bi-folder-plus::before { content: "\f3d3"; }
.bi-folder-symlink-fill::before { content: "\f3d4"; }
.bi-folder-symlink::before { content: "\f3d5"; }
.bi-folder-x::before { content: "\f3d6"; }
.bi-folder::before { content: "\f3d7"; }
.bi-folder2-open::before { content: "\f3d8"; }
.bi-folder2::before { content: "\f3d9"; }
.bi-fonts::before { content: "\f3da"; }
.bi-forward-fill::before { content: "\f3db"; }
.bi-forward::before { content: "\f3dc"; }
.bi-front::before { content: "\f3dd"; }
.bi-fullscreen-exit::before { content: "\f3de"; }
.bi-fullscreen::before { content: "\f3df"; }
.bi-funnel-fill::before { content: "\f3e0"; }
.bi-funnel::before { content: "\f3e1"; }
.bi-gear-fill::before { content: "\f3e2"; }
.bi-gear-wide-connected::before { content: "\f3e3"; }
.bi-gear-wide::before { content: "\f3e4"; }
.bi-gear::before { content: "\f3e5"; }
.bi-gem::before { content: "\f3e6"; }
.bi-geo-alt-fill::before { content: "\f3e7"; }
.bi-geo-alt::before { content: "\f3e8"; }
.bi-geo-fill::before { content: "\f3e9"; }
.bi-geo::before { content: "\f3ea"; }
.bi-gift-fill::before { content: "\f3eb"; }
.bi-gift::before { content: "\f3ec"; }
.bi-github::before { content: "\f3ed"; }
.bi-globe::before { content: "\f3ee"; }
.bi-globe2::before { content: "\f3ef"; }
.bi-google::before { content: "\f3f0"; }
.bi-graph-down::before { content: "\f3f1"; }
.bi-graph-up::before { content: "\f3f2"; }
.bi-grid-1x2-fill::before { content: "\f3f3"; }
.bi-grid-1x2::before { content: "\f3f4"; }
.bi-grid-3x2-gap-fill::before { content: "\f3f5"; }
.bi-grid-3x2-gap::before { content: "\f3f6"; }
.bi-grid-3x2::before { content: "\f3f7"; }
.bi-grid-3x3-gap-fill::before { content: "\f3f8"; }
.bi-grid-3x3-gap::before { content: "\f3f9"; }
.bi-grid-3x3::before { content: "\f3fa"; }
.bi-grid-fill::before { content: "\f3fb"; }
.bi-grid::before { content: "\f3fc"; }
.bi-grip-horizontal::before { content: "\f3fd"; }
.bi-grip-vertical::before { content: "\f3fe"; }
.bi-hammer::before { content: "\f3ff"; }
.bi-hand-index-fill::before { content: "\f400"; }
.bi-hand-index-thumb-fill::before { content: "\f401"; }
.bi-hand-index-thumb::before { content: "\f402"; }
.bi-hand-index::before { content: "\f403"; }
.bi-hand-thumbs-down-fill::before { content: "\f404"; }
.bi-hand-thumbs-down::before { content: "\f405"; }
.bi-hand-thumbs-up-fill::before { content: "\f406"; }
.bi-hand-thumbs-up::before { content: "\f407"; }
.bi-handbag-fill::before { content: "\f408"; }
.bi-handbag::before { content: "\f409"; }
.bi-hash::before { content: "\f40a"; }
.bi-hdd-fill::before { content: "\f40b"; }
.bi-hdd-network-fill::before { content: "\f40c"; }
.bi-hdd-network::before { content: "\f40d"; }
.bi-hdd-rack-fill::before { content: "\f40e"; }
.bi-hdd-rack::before { content: "\f40f"; }
.bi-hdd-stack-fill::before { content: "\f410"; }
.bi-hdd-stack::before { content: "\f411"; }
.bi-hdd::before { content: "\f412"; }
.bi-headphones::before { content: "\f413"; }
.bi-headset::before { content: "\f414"; }
.bi-heart-fill::before { content: "\f415"; }
.bi-heart-half::before { content: "\f416"; }
.bi-heart::before { content: "\f417"; }
.bi-heptagon-fill::before { content: "\f418"; }
.bi-heptagon-half::before { content: "\f419"; }
.bi-heptagon::before { content: "\f41a"; }
.bi-hexagon-fill::before { content: "\f41b"; }
.bi-hexagon-half::before { content: "\f41c"; }
.bi-hexagon::before { content: "\f41d"; }
.bi-hourglass-bottom::before { content: "\f41e"; }
.bi-hourglass-split::before { content: "\f41f"; }
.bi-hourglass-top::before { content: "\f420"; }
.bi-hourglass::before { content: "\f421"; }
.bi-house-door-fill::before { content: "\f422"; }
.bi-house-door::before { content: "\f423"; }
.bi-house-fill::before { content: "\f424"; }
.bi-house::before { content: "\f425"; }
.bi-hr::before { content: "\f426"; }
.bi-hurricane::before { content: "\f427"; }
.bi-image-alt::before { content: "\f428"; }
.bi-image-fill::before { content: "\f429"; }
.bi-image::before { content: "\f42a"; }
.bi-images::before { content: "\f42b"; }
.bi-inbox-fill::before { content: "\f42c"; }
.bi-inbox::before { content: "\f42d"; }
.bi-inboxes-fill::before { content: "\f42e"; }
.bi-inboxes::before { content: "\f42f"; }
.bi-info-circle-fill::before { content: "\f430"; }
.bi-info-circle::before { content: "\f431"; }
.bi-info-square-fill::before { content: "\f432"; }
.bi-info-square::before { content: "\f433"; }
.bi-info::before { content: "\f434"; }
.bi-input-cursor-text::before { content: "\f435"; }
.bi-input-cursor::before { content: "\f436"; }
.bi-instagram::before { content: "\f437"; }
.bi-intersect::before { content: "\f438"; }
.bi-journal-album::before { content: "\f439"; }
.bi-journal-arrow-down::before { content: "\f43a"; }
.bi-journal-arrow-up::before { content: "\f43b"; }
.bi-journal-bookmark-fill::before { content: "\f43c"; }
.bi-journal-bookmark::before { content: "\f43d"; }
.bi-journal-check::before { content: "\f43e"; }
.bi-journal-code::before { content: "\f43f"; }
.bi-journal-medical::before { content: "\f440"; }
.bi-journal-minus::before { content: "\f441"; }
.bi-journal-plus::before { content: "\f442"; }
.bi-journal-richtext::before { content: "\f443"; }
.bi-journal-text::before { content: "\f444"; }
.bi-journal-x::before { content: "\f445"; }
.bi-journal::before { content: "\f446"; }
.bi-journals::before { content: "\f447"; }
.bi-joystick::before { content: "\f448"; }
.bi-justify-left::before { content: "\f449"; }
.bi-justify-right::before { content: "\f44a"; }
.bi-justify::before { content: "\f44b"; }
.bi-kanban-fill::before { content: "\f44c"; }
.bi-kanban::before { content: "\f44d"; }
.bi-key-fill::before { content: "\f44e"; }
.bi-key::before { content: "\f44f"; }
.bi-keyboard-fill::before { content: "\f450"; }
.bi-keyboard::before { content: "\f451"; }
.bi-ladder::before { content: "\f452"; }
.bi-lamp-fill::before { content: "\f453"; }
.bi-lamp::before { content: "\f454"; }
.bi-laptop-fill::before { content: "\f455"; }
.bi-laptop::before { content: "\f456"; }
.bi-layer-backward::before { content: "\f457"; }
.bi-layer-forward::before { content: "\f458"; }
.bi-layers-fill::before { content: "\f459"; }
.bi-layers-half::before { content: "\f45a"; }
.bi-layers::before { content: "\f45b"; }
.bi-layout-sidebar-inset-reverse::before { content: "\f45c"; }
.bi-layout-sidebar-inset::before { content: "\f45d"; }
.bi-layout-sidebar-reverse::before { content: "\f45e"; }
.bi-layout-sidebar::before { content: "\f45f"; }
.bi-layout-split::before { content: "\f460"; }
.bi-layout-text-sidebar-reverse::before { content: "\f461"; }
.bi-layout-text-sidebar::before { content: "\f462"; }
.bi-layout-text-window-reverse::before { content: "\f463"; }
.bi-layout-text-window::before { content: "\f464"; }
.bi-layout-three-columns::before { content: "\f465"; }
.bi-layout-wtf::before { content: "\f466"; }
.bi-life-preserver::before { content: "\f467"; }
.bi-lightbulb-fill::before { content: "\f468"; }
.bi-lightbulb-off-fill::before { content: "\f469"; }
.bi-lightbulb-off::before { content: "\f46a"; }
.bi-lightbulb::before { content: "\f46b"; }
.bi-lightning-charge-fill::before { content: "\f46c"; }
.bi-lightning-charge::before { content: "\f46d"; }
.bi-lightning-fill::before { content: "\f46e"; }
.bi-lightning::before { content: "\f46f"; }
.bi-link-45deg::before { content: "\f470"; }
.bi-link::before { content: "\f471"; }
.bi-linkedin::before { content: "\f472"; }
.bi-list-check::before { content: "\f473"; }
.bi-list-nested::before { content: "\f474"; }
.bi-list-ol::before { content: "\f475"; }
.bi-list-stars::before { content: "\f476"; }
.bi-list-task::before { content: "\f477"; }
.bi-list-ul::before { content: "\f478"; }
.bi-list::before { content: "\f479"; }
.bi-lock-fill::before { content: "\f47a"; }
.bi-lock::before { content: "\f47b"; }
.bi-mailbox::before { content: "\f47c"; }
.bi-mailbox2::before { content: "\f47d"; }
.bi-map-fill::before { content: "\f47e"; }
.bi-map::before { content: "\f47f"; }
.bi-markdown-fill::before { content: "\f480"; }
.bi-markdown::before { content: "\f481"; }
.bi-mask::before { content: "\f482"; }
.bi-megaphone-fill::before { content: "\f483"; }
.bi-megaphone::before { content: "\f484"; }
.bi-menu-app-fill::before { content: "\f485"; }
.bi-menu-app::before { content: "\f486"; }
.bi-menu-button-fill::before { content: "\f487"; }
.bi-menu-button-wide-fill::before { content: "\f488"; }
.bi-menu-button-wide::before { content: "\f489"; }
.bi-menu-button::before { content: "\f48a"; }
.bi-menu-down::before { content: "\f48b"; }
.bi-menu-up::before { content: "\f48c"; }
.bi-mic-fill::before { content: "\f48d"; }
.bi-mic-mute-fill::before { content: "\f48e"; }
.bi-mic-mute::before { content: "\f48f"; }
.bi-mic::before { content: "\f490"; }
.bi-minecart-loaded::before { content: "\f491"; }
.bi-minecart::before { content: "\f492"; }
.bi-moisture::before { content: "\f493"; }
.bi-moon-fill::before { content: "\f494"; }
.bi-moon-stars-fill::before { content: "\f495"; }
.bi-moon-stars::before { content: "\f496"; }
.bi-moon::before { content: "\f497"; }
.bi-mouse-fill::before { content: "\f498"; }
.bi-mouse::before { content: "\f499"; }
.bi-mouse2-fill::before { content: "\f49a"; }
.bi-mouse2::before { content: "\f49b"; }
.bi-mouse3-fill::before { content: "\f49c"; }
.bi-mouse3::before { content: "\f49d"; }
.bi-music-note-beamed::before { content: "\f49e"; }
.bi-music-note-list::before { content: "\f49f"; }
.bi-music-note::before { content: "\f4a0"; }
.bi-music-player-fill::before { content: "\f4a1"; }
.bi-music-player::before { content: "\f4a2"; }
.bi-newspaper::before { content: "\f4a3"; }
.bi-node-minus-fill::before { content: "\f4a4"; }
.bi-node-minus::before { content: "\f4a5"; }
.bi-node-plus-fill::before { content: "\f4a6"; }
.bi-node-plus::before { content: "\f4a7"; }
.bi-nut-fill::before { content: "\f4a8"; }
.bi-nut::before { content: "\f4a9"; }
.bi-octagon-fill::before { content: "\f4aa"; }
.bi-octagon-half::before { content: "\f4ab"; }
.bi-octagon::before { content: "\f4ac"; }
.bi-option::before { content: "\f4ad"; }
.bi-outlet::before { content: "\f4ae"; }
.bi-paint-bucket::before { content: "\f4af"; }
.bi-palette-fill::before { content: "\f4b0"; }
.bi-palette::before { content: "\f4b1"; }
.bi-palette2::before { content: "\f4b2"; }
.bi-paperclip::before { content: "\f4b3"; }
.bi-paragraph::before { content: "\f4b4"; }
.bi-patch-check-fill::before { content: "\f4b5"; }
.bi-patch-check::before { content: "\f4b6"; }
.bi-patch-exclamation-fill::before { content: "\f4b7"; }
.bi-patch-exclamation::before { content: "\f4b8"; }
.bi-patch-minus-fill::before { content: "\f4b9"; }
.bi-patch-minus::before { content: "\f4ba"; }
.bi-patch-plus-fill::before { content: "\f4bb"; }
.bi-patch-plus::before { content: "\f4bc"; }
.bi-patch-question-fill::before { content: "\f4bd"; }
.bi-patch-question::before { content: "\f4be"; }
.bi-pause-btn-fill::before { content: "\f4bf"; }
.bi-pause-btn::before { content: "\f4c0"; }
.bi-pause-circle-fill::before { content: "\f4c1"; }
.bi-pause-circle::before { content: "\f4c2"; }
.bi-pause-fill::before { content: "\f4c3"; }
.bi-pause::before { content: "\f4c4"; }
.bi-peace-fill::before { content: "\f4c5"; }
.bi-peace::before { content: "\f4c6"; }
.bi-pen-fill::before { content: "\f4c7"; }
.bi-pen::before { content: "\f4c8"; }
.bi-pencil-fill::before { content: "\f4c9"; }
.bi-pencil-square::before { content: "\f4ca"; }
.bi-pencil::before { content: "\f4cb"; }
.bi-pentagon-fill::before { content: "\f4cc"; }
.bi-pentagon-half::before { content: "\f4cd"; }
.bi-pentagon::before { content: "\f4ce"; }
.bi-people-fill::before { content: "\f4cf"; }
.bi-people::before { content: "\f4d0"; }
.bi-percent::before { content: "\f4d1"; }
.bi-person-badge-fill::before { content: "\f4d2"; }
.bi-person-badge::before { content: "\f4d3"; }
.bi-person-bounding-box::before { content: "\f4d4"; }
.bi-person-check-fill::before { content: "\f4d5"; }
.bi-person-check::before { content: "\f4d6"; }
.bi-person-circle::before { content: "\f4d7"; }
.bi-person-dash-fill::before { content: "\f4d8"; }
.bi-person-dash::before { content: "\f4d9"; }
.bi-person-fill::before { content: "\f4da"; }
.bi-person-lines-fill::before { content: "\f4db"; }
.bi-person-plus-fill::before { content: "\f4dc"; }
.bi-person-plus::before { content: "\f4dd"; }
.bi-person-square::before { content: "\f4de"; }
.bi-person-x-fill::before { content: "\f4df"; }
.bi-person-x::before { content: "\f4e0"; }
.bi-person::before { content: "\f4e1"; }
.bi-phone-fill::before { content: "\f4e2"; }
.bi-phone-landscape-fill::before { content: "\f4e3"; }
.bi-phone-landscape::before { content: "\f4e4"; }
.bi-phone-vibrate-fill::before { content: "\f4e5"; }
.bi-phone-vibrate::before { content: "\f4e6"; }
.bi-phone::before { content: "\f4e7"; }
.bi-pie-chart-fill::before { content: "\f4e8"; }
.bi-pie-chart::before { content: "\f4e9"; }
.bi-pin-angle-fill::before { content: "\f4ea"; }
.bi-pin-angle::before { content: "\f4eb"; }
.bi-pin-fill::before { content: "\f4ec"; }
.bi-pin::before { content: "\f4ed"; }
.bi-pip-fill::before { content: "\f4ee"; }
.bi-pip::before { content: "\f4ef"; }
.bi-play-btn-fill::before { content: "\f4f0"; }
.bi-play-btn::before { content: "\f4f1"; }
.bi-play-circle-fill::before { content: "\f4f2"; }
.bi-play-circle::before { content: "\f4f3"; }
.bi-play-fill::before { content: "\f4f4"; }
.bi-play::before { content: "\f4f5"; }
.bi-plug-fill::before { content: "\f4f6"; }
.bi-plug::before { content: "\f4f7"; }
.bi-plus-circle-dotted::before { content: "\f4f8"; }
.bi-plus-circle-fill::before { content: "\f4f9"; }
.bi-plus-circle::before { content: "\f4fa"; }
.bi-plus-square-dotted::before { content: "\f4fb"; }
.bi-plus-square-fill::before { content: "\f4fc"; }
.bi-plus-square::before { content: "\f4fd"; }
.bi-plus::before { content: "\f4fe"; }
.bi-power::before { content: "\f4ff"; }
.bi-printer-fill::before { content: "\f500"; }
.bi-printer::before { content: "\f501"; }
.bi-puzzle-fill::before { content: "\f502"; }
.bi-puzzle::before { content: "\f503"; }
.bi-question-circle-fill::before { content: "\f504"; }
.bi-question-circle::before { content: "\f505"; }
.bi-question-diamond-fill::before { content: "\f506"; }
.bi-question-diamond::before { content: "\f507"; }
.bi-question-octagon-fill::before { content: "\f508"; }
.bi-question-octagon::before { content: "\f509"; }
.bi-question-square-fill::before { content: "\f50a"; }
.bi-question-square::before { content: "\f50b"; }
.bi-question::before { content: "\f50c"; }
.bi-rainbow::before { content: "\f50d"; }
.bi-receipt-cutoff::before { content: "\f50e"; }
.bi-receipt::before { content: "\f50f"; }
.bi-reception-0::before { content: "\f510"; }
.bi-reception-1::before { content: "\f511"; }
.bi-reception-2::before { content: "\f512"; }
.bi-reception-3::before { content: "\f513"; }
.bi-reception-4::before { content: "\f514"; }
.bi-record-btn-fill::before { content: "\f515"; }
.bi-record-btn::before { content: "\f516"; }
.bi-record-circle-fill::before { content: "\f517"; }
.bi-record-circle::before { content: "\f518"; }
.bi-record-fill::before { content: "\f519"; }
.bi-record::before { content: "\f51a"; }
.bi-record2-fill::before { content: "\f51b"; }
.bi-record2::before { content: "\f51c"; }
.bi-reply-all-fill::before { content: "\f51d"; }
.bi-reply-all::before { content: "\f51e"; }
.bi-reply-fill::before { content: "\f51f"; }
.bi-reply::before { content: "\f520"; }
.bi-rss-fill::before { content: "\f521"; }
.bi-rss::before { content: "\f522"; }
.bi-rulers::before { content: "\f523"; }
.bi-save-fill::before { content: "\f524"; }
.bi-save::before { content: "\f525"; }
.bi-save2-fill::before { content: "\f526"; }
.bi-save2::before { content: "\f527"; }
.bi-scissors::before { content: "\f528"; }
.bi-screwdriver::before { content: "\f529"; }
.bi-search::before { content: "\f52a"; }
.bi-segmented-nav::before { content: "\f52b"; }
.bi-server::before { content: "\f52c"; }
.bi-share-fill::before { content: "\f52d"; }
.bi-share::before { content: "\f52e"; }
.bi-shield-check::before { content: "\f52f"; }
.bi-shield-exclamation::before { content: "\f530"; }
.bi-shield-fill-check::before { content: "\f531"; }
.bi-shield-fill-exclamation::before { content: "\f532"; }
.bi-shield-fill-minus::before { content: "\f533"; }
.bi-shield-fill-plus::before { content: "\f534"; }
.bi-shield-fill-x::before { content: "\f535"; }
.bi-shield-fill::before { content: "\f536"; }
.bi-shield-lock-fill::before { content: "\f537"; }
.bi-shield-lock::before { content: "\f538"; }
.bi-shield-minus::before { content: "\f539"; }
.bi-shield-plus::before { content: "\f53a"; }
.bi-shield-shaded::before { content: "\f53b"; }
.bi-shield-slash-fill::before { content: "\f53c"; }
.bi-shield-slash::before { content: "\f53d"; }
.bi-shield-x::before { content: "\f53e"; }
.bi-shield::before { content: "\f53f"; }
.bi-shift-fill::before { content: "\f540"; }
.bi-shift::before { content: "\f541"; }
.bi-shop-window::before { content: "\f542"; }
.bi-shop::before { content: "\f543"; }
.bi-shuffle::before { content: "\f544"; }
.bi-signpost-2-fill::before { content: "\f545"; }
.bi-signpost-2::before { content: "\f546"; }
.bi-signpost-fill::before { content: "\f547"; }
.bi-signpost-split-fill::before { content: "\f548"; }
.bi-signpost-split::before { content: "\f549"; }
.bi-signpost::before { content: "\f54a"; }
.bi-sim-fill::before { content: "\f54b"; }
.bi-sim::before { content: "\f54c"; }
.bi-skip-backward-btn-fill::before { content: "\f54d"; }
.bi-skip-backward-btn::before { content: "\f54e"; }
.bi-skip-backward-circle-fill::before { content: "\f54f"; }
.bi-skip-backward-circle::before { content: "\f550"; }
.bi-skip-backward-fill::before { content: "\f551"; }
.bi-skip-backward::before { content: "\f552"; }
.bi-skip-end-btn-fill::before { content: "\f553"; }
.bi-skip-end-btn::before { content: "\f554"; }
.bi-skip-end-circle-fill::before { content: "\f555"; }
.bi-skip-end-circle::before { content: "\f556"; }
.bi-skip-end-fill::before { content: "\f557"; }
.bi-skip-end::before { content: "\f558"; }
.bi-skip-forward-btn-fill::before { content: "\f559"; }
.bi-skip-forward-btn::before { content: "\f55a"; }
.bi-skip-forward-circle-fill::before { content: "\f55b"; }
.bi-skip-forward-circle::before { content: "\f55c"; }
.bi-skip-forward-fill::before { content: "\f55d"; }
.bi-skip-forward::before { content: "\f55e"; }
.bi-skip-start-btn-fill::before { content: "\f55f"; }
.bi-skip-start-btn::before { content: "\f560"; }
.bi-skip-start-circle-fill::before { content: "\f561"; }
.bi-skip-start-circle::before { content: "\f562"; }
.bi-skip-start-fill::before { content: "\f563"; }
.bi-skip-start::before { content: "\f564"; }
.bi-slack::before { content: "\f565"; }
.bi-slash-circle-fill::before { content: "\f566"; }
.bi-slash-circle::before { content: "\f567"; }
.bi-slash-square-fill::before { content: "\f568"; }
.bi-slash-square::before { content: "\f569"; }
.bi-slash::before { content: "\f56a"; }
.bi-sliders::before { content: "\f56b"; }
.bi-smartwatch::before { content: "\f56c"; }
.bi-snow::before { content: "\f56d"; }
.bi-snow2::before { content: "\f56e"; }
.bi-snow3::before { content: "\f56f"; }
.bi-sort-alpha-down-alt::before { content: "\f570"; }
.bi-sort-alpha-down::before { content: "\f571"; }
.bi-sort-alpha-up-alt::before { content: "\f572"; }
.bi-sort-alpha-up::before { content: "\f573"; }
.bi-sort-down-alt::before { content: "\f574"; }
.bi-sort-down::before { content: "\f575"; }
.bi-sort-numeric-down-alt::before { content: "\f576"; }
.bi-sort-numeric-down::before { content: "\f577"; }
.bi-sort-numeric-up-alt::before { content: "\f578"; }
.bi-sort-numeric-up::before { content: "\f579"; }
.bi-sort-up-alt::before { content: "\f57a"; }
.bi-sort-up::before { content: "\f57b"; }
.bi-soundwave::before { content: "\f57c"; }
.bi-speaker-fill::before { content: "\f57d"; }
.bi-speaker::before { content: "\f57e"; }
.bi-speedometer::before { content: "\f57f"; }
.bi-speedometer2::before { content: "\f580"; }
.bi-spellcheck::before { content: "\f581"; }
.bi-square-fill::before { content: "\f582"; }
.bi-square-half::before { content: "\f583"; }
.bi-square::before { content: "\f584"; }
.bi-stack::before { content: "\f585"; }
.bi-star-fill::before { content: "\f586"; }
.bi-star-half::before { content: "\f587"; }
.bi-star::before { content: "\f588"; }
.bi-stars::before { content: "\f589"; }
.bi-stickies-fill::before { content: "\f58a"; }
.bi-stickies::before { content: "\f58b"; }
.bi-sticky-fill::before { content: "\f58c"; }
.bi-sticky::before { content: "\f58d"; }
.bi-stop-btn-fill::before { content: "\f58e"; }
.bi-stop-btn::before { content: "\f58f"; }
.bi-stop-circle-fill::before { content: "\f590"; }
.bi-stop-circle::before { content: "\f591"; }
.bi-stop-fill::before { content: "\f592"; }
.bi-stop::before { content: "\f593"; }
.bi-stoplights-fill::before { content: "\f594"; }
.bi-stoplights::before { content: "\f595"; }
.bi-stopwatch-fill::before { content: "\f596"; }
.bi-stopwatch::before { content: "\f597"; }
.bi-subtract::before { content: "\f598"; }
.bi-suit-club-fill::before { content: "\f599"; }
.bi-suit-club::before { content: "\f59a"; }
.bi-suit-diamond-fill::before { content: "\f59b"; }
.bi-suit-diamond::before { content: "\f59c"; }
.bi-suit-heart-fill::before { content: "\f59d"; }
.bi-suit-heart::before { content: "\f59e"; }
.bi-suit-spade-fill::before { content: "\f59f"; }
.bi-suit-spade::before { content: "\f5a0"; }
.bi-sun-fill::before { content: "\f5a1"; }
.bi-sun::before { content: "\f5a2"; }
.bi-sunglasses::before { content: "\f5a3"; }
.bi-sunrise-fill::before { content: "\f5a4"; }
.bi-sunrise::before { content: "\f5a5"; }
.bi-sunset-fill::before { content: "\f5a6"; }
.bi-sunset::before { content: "\f5a7"; }
.bi-symmetry-horizontal::before { content: "\f5a8"; }
.bi-symmetry-vertical::before { content: "\f5a9"; }
.bi-table::before { content: "\f5aa"; }
.bi-tablet-fill::before { content: "\f5ab"; }
.bi-tablet-landscape-fill::before { content: "\f5ac"; }
.bi-tablet-landscape::before { content: "\f5ad"; }
.bi-tablet::before { content: "\f5ae"; }
.bi-tag-fill::before { content: "\f5af"; }
.bi-tag::before { content: "\f5b0"; }
.bi-tags-fill::before { content: "\f5b1"; }
.bi-tags::before { content: "\f5b2"; }
.bi-telegram::before { content: "\f5b3"; }
.bi-telephone-fill::before { content: "\f5b4"; }
.bi-telephone-forward-fill::before { content: "\f5b5"; }
.bi-telephone-forward::before { content: "\f5b6"; }
.bi-telephone-inbound-fill::before { content: "\f5b7"; }
.bi-telephone-inbound::before { content: "\f5b8"; }
.bi-telephone-minus-fill::before { content: "\f5b9"; }
.bi-telephone-minus::before { content: "\f5ba"; }
.bi-telephone-outbound-fill::before { content: "\f5bb"; }
.bi-telephone-outbound::before { content: "\f5bc"; }
.bi-telephone-plus-fill::before { content: "\f5bd"; }
.bi-telephone-plus::before { content: "\f5be"; }
.bi-telephone-x-fill::before { content: "\f5bf"; }
.bi-telephone-x::before { content: "\f5c0"; }
.bi-telephone::before { content: "\f5c1"; }
.bi-terminal-fill::before { content: "\f5c2"; }
.bi-terminal::before { content: "\f5c3"; }
.bi-text-center::before { content: "\f5c4"; }
.bi-text-indent-left::before { content: "\f5c5"; }
.bi-text-indent-right::before { content: "\f5c6"; }
.bi-text-left::before { content: "\f5c7"; }
.bi-text-paragraph::before { content: "\f5c8"; }
.bi-text-right::before { content: "\f5c9"; }
.bi-textarea-resize::before { content: "\f5ca"; }
.bi-textarea-t::before { content: "\f5cb"; }
.bi-textarea::before { content: "\f5cc"; }
.bi-thermometer-half::before { content: "\f5cd"; }
.bi-thermometer-high::before { content: "\f5ce"; }
.bi-thermometer-low::before { content: "\f5cf"; }
.bi-thermometer-snow::before { content: "\f5d0"; }
.bi-thermometer-sun::before { content: "\f5d1"; }
.bi-thermometer::before { content: "\f5d2"; }
.bi-three-dots-vertical::before { content: "\f5d3"; }
.bi-three-dots::before { content: "\f5d4"; }
.bi-toggle-off::before { content: "\f5d5"; }
.bi-toggle-on::before { content: "\f5d6"; }
.bi-toggle2-off::before { content: "\f5d7"; }
.bi-toggle2-on::before { content: "\f5d8"; }
.bi-toggles::before { content: "\f5d9"; }
.bi-toggles2::before { content: "\f5da"; }
.bi-tools::before { content: "\f5db"; }
.bi-tornado::before { content: "\f5dc"; }
.bi-trash-fill::before { content: "\f5dd"; }
.bi-trash::before { content: "\f5de"; }
.bi-trash2-fill::before { content: "\f5df"; }
.bi-trash2::before { content: "\f5e0"; }
.bi-tree-fill::before { content: "\f5e1"; }
.bi-tree::before { content: "\f5e2"; }
.bi-triangle-fill::before { content: "\f5e3"; }
.bi-triangle-half::before { content: "\f5e4"; }
.bi-triangle::before { content: "\f5e5"; }
.bi-trophy-fill::before { content: "\f5e6"; }
.bi-trophy::before { content: "\f5e7"; }
.bi-tropical-storm::before { content: "\f5e8"; }
.bi-truck-flatbed::before { content: "\f5e9"; }
.bi-truck::before { content: "\f5ea"; }
.bi-tsunami::before { content: "\f5eb"; }
.bi-tv-fill::before { content: "\f5ec"; }
.bi-tv::before { content: "\f5ed"; }
.bi-twitch::before { content: "\f5ee"; }
.bi-twitter::before { content: "\f5ef"; }
.bi-type-bold::before { content: "\f5f0"; }
.bi-type-h1::before { content: "\f5f1"; }
.bi-type-h2::before { content: "\f5f2"; }
.bi-type-h3::before { content: "\f5f3"; }
.bi-type-italic::before { content: "\f5f4"; }
.bi-type-strikethrough::before { content: "\f5f5"; }
.bi-type-underline::before { content: "\f5f6"; }
.bi-type::before { content: "\f5f7"; }
.bi-ui-checks-grid::before { content: "\f5f8"; }
.bi-ui-checks::before { content: "\f5f9"; }
.bi-ui-radios-grid::before { content: "\f5fa"; }
.bi-ui-radios::before { content: "\f5fb"; }
.bi-umbrella-fill::before { content: "\f5fc"; }
.bi-umbrella::before { content: "\f5fd"; }
.bi-union::before { content: "\f5fe"; }
.bi-unlock-fill::before { content: "\f5ff"; }
.bi-unlock::before { content: "\f600"; }
.bi-upc-scan::before { content: "\f601"; }
.bi-upc::before { content: "\f602"; }
.bi-upload::before { content: "\f603"; }
.bi-vector-pen::before { content: "\f604"; }
.bi-view-list::before { content: "\f605"; }
.bi-view-stacked::before { content: "\f606"; }
.bi-vinyl-fill::before { content: "\f607"; }
.bi-vinyl::before { content: "\f608"; }
.bi-voicemail::before { content: "\f609"; }
.bi-volume-down-fill::before { content: "\f60a"; }
.bi-volume-down::before { content: "\f60b"; }
.bi-volume-mute-fill::before { content: "\f60c"; }
.bi-volume-mute::before { content: "\f60d"; }
.bi-volume-off-fill::before { content: "\f60e"; }
.bi-volume-off::before { content: "\f60f"; }
.bi-volume-up-fill::before { content: "\f610"; }
.bi-volume-up::before { content: "\f611"; }
.bi-vr::before { content: "\f612"; }
.bi-wallet-fill::before { content: "\f613"; }
.bi-wallet::before { content: "\f614"; }
.bi-wallet2::before { content: "\f615"; }
.bi-watch::before { content: "\f616"; }
.bi-water::before { content: "\f617"; }
.bi-whatsapp::before { content: "\f618"; }
.bi-wifi-1::before { content: "\f619"; }
.bi-wifi-2::before { content: "\f61a"; }
.bi-wifi-off::before { content: "\f61b"; }
.bi-wifi::before { content: "\f61c"; }
.bi-wind::before { content: "\f61d"; }
.bi-window-dock::before { content: "\f61e"; }
.bi-window-sidebar::before { content: "\f61f"; }
.bi-window::before { content: "\f620"; }
.bi-wrench::before { content: "\f621"; }
.bi-x-circle-fill::before { content: "\f622"; }
.bi-x-circle::before { content: "\f623"; }
.bi-x-diamond-fill::before { content: "\f624"; }
.bi-x-diamond::before { content: "\f625"; }
.bi-x-octagon-fill::before { content: "\f626"; }
.bi-x-octagon::before { content: "\f627"; }
.bi-x-square-fill::before { content: "\f628"; }
.bi-x-square::before { content: "\f629"; }
.bi-x::before { content: "\f62a"; }
.bi-youtube::before { content: "\f62b"; }
.bi-zoom-in::before { content: "\f62c"; }
.bi-zoom-out::before { content: "\f62d"; }
.bi-bank::before { content: "\f62e"; }
.bi-bank2::before { content: "\f62f"; }
.bi-bell-slash-fill::before { content: "\f630"; }
.bi-bell-slash::before { content: "\f631"; }
.bi-cash-coin::before { content: "\f632"; }
.bi-check-lg::before { content: "\f633"; }
.bi-coin::before { content: "\f634"; }
.bi-currency-bitcoin::before { content: "\f635"; }
.bi-currency-dollar::before { content: "\f636"; }
.bi-currency-euro::before { content: "\f637"; }
.bi-currency-exchange::before { content: "\f638"; }
.bi-currency-pound::before { content: "\f639"; }
.bi-currency-yen::before { content: "\f63a"; }
.bi-dash-lg::before { content: "\f63b"; }
.bi-exclamation-lg::before { content: "\f63c"; }
.bi-file-earmark-pdf-fill::before { content: "\f63d"; }
.bi-file-earmark-pdf::before { content: "\f63e"; }
.bi-file-pdf-fill::before { content: "\f63f"; }
.bi-file-pdf::before { content: "\f640"; }
.bi-gender-ambiguous::before { content: "\f641"; }
.bi-gender-female::before { content: "\f642"; }
.bi-gender-male::before { content: "\f643"; }
.bi-gender-trans::before { content: "\f644"; }
.bi-headset-vr::before { content: "\f645"; }
.bi-info-lg::before { content: "\f646"; }
.bi-mastodon::before { content: "\f647"; }
.bi-messenger::before { content: "\f648"; }
.bi-piggy-bank-fill::before { content: "\f649"; }
.bi-piggy-bank::before { content: "\f64a"; }
.bi-pin-map-fill::before { content: "\f64b"; }
.bi-pin-map::before { content: "\f64c"; }
.bi-plus-lg::before { content: "\f64d"; }
.bi-question-lg::before { content: "\f64e"; }
.bi-recycle::before { content: "\f64f"; }
.bi-reddit::before { content: "\f650"; }
.bi-safe-fill::before { content: "\f651"; }
.bi-safe2-fill::before { content: "\f652"; }
.bi-safe2::before { content: "\f653"; }
.bi-sd-card-fill::before { content: "\f654"; }
.bi-sd-card::before { content: "\f655"; }
.bi-skype::before { content: "\f656"; }
.bi-slash-lg::before { content: "\f657"; }
.bi-translate::before { content: "\f658"; }
.bi-x-lg::before { content: "\f659"; }
.bi-safe::before { content: "\f65a"; }
.bi-apple::before { content: "\f65b"; }
.bi-microsoft::before { content: "\f65d"; }
.bi-windows::before { content: "\f65e"; }
.bi-behance::before { content: "\f65c"; }
.bi-dribbble::before { content: "\f65f"; }
.bi-line::before { content: "\f660"; }
.bi-medium::before { content: "\f661"; }
.bi-paypal::before { content: "\f662"; }
.bi-pinterest::before { content: "\f663"; }
.bi-signal::before { content: "\f664"; }
.bi-snapchat::before { content: "\f665"; }
.bi-spotify::before { content: "\f666"; }
.bi-stack-overflow::before { content: "\f667"; }
.bi-strava::before { content: "\f668"; }
.bi-wordpress::before { content: "\f669"; }
.bi-vimeo::before { content: "\f66a"; }
.bi-activity::before { content: "\f66b"; }
.bi-easel2-fill::before { content: "\f66c"; }
.bi-easel2::before { content: "\f66d"; }
.bi-easel3-fill::before { content: "\f66e"; }
.bi-easel3::before { content: "\f66f"; }
.bi-fan::before { content: "\f670"; }
.bi-fingerprint::before { content: "\f671"; }
.bi-graph-down-arrow::before { content: "\f672"; }
.bi-graph-up-arrow::before { content: "\f673"; }
.bi-hypnotize::before { content: "\f674"; }
.bi-magic::before { content: "\f675"; }
.bi-person-rolodex::before { content: "\f676"; }
.bi-person-video::before { content: "\f677"; }
.bi-person-video2::before { content: "\f678"; }
.bi-person-video3::before { content: "\f679"; }
.bi-person-workspace::before { content: "\f67a"; }
.bi-radioactive::before { content: "\f67b"; }
.bi-webcam-fill::before { content: "\f67c"; }
.bi-webcam::before { content: "\f67d"; }
.bi-yin-yang::before { content: "\f67e"; }
.bi-bandaid-fill::before { content: "\f680"; }
.bi-bandaid::before { content: "\f681"; }
.bi-bluetooth::before { content: "\f682"; }
.bi-body-text::before { content: "\f683"; }
.bi-boombox::before { content: "\f684"; }
.bi-boxes::before { content: "\f685"; }
.bi-dpad-fill::before { content: "\f686"; }
.bi-dpad::before { content: "\f687"; }
.bi-ear-fill::before { content: "\f688"; }
.bi-ear::before { content: "\f689"; }
.bi-envelope-check-fill::before { content: "\f68b"; }
.bi-envelope-check::before { content: "\f68c"; }
.bi-envelope-dash-fill::before { content: "\f68e"; }
.bi-envelope-dash::before { content: "\f68f"; }
.bi-envelope-exclamation-fill::before { content: "\f691"; }
.bi-envelope-exclamation::before { content: "\f692"; }
.bi-envelope-plus-fill::before { content: "\f693"; }
.bi-envelope-plus::before { content: "\f694"; }
.bi-envelope-slash-fill::before { content: "\f696"; }
.bi-envelope-slash::before { content: "\f697"; }
.bi-envelope-x-fill::before { content: "\f699"; }
.bi-envelope-x::before { content: "\f69a"; }
.bi-explicit-fill::before { content: "\f69b"; }
.bi-explicit::before { content: "\f69c"; }
.bi-git::before { content: "\f69d"; }
.bi-infinity::before { content: "\f69e"; }
.bi-list-columns-reverse::before { content: "\f69f"; }
.bi-list-columns::before { content: "\f6a0"; }
.bi-meta::before { content: "\f6a1"; }
.bi-nintendo-switch::before { content: "\f6a4"; }
.bi-pc-display-horizontal::before { content: "\f6a5"; }
.bi-pc-display::before { content: "\f6a6"; }
.bi-pc-horizontal::before { content: "\f6a7"; }
.bi-pc::before { content: "\f6a8"; }
.bi-playstation::before { content: "\f6a9"; }
.bi-plus-slash-minus::before { content: "\f6aa"; }
.bi-projector-fill::before { content: "\f6ab"; }
.bi-projector::before { content: "\f6ac"; }
.bi-qr-code-scan::before { content: "\f6ad"; }
.bi-qr-code::before { content: "\f6ae"; }
.bi-quora::before { content: "\f6af"; }
.bi-quote::before { content: "\f6b0"; }
.bi-robot::before { content: "\f6b1"; }
.bi-send-check-fill::before { content: "\f6b2"; }
.bi-send-check::before { content: "\f6b3"; }
.bi-send-dash-fill::before { content: "\f6b4"; }
.bi-send-dash::before { content: "\f6b5"; }
.bi-send-exclamation-fill::before { content: "\f6b7"; }
.bi-send-exclamation::before { content: "\f6b8"; }
.bi-send-fill::before { content: "\f6b9"; }
.bi-send-plus-fill::before { content: "\f6ba"; }
.bi-send-plus::before { content: "\f6bb"; }
.bi-send-slash-fill::before { content: "\f6bc"; }
.bi-send-slash::before { content: "\f6bd"; }
.bi-send-x-fill::before { content: "\f6be"; }
.bi-send-x::before { content: "\f6bf"; }
.bi-send::before { content: "\f6c0"; }
.bi-steam::before { content: "\f6c1"; }
.bi-terminal-dash::before { content: "\f6c3"; }
.bi-terminal-plus::before { content: "\f6c4"; }
.bi-terminal-split::before { content: "\f6c5"; }
.bi-ticket-detailed-fill::before { content: "\f6c6"; }
.bi-ticket-detailed::before { content: "\f6c7"; }
.bi-ticket-fill::before { content: "\f6c8"; }
.bi-ticket-perforated-fill::before { content: "\f6c9"; }
.bi-ticket-perforated::before { content: "\f6ca"; }
.bi-ticket::before { content: "\f6cb"; }
.bi-tiktok::before { content: "\f6cc"; }
.bi-window-dash::before { content: "\f6cd"; }
.bi-window-desktop::before { content: "\f6ce"; }
.bi-window-fullscreen::before { content: "\f6cf"; }
.bi-window-plus::before { content: "\f6d0"; }
.bi-window-split::before { content: "\f6d1"; }
.bi-window-stack::before { content: "\f6d2"; }
.bi-window-x::before { content: "\f6d3"; }
.bi-xbox::before { content: "\f6d4"; }
.bi-ethernet::before { content: "\f6d5"; }
.bi-hdmi-fill::before { content: "\f6d6"; }
.bi-hdmi::before { content: "\f6d7"; }
.bi-usb-c-fill::before { content: "\f6d8"; }
.bi-usb-c::before { content: "\f6d9"; }
.bi-usb-fill::before { content: "\f6da"; }
.bi-usb-plug-fill::before { content: "\f6db"; }
.bi-usb-plug::before { content: "\f6dc"; }
.bi-usb-symbol::before { content: "\f6dd"; }
.bi-usb::before { content: "\f6de"; }
.bi-boombox-fill::before { content: "\f6df"; }
.bi-displayport::before { content: "\f6e1"; }
.bi-gpu-card::before { content: "\f6e2"; }
.bi-memory::before { content: "\f6e3"; }
.bi-modem-fill::before { content: "\f6e4"; }
.bi-modem::before { content: "\f6e5"; }
.bi-motherboard-fill::before { content: "\f6e6"; }
.bi-motherboard::before { content: "\f6e7"; }
.bi-optical-audio-fill::before { content: "\f6e8"; }
.bi-optical-audio::before { content: "\f6e9"; }
.bi-pci-card::before { content: "\f6ea"; }
.bi-router-fill::before { content: "\f6eb"; }
.bi-router::before { content: "\f6ec"; }
.bi-thunderbolt-fill::before { content: "\f6ef"; }
.bi-thunderbolt::before { content: "\f6f0"; }
.bi-usb-drive-fill::before { content: "\f6f1"; }
.bi-usb-drive::before { content: "\f6f2"; }
.bi-usb-micro-fill::before { content: "\f6f3"; }
.bi-usb-micro::before { content: "\f6f4"; }
.bi-usb-mini-fill::before { content: "\f6f5"; }
.bi-usb-mini::before { content: "\f6f6"; }
.bi-cloud-haze2::before { content: "\f6f7"; }
.bi-device-hdd-fill::before { content: "\f6f8"; }
.bi-device-hdd::before { content: "\f6f9"; }
.bi-device-ssd-fill::before { content: "\f6fa"; }
.bi-device-ssd::before { content: "\f6fb"; }
.bi-displayport-fill::before { content: "\f6fc"; }
.bi-mortarboard-fill::before { content: "\f6fd"; }
.bi-mortarboard::before { content: "\f6fe"; }
.bi-terminal-x::before { content: "\f6ff"; }
.bi-arrow-through-heart-fill::before { content: "\f700"; }
.bi-arrow-through-heart::before { content: "\f701"; }
.bi-badge-sd-fill::before { content: "\f702"; }
.bi-badge-sd::before { content: "\f703"; }
.bi-bag-heart-fill::before { content: "\f704"; }
.bi-bag-heart::before { content: "\f705"; }
.bi-balloon-fill::before { content: "\f706"; }
.bi-balloon-heart-fill::before { content: "\f707"; }
.bi-balloon-heart::before { content: "\f708"; }
.bi-balloon::before { content: "\f709"; }
.bi-box2-fill::before { content: "\f70a"; }
.bi-box2-heart-fill::before { content: "\f70b"; }
.bi-box2-heart::before { content: "\f70c"; }
.bi-box2::before { content: "\f70d"; }
.bi-braces-asterisk::before { content: "\f70e"; }
.bi-calendar-heart-fill::before { content: "\f70f"; }
.bi-calendar-heart::before { content: "\f710"; }
.bi-calendar2-heart-fill::before { content: "\f711"; }
.bi-calendar2-heart::before { content: "\f712"; }
.bi-chat-heart-fill::before { content: "\f713"; }
.bi-chat-heart::before { content: "\f714"; }
.bi-chat-left-heart-fill::before { content: "\f715"; }
.bi-chat-left-heart::before { content: "\f716"; }
.bi-chat-right-heart-fill::before { content: "\f717"; }
.bi-chat-right-heart::before { content: "\f718"; }
.bi-chat-square-heart-fill::before { content: "\f719"; }
.bi-chat-square-heart::before { content: "\f71a"; }
.bi-clipboard-check-fill::before { content: "\f71b"; }
.bi-clipboard-data-fill::before { content: "\f71c"; }
.bi-clipboard-fill::before { content: "\f71d"; }
.bi-clipboard-heart-fill::before { content: "\f71e"; }
.bi-clipboard-heart::before { content: "\f71f"; }
.bi-clipboard-minus-fill::before { content: "\f720"; }
.bi-clipboard-plus-fill::before { content: "\f721"; }
.bi-clipboard-pulse::before { content: "\f722"; }
.bi-clipboard-x-fill::before { content: "\f723"; }
.bi-clipboard2-check-fill::before { content: "\f724"; }
.bi-clipboard2-check::before { content: "\f725"; }
.bi-clipboard2-data-fill::before { content: "\f726"; }
.bi-clipboard2-data::before { content: "\f727"; }
.bi-clipboard2-fill::before { content: "\f728"; }
.bi-clipboard2-heart-fill::before { content: "\f729"; }
.bi-clipboard2-heart::before { content: "\f72a"; }
.bi-clipboard2-minus-fill::before { content: "\f72b"; }
.bi-clipboard2-minus::before { content: "\f72c"; }
.bi-clipboard2-plus-fill::before { content: "\f72d"; }
.bi-clipboard2-plus::before { content: "\f72e"; }
.bi-clipboard2-pulse-fill::before { content: "\f72f"; }
.bi-clipboard2-pulse::before { content: "\f730"; }
.bi-clipboard2-x-fill::before { content: "\f731"; }
.bi-clipboard2-x::before { content: "\f732"; }
.bi-clipboard2::before { content: "\f733"; }
.bi-emoji-kiss-fill::before { content: "\f734"; }
.bi-emoji-kiss::before { content: "\f735"; }
.bi-envelope-heart-fill::before { content: "\f736"; }
.bi-envelope-heart::before { content: "\f737"; }
.bi-envelope-open-heart-fill::before { content: "\f738"; }
.bi-envelope-open-heart::before { content: "\f739"; }
.bi-envelope-paper-fill::before { content: "\f73a"; }
.bi-envelope-paper-heart-fill::before { content: "\f73b"; }
.bi-envelope-paper-heart::before { content: "\f73c"; }
.bi-envelope-paper::before { content: "\f73d"; }
.bi-filetype-aac::before { content: "\f73e"; }
.bi-filetype-ai::before { content: "\f73f"; }
.bi-filetype-bmp::before { content: "\f740"; }
.bi-filetype-cs::before { content: "\f741"; }
.bi-filetype-css::before { content: "\f742"; }
.bi-filetype-csv::before { content: "\f743"; }
.bi-filetype-doc::before { content: "\f744"; }
.bi-filetype-docx::before { content: "\f745"; }
.bi-filetype-exe::before { content: "\f746"; }
.bi-filetype-gif::before { content: "\f747"; }
.bi-filetype-heic::before { content: "\f748"; }
.bi-filetype-html::before { content: "\f749"; }
.bi-filetype-java::before { content: "\f74a"; }
.bi-filetype-jpg::before { content: "\f74b"; }
.bi-filetype-js::before { content: "\f74c"; }
.bi-filetype-jsx::before { content: "\f74d"; }
.bi-filetype-key::before { content: "\f74e"; }
.bi-filetype-m4p::before { content: "\f74f"; }
.bi-filetype-md::before { content: "\f750"; }
.bi-filetype-mdx::before { content: "\f751"; }
.bi-filetype-mov::before { content: "\f752"; }
.bi-filetype-mp3::before { content: "\f753"; }
.bi-filetype-mp4::before { content: "\f754"; }
.bi-filetype-otf::before { content: "\f755"; }
.bi-filetype-pdf::before { content: "\f756"; }
.bi-filetype-php::before { content: "\f757"; }
.bi-filetype-png::before { content: "\f758"; }
.bi-filetype-ppt::before { content: "\f75a"; }
.bi-filetype-psd::before { content: "\f75b"; }
.bi-filetype-py::before { content: "\f75c"; }
.bi-filetype-raw::before { content: "\f75d"; }
.bi-filetype-rb::before { content: "\f75e"; }
.bi-filetype-sass::before { content: "\f75f"; }
.bi-filetype-scss::before { content: "\f760"; }
.bi-filetype-sh::before { content: "\f761"; }
.bi-filetype-svg::before { content: "\f762"; }
.bi-filetype-tiff::before { content: "\f763"; }
.bi-filetype-tsx::before { content: "\f764"; }
.bi-filetype-ttf::before { content: "\f765"; }
.bi-filetype-txt::before { content: "\f766"; }
.bi-filetype-wav::before { content: "\f767"; }
.bi-filetype-woff::before { content: "\f768"; }
.bi-filetype-xls::before { content: "\f76a"; }
.bi-filetype-xml::before { content: "\f76b"; }
.bi-filetype-yml::before { content: "\f76c"; }
.bi-heart-arrow::before { content: "\f76d"; }
.bi-heart-pulse-fill::before { content: "\f76e"; }
.bi-heart-pulse::before { content: "\f76f"; }
.bi-heartbreak-fill::before { content: "\f770"; }
.bi-heartbreak::before { content: "\f771"; }
.bi-hearts::before { content: "\f772"; }
.bi-hospital-fill::before { content: "\f773"; }
.bi-hospital::before { content: "\f774"; }
.bi-house-heart-fill::before { content: "\f775"; }
.bi-house-heart::before { content: "\f776"; }
.bi-incognito::before { content: "\f777"; }
.bi-magnet-fill::before { content: "\f778"; }
.bi-magnet::before { content: "\f779"; }
.bi-person-heart::before { content: "\f77a"; }
.bi-person-hearts::before { content: "\f77b"; }
.bi-phone-flip::before { content: "\f77c"; }
.bi-plugin::before { content: "\f77d"; }
.bi-postage-fill::before { content: "\f77e"; }
.bi-postage-heart-fill::before { content: "\f77f"; }
.bi-postage-heart::before { content: "\f780"; }
.bi-postage::before { content: "\f781"; }
.bi-postcard-fill::before { content: "\f782"; }
.bi-postcard-heart-fill::before { content: "\f783"; }
.bi-postcard-heart::before { content: "\f784"; }
.bi-postcard::before { content: "\f785"; }
.bi-search-heart-fill::before { content: "\f786"; }
.bi-search-heart::before { content: "\f787"; }
.bi-sliders2-vertical::before { content: "\f788"; }
.bi-sliders2::before { content: "\f789"; }
.bi-trash3-fill::before { content: "\f78a"; }
.bi-trash3::before { content: "\f78b"; }
.bi-valentine::before { content: "\f78c"; }
.bi-valentine2::before { content: "\f78d"; }
.bi-wrench-adjustable-circle-fill::before { content: "\f78e"; }
.bi-wrench-adjustable-circle::before { content: "\f78f"; }
.bi-wrench-adjustable::before { content: "\f790"; }
.bi-filetype-json::before { content: "\f791"; }
.bi-filetype-pptx::before { content: "\f792"; }
.bi-filetype-xlsx::before { content: "\f793"; }
.bi-1-circle-fill::before { content: "\f796"; }
.bi-1-circle::before { content: "\f797"; }
.bi-1-square-fill::before { content: "\f798"; }
.bi-1-square::before { content: "\f799"; }
.bi-2-circle-fill::before { content: "\f79c"; }
.bi-2-circle::before { content: "\f79d"; }
.bi-2-square-fill::before { content: "\f79e"; }
.bi-2-square::before { content: "\f79f"; }
.bi-3-circle-fill::before { content: "\f7a2"; }
.bi-3-circle::before { content: "\f7a3"; }
.bi-3-square-fill::before { content: "\f7a4"; }
.bi-3-square::before { content: "\f7a5"; }
.bi-4-circle-fill::before { content: "\f7a8"; }
.bi-4-circle::before { content: "\f7a9"; }
.bi-4-square-fill::before { content: "\f7aa"; }
.bi-4-square::before { content: "\f7ab"; }
.bi-5-circle-fill::before { content: "\f7ae"; }
.bi-5-circle::before { content: "\f7af"; }
.bi-5-square-fill::before { content: "\f7b0"; }
.bi-5-square::before { content: "\f7b1"; }
.bi-6-circle-fill::before { content: "\f7b4"; }
.bi-6-circle::before { content: "\f7b5"; }
.bi-6-square-fill::before { content: "\f7b6"; }
.bi-6-square::before { content: "\f7b7"; }
.bi-7-circle-fill::before { content: "\f7ba"; }
.bi-7-circle::before { content: "\f7bb"; }
.bi-7-square-fill::before { content: "\f7bc"; }
.bi-7-square::before { content: "\f7bd"; }
.bi-8-circle-fill::before { content: "\f7c0"; }
.bi-8-circle::before { content: "\f7c1"; }
.bi-8-square-fill::before { content: "\f7c2"; }
.bi-8-square::before { content: "\f7c3"; }
.bi-9-circle-fill::before { content: "\f7c6"; }
.bi-9-circle::before { content: "\f7c7"; }
.bi-9-square-fill::before { content: "\f7c8"; }
.bi-9-square::before { content: "\f7c9"; }
.bi-airplane-engines-fill::before { content: "\f7ca"; }
.bi-airplane-engines::before { content: "\f7cb"; }
.bi-airplane-fill::before { content: "\f7cc"; }
.bi-airplane::before { content: "\f7cd"; }
.bi-alexa::before { content: "\f7ce"; }
.bi-alipay::before { content: "\f7cf"; }
.bi-android::before { content: "\f7d0"; }
.bi-android2::before { content: "\f7d1"; }
.bi-box-fill::before { content: "\f7d2"; }
.bi-box-seam-fill::before { content: "\f7d3"; }
.bi-browser-chrome::before { content: "\f7d4"; }
.bi-browser-edge::before { content: "\f7d5"; }
.bi-browser-firefox::before { content: "\f7d6"; }
.bi-browser-safari::before { content: "\f7d7"; }
.bi-c-circle-fill::before { content: "\f7da"; }
.bi-c-circle::before { content: "\f7db"; }
.bi-c-square-fill::before { content: "\f7dc"; }
.bi-c-square::before { content: "\f7dd"; }
.bi-capsule-pill::before { content: "\f7de"; }
.bi-capsule::before { content: "\f7df"; }
.bi-car-front-fill::before { content: "\f7e0"; }
.bi-car-front::before { content: "\f7e1"; }
.bi-cassette-fill::before { content: "\f7e2"; }
.bi-cassette::before { content: "\f7e3"; }
.bi-cc-circle-fill::before { content: "\f7e6"; }
.bi-cc-circle::before { content: "\f7e7"; }
.bi-cc-square-fill::before { content: "\f7e8"; }
.bi-cc-square::before { content: "\f7e9"; }
.bi-cup-hot-fill::before { content: "\f7ea"; }
.bi-cup-hot::before { content: "\f7eb"; }
.bi-currency-rupee::before { content: "\f7ec"; }
.bi-dropbox::before { content: "\f7ed"; }
.bi-escape::before { content: "\f7ee"; }
.bi-fast-forward-btn-fill::before { content: "\f7ef"; }
.bi-fast-forward-btn::before { content: "\f7f0"; }
.bi-fast-forward-circle-fill::before { content: "\f7f1"; }
.bi-fast-forward-circle::before { content: "\f7f2"; }
.bi-fast-forward-fill::before { content: "\f7f3"; }
.bi-fast-forward::before { content: "\f7f4"; }
.bi-filetype-sql::before { content: "\f7f5"; }
.bi-fire::before { content: "\f7f6"; }
.bi-google-play::before { content: "\f7f7"; }
.bi-h-circle-fill::before { content: "\f7fa"; }
.bi-h-circle::before { content: "\f7fb"; }
.bi-h-square-fill::before { content: "\f7fc"; }
.bi-h-square::before { content: "\f7fd"; }
.bi-indent::before { content: "\f7fe"; }
.bi-lungs-fill::before { content: "\f7ff"; }
.bi-lungs::before { content: "\f800"; }
.bi-microsoft-teams::before { content: "\f801"; }
.bi-p-circle-fill::before { content: "\f804"; }
.bi-p-circle::before { content: "\f805"; }
.bi-p-square-fill::before { content: "\f806"; }
.bi-p-square::before { content: "\f807"; }
.bi-pass-fill::before { content: "\f808"; }
.bi-pass::before { content: "\f809"; }
.bi-prescription::before { content: "\f80a"; }
.bi-prescription2::before { content: "\f80b"; }
.bi-r-circle-fill::before { content: "\f80e"; }
.bi-r-circle::before { content: "\f80f"; }
.bi-r-square-fill::before { content: "\f810"; }
.bi-r-square::before { content: "\f811"; }
.bi-repeat-1::before { content: "\f812"; }
.bi-repeat::before { content: "\f813"; }
.bi-rewind-btn-fill::before { content: "\f814"; }
.bi-rewind-btn::before { content: "\f815"; }
.bi-rewind-circle-fill::before { content: "\f816"; }
.bi-rewind-circle::before { content: "\f817"; }
.bi-rewind-fill::before { content: "\f818"; }
.bi-rewind::before { content: "\f819"; }
.bi-train-freight-front-fill::before { content: "\f81a"; }
.bi-train-freight-front::before { content: "\f81b"; }
.bi-train-front-fill::before { content: "\f81c"; }
.bi-train-front::before { content: "\f81d"; }
.bi-train-lightrail-front-fill::before { content: "\f81e"; }
.bi-train-lightrail-front::before { content: "\f81f"; }
.bi-truck-front-fill::before { content: "\f820"; }
.bi-truck-front::before { content: "\f821"; }
.bi-ubuntu::before { content: "\f822"; }
.bi-unindent::before { content: "\f823"; }
.bi-unity::before { content: "\f824"; }
.bi-universal-access-circle::before { content: "\f825"; }
.bi-universal-access::before { content: "\f826"; }
.bi-virus::before { content: "\f827"; }
.bi-virus2::before { content: "\f828"; }
.bi-wechat::before { content: "\f829"; }
.bi-yelp::before { content: "\f82a"; }
.bi-sign-stop-fill::before { content: "\f82b"; }
.bi-sign-stop-lights-fill::before { content: "\f82c"; }
.bi-sign-stop-lights::before { content: "\f82d"; }
.bi-sign-stop::before { content: "\f82e"; }
.bi-sign-turn-left-fill::before { content: "\f82f"; }
.bi-sign-turn-left::before { content: "\f830"; }
.bi-sign-turn-right-fill::before { content: "\f831"; }
.bi-sign-turn-right::before { content: "\f832"; }
.bi-sign-turn-slight-left-fill::before { content: "\f833"; }
.bi-sign-turn-slight-left::before { content: "\f834"; }
.bi-sign-turn-slight-right-fill::before { content: "\f835"; }
.bi-sign-turn-slight-right::before { content: "\f836"; }
.bi-sign-yield-fill::before { content: "\f837"; }
.bi-sign-yield::before { content: "\f838"; }
.bi-ev-station-fill::before { content: "\f839"; }
.bi-ev-station::before { content: "\f83a"; }
.bi-fuel-pump-diesel-fill::before { content: "\f83b"; }
.bi-fuel-pump-diesel::before { content: "\f83c"; }
.bi-fuel-pump-fill::before { content: "\f83d"; }
.bi-fuel-pump::before { content: "\f83e"; }
.bi-0-circle-fill::before { content: "\f83f"; }
.bi-0-circle::before { content: "\f840"; }
.bi-0-square-fill::before { content: "\f841"; }
.bi-0-square::before { content: "\f842"; }
.bi-rocket-fill::before { content: "\f843"; }
.bi-rocket-takeoff-fill::before { content: "\f844"; }
.bi-rocket-takeoff::before { content: "\f845"; }
.bi-rocket::before { content: "\f846"; }
.bi-stripe::before { content: "\f847"; }
.bi-subscript::before { content: "\f848"; }
.bi-superscript::before { content: "\f849"; }
.bi-trello::before { content: "\f84a"; }
.bi-envelope-at-fill::before { content: "\f84b"; }
.bi-envelope-at::before { content: "\f84c"; }
.bi-regex::before { content: "\f84d"; }
.bi-text-wrap::before { content: "\f84e"; }
.bi-sign-dead-end-fill::before { content: "\f84f"; }
.bi-sign-dead-end::before { content: "\f850"; }
.bi-sign-do-not-enter-fill::before { content: "\f851"; }
.bi-sign-do-not-enter::before { content: "\f852"; }
.bi-sign-intersection-fill::before { content: "\f853"; }
.bi-sign-intersection-side-fill::before { content: "\f854"; }
.bi-sign-intersection-side::before { content: "\f855"; }
.bi-sign-intersection-t-fill::before { content: "\f856"; }
.bi-sign-intersection-t::before { content: "\f857"; }
.bi-sign-intersection-y-fill::before { content: "\f858"; }
.bi-sign-intersection-y::before { content: "\f859"; }
.bi-sign-intersection::before { content: "\f85a"; }
.bi-sign-merge-left-fill::before { content: "\f85b"; }
.bi-sign-merge-left::before { content: "\f85c"; }
.bi-sign-merge-right-fill::before { content: "\f85d"; }
.bi-sign-merge-right::before { content: "\f85e"; }
.bi-sign-no-left-turn-fill::before { content: "\f85f"; }
.bi-sign-no-left-turn::before { content: "\f860"; }
.bi-sign-no-parking-fill::before { content: "\f861"; }
.bi-sign-no-parking::before { content: "\f862"; }
.bi-sign-no-right-turn-fill::before { content: "\f863"; }
.bi-sign-no-right-turn::before { content: "\f864"; }
.bi-sign-railroad-fill::before { content: "\f865"; }
.bi-sign-railroad::before { content: "\f866"; }
.bi-building-add::before { content: "\f867"; }
.bi-building-check::before { content: "\f868"; }
.bi-building-dash::before { content: "\f869"; }
.bi-building-down::before { content: "\f86a"; }
.bi-building-exclamation::before { content: "\f86b"; }
.bi-building-fill-add::before { content: "\f86c"; }
.bi-building-fill-check::before { content: "\f86d"; }
.bi-building-fill-dash::before { content: "\f86e"; }
.bi-building-fill-down::before { content: "\f86f"; }
.bi-building-fill-exclamation::before { content: "\f870"; }
.bi-building-fill-gear::before { content: "\f871"; }
.bi-building-fill-lock::before { content: "\f872"; }
.bi-building-fill-slash::before { content: "\f873"; }
.bi-building-fill-up::before { content: "\f874"; }
.bi-building-fill-x::before { content: "\f875"; }
.bi-building-fill::before { content: "\f876"; }
.bi-building-gear::before { content: "\f877"; }
.bi-building-lock::before { content: "\f878"; }
.bi-building-slash::before { content: "\f879"; }
.bi-building-up::before { content: "\f87a"; }
.bi-building-x::before { content: "\f87b"; }
.bi-buildings-fill::before { content: "\f87c"; }
.bi-buildings::before { content: "\f87d"; }
.bi-bus-front-fill::before { content: "\f87e"; }
.bi-bus-front::before { content: "\f87f"; }
.bi-ev-front-fill::before { content: "\f880"; }
.bi-ev-front::before { content: "\f881"; }
.bi-globe-americas::before { content: "\f882"; }
.bi-globe-asia-australia::before { content: "\f883"; }
.bi-globe-central-south-asia::before { content: "\f884"; }
.bi-globe-europe-africa::before { content: "\f885"; }
.bi-house-add-fill::before { content: "\f886"; }
.bi-house-add::before { content: "\f887"; }
.bi-house-check-fill::before { content: "\f888"; }
.bi-house-check::before { content: "\f889"; }
.bi-house-dash-fill::before { content: "\f88a"; }
.bi-house-dash::before { content: "\f88b"; }
.bi-house-down-fill::before { content: "\f88c"; }
.bi-house-down::before { content: "\f88d"; }
.bi-house-exclamation-fill::before { content: "\f88e"; }
.bi-house-exclamation::before { content: "\f88f"; }
.bi-house-gear-fill::before { content: "\f890"; }
.bi-house-gear::before { content: "\f891"; }
.bi-house-lock-fill::before { content: "\f892"; }
.bi-house-lock::before { content: "\f893"; }
.bi-house-slash-fill::before { content: "\f894"; }
.bi-house-slash::before { content: "\f895"; }
.bi-house-up-fill::before { content: "\f896"; }
.bi-house-up::before { content: "\f897"; }
.bi-house-x-fill::before { content: "\f898"; }
.bi-house-x::before { content: "\f899"; }
.bi-person-add::before { content: "\f89a"; }
.bi-person-down::before { content: "\f89b"; }
.bi-person-exclamation::before { content: "\f89c"; }
.bi-person-fill-add::before { content: "\f89d"; }
.bi-person-fill-check::before { content: "\f89e"; }
.bi-person-fill-dash::before { content: "\f89f"; }
.bi-person-fill-down::before { content: "\f8a0"; }
.bi-person-fill-exclamation::before { content: "\f8a1"; }
.bi-person-fill-gear::before { content: "\f8a2"; }
.bi-person-fill-lock::before { content: "\f8a3"; }
.bi-person-fill-slash::before { content: "\f8a4"; }
.bi-person-fill-up::before { content: "\f8a5"; }
.bi-person-fill-x::before { content: "\f8a6"; }
.bi-person-gear::before { content: "\f8a7"; }
.bi-person-lock::before { content: "\f8a8"; }
.bi-person-slash::before { content: "\f8a9"; }
.bi-person-up::before { content: "\f8aa"; }
.bi-scooter::before { content: "\f8ab"; }
.bi-taxi-front-fill::before { content: "\f8ac"; }
.bi-taxi-front::before { content: "\f8ad"; }
.bi-amd::before { content: "\f8ae"; }
.bi-database-add::before { content: "\f8af"; }
.bi-database-check::before { content: "\f8b0"; }
.bi-database-dash::before { content: "\f8b1"; }
.bi-database-down::before { content: "\f8b2"; }
.bi-database-exclamation::before { content: "\f8b3"; }
.bi-database-fill-add::before { content: "\f8b4"; }
.bi-database-fill-check::before { content: "\f8b5"; }
.bi-database-fill-dash::before { content: "\f8b6"; }
.bi-database-fill-down::before { content: "\f8b7"; }
.bi-database-fill-exclamation::before { content: "\f8b8"; }
.bi-database-fill-gear::before { content: "\f8b9"; }
.bi-database-fill-lock::before { content: "\f8ba"; }
.bi-database-fill-slash::before { content: "\f8bb"; }
.bi-database-fill-up::before { content: "\f8bc"; }
.bi-database-fill-x::before { content: "\f8bd"; }
.bi-database-fill::before { content: "\f8be"; }
.bi-database-gear::before { content: "\f8bf"; }
.bi-database-lock::before { content: "\f8c0"; }
.bi-database-slash::before { content: "\f8c1"; }
.bi-database-up::before { content: "\f8c2"; }
.bi-database-x::before { content: "\f8c3"; }
.bi-database::before { content: "\f8c4"; }
.bi-houses-fill::before { content: "\f8c5"; }
.bi-houses::before { content: "\f8c6"; }
.bi-nvidia::before { content: "\f8c7"; }
.bi-person-vcard-fill::before { content: "\f8c8"; }
.bi-person-vcard::before { content: "\f8c9"; }
.bi-sina-weibo::before { content: "\f8ca"; }
.bi-tencent-qq::before { content: "\f8cb"; }
.bi-wikipedia::before { content: "\f8cc"; }
.bi-alphabet-uppercase::before { content: "\f2a5"; }
.bi-alphabet::before { content: "\f68a"; }
.bi-amazon::before { content: "\f68d"; }
.bi-arrows-collapse-vertical::before { content: "\f690"; }
.bi-arrows-expand-vertical::before { content: "\f695"; }
.bi-arrows-vertical::before { content: "\f698"; }
.bi-arrows::before { content: "\f6a2"; }
.bi-ban-fill::before { content: "\f6a3"; }
.bi-ban::before { content: "\f6b6"; }
.bi-bing::before { content: "\f6c2"; }
.bi-cake::before { content: "\f6e0"; }
.bi-cake2::before { content: "\f6ed"; }
.bi-cookie::before { content: "\f6ee"; }
.bi-copy::before { content: "\f759"; }
.bi-crosshair::before { content: "\f769"; }
.bi-crosshair2::before { content: "\f794"; }
.bi-emoji-astonished-fill::before { content: "\f795"; }
.bi-emoji-astonished::before { content: "\f79a"; }
.bi-emoji-grimace-fill::before { content: "\f79b"; }
.bi-emoji-grimace::before { content: "\f7a0"; }
.bi-emoji-grin-fill::before { content: "\f7a1"; }
.bi-emoji-grin::before { content: "\f7a6"; }
.bi-emoji-surprise-fill::before { content: "\f7a7"; }
.bi-emoji-surprise::before { content: "\f7ac"; }
.bi-emoji-tear-fill::before { content: "\f7ad"; }
.bi-emoji-tear::before { content: "\f7b2"; }
.bi-envelope-arrow-down-fill::before { content: "\f7b3"; }
.bi-envelope-arrow-down::before { content: "\f7b8"; }
.bi-envelope-arrow-up-fill::before { content: "\f7b9"; }
.bi-envelope-arrow-up::before { content: "\f7be"; }
.bi-feather::before { content: "\f7bf"; }
.bi-feather2::before { content: "\f7c4"; }
.bi-floppy-fill::before { content: "\f7c5"; }
.bi-floppy::before { content: "\f7d8"; }
.bi-floppy2-fill::before { content: "\f7d9"; }
.bi-floppy2::before { content: "\f7e4"; }
.bi-gitlab::before { content: "\f7e5"; }
.bi-highlighter::before { content: "\f7f8"; }
.bi-marker-tip::before { content: "\f802"; }
.bi-nvme-fill::before { content: "\f803"; }
.bi-nvme::before { content: "\f80c"; }
.bi-opencollective::before { content: "\f80d"; }
.bi-pci-card-network::before { content: "\f8cd"; }
.bi-pci-card-sound::before { content: "\f8ce"; }
.bi-radar::before { content: "\f8cf"; }
.bi-send-arrow-down-fill::before { content: "\f8d0"; }
.bi-send-arrow-down::before { content: "\f8d1"; }
.bi-send-arrow-up-fill::before { content: "\f8d2"; }
.bi-send-arrow-up::before { content: "\f8d3"; }
.bi-sim-slash-fill::before { content: "\f8d4"; }
.bi-sim-slash::before { content: "\f8d5"; }
.bi-sourceforge::before { content: "\f8d6"; }
.bi-substack::before { content: "\f8d7"; }
.bi-threads-fill::before { content: "\f8d8"; }
.bi-threads::before { content: "\f8d9"; }
.bi-transparency::before { content: "\f8da"; }
.bi-twitter-x::before { content: "\f8db"; }
.bi-type-h4::before { content: "\f8dc"; }
.bi-type-h5::before { content: "\f8dd"; }
.bi-type-h6::before { content: "\f8de"; }
.bi-backpack-fill::before { content: "\f8df"; }
.bi-backpack::before { content: "\f8e0"; }
.bi-backpack2-fill::before { content: "\f8e1"; }
.bi-backpack2::before { content: "\f8e2"; }
.bi-backpack3-fill::before { content: "\f8e3"; }
.bi-backpack3::before { content: "\f8e4"; }
.bi-backpack4-fill::before { content: "\f8e5"; }
.bi-backpack4::before { content: "\f8e6"; }
.bi-brilliance::before { content: "\f8e7"; }
.bi-cake-fill::before { content: "\f8e8"; }
.bi-cake2-fill::before { content: "\f8e9"; }
.bi-duffle-fill::before { content: "\f8ea"; }
.bi-duffle::before { content: "\f8eb"; }
.bi-exposure::before { content: "\f8ec"; }
.bi-gender-neuter::before { content: "\f8ed"; }
.bi-highlights::before { content: "\f8ee"; }
.bi-luggage-fill::before { content: "\f8ef"; }
.bi-luggage::before { content: "\f8f0"; }
.bi-mailbox-flag::before { content: "\f8f1"; }
.bi-mailbox2-flag::before { content: "\f8f2"; }
.bi-noise-reduction::before { content: "\f8f3"; }
.bi-passport-fill::before { content: "\f8f4"; }
.bi-passport::before { content: "\f8f5"; }
.bi-person-arms-up::before { content: "\f8f6"; }
.bi-person-raised-hand::before { content: "\f8f7"; }
.bi-person-standing-dress::before { content: "\f8f8"; }
.bi-person-standing::before { content: "\f8f9"; }
.bi-person-walking::before { content: "\f8fa"; }
.bi-person-wheelchair::before { content: "\f8fb"; }
.bi-shadows::before { content: "\f8fc"; }
.bi-suitcase-fill::before { content: "\f8fd"; }
.bi-suitcase-lg-fill::before { content: "\f8fe"; }
.bi-suitcase-lg::before { content: "\f8ff"; }
.bi-suitcase::before { content: "\f900"; }
.bi-suitcase2-fill::before { content: "\f901"; }
.bi-suitcase2::before { content: "\f902"; }
.bi-vignette::before { content: "\f903"; }

:root{--cc-bg:#fff;--cc-text:#2d4156;--cc-btn-primary-bg:#2d4156;--cc-btn-primary-text:var(--cc-bg);--cc-btn-primary-hover-bg:#1d2e38;--cc-btn-secondary-bg:#eaeff2;--cc-btn-secondary-text:var(--cc-text);--cc-btn-secondary-hover-bg:#d8e0e6;--cc-toggle-bg-off:#919ea6;--cc-toggle-bg-on:var(--cc-btn-primary-bg);--cc-toggle-bg-readonly:#d5dee2;--cc-toggle-knob-bg:#fff;--cc-toggle-knob-icon-color:#ecf2fa;--cc-block-text:var(--cc-text);--cc-cookie-category-block-bg:#f0f4f7;--cc-cookie-category-block-bg-hover:#e9eff4;--cc-section-border:#f1f3f5;--cc-cookie-table-border:#e9edf2;--cc-overlay-bg:rgba(4, 6, 8, .85);--cc-webkit-scrollbar-bg:#cfd5db;--cc-webkit-scrollbar-bg-hover:#9199a0}.c_darkmode{--cc-bg:#181b1d;--cc-text:#d8e5ea;--cc-btn-primary-bg:#a6c4dd;--cc-btn-primary-text:#000;--cc-btn-primary-hover-bg:#c2dff7;--cc-btn-secondary-bg:#33383c;--cc-btn-secondary-text:var(--cc-text);--cc-btn-secondary-hover-bg:#3e454a;--cc-toggle-bg-off:#667481;--cc-toggle-bg-on:var(--cc-btn-primary-bg);--cc-toggle-bg-readonly:#454c54;--cc-toggle-knob-bg:var(--cc-cookie-category-block-bg);--cc-toggle-knob-icon-color:var(--cc-bg);--cc-block-text:#b3bfc5;--cc-cookie-category-block-bg:#23272a;--cc-cookie-category-block-bg-hover:#2b3035;--cc-section-border:#292d31;--cc-cookie-table-border:#2b3035;--cc-webkit-scrollbar-bg:#667481;--cc-webkit-scrollbar-bg-hover:#9199a0}.cc_div *,.cc_div :after,.cc_div :before{-webkit-box-sizing:border-box;box-sizing:border-box;float:none;font-style:inherit;font-variant:normal;font-weight:inherit;font-family:inherit;line-height:1.2;font-size:1em;transition:none;animation:none;margin:0;padding:0;text-transform:none;letter-spacing:unset;color:inherit;background:0 0;border:none;box-shadow:none;text-decoration:none;text-align:left;visibility:unset}.cc_div{font-size:16px;font-weight:400;font-family:-apple-system,BlinkMacSystemFont,"Segoe UI",Roboto,Helvetica,Arial,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol";-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale;text-rendering:optimizeLegibility;color:#2d4156;color:var(--cc-text)}#c-ttl,#s-bl td:before,#s-ttl,.cc_div .b-tl,.cc_div .c-bn{font-weight:600}#cm,#s-bl .act .b-acc,#s-inr,.cc_div .b-tl,.cc_div .c-bl{border-radius:.35em}#s-bl .act .b-acc{border-top-left-radius:0;border-top-right-radius:0}.cc_div a,.cc_div button,.cc_div input{-webkit-appearance:none;-moz-appearance:none;appearance:none}.cc_div a{border-bottom:1px solid}.cc_div a:hover{text-decoration:none;border-color:transparent}#cm-ov,#cs-ov,.c--anim #cm,.c--anim #s-cnt,.c--anim #s-inr{transition:visibility .25s linear,opacity .25s ease,transform .25s ease!important}.c--anim .c-bn{transition:background-color .25s ease!important}.c--anim #cm.bar.slide,.c--anim .bar.slide #s-inr{transition:visibility .4s ease,opacity .4s ease,transform .4s ease!important}.c--anim #cm.bar.slide+#cm-ov,.c--anim .bar.slide+#cs-ov{transition:visibility .4s ease,opacity .4s ease,transform .4s ease!important}#cm.bar.slide,.cc_div .bar.slide #s-inr{transform:translateX(100%);opacity:1}#cm.bar.top.slide,.cc_div .bar.left.slide #s-inr{transform:translateX(-100%);opacity:1}#cm.slide,.cc_div .slide #s-inr{transform:translateY(1.6em)}#cm.top.slide{transform:translateY(-1.6em)}#cm.bar.slide{transform:translateY(100%)}#cm.bar.top.slide{transform:translateY(-100%)}.show--consent .c--anim #cm,.show--consent .c--anim #cm.bar,.show--settings .c--anim #s-inr,.show--settings .c--anim .bar.slide #s-inr{opacity:1;transform:scale(1);visibility:visible!important}.show--consent .c--anim #cm.box.middle,.show--consent .c--anim #cm.cloud.middle{transform:scale(1) translateY(-50%)}.show--settings .c--anim #s-cnt{visibility:visible!important}.force--consent.show--consent .c--anim #cm-ov,.show--settings .c--anim #cs-ov{visibility:visible!important;opacity:1!important}#cm{font-family:inherit;padding:1.1em 1.8em 1.4em 1.8em;position:fixed;z-index:1;background:#fff;background:var(--cc-bg);max-width:24.2em;width:100%;bottom:1.25em;right:1.25em;box-shadow:0 .625em 1.875em #000;box-shadow:0 .625em 1.875em rgba(2,2,3,.28);opacity:0;visibility:hidden;transform:scale(.95);line-height:initial}#cc_div #cm{display:block!important}#c-ttl{margin-bottom:.7em;font-size:1.05em}.cloud #c-ttl{margin-top:-.15em}#c-txt{font-size:.9em;line-height:1.5em}.cc_div #c-bns{display:flex;justify-content:space-between;margin-top:1.4em}.cc_div .c-bn{color:#40505a;color:var(--cc-btn-secondary-text);background:#e5ebef;background:var(--cc-btn-secondary-bg);padding:1em 1.7em;display:inline-block;cursor:pointer;font-size:.82em;-moz-user-select:none;-khtml-user-select:none;-webkit-user-select:none;-o-user-select:none;user-select:none;text-align:center;border-radius:4px;flex:1}#c-bns button+button,#s-c-bn,#s-cnt button+button{float:right;margin-left:1em}#s-cnt #s-rall-bn{float:none}#cm .c_link:active,#cm .c_link:hover,#s-c-bn:active,#s-c-bn:hover,#s-cnt button+button:active,#s-cnt button+button:hover{background:#d8e0e6;background:var(--cc-btn-secondary-hover-bg)}#s-cnt{position:fixed;top:0;left:0;width:100%;z-index:101;display:table;height:100%;visibility:hidden}#s-bl{outline:0}#s-bl .title{margin-top:1.4em}#s-bl .title:first-child{margin-top:0}#s-bl .b-bn{margin-top:0}#s-bl .b-acc .p{margin-top:0;padding:1em}#s-cnt .b-bn .b-tl{display:block;font-family:inherit;font-size:.95em;width:100%;position:relative;padding:1.3em 6.4em 1.3em 2.7em;background:0 0;transition:background-color .25s ease}#s-cnt .b-bn .b-tl.exp{cursor:pointer}#s-cnt .act .b-bn .b-tl{border-bottom-right-radius:0;border-bottom-left-radius:0}#s-cnt .b-bn .b-tl:active,#s-cnt .b-bn .b-tl:hover{background:#e9eff4;background:var(--cc-cookie-category-block-bg-hover)}#s-bl .b-bn{position:relative}#s-bl .c-bl{padding:1em;margin-bottom:.5em;border:1px solid #f1f3f5;border-color:var(--cc-section-border);transition:background-color .25s ease}#s-bl .c-bl:hover{background:#f0f4f7;background:var(--cc-cookie-category-block-bg)}#s-bl .c-bl:last-child{margin-bottom:.5em}#s-bl .c-bl:first-child{transition:none;padding:0;margin-top:0;border:none;margin-bottom:2em}#s-bl .c-bl:not(.b-ex):first-child:hover{background:0 0;background:unset}#s-bl .c-bl.b-ex{padding:0;border:none;background:#f0f4f7;background:var(--cc-cookie-category-block-bg);transition:none}#s-bl .c-bl.b-ex+.c-bl{margin-top:2em}#s-bl .c-bl.b-ex+.c-bl.b-ex{margin-top:0}#s-bl .c-bl.b-ex:first-child{margin-bottom:1em}#s-bl .c-bl.b-ex:first-child{margin-bottom:.5em}#s-bl .b-acc{max-height:0;overflow:hidden;padding-top:0;margin-bottom:0;display:none}#s-bl .act .b-acc{max-height:100%;display:block;overflow:hidden}#s-cnt .p{font-size:.9em;line-height:1.5em;margin-top:.85em;color:#2d4156;color:var(--cc-block-text)}.cc_div .b-tg .c-tgl:disabled{cursor:not-allowed}#c-vln{display:table-cell;vertical-align:middle;position:relative}#cs{padding:0 1.7em;width:100%;position:fixed;left:0;right:0;top:0;bottom:0;height:100%}#s-inr{height:100%;position:relative;max-width:45em;margin:0 auto;transform:scale(.96);opacity:0;padding-top:4.75em;padding-bottom:4.75em;position:relative;height:100%;overflow:hidden;visibility:hidden;box-shadow:rgba(3,6,9,.26) 0 13px 27px -5px}#s-bns,#s-hdr,#s-inr{background:#fff;background:var(--cc-bg)}#s-bl{overflow-y:auto;overflow-y:overlay;overflow-x:hidden;height:100%;padding:1.3em 2.1em;display:block;width:100%}#s-bns{position:absolute;bottom:0;left:0;right:0;padding:1em 2.1em;border-top:1px solid #f1f3f5;border-color:var(--cc-section-border);height:4.75em}.cc_div .cc-link{color:#253b48;color:var(--cc-btn-primary-bg);border-bottom:1px solid #253b48;border-color:var(--cc-btn-primary-bg);display:inline;padding-bottom:0;text-decoration:none;cursor:pointer;font-weight:600}.cc_div .cc-link:active,.cc_div .cc-link:hover{border-color:transparent}#c-bns button:first-child,#s-bns button:first-child{color:#fff;color:var(--cc-btn-primary-text);background:#253b48;background:var(--cc-btn-primary-bg)}#c-bns.swap button:first-child{color:#40505a;color:var(--cc-btn-secondary-text);background:#e5ebef;background:var(--cc-btn-secondary-bg)}#c-bns.swap button:last-child{color:#fff;color:var(--cc-btn-primary-text);background:#253b48;background:var(--cc-btn-primary-bg)}.cc_div .b-tg .c-tgl:checked~.c-tg{background:#253b48;background:var(--cc-toggle-bg-on)}#c-bns button:first-child:active,#c-bns button:first-child:hover,#c-bns.swap button:last-child:active,#c-bns.swap button:last-child:hover,#s-bns button:first-child:active,#s-bns button:first-child:hover{background:#1d2e38;background:var(--cc-btn-primary-hover-bg)}#c-bns.swap button:first-child:active,#c-bns.swap button:first-child:hover{background:#d8e0e6;background:var(--cc-btn-secondary-hover-bg)}#s-hdr{position:absolute;top:0;width:100%;display:table;padding:0 2.1em;height:4.75em;vertical-align:middle;z-index:2;border-bottom:1px solid #f1f3f5;border-color:var(--cc-section-border)}#s-ttl{display:table-cell;vertical-align:middle;font-size:1em}#s-c-bn{padding:0;width:1.7em;height:1.7em;font-size:1.45em;margin:0;font-weight:initial;position:relative}#s-c-bnc{display:table-cell;vertical-align:middle}.cc_div span.t-lb{position:absolute;top:0;z-index:-1;opacity:0;pointer-events:none;overflow:hidden}#c_policy__text{height:31.25em;overflow-y:auto;margin-top:1.25em}#c-s-in{position:relative;transform:translateY(-50%);top:50%;height:100%;height:calc(100% - 2.5em);max-height:37.5em}@media screen and (min-width:688px){#s-bl::-webkit-scrollbar{width:.9em;height:100%;background:0 0;border-radius:0 .25em .25em 0}#s-bl::-webkit-scrollbar-thumb{border:.25em solid var(--cc-bg);background:#cfd5db;background:var(--cc-webkit-scrollbar-bg);border-radius:100em}#s-bl::-webkit-scrollbar-thumb:hover{background:#9199a0;background:var(--cc-webkit-scrollbar-bg-hover)}#s-bl::-webkit-scrollbar-button{width:10px;height:5px}}.cc_div .b-tg{position:absolute;right:0;top:0;bottom:0;display:inline-block;margin:auto;right:1.2em;cursor:pointer;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;vertical-align:middle}.cc_div .b-tg .c-tgl{position:absolute;cursor:pointer;display:block;top:0;left:0;margin:0;border:0}.cc_div .b-tg .c-tg{position:absolute;background:#919ea6;background:var(--cc-toggle-bg-off);transition:background-color .25s ease,box-shadow .25s ease;pointer-events:none}.cc_div .b-tg,.cc_div .b-tg .c-tg,.cc_div .b-tg .c-tgl,.cc_div span.t-lb{width:3.4em;height:1.5em;border-radius:4em}.cc_div .b-tg .c-tg.c-ro{cursor:not-allowed}.cc_div .b-tg .c-tgl~.c-tg.c-ro{background:#d5dee2;background:var(--cc-toggle-bg-readonly)}.cc_div .b-tg .c-tgl~.c-tg.c-ro:after{box-shadow:none}.cc_div .b-tg .c-tg:after{content:"";position:relative;display:block;left:.125em;top:.125em;width:1.25em;height:1.25em;border:none;box-sizing:content-box;background:#fff;background:var(--cc-toggle-knob-bg);box-shadow:0 1px 2px rgba(24,32,35,.36);transition:transform .25s ease;border-radius:100%}.cc_div .b-tg .c-tgl:checked~.c-tg:after{transform:translateX(1.9em)}#s-bl table,#s-bl td,#s-bl th{border:none}#s-bl tbody tr{transition:background-color .25s ease}#s-bl tbody tr:hover{background:#e9eff4;background:var(--cc-cookie-category-block-bg-hover)}#s-bl table{text-align:left;border-collapse:collapse;width:100%;padding:0;margin:0;overflow:hidden}#s-bl td,#s-bl th{padding:.8em .625em;text-align:left;vertical-align:top;font-size:.8em;padding-left:1.2em}#s-bl th{font-family:inherit;padding:1.2em 1.2em}#s-bl thead tr:first-child{border-bottom:1px solid #e9edf2;border-color:var(--cc-cookie-table-border)}.force--consent #cs,.force--consent #s-cnt{width:100vw}#cm-ov,#cs-ov{position:fixed;left:0;right:0;top:0;bottom:0;visibility:hidden;opacity:0;background:#070707;background:rgba(4,6,8,.85);background:var(--cc-overlay-bg);display:none;transition:none}.c--anim #cs-ov,.force--consent .c--anim #cm-ov,.force--consent.show--consent #cm-ov,.show--settings #cs-ov{display:block}#cs-ov{z-index:2}.force--consent .cc_div{position:fixed;top:0;left:0;bottom:0;width:100%;width:100vw;visibility:hidden;transition:visibility .25s linear}.force--consent.show--consent .c--anim .cc_div,.force--consent.show--settings .c--anim .cc_div{visibility:visible}.force--consent #cm{position:absolute}.force--consent #cm.bar{width:100vw;max-width:100vw}html.force--consent.show--consent{overflow-y:hidden!important}html.force--consent.show--consent,html.force--consent.show--consent body{height:auto!important;overflow-x:hidden!important}.cc_div .act .b-bn .b-tl.exp::before,.cc_div .b-bn .b-tl.exp::before{border:solid #2d4156;border-color:var(--cc-btn-secondary-text);border-width:0 2px 2px 0;padding:.2em;display:inline-block;position:absolute;content:'';margin-right:15px;position:absolute;transform:translateY(-50%) rotate(45deg);left:1.2em;top:50%}.cc_div .act .b-bn .b-tl::before{transform:translateY(-20%) rotate(225deg)}.cc_div .on-i::before{border:solid #fff;border-color:var(--cc-toggle-knob-icon-color);border-width:0 2px 2px 0;padding:.1em;display:inline-block;padding-bottom:.45em;content:'';margin:0 auto;transform:rotate(45deg);top:.37em;left:.75em;position:absolute}#s-c-bn::after,#s-c-bn::before{content:'';position:absolute;left:.82em;top:.58em;height:.6em;width:1.5px;background:#444d53;background:var(--cc-btn-secondary-text);transform:rotate(45deg);border-radius:1em;margin:0 auto}#s-c-bn::after{transform:rotate(-45deg)}.cc_div .off-i,.cc_div .on-i{height:100%;width:50%;position:absolute;right:0;display:block;text-align:center;transition:opacity .15s ease}.cc_div .on-i{left:0;opacity:0}.cc_div .off-i::after,.cc_div .off-i::before{right:.8em;top:.42em;content:' ';height:.7em;width:.09375em;display:block;background:#cdd6dc;background:var(--cc-toggle-knob-icon-color);margin:0 auto;position:absolute;transform-origin:center}.cc_div .off-i::before{transform:rotate(45deg)}.cc_div .off-i::after{transform:rotate(-45deg)}.cc_div .b-tg .c-tgl:checked~.c-tg .on-i{opacity:1}.cc_div .b-tg .c-tgl:checked~.c-tg .off-i{opacity:0}#cm.box.middle,#cm.cloud.middle{top:50%;transform:translateY(-37%);bottom:auto}#cm.box.middle.zoom,#cm.cloud.middle.zoom{transform:scale(.95) translateY(-50%)}#cm.box.center{left:1em;right:1em;margin:0 auto}#cm.cloud{max-width:50em;margin:0 auto;text-align:center;left:1em;right:1em;overflow:hidden;padding:1.3em 2em;width:unset}.cc_div .cloud #c-inr{display:table;width:100%}.cc_div .cloud #c-inr-i{width:70%;display:table-cell;vertical-align:top;padding-right:2.4em}.cc_div .cloud #c-txt{font-size:.85em}.cc_div .cloud #c-bns{min-width:170px;display:table-cell;vertical-align:middle}#cm.cloud .c-bn{margin:.625em 0 0 0;width:100%}#cm.cloud .c-bn:first-child{margin:0}#cm.cloud.left{margin-right:1.25em}#cm.cloud.right{margin-left:1.25em}#cm.bar{width:100%;max-width:100%;left:0;right:0;bottom:0;border-radius:0;position:fixed;padding:2em}#cm.bar #c-inr{max-width:32em;margin:0 auto}#cm.bar #c-bns{max-width:33.75em}#cm.bar #cs{padding:0}.cc_div .bar #c-s-in{top:0;transform:none;height:100%;max-height:100%}.cc_div .bar #s-bl,.cc_div .bar #s-bns,.cc_div .bar #s-hdr{padding-left:1.6em;padding-right:1.6em}.cc_div .bar #cs{padding:0}.cc_div .bar #s-inr{margin:0;margin-left:auto;margin-right:0;border-radius:0;max-width:32em}.cc_div .bar.left #s-inr{margin-left:0;margin-right:auto}.cc_div .bar #s-bl table,.cc_div .bar #s-bl tbody,.cc_div .bar #s-bl td,.cc_div .bar #s-bl th,.cc_div .bar #s-bl thead,.cc_div .bar #s-bl tr,.cc_div .bar #s-cnt{display:block}.cc_div .bar #s-bl thead tr{position:absolute;top:-9999px;left:-9999px}.cc_div .bar #s-bl tr{border-top:1px solid #e3e7ed;border-color:var(--cc-cookie-table-border)}.cc_div .bar #s-bl td{border:none;position:relative;padding-left:35%}.cc_div .bar #s-bl td:before{position:absolute;left:1em;padding-right:.625em;white-space:nowrap;content:attr(data-column);color:#000;color:var(--cc-text);overflow:hidden;text-overflow:ellipsis}#cm.top{bottom:auto;top:1.25em}#cm.left{right:auto;left:1.25em}#cm.right{left:auto;right:1.25em}#cm.bar.left,#cm.bar.right{left:0;right:0}#cm.bar.top{top:0}@media screen and (max-width:688px){#cm,#cm.cloud,#cm.left,#cm.right{width:auto;max-width:100%;margin:0;padding:1.4em!important;right:1em;left:1em;bottom:1em;display:block}.force--consent #cm,.force--consent #cm.cloud{width:auto;max-width:100vw}#cm.top{top:1em;bottom:auto}#cm.bottom{bottom:1em;top:auto}#cm.bar.bottom{bottom:0}#cm.cloud .c-bn{font-size:.85em}#s-bns,.cc_div .bar #s-bns{padding:1em 1.3em}.cc_div .bar #s-inr{max-width:100%;width:100%}.cc_div .cloud #c-inr-i{padding-right:0}#cs{border-radius:0;padding:0}#c-s-in{max-height:100%;height:100%;top:0;transform:none}.cc_div .b-tg{transform:scale(1.1);right:1.1em}#s-inr{margin:0;padding-bottom:7.9em;border-radius:0}#s-bns{height:7.9em}#s-bl,.cc_div .bar #s-bl{padding:1.3em}#s-hdr,.cc_div .bar #s-hdr{padding:0 1.3em}#s-bl table{width:100%}#s-inr.bns-t{padding-bottom:10.5em}.bns-t #s-bns{height:10.5em}.cc_div .bns-t .c-bn{font-size:.83em;padding:.9em 1.6em}#s-cnt .b-bn .b-tl{padding-top:1.2em;padding-bottom:1.2em}#s-bl table,#s-bl tbody,#s-bl td,#s-bl th,#s-bl thead,#s-bl tr,#s-cnt{display:block}#s-bl thead tr{position:absolute;top:-9999px;left:-9999px}#s-bl tr{border-top:1px solid #e3e7ed;border-color:var(--cc-cookie-table-border)}#s-bl td{border:none;position:relative;padding-left:35%}#s-bl td:before{position:absolute;left:1em;padding-right:.625em;white-space:nowrap;content:attr(data-column);color:#000;color:var(--cc-text);overflow:hidden;text-overflow:ellipsis}#cm .c-bn,.cc_div .c-bn{width:100%;margin-right:0}#s-cnt #s-rall-bn{margin-left:0}.cc_div #c-bns{flex-direction:column}#c-bns button+button,#s-cnt button+button{margin-top:.625em;margin-left:0;float:unset}#cm.box,#cm.cloud{left:1em;right:1em;width:auto}#cm.cloud.left,#cm.cloud.right{margin:0}.cc_div .cloud #c-bns,.cc_div .cloud #c-inr,.cc_div .cloud #c-inr-i{display:block;width:auto;min-width:unset}.cc_div .cloud #c-txt{font-size:.9em}.cc_div .cloud #c-bns{margin-top:1.625em}}.cc_div.ie #c-vln{height:100%;padding-top:5.62em}.cc_div.ie .bar #c-vln{padding-top:0}.cc_div.ie #cs{max-height:37.5em;position:relative;top:0;margin-top:-5.625em}.cc_div.ie .bar #cs{margin-top:0;max-height:100%}.cc_div.ie #cm{border:1px solid #dee6e9}.cc_div.ie #c-s-in{top:0}.cc_div.ie .b-tg{padding-left:1em;margin-bottom:.7em}.cc_div.ie .b-tg .c-tgl:checked~.c-tg:after{left:1.95em}.cc_div.ie #s-bl table{overflow:auto}.cc_div.ie .b-tg .c-tg{display:none}.cc_div.ie .b-tg .c-tgl{position:relative;display:inline-block;vertical-align:middle;margin-bottom:.2em;height:auto}.cc_div.ie #s-cnt .b-bn .b-tl{padding:1.3em 6.4em 1.3em 1.4em}.cc_div.ie .bar #s-bl td:before{display:none}.cc_div.ie .bar #s-bl td{padding:.8em .625em .8em 1.2em}.cc_div.ie .bar #s-bl thead tr{position:relative}.cc_div.ie .b-tg .t-lb{filter: alpha(opacity=0);}.cc_div.ie #cm-ov,.cc_div.ie #cs-ov{filter: alpha(opacity=80);}

/* Posts */
.blog-posts:not(.blog-posts-no-margins) article {
	/* border-bottom: 1px solid rgba(0, 0, 0, 0.06); */
	margin-bottom: 50px;
	padding-bottom: 20px;
}

.blog-posts:not(.blog-posts-no-margins) .pagination {
	margin: -10px 0 20px;
}

.blog-posts.blog-posts-no-margins .pagination {
	margin-top: 28.8px;
	margin-top: 1.8rem;
}

/* Post */
article.post h2 a {
	text-decoration: none;
}

article.post .post-meta {
	font-size: 0.9em;
	margin-bottom: 7px;
}

article.post .post-meta > span {
	display: inline-block;
	padding-right: 8px;
}

article.post .post-meta i {
	margin-right: 3px;
}

article.post .post-date {
	float: left;
	margin-right: 10px;
	text-align: center;
}

article.post .post-date .month {
	display: block;
	background: #CCC;
	border-radius: 0 0 2px 2px;
	color: #FFF;
	font-size: 0.8em;
	line-height: 1.8;
	padding: 1px 10px;
	text-transform: uppercase;
}

article.post .post-date .day {
	background: #f7f7f7;
	border-radius: 2px 2px 0 0;
	color: #CCC;
	display: block;
	font-size: 18px;
	font-weight: 900;
	padding: 10px;
}

article.post .post-image .owl-carousel {
	width: 100.1%;
}

article .post-video {
	-webkit-transition: all 0.2s ease-in-out;
	transition: all 0.2s ease-in-out;
	padding: 0;
	background-color: #FFF;
	border: 1px solid rgba(0, 0, 0, 0.06);
	border-radius: 8px;
	display: block;
	height: auto;
	position: relative;
	margin: 0 0 30px 0;
	padding-bottom: 61%;
}

article .post-video iframe {
	bottom: 0;
	height: auto;
	left: 0;
	margin: 0;
	min-height: 100%;
	min-width: 100%;
	padding: 4px;
	position: absolute;
	right: 0;
	top: 0;
	width: auto;
}

article .post-audio {
	-webkit-transition: all 0.2s ease-in-out;
	transition: all 0.2s ease-in-out;
	padding: 0;
	background-color: #FFF;
	border: 1px solid rgba(0, 0, 0, 0.06);
	border-radius: 8px;
	display: block;
	height: auto;
	position: relative;
	margin: 0 0 30px 0;
	padding-bottom: 35%;
	min-height: 160px;
}

article .post-audio iframe {
	bottom: 0;
	height: auto;
	left: 0;
	margin: 0;
	min-height: 100%;
	min-width: 100%;
	padding: 4px;
	position: absolute;
	right: 0;
	top: 0;
	width: auto;
}

article.post-medium .post-image .owl-carousel {
	width: 100.2%;
}

article.post-large {
	margin-left: 60px;
}

article.post-large h2 {
	margin-bottom: 5px;
}

article.post-large .post-image, article.post-large .post-date {
	margin-left: -60px;
}

article.post-large .post-image {
	margin-bottom: 25px;
}

article.post-large .post-image.single {
	margin-bottom: 30px;
}

article.post-large .post-video {
	margin-left: -60px;
}

article.post-large .post-audio {
	margin-left: -60px;
}

/* Single Post */
.single-post article {
	border-bottom: 0;
	margin-bottom: 0;
}

article.blog-single-post .post-meta {
	margin-bottom: 20px;
}

/* Post Block */
.post-block h3 {
	font-size: 1.8em;
	font-weight: 200;
	margin: 0 0 20px;
	text-transform: none;
}

.post-block h3 i {
	margin-right: 7px;
}

/* Post Author */
.post-author img {
	max-height: 80px;
	max-width: 80px;
}

.post-author p {
	font-size: 0.9em;
	line-height: 22px;
	margin: 0;
	padding: 0;
}

.post-author p .name {
	font-size: 1.1em;
}

.post-author .img-thumbnail {
	display: inline-block;
	float: left;
	margin-right: 20px;
}

/* Post Comments */
ul.comments {
	list-style: none;
	margin: 0;
	padding: 0;
}

ul.comments li {
	clear: both;
	padding: 10px 0 0 70px;
}

ul.comments li img.avatar {
	height: 48px;
	width: 48px;
}

ul.comments li ul.reply {
	margin: 0;
}

ul.comments li a {
	text-decoration: none;
}

ul.comments li .img-thumbnail {
	margin-left: -70px;
	position: absolute;
}

ul.comments li .comment {
	margin-bottom: 10px;
}

ul.comments .comment-arrow {
	border-bottom: 12px solid transparent;
	border-right: 12px solid #f7f7f7;
	border-top: 12px solid transparent;
	height: 0;
	left: -12px;
	position: absolute;
	top: 12px;
	width: 0;
}

ul.comments .comment-block {
	background: #f7f7f7;
	border-radius: 5px;
	padding: 20px 20px 30px;
	position: relative;
}

ul.comments .comment-block p {
	font-size: 0.9em;
	line-height: 21px;
	margin: 0;
	padding: 0;
}

ul.comments .comment-block .comment-by {
	display: block;
	font-size: 1em;
	line-height: 21px;
	margin: 0;
	padding: 0 0 5px 0;
}

ul.comments .comment-block .date {
	color: #999;
	font-size: 0.9em;
}

/* Leave a Comment */
.post-leave-comment h3 {
	margin: 0 0 40px;
}

/* Recent Posts */
.recent-posts h4 {
	margin-bottom: 7px;
}

.recent-posts article.recent-post h4 {
	margin: 0 0 3px 0;
}

.recent-posts article.recent-post h4 a {
	display: block;
}

.recent-posts .date {
	margin-right: 10px;
	text-align: center;
}

.recent-posts .date .month {
	background: #CCC;
	color: #FFF;
	font-size: 0.9em;
	padding: 3px 10px;
	position: relative;
	top: -2px;
}

.recent-posts .date .day {
	background: #F7F7F7;
	color: #CCC;
	display: block;
	font-size: 18px;
	font-weight: 500;
	font-weight: bold;
	padding: 8px;
}

section.section .recent-posts .date .day {
	background: #FFF;
}

/* Simple Post List */
ul.simple-post-list {
	list-style: none;
	margin: 0;
	padding: 0;
}

ul.simple-post-list li {
	border-bottom: 1px dotted #E2E2E2;
	padding: 15px 0;
}

ul.simple-post-list li::after {
	clear: both;
	content: "";
	display: block;
}

ul.simple-post-list li:last-child {
	border-bottom: 0;
}

ul.simple-post-list .post-image {
	float: left;
	margin-right: 12px;
}

ul.simple-post-list .post-meta {
	color: #888;
	font-size: 0.8em;
}

ul.simple-post-list .post-info {
	line-height: 20px;
}

/* Responsive */
@media (max-width: 575px) {
	ul.comments li {
		border-left: 8px solid rgba(0, 0, 0, 0.06);
		clear: both;
		padding: 0 0 0 10px;
	}

	ul.comments li .img-thumbnail {
		display: none;
	}

	ul.comments .comment-arrow {
		display: none;
	}
}

/* Nav List */
ul.nav-list li {
	margin: 0;
	padding: 0;
	display: block;
	position: relative;
}

ul.nav-list li a {
	-webkit-transition: background 0.1s;
	transition: background 0.1s;
	border-bottom: 1px solid rgba(0, 0, 0, 0.06);
	padding: 8px 0 8px 22px;
	display: block;
	color: #666;
	font-size: 0.9em;
	text-decoration: none;
	line-height: 20px;
}

ul.nav-list li a:before {
	font-family: 'FontAwesome';
	content: "\f054";
	font-weight: 900;
	position: absolute;
	top: 8px;
	font-size: 7.2px;
	font-size: 0.45rem;
	opacity: 0.7;
	-webkit-transform: translate3d(-1px, 0, 0);
	transform: translate3d(-1px, 0, 0);
	left: 12px;
}

ul.nav-list li a:hover {
	text-decoration: none;
}

ul.nav-list li a:hover:before,
ul.nav-list li a:hover i[class*="fa-chevron"] {
	-webkit-animation-name: arrowLeftRight;
	animation-name: arrowLeftRight;
	-webkit-animation-duration: 500ms;
	animation-duration: 500ms;
	-webkit-animation-iteration-count: infinite;
	animation-iteration-count: infinite;
}

ul.nav-list li a i[class*="fa-chevron"] {
	position: relative;
	top: -1px;
	font-size: 8px;
	font-size: 0.5rem;
	opacity: 0.8;
}

ul.nav-list li > a.active {
	font-weight: bold;
}

ul.nav-list li ul {
	list-style: none;
	margin: 0 0 0 25px;
	padding: 0;
}

ul.nav-list ul li:last-child a {
	border-bottom: 0;
}

ul.nav-list.hide-not-active li ul {
	display: none;
}

ul.nav-list.hide-not-active li.active ul {
	display: block;
}

ul.nav-list.show-bg-active .active > a,
ul.nav-list.show-bg-active a.active {
	background-color: #f5f5f5;
}

ul.nav-list.show-bg-active .active > a:hover,
ul.nav-list.show-bg-active a.active:hover {
	background-color: #eee;
}

ul.nav-list.no-arrows li a:before {
	content: none;
}

ul.nav-list-simple li {
	margin: 0;
	padding: 0;
	display: block;
	position: relative;
}

ul.nav-list-simple li a {
	-webkit-transition: background 0.1s;
	transition: background 0.1s;
	border-bottom: 1px solid rgba(0, 0, 0, 0.07);
	padding: 8px 0;
	display: block;
	color: #666;
	font-size: 0.9em;
	text-decoration: none;
	line-height: 20px;
	-webkit-transition: ease padding 300ms;
	transition: ease padding 300ms;
}

ul.nav-list-simple li > a.active {
	font-weight: bold;
}

ul.nav-list-simple li:hover a {
	padding-left: 4px;
}

ul.nav-list-simple li ul {
	list-style: none;
	margin: 0 0 0 25px;
	padding: 0;
}

ul.narrow li a {
	padding: 4px 0;
}

ul.nav-pills > li > a.active {
	color: #FFF;
	background-color: #CCC;
}

ul.nav-pills > li > a.active:hover, ul.nav-pills > li > a.active:focus {
	color: #FFF;
	background-color: #CCC;
}

/* Nav Pills */
.nav-pills-center {
	text-align: center;
}

.nav-pills-center > li {
	display: inline-block;
	float: none;
}

.nav-pills-sm > li > a {
	padding: 7px 12px;
}

.nav-pills-xs > li > a {
	padding: 5px 10px;
	font-size: 0.9em;
}

.nav-pills .nav-link.active {
	background-color: transparent;
}

.show > .nav-pills .nav-link {
	background-color: transparent;
}

 .blogsearch .buton {
     display: block;
     border: 0;
         border-left-color: currentcolor;
         border-left-style: none;
         border-left-width: 0px;
     padding: 0 15px;
     font-weight: normal;
     font-size: 14px;
     text-align: center;
     white-space: nowrap;
     color: #fff;
     line-height: 38px;
     position: absolute;
     top: 0;
     right: 0;
     height: 34px;
     color: #555;
     line-height: 34px;
     border-left: 1px solid #ccc;
 }
 .float-right {
     float: right !important;
 }
 .float-left {
     float: left !important;
 }

 .img-thumbnail-no-borders {
    display: inline-block;
    min-width: 100%;
    height: auto;
    padding: 4px;
    line-height: 1.42857143;
    background-color: #fff;
    border: 0px solid #ddd;
    border-radius: 4px;
    -webkit-transition: all .2s ease-in-out;
    -o-transition: all .2s ease-in-out;
    transition: all .2s ease-in-out;

}

.clear
{
	clear:both;
}
.eblog a
{
	color:#878787;
	transition: all 0.4s ease-in-out;
	-webkit-transition: all 0.4s ease-in-out;
	-moz-transition: all 0.4s ease-in-out;

}
.eblog a:hover
{
	color:#0db9f0;
	text-decoration:none;
}

/* blog */
.eblog
{
    padding: 30px 0;
	font-family: 'Montserrat', sans-serif;
	font-size:14px;
	color:#878787;
	line-height:26px;
	font-weight:500;
}

.latest_blog_wrapper .swiper-viewport {
    margin: 0;
    background: #0000;
    z-index: 1;
    border: 0;
    border-radius: 4px;
    box-shadow: none;
    width: 100%;
    position: relative;
    overflow: visible;
}
.blog_categories .search h4, .search.popular_posts h4, .latest_blog_wrapper h4, .search.tags h4 {
    color: #555566;
    margin: 0;
    padding: 0px;
    font-weight: 500;
    text-transform: uppercase;
	font-size: 18px;
	font-family: 'Montserrat', sans-serif;
}
.latest_blog_wrapper h4 {
    padding: 0px 0px 15px 0px;
}

.blog_categories h4:after, .search.popular_posts h4:after,  .latest_blog_wrapper h4:after, .search.tags h4:after {
    content: " ";
    display: block;
	background: #0db9f0;
    height: 2px;
    width:60px;
    margin: 12px 0 0;
}
#blogsearch
{
    padding-top: 12px;
}
#blogsearch input[type="text"]
{
    border-radius: 0;
    border: 1px solid #ddd;
    padding: 8px 15px;
    height: auto;
	outline: 0;
	font-size: 15px;
}
#blogsearch button[type="button"]
{
    border: 0;
    border-radius: 0;
    background: #0db9f0;
    color: #fff;
    padding:11px 15px;
	outline: 0;
}
.form-control:focus {
    outline: 0;
    -webkit-box-shadow: none;
    box-shadow: none;
}

#column-left .blog_categories .search
{
	padding-bottom:25px;
}
.eblog .blog_categories .search:last-child
{
	padding-bottom:0;
}
.blog_categories .search ul

{
    padding: 0;
    list-style: none;
    margin: 0;
	padding-top: 10px;
}
.blog_categories .search ul li
{
    padding-bottom: 5px;
}
.blog_categories .search ul li a
{
	color:#878787
}
.blog_categories .search ul li a i
{
    color: #0db9f0;
	margin-right: 5px;
}

.blog_categories .search ul li a:hover
{
	 color: #0db9f0;
}
.eblog .blog_categories .popular_posts_section
 {
    padding-top: 12px;
}
.popular_posts .popular_posts_images
{
    width: 30%;
    float: left;
}
.eblog .openthumbs img
{
    width: 100%;
}
.popular_posts .popular_posts_text
{
    display: inline-block;
    width: 66%;
    margin-left: 10px;
}
.popular_posts  .popular_posts_text h5 {
    font-size: 12px;
    line-height: normal;
    margin: 0;
    padding: 0 0 2px 0;
    text-transform: uppercase;
	font-weight: 600;
}

.popular_posts  .popular_posts_text span {
	margin: 2px 0 5px 0;
    font-size: 11px;
    padding: 0;
    line-height: normal;
    display: grid;
}
.popular_posts .popular_posts_section
{
    padding: 15px 0;
    border-bottom: 1px solid #ddd;
}
.popular_posts .popular_posts_section:last-child
{
    border-bottom: 0;
}
.search.tags ul li {
	padding-bottom: 5px;
    float: none;
    margin-right: 10px;
    display: inline-block;
}
.search.tags ul
{
    padding: 0;
    list-style: none;
    margin: 0;
	padding-top: 10px;
}
.search.tags ul li a
{
    color: #fff;
    background: #556;
    padding: 3px 8px;
	margin-bottom: 5px;
    display: inline-block;
}
.search.tags {
    padding-top: 25px;
	padding-bottom: 25px;
}

/* right section */

.eblog .update_post .update_post_text
{
    background: #f2f2f2;
    padding: 15px;
}

.eblog .update_post .update_post_text h3:after {
    content: " ";
    display: block;
	background: #0db9f0;
    height: 2px;
    width:80px;
    margin: 12px 0 0;
}
.eblog .update_post .update_post_text span a
{
    padding-top: 12px;
    display: inline-block;
    font-style: italic;
    font-weight: 600;
}

.eblog .update_post .update_post_text p {
    margin: 7px 0 10px;
    font-size: 14px;
    text-align: justify;

}
.eblog .update_post .blogcomments i
{
    color: #0db9f0;
}

.eblog .update_post a.base_button
{
    text-transform: uppercase;
    color: #0db9f0;
    font-weight: 600;
}
.eblog .update_post a.base_button:hover
{
    color: #000000;
}

.eblog .update_post
{
	padding-bottom:25px;
}
.eblog .update_post:last-child
{
	padding-bottom:0;
}



/* full page */

.eblog ul.fullblogcomments, .social_icons ul{
    margin-top: 0;
    margin-bottom: 10px;
    padding: 0;
    list-style: none;
}
.eblog ul.fullblogcomments li
{
    margin-right: 15px;
    display: inline-block;
    padding-top: 12px;
}

.social_icons
{
    position: fixed;
    top: 0;
    right: 0;
	bottom:0;
	height:127px;
	margin:auto;
}
.social_icons ul li a
{
    font-size: 28px;
}

.social_icons ul li.facebook i
{
	 color: #3b5998;
}
.social_icons ul li.twitter i
{
	 color: #1dcaff;
}
.social_icons ul li.google-plus i
{
	 color: #d34836;
}
.social_icons ul li.linkedin i
{
	 color: #0077b5;
}


.eblog .subimages .images_silde {
    padding: 0;
}

.eblog .subimages .images_silde img {
    width:100%;
}

.eblog .update_post h3, .eblog h1 {
    font-size: 18px;
    color: #555566;
    margin: 0;
    padding: 0px;
    font-weight: 500;
    text-transform: uppercase;
}
h3.mail_page_hadding
{
    font-size: 24px;
    text-transform: uppercase;
    padding: 15px 0 5px 0;
	margin:0;

}
.eblog .update_post h3{
	line-height: 30px;
    min-height: 74px;
}
.eblog h1
{
	font-size:28px;
	padding-bottom: 5px;
}
.update_post_text h3
{
	padding-top: 15px;
	font-size: 24px;
}
.eblog .update_post .img-responsive {
    display: block;
    max-width: 100%;
    height: auto;
    width: 100%;
}
.eblog .auther_des
{
    margin-bottom: 40px;
}
.eblog .auther_des img.auther_images
{
    border-radius: 100%;
    max-width: 200px;
    margin: auto;
}
.update_post .video-image
{
    position: relative;
    /*padding-bottom: 55.97%; */
    height: 100%;
    overflow: hidden;
    margin-bottom: -0.535%;
}
.update_post .video-image iframe
 {
    position: absolute;
    top: 0;
    left: 0;
    width: 100%;
    height: 100%;
}
.shear_social_media
{
    text-align: right;
    padding: 14px 0 0px;
}
.shear_social_media .addthis_default_style .at300b
{
	float:none;
	margin: 0;
}
.eblog .search.popular_posts
{
    margin-bottom: 30px;
}
/* responsive */

@media screen and (max-width: 1200px)
{
.popular_posts .popular_posts_text {
    width: 64%;
    margin-left: 10px;
}
.eblog .update_post h3 {
    line-height: 30px;
    min-height: 104px;
}
.eblog {
    padding: 30px 10px;
}
}


@media screen and (max-width: 992px)
{
.popular_posts .popular_posts_text {
    width: 61%;
    margin-left: 10px;
}
.blog_categories .search h4, .search.popular_posts h4, .latest_blog_wrapper h4, .search.tags h4 {
    font-size: 15px;
}
.eblog .update_post h3 {
    line-height: 26px;
    font-size: 17px;
	min-height: auto;
}
.eblog .update_post a.base_button {
    font-size: 12px;
}
.eblog .update_post .update_post_text span a {
    font-size: 11px;
}
}

@media screen and (max-width: 768px)
{
	.eblog {
    padding: 30px 15px;
}
}


.productdeals .product-thumb .caption {
    min-height:315px;

}

.auction.products-col {
    width: 100%;
    padding-left: 10px;
    padding-right: 10px;
}

.productdeals .product .banner {
    background: #b70505;
    position: relative;
    overflow: hidden;
    margin-bottom: 35px;

  }
.productdeals .product .banner:hover {
    background: #000;
    position: relative;
    overflow: hidden;

  }


.productdeals .product .banner .footer-deals {
  color: white;
  text-align: center;

}

.productdeals .product .banner .list-inline {
  padding: 0 0 0 0 !important;
  height: 2.5em;
}

.item-countdown li {
  margin: 0;
  padding: 10px 0;
  position: relative;
  width: 40px;
  display: inline-block;
  font-weight: 900;
  cursor: pointer;
}

.productdeals img.img-responsive.aukce {
    background-color: white;
}

@media (max-width: 767px){
.productdeals .product .banner {
    max-width: 270px;
    margin-right: auto;
    margin-left: auto;
}
}
/* Countdown */
.productdeals .timeleft {
    background-color: #3b5871;
    background-image: linear-gradient(to bottom, #3b5871, #0A263D);
    background-image: -webkit-linear-gradient(to bottom, #3b5871, #0A263D);
    background-image:    -moz-linear-gradient(to bottom, #3b5871, #0A263D);
    background-image:     -ms-linear-gradient(to bottom, #3b5871, #0A263D);
    background-image:      -o-linear-gradient(to bottom, #3b5871, #0A263D);
    min-height: 40px;
    border-radius: 5px 5px 0px 0px;
    -webkit-border-radius: 5px 5px 0px 0px;
    -moz-border-radius: 5px 5px 0px 0px;
    text-align: center;
}
.productdeals .timeleft h3{
    color: #FFFFFF!important;
    padding:0;
    margin:0;
    line-height:40px;
    font-family: verdana,arial;
    font-size: 19px;
    font-weight: normal;
}



/* .productdeals .item-countdown ul li{display: inline-table; line-height: inherit!important; } */
.productdeals .item-countdown ul li.first{}
.productdeals .item-countdown ul li.last{ margin: 0px;}
/*.productdeals .item-countdown ul li div{text-transform: uppercase; clear: both;text-align:center;width:100%;font-size:10px;}
.productdeals .item-countdown ul li div.countdown_num{font-size: 18px; color: #fff; margin: 0px 0px 3px 0px;}
/*.productdeals .item-countdown ul li div.countdown_num span{background: #000; padding: 1px 3px; border-radius: 5px; -webkit-border-radius: 5px; -moz-border-radius: 5px; margin: 0px 1px;}


.productdeals .timeleft{background-color: #6B9E1B; background-image: linear-gradient(to bottom, #7aa832, #4b6f13);}
.productdeals .item-countdown ul li div.countdown_num span{background: #6B9E1B;} */
.productdeals .item-countdown ul li div.countdown_num span.mw_dld_detail_num{color: #CC3333}

@charset "UTF-8";

/*!
Animate.css - http://daneden.me/animate
Licensed under the MIT license - http://opensource.org/licenses/MIT

Copyright (c) 2015 Daniel Eden
*/

.animated {
  -webkit-animation-duration: 1s;
  animation-duration: 1s;
  -webkit-animation-fill-mode: both;
  animation-fill-mode: both;
}

.animated.infinite {
  -webkit-animation-iteration-count: infinite;
  animation-iteration-count: infinite;
}

.animated.hinge {
  -webkit-animation-duration: 2s;
  animation-duration: 2s;
}

.animated.bounceIn,
.animated.bounceOut {
  -webkit-animation-duration: .75s;
  animation-duration: .75s;
}

.animated.flipOutX,
.animated.flipOutY {
  -webkit-animation-duration: .75s;
  animation-duration: .75s;
}

@-webkit-keyframes bounce {
  0%, 20%, 53%, 80%, 100% {
    -webkit-animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000);
    animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000);
    -webkit-transform: translate3d(0,0,0);
    transform: translate3d(0,0,0);
  }

  40%, 43% {
    -webkit-animation-timing-function: cubic-bezier(0.755, 0.050, 0.855, 0.060);
    animation-timing-function: cubic-bezier(0.755, 0.050, 0.855, 0.060);
    -webkit-transform: translate3d(0, -30px, 0);
    transform: translate3d(0, -30px, 0);
  }

  70% {
    -webkit-animation-timing-function: cubic-bezier(0.755, 0.050, 0.855, 0.060);
    animation-timing-function: cubic-bezier(0.755, 0.050, 0.855, 0.060);
    -webkit-transform: translate3d(0, -15px, 0);
    transform: translate3d(0, -15px, 0);
  }

  90% {
    -webkit-transform: translate3d(0,-4px,0);
    transform: translate3d(0,-4px,0);
  }
}

@keyframes bounce {
  0%, 20%, 53%, 80%, 100% {
    -webkit-animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000);
    animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000);
    -webkit-transform: translate3d(0,0,0);
    transform: translate3d(0,0,0);
  }

  40%, 43% {
    -webkit-animation-timing-function: cubic-bezier(0.755, 0.050, 0.855, 0.060);
    animation-timing-function: cubic-bezier(0.755, 0.050, 0.855, 0.060);
    -webkit-transform: translate3d(0, -30px, 0);
    transform: translate3d(0, -30px, 0);
  }

  70% {
    -webkit-animation-timing-function: cubic-bezier(0.755, 0.050, 0.855, 0.060);
    animation-timing-function: cubic-bezier(0.755, 0.050, 0.855, 0.060);
    -webkit-transform: translate3d(0, -15px, 0);
    transform: translate3d(0, -15px, 0);
  }

  90% {
    -webkit-transform: translate3d(0,-4px,0);
    transform: translate3d(0,-4px,0);
  }
}

.bounce {
  -webkit-animation-name: bounce;
  animation-name: bounce;
  -webkit-transform-origin: center bottom;
  transform-origin: center bottom;
}

@-webkit-keyframes flash {
  0%, 50%, 100% {
    opacity: 1;
  }

  25%, 75% {
    opacity: 0;
  }
}

@keyframes flash {
  0%, 50%, 100% {
    opacity: 1;
  }

  25%, 75% {
    opacity: 0;
  }
}

.flash {
  -webkit-animation-name: flash;
  animation-name: flash;
}

/* originally authored by Nick Pettit - https://github.com/nickpettit/glide */

@-webkit-keyframes pulse {
  0% {
    -webkit-transform: scale3d(1, 1, 1);
    transform: scale3d(1, 1, 1);
  }

  50% {
    -webkit-transform: scale3d(1.05, 1.05, 1.05);
    transform: scale3d(1.05, 1.05, 1.05);
  }

  100% {
    -webkit-transform: scale3d(1, 1, 1);
    transform: scale3d(1, 1, 1);
  }
}

@keyframes pulse {
  0% {
    -webkit-transform: scale3d(1, 1, 1);
    transform: scale3d(1, 1, 1);
  }

  50% {
    -webkit-transform: scale3d(1.05, 1.05, 1.05);
    transform: scale3d(1.05, 1.05, 1.05);
  }

  100% {
    -webkit-transform: scale3d(1, 1, 1);
    transform: scale3d(1, 1, 1);
  }
}

.pulse {
  -webkit-animation-name: pulse;
  animation-name: pulse;
}

@-webkit-keyframes rubberBand {
  0% {
    -webkit-transform: scale3d(1, 1, 1);
    transform: scale3d(1, 1, 1);
  }

  30% {
    -webkit-transform: scale3d(1.25, 0.75, 1);
    transform: scale3d(1.25, 0.75, 1);
  }

  40% {
    -webkit-transform: scale3d(0.75, 1.25, 1);
    transform: scale3d(0.75, 1.25, 1);
  }

  50% {
    -webkit-transform: scale3d(1.15, 0.85, 1);
    transform: scale3d(1.15, 0.85, 1);
  }

  65% {
    -webkit-transform: scale3d(.95, 1.05, 1);
    transform: scale3d(.95, 1.05, 1);
  }

  75% {
    -webkit-transform: scale3d(1.05, .95, 1);
    transform: scale3d(1.05, .95, 1);
  }

  100% {
    -webkit-transform: scale3d(1, 1, 1);
    transform: scale3d(1, 1, 1);
  }
}

@keyframes rubberBand {
  0% {
    -webkit-transform: scale3d(1, 1, 1);
    transform: scale3d(1, 1, 1);
  }

  30% {
    -webkit-transform: scale3d(1.25, 0.75, 1);
    transform: scale3d(1.25, 0.75, 1);
  }

  40% {
    -webkit-transform: scale3d(0.75, 1.25, 1);
    transform: scale3d(0.75, 1.25, 1);
  }

  50% {
    -webkit-transform: scale3d(1.15, 0.85, 1);
    transform: scale3d(1.15, 0.85, 1);
  }

  65% {
    -webkit-transform: scale3d(.95, 1.05, 1);
    transform: scale3d(.95, 1.05, 1);
  }

  75% {
    -webkit-transform: scale3d(1.05, .95, 1);
    transform: scale3d(1.05, .95, 1);
  }

  100% {
    -webkit-transform: scale3d(1, 1, 1);
    transform: scale3d(1, 1, 1);
  }
}

.rubberBand {
  -webkit-animation-name: rubberBand;
  animation-name: rubberBand;
}

@-webkit-keyframes shake {
  0%, 100% {
    -webkit-transform: translate3d(0, 0, 0);
    transform: translate3d(0, 0, 0);
  }

  10%, 30%, 50%, 70%, 90% {
    -webkit-transform: translate3d(-10px, 0, 0);
    transform: translate3d(-10px, 0, 0);
  }

  20%, 40%, 60%, 80% {
    -webkit-transform: translate3d(10px, 0, 0);
    transform: translate3d(10px, 0, 0);
  }
}

@keyframes shake {
  0%, 100% {
    -webkit-transform: translate3d(0, 0, 0);
    transform: translate3d(0, 0, 0);
  }

  10%, 30%, 50%, 70%, 90% {
    -webkit-transform: translate3d(-10px, 0, 0);
    transform: translate3d(-10px, 0, 0);
  }

  20%, 40%, 60%, 80% {
    -webkit-transform: translate3d(10px, 0, 0);
    transform: translate3d(10px, 0, 0);
  }
}

.shake {
  -webkit-animation-name: shake;
  animation-name: shake;
}

@-webkit-keyframes swing {
  20% {
    -webkit-transform: rotate3d(0, 0, 1, 15deg);
    transform: rotate3d(0, 0, 1, 15deg);
  }

  40% {
    -webkit-transform: rotate3d(0, 0, 1, -10deg);
    transform: rotate3d(0, 0, 1, -10deg);
  }

  60% {
    -webkit-transform: rotate3d(0, 0, 1, 5deg);
    transform: rotate3d(0, 0, 1, 5deg);
  }

  80% {
    -webkit-transform: rotate3d(0, 0, 1, -5deg);
    transform: rotate3d(0, 0, 1, -5deg);
  }

  100% {
    -webkit-transform: rotate3d(0, 0, 1, 0deg);
    transform: rotate3d(0, 0, 1, 0deg);
  }
}

@keyframes swing {
  20% {
    -webkit-transform: rotate3d(0, 0, 1, 15deg);
    transform: rotate3d(0, 0, 1, 15deg);
  }

  40% {
    -webkit-transform: rotate3d(0, 0, 1, -10deg);
    transform: rotate3d(0, 0, 1, -10deg);
  }

  60% {
    -webkit-transform: rotate3d(0, 0, 1, 5deg);
    transform: rotate3d(0, 0, 1, 5deg);
  }

  80% {
    -webkit-transform: rotate3d(0, 0, 1, -5deg);
    transform: rotate3d(0, 0, 1, -5deg);
  }

  100% {
    -webkit-transform: rotate3d(0, 0, 1, 0deg);
    transform: rotate3d(0, 0, 1, 0deg);
  }
}

.swing {
  -webkit-transform-origin: top center;
  transform-origin: top center;
  -webkit-animation-name: swing;
  animation-name: swing;
}

@-webkit-keyframes tada {
  0% {
    -webkit-transform: scale3d(1, 1, 1);
    transform: scale3d(1, 1, 1);
  }

  10%, 20% {
    -webkit-transform: scale3d(.9, .9, .9) rotate3d(0, 0, 1, -3deg);
    transform: scale3d(.9, .9, .9) rotate3d(0, 0, 1, -3deg);
  }

  30%, 50%, 70%, 90% {
    -webkit-transform: scale3d(1.1, 1.1, 1.1) rotate3d(0, 0, 1, 3deg);
    transform: scale3d(1.1, 1.1, 1.1) rotate3d(0, 0, 1, 3deg);
  }

  40%, 60%, 80% {
    -webkit-transform: scale3d(1.1, 1.1, 1.1) rotate3d(0, 0, 1, -3deg);
    transform: scale3d(1.1, 1.1, 1.1) rotate3d(0, 0, 1, -3deg);
  }

  100% {
    -webkit-transform: scale3d(1, 1, 1);
    transform: scale3d(1, 1, 1);
  }
}

@keyframes tada {
  0% {
    -webkit-transform: scale3d(1, 1, 1);
    transform: scale3d(1, 1, 1);
  }

  10%, 20% {
    -webkit-transform: scale3d(.9, .9, .9) rotate3d(0, 0, 1, -3deg);
    transform: scale3d(.9, .9, .9) rotate3d(0, 0, 1, -3deg);
  }

  30%, 50%, 70%, 90% {
    -webkit-transform: scale3d(1.1, 1.1, 1.1) rotate3d(0, 0, 1, 3deg);
    transform: scale3d(1.1, 1.1, 1.1) rotate3d(0, 0, 1, 3deg);
  }

  40%, 60%, 80% {
    -webkit-transform: scale3d(1.1, 1.1, 1.1) rotate3d(0, 0, 1, -3deg);
    transform: scale3d(1.1, 1.1, 1.1) rotate3d(0, 0, 1, -3deg);
  }

  100% {
    -webkit-transform: scale3d(1, 1, 1);
    transform: scale3d(1, 1, 1);
  }
}

.tada {
  -webkit-animation-name: tada;
  animation-name: tada;
}

/* originally authored by Nick Pettit - https://github.com/nickpettit/glide */

@-webkit-keyframes wobble {
  0% {
    -webkit-transform: none;
    transform: none;
  }

  15% {
    -webkit-transform: translate3d(-25%, 0, 0) rotate3d(0, 0, 1, -5deg);
    transform: translate3d(-25%, 0, 0) rotate3d(0, 0, 1, -5deg);
  }

  30% {
    -webkit-transform: translate3d(20%, 0, 0) rotate3d(0, 0, 1, 3deg);
    transform: translate3d(20%, 0, 0) rotate3d(0, 0, 1, 3deg);
  }

  45% {
    -webkit-transform: translate3d(-15%, 0, 0) rotate3d(0, 0, 1, -3deg);
    transform: translate3d(-15%, 0, 0) rotate3d(0, 0, 1, -3deg);
  }

  60% {
    -webkit-transform: translate3d(10%, 0, 0) rotate3d(0, 0, 1, 2deg);
    transform: translate3d(10%, 0, 0) rotate3d(0, 0, 1, 2deg);
  }

  75% {
    -webkit-transform: translate3d(-5%, 0, 0) rotate3d(0, 0, 1, -1deg);
    transform: translate3d(-5%, 0, 0) rotate3d(0, 0, 1, -1deg);
  }

  100% {
    -webkit-transform: none;
    transform: none;
  }
}

@keyframes wobble {
  0% {
    -webkit-transform: none;
    transform: none;
  }

  15% {
    -webkit-transform: translate3d(-25%, 0, 0) rotate3d(0, 0, 1, -5deg);
    transform: translate3d(-25%, 0, 0) rotate3d(0, 0, 1, -5deg);
  }

  30% {
    -webkit-transform: translate3d(20%, 0, 0) rotate3d(0, 0, 1, 3deg);
    transform: translate3d(20%, 0, 0) rotate3d(0, 0, 1, 3deg);
  }

  45% {
    -webkit-transform: translate3d(-15%, 0, 0) rotate3d(0, 0, 1, -3deg);
    transform: translate3d(-15%, 0, 0) rotate3d(0, 0, 1, -3deg);
  }

  60% {
    -webkit-transform: translate3d(10%, 0, 0) rotate3d(0, 0, 1, 2deg);
    transform: translate3d(10%, 0, 0) rotate3d(0, 0, 1, 2deg);
  }

  75% {
    -webkit-transform: translate3d(-5%, 0, 0) rotate3d(0, 0, 1, -1deg);
    transform: translate3d(-5%, 0, 0) rotate3d(0, 0, 1, -1deg);
  }

  100% {
    -webkit-transform: none;
    transform: none;
  }
}

.wobble {
  -webkit-animation-name: wobble;
  animation-name: wobble;
}

@-webkit-keyframes jello {
  11.1% {
    -webkit-transform: none;
            transform: none
  }

  22.2% {
    -webkit-transform: skewX(-12.5deg) skewY(-12.5deg);
            transform: skewX(-12.5deg) skewY(-12.5deg)
  }
  33.3% {
    -webkit-transform: skewX(6.25deg) skewY(6.25deg);
            transform: skewX(6.25deg) skewY(6.25deg)
  }
  44.4% {
    -webkit-transform: skewX(-3.125deg) skewY(-3.125deg);
            transform: skewX(-3.125deg) skewY(-3.125deg)
  }
  55.5% {
    -webkit-transform: skewX(1.5625deg) skewY(1.5625deg);
            transform: skewX(1.5625deg) skewY(1.5625deg)
  }
  66.6% {
    -webkit-transform: skewX(-0.78125deg) skewY(-0.78125deg);
            transform: skewX(-0.78125deg) skewY(-0.78125deg)
  }
  77.7% {
    -webkit-transform: skewX(0.390625deg) skewY(0.390625deg);
            transform: skewX(0.390625deg) skewY(0.390625deg)
  }
  88.8% {
    -webkit-transform: skewX(-0.1953125deg) skewY(-0.1953125deg);
            transform: skewX(-0.1953125deg) skewY(-0.1953125deg)
  }
  100% {
    -webkit-transform: none;
            transform: none
  }
}

@keyframes jello {
  11.1% {
    -webkit-transform: none;
            transform: none
  }

  22.2% {

    -webkit-transform: skewX(-12.5deg) skewY(-12.5deg);
            transform: skewX(-12.5deg) skewY(-12.5deg)
  }
  33.3% {
    -webkit-transform: skewX(6.25deg) skewY(6.25deg);
            transform: skewX(6.25deg) skewY(6.25deg)
  }
  44.4% {
    -webkit-transform: skewX(-3.125deg) skewY(-3.125deg);
            transform: skewX(-3.125deg) skewY(-3.125deg)
  }
  55.5% {
    -webkit-transform: skewX(1.5625deg) skewY(1.5625deg);
            transform: skewX(1.5625deg) skewY(1.5625deg)
  }
  66.6% {
    -webkit-transform: skewX(-0.78125deg) skewY(-0.78125deg);
            transform: skewX(-0.78125deg) skewY(-0.78125deg)
  }
  77.7% {
    -webkit-transform: skewX(0.390625deg) skewY(0.390625deg);
            transform: skewX(0.390625deg) skewY(0.390625deg)
  }
  88.8% {
    -webkit-transform: skewX(-0.1953125deg) skewY(-0.1953125deg);
            transform: skewX(-0.1953125deg) skewY(-0.1953125deg)
  }
  100% {
    -webkit-transform: none;
            transform: none
  }
}



.jello{
    -webkit-animation-name:jello;
            animation-name:jello;
    -webkit-transform-origin: center;

            transform-origin: center
}

@-webkit-keyframes bounceIn {
  0%, 20%, 40%, 60%, 80%, 100% {
    -webkit-animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000);
    animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000);
  }

  0% {
    opacity: 0;
    -webkit-transform: scale3d(.3, .3, .3);
    transform: scale3d(.3, .3, .3);
  }

  20% {
    -webkit-transform: scale3d(1.1, 1.1, 1.1);
    transform: scale3d(1.1, 1.1, 1.1);
  }

  40% {
    -webkit-transform: scale3d(.9, .9, .9);
    transform: scale3d(.9, .9, .9);
  }

  60% {
    opacity: 1;
    -webkit-transform: scale3d(1.03, 1.03, 1.03);
    transform: scale3d(1.03, 1.03, 1.03);
  }

  80% {
    -webkit-transform: scale3d(.97, .97, .97);
    transform: scale3d(.97, .97, .97);
  }

  100% {
    opacity: 1;
    -webkit-transform: scale3d(1, 1, 1);
    transform: scale3d(1, 1, 1);
  }
}

@keyframes bounceIn {
  0%, 20%, 40%, 60%, 80%, 100% {
    -webkit-animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000);
    animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000);
  }

  0% {
    opacity: 0;
    -webkit-transform: scale3d(.3, .3, .3);
    transform: scale3d(.3, .3, .3);
  }

  20% {
    -webkit-transform: scale3d(1.1, 1.1, 1.1);
    transform: scale3d(1.1, 1.1, 1.1);
  }

  40% {
    -webkit-transform: scale3d(.9, .9, .9);
    transform: scale3d(.9, .9, .9);
  }

  60% {
    opacity: 1;
    -webkit-transform: scale3d(1.03, 1.03, 1.03);
    transform: scale3d(1.03, 1.03, 1.03);
  }

  80% {
    -webkit-transform: scale3d(.97, .97, .97);
    transform: scale3d(.97, .97, .97);
  }

  100% {
    opacity: 1;
    -webkit-transform: scale3d(1, 1, 1);
    transform: scale3d(1, 1, 1);
  }
}

.bounceIn {
  -webkit-animation-name: bounceIn;
  animation-name: bounceIn;
}

@-webkit-keyframes bounceInDown {
  0%, 60%, 75%, 90%, 100% {
    -webkit-animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000);
    animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000);
  }

  0% {
    opacity: 0;
    -webkit-transform: translate3d(0, -3000px, 0);
    transform: translate3d(0, -3000px, 0);
  }

  60% {
    opacity: 1;
    -webkit-transform: translate3d(0, 25px, 0);
    transform: translate3d(0, 25px, 0);
  }

  75% {
    -webkit-transform: translate3d(0, -10px, 0);
    transform: translate3d(0, -10px, 0);
  }

  90% {
    -webkit-transform: translate3d(0, 5px, 0);
    transform: translate3d(0, 5px, 0);
  }

  100% {
    -webkit-transform: none;
    transform: none;
  }
}

@keyframes bounceInDown {
  0%, 60%, 75%, 90%, 100% {
    -webkit-animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000);
    animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000);
  }

  0% {
    opacity: 0;
    -webkit-transform: translate3d(0, -3000px, 0);
    transform: translate3d(0, -3000px, 0);
  }

  60% {
    opacity: 1;
    -webkit-transform: translate3d(0, 25px, 0);
    transform: translate3d(0, 25px, 0);
  }

  75% {
    -webkit-transform: translate3d(0, -10px, 0);
    transform: translate3d(0, -10px, 0);
  }

  90% {
    -webkit-transform: translate3d(0, 5px, 0);
    transform: translate3d(0, 5px, 0);
  }

  100% {
    -webkit-transform: none;
    transform: none;
  }
}

.bounceInDown {
  -webkit-animation-name: bounceInDown;
  animation-name: bounceInDown;
}

@-webkit-keyframes bounceInLeft {
  0%, 60%, 75%, 90%, 100% {
    -webkit-animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000);
    animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000);
  }

  0% {
    opacity: 0;
    -webkit-transform: translate3d(-3000px, 0, 0);
    transform: translate3d(-3000px, 0, 0);
  }

  60% {
    opacity: 1;
    -webkit-transform: translate3d(25px, 0, 0);
    transform: translate3d(25px, 0, 0);
  }

  75% {
    -webkit-transform: translate3d(-10px, 0, 0);
    transform: translate3d(-10px, 0, 0);
  }

  90% {
    -webkit-transform: translate3d(5px, 0, 0);
    transform: translate3d(5px, 0, 0);
  }

  100% {
    -webkit-transform: none;
    transform: none;
  }
}

@keyframes bounceInLeft {
  0%, 60%, 75%, 90%, 100% {
    -webkit-animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000);
    animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000);
  }

  0% {
    opacity: 0;
    -webkit-transform: translate3d(-3000px, 0, 0);
    transform: translate3d(-3000px, 0, 0);
  }

  60% {
    opacity: 1;
    -webkit-transform: translate3d(25px, 0, 0);
    transform: translate3d(25px, 0, 0);
  }

  75% {
    -webkit-transform: translate3d(-10px, 0, 0);
    transform: translate3d(-10px, 0, 0);
  }

  90% {
    -webkit-transform: translate3d(5px, 0, 0);
    transform: translate3d(5px, 0, 0);
  }

  100% {
    -webkit-transform: none;
    transform: none;
  }
}

.bounceInLeft {
  -webkit-animation-name: bounceInLeft;
  animation-name: bounceInLeft;
}

@-webkit-keyframes bounceInRight {
  0%, 60%, 75%, 90%, 100% {
    -webkit-animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000);
    animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000);
  }

  0% {
    opacity: 0;
    -webkit-transform: translate3d(3000px, 0, 0);
    transform: translate3d(3000px, 0, 0);
  }

  60% {
    opacity: 1;
    -webkit-transform: translate3d(-25px, 0, 0);
    transform: translate3d(-25px, 0, 0);
  }

  75% {
    -webkit-transform: translate3d(10px, 0, 0);
    transform: translate3d(10px, 0, 0);
  }

  90% {
    -webkit-transform: translate3d(-5px, 0, 0);
    transform: translate3d(-5px, 0, 0);
  }

  100% {
    -webkit-transform: none;
    transform: none;
  }
}

@keyframes bounceInRight {
  0%, 60%, 75%, 90%, 100% {
    -webkit-animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000);
    animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000);
  }

  0% {
    opacity: 0;
    -webkit-transform: translate3d(3000px, 0, 0);
    transform: translate3d(3000px, 0, 0);
  }

  60% {
    opacity: 1;
    -webkit-transform: translate3d(-25px, 0, 0);
    transform: translate3d(-25px, 0, 0);
  }

  75% {
    -webkit-transform: translate3d(10px, 0, 0);
    transform: translate3d(10px, 0, 0);
  }

  90% {
    -webkit-transform: translate3d(-5px, 0, 0);
    transform: translate3d(-5px, 0, 0);
  }

  100% {
    -webkit-transform: none;
    transform: none;
  }
}

.bounceInRight {
  -webkit-animation-name: bounceInRight;
  animation-name: bounceInRight;
}

@-webkit-keyframes bounceInUp {
  0%, 60%, 75%, 90%, 100% {
    -webkit-animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000);
    animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000);
  }

  0% {
    opacity: 0;
    -webkit-transform: translate3d(0, 3000px, 0);
    transform: translate3d(0, 3000px, 0);
  }

  60% {
    opacity: 1;
    -webkit-transform: translate3d(0, -20px, 0);
    transform: translate3d(0, -20px, 0);
  }

  75% {
    -webkit-transform: translate3d(0, 10px, 0);
    transform: translate3d(0, 10px, 0);
  }

  90% {
    -webkit-transform: translate3d(0, -5px, 0);
    transform: translate3d(0, -5px, 0);
  }

  100% {
    -webkit-transform: translate3d(0, 0, 0);
    transform: translate3d(0, 0, 0);
  }
}

@keyframes bounceInUp {
  0%, 60%, 75%, 90%, 100% {
    -webkit-animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000);
    animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000);
  }

  0% {
    opacity: 0;
    -webkit-transform: translate3d(0, 3000px, 0);
    transform: translate3d(0, 3000px, 0);
  }

  60% {
    opacity: 1;
    -webkit-transform: translate3d(0, -20px, 0);
    transform: translate3d(0, -20px, 0);
  }

  75% {
    -webkit-transform: translate3d(0, 10px, 0);
    transform: translate3d(0, 10px, 0);
  }

  90% {
    -webkit-transform: translate3d(0, -5px, 0);
    transform: translate3d(0, -5px, 0);
  }

  100% {
    -webkit-transform: translate3d(0, 0, 0);
    transform: translate3d(0, 0, 0);
  }
}

.bounceInUp {
  -webkit-animation-name: bounceInUp;
  animation-name: bounceInUp;
}

@-webkit-keyframes bounceOut {
  20% {
    -webkit-transform: scale3d(.9, .9, .9);
    transform: scale3d(.9, .9, .9);
  }

  50%, 55% {
    opacity: 1;
    -webkit-transform: scale3d(1.1, 1.1, 1.1);
    transform: scale3d(1.1, 1.1, 1.1);
  }

  100% {
    opacity: 0;
    -webkit-transform: scale3d(.3, .3, .3);
    transform: scale3d(.3, .3, .3);
  }
}

@keyframes bounceOut {
  20% {
    -webkit-transform: scale3d(.9, .9, .9);
    transform: scale3d(.9, .9, .9);
  }

  50%, 55% {
    opacity: 1;
    -webkit-transform: scale3d(1.1, 1.1, 1.1);
    transform: scale3d(1.1, 1.1, 1.1);
  }

  100% {
    opacity: 0;
    -webkit-transform: scale3d(.3, .3, .3);
    transform: scale3d(.3, .3, .3);
  }
}

.bounceOut {
  -webkit-animation-name: bounceOut;
  animation-name: bounceOut;
}

@-webkit-keyframes bounceOutDown {
  20% {
    -webkit-transform: translate3d(0, 10px, 0);
    transform: translate3d(0, 10px, 0);
  }

  40%, 45% {
    opacity: 1;
    -webkit-transform: translate3d(0, -20px, 0);
    transform: translate3d(0, -20px, 0);
  }

  100% {
    opacity: 0;
    -webkit-transform: translate3d(0, 2000px, 0);
    transform: translate3d(0, 2000px, 0);
  }
}

@keyframes bounceOutDown {
  20% {
    -webkit-transform: translate3d(0, 10px, 0);
    transform: translate3d(0, 10px, 0);
  }

  40%, 45% {
    opacity: 1;
    -webkit-transform: translate3d(0, -20px, 0);
    transform: translate3d(0, -20px, 0);
  }

  100% {
    opacity: 0;
    -webkit-transform: translate3d(0, 2000px, 0);
    transform: translate3d(0, 2000px, 0);
  }
}

.bounceOutDown {
  -webkit-animation-name: bounceOutDown;
  animation-name: bounceOutDown;
}

@-webkit-keyframes bounceOutLeft {
  20% {
    opacity: 1;
    -webkit-transform: translate3d(20px, 0, 0);
    transform: translate3d(20px, 0, 0);
  }

  100% {
    opacity: 0;
    -webkit-transform: translate3d(-2000px, 0, 0);
    transform: translate3d(-2000px, 0, 0);
  }
}

@keyframes bounceOutLeft {
  20% {
    opacity: 1;
    -webkit-transform: translate3d(20px, 0, 0);
    transform: translate3d(20px, 0, 0);
  }

  100% {
    opacity: 0;
    -webkit-transform: translate3d(-2000px, 0, 0);
    transform: translate3d(-2000px, 0, 0);
  }
}

.bounceOutLeft {
  -webkit-animation-name: bounceOutLeft;
  animation-name: bounceOutLeft;
}

@-webkit-keyframes bounceOutRight {
  20% {
    opacity: 1;
    -webkit-transform: translate3d(-20px, 0, 0);
    transform: translate3d(-20px, 0, 0);
  }

  100% {
    opacity: 0;
    -webkit-transform: translate3d(2000px, 0, 0);
    transform: translate3d(2000px, 0, 0);
  }
}

@keyframes bounceOutRight {
  20% {
    opacity: 1;
    -webkit-transform: translate3d(-20px, 0, 0);
    transform: translate3d(-20px, 0, 0);
  }

  100% {
    opacity: 0;
    -webkit-transform: translate3d(2000px, 0, 0);
    transform: translate3d(2000px, 0, 0);
  }
}

.bounceOutRight {
  -webkit-animation-name: bounceOutRight;
  animation-name: bounceOutRight;
}

@-webkit-keyframes bounceOutUp {
  20% {
    -webkit-transform: translate3d(0, -10px, 0);
    transform: translate3d(0, -10px, 0);
  }

  40%, 45% {
    opacity: 1;
    -webkit-transform: translate3d(0, 20px, 0);
    transform: translate3d(0, 20px, 0);
  }

  100% {
    opacity: 0;
    -webkit-transform: translate3d(0, -2000px, 0);
    transform: translate3d(0, -2000px, 0);
  }
}

@keyframes bounceOutUp {
  20% {
    -webkit-transform: translate3d(0, -10px, 0);
    transform: translate3d(0, -10px, 0);
  }

  40%, 45% {
    opacity: 1;
    -webkit-transform: translate3d(0, 20px, 0);
    transform: translate3d(0, 20px, 0);
  }

  100% {
    opacity: 0;
    -webkit-transform: translate3d(0, -2000px, 0);
    transform: translate3d(0, -2000px, 0);
  }
}

.bounceOutUp {
  -webkit-animation-name: bounceOutUp;
  animation-name: bounceOutUp;
}

@-webkit-keyframes fadeIn {
  0% {
    opacity: 0;
  }

  100% {
    opacity: 1;
  }
}

@keyframes fadeIn {
  0% {
    opacity: 0;
  }

  100% {
    opacity: 1;
  }
}

.fadeIn {
  -webkit-animation-name: fadeIn;
  animation-name: fadeIn;
}

@-webkit-keyframes fadeInDown {
  0% {
    opacity: 0;
    -webkit-transform: translate3d(0, -100%, 0);
    transform: translate3d(0, -100%, 0);
  }

  100% {
    opacity: 1;
    -webkit-transform: none;
    transform: none;
  }
}

@keyframes fadeInDown {
  0% {
    opacity: 0;
    -webkit-transform: translate3d(0, -100%, 0);
    transform: translate3d(0, -100%, 0);
  }

  100% {
    opacity: 1;
    -webkit-transform: none;
    transform: none;
  }
}

.fadeInDown {
  -webkit-animation-name: fadeInDown;
  animation-name: fadeInDown;
}

@-webkit-keyframes fadeInDownBig {
  0% {
    opacity: 0;
    -webkit-transform: translate3d(0, -2000px, 0);
    transform: translate3d(0, -2000px, 0);
  }

  100% {
    opacity: 1;
    -webkit-transform: none;
    transform: none;
  }
}

@keyframes fadeInDownBig {
  0% {
    opacity: 0;
    -webkit-transform: translate3d(0, -2000px, 0);
    transform: translate3d(0, -2000px, 0);
  }

  100% {
    opacity: 1;
    -webkit-transform: none;
    transform: none;
  }
}

.fadeInDownBig {
  -webkit-animation-name: fadeInDownBig;
  animation-name: fadeInDownBig;
}

@-webkit-keyframes fadeInLeft {
  0% {
    opacity: 0;
    -webkit-transform: translate3d(-100%, 0, 0);
    transform: translate3d(-100%, 0, 0);
  }

  100% {
    opacity: 1;
    -webkit-transform: none;
    transform: none;
  }
}

@keyframes fadeInLeft {
  0% {
    opacity: 0;
    -webkit-transform: translate3d(-100%, 0, 0);
    transform: translate3d(-100%, 0, 0);
  }

  100% {
    opacity: 1;
    -webkit-transform: none;
    transform: none;
  }
}

.fadeInLeft {
  -webkit-animation-name: fadeInLeft;
  animation-name: fadeInLeft;
}

@-webkit-keyframes fadeInLeftBig {
  0% {
    opacity: 0;
    -webkit-transform: translate3d(-2000px, 0, 0);
    transform: translate3d(-2000px, 0, 0);
  }

  100% {
    opacity: 1;
    -webkit-transform: none;
    transform: none;
  }
}

@keyframes fadeInLeftBig {
  0% {
    opacity: 0;
    -webkit-transform: translate3d(-2000px, 0, 0);
    transform: translate3d(-2000px, 0, 0);
  }

  100% {
    opacity: 1;
    -webkit-transform: none;
    transform: none;
  }
}

.fadeInLeftBig {
  -webkit-animation-name: fadeInLeftBig;
  animation-name: fadeInLeftBig;
}

@-webkit-keyframes fadeInRight {
  0% {
    opacity: 0;
    -webkit-transform: translate3d(100%, 0, 0);
    transform: translate3d(100%, 0, 0);
  }

  100% {
    opacity: 1;
    -webkit-transform: none;
    transform: none;
  }
}

@keyframes fadeInRight {
  0% {
    opacity: 0;
    -webkit-transform: translate3d(100%, 0, 0);
    transform: translate3d(100%, 0, 0);
  }

  100% {
    opacity: 1;
    -webkit-transform: none;
    transform: none;
  }
}

.fadeInRight {
  -webkit-animation-name: fadeInRight;
  animation-name: fadeInRight;
}

@-webkit-keyframes fadeInRightBig {
  0% {
    opacity: 0;
    -webkit-transform: translate3d(2000px, 0, 0);
    transform: translate3d(2000px, 0, 0);
  }

  100% {
    opacity: 1;
    -webkit-transform: none;
    transform: none;
  }
}

@keyframes fadeInRightBig {
  0% {
    opacity: 0;
    -webkit-transform: translate3d(2000px, 0, 0);
    transform: translate3d(2000px, 0, 0);
  }

  100% {
    opacity: 1;
    -webkit-transform: none;
    transform: none;
  }
}

.fadeInRightBig {
  -webkit-animation-name: fadeInRightBig;
  animation-name: fadeInRightBig;
}

@-webkit-keyframes fadeInUp {
  0% {
    opacity: 0;
    -webkit-transform: translate3d(0, 100%, 0);
    transform: translate3d(0, 100%, 0);
  }

  100% {
    opacity: 1;
    -webkit-transform: none;
    transform: none;
  }
}

@keyframes fadeInUp {
  0% {
    opacity: 0;
    -webkit-transform: translate3d(0, 100%, 0);
    transform: translate3d(0, 100%, 0);
  }

  100% {
    opacity: 1;
    -webkit-transform: none;
    transform: none;
  }
}

.fadeInUp {
  -webkit-animation-name: fadeInUp;
  animation-name: fadeInUp;
}

@-webkit-keyframes fadeInUpBig {
  0% {
    opacity: 0;
    -webkit-transform: translate3d(0, 2000px, 0);
    transform: translate3d(0, 2000px, 0);
  }

  100% {
    opacity: 1;
    -webkit-transform: none;
    transform: none;
  }
}

@keyframes fadeInUpBig {
  0% {
    opacity: 0;
    -webkit-transform: translate3d(0, 2000px, 0);
    transform: translate3d(0, 2000px, 0);
  }

  100% {
    opacity: 1;
    -webkit-transform: none;
    transform: none;
  }
}

.fadeInUpBig {
  -webkit-animation-name: fadeInUpBig;
  animation-name: fadeInUpBig;
}

@-webkit-keyframes fadeOut {
  0% {
    opacity: 1;
  }

  100% {
    opacity: 0;
  }
}

@keyframes fadeOut {
  0% {
    opacity: 1;
  }

  100% {
    opacity: 0;
  }
}

.fadeOut {
  -webkit-animation-name: fadeOut;
  animation-name: fadeOut;
}

@-webkit-keyframes fadeOutDown {
  0% {
    opacity: 1;
  }

  100% {
    opacity: 0;
    -webkit-transform: translate3d(0, 100%, 0);
    transform: translate3d(0, 100%, 0);
  }
}

@keyframes fadeOutDown {
  0% {
    opacity: 1;
  }

  100% {
    opacity: 0;
    -webkit-transform: translate3d(0, 100%, 0);
    transform: translate3d(0, 100%, 0);
  }
}

.fadeOutDown {
  -webkit-animation-name: fadeOutDown;
  animation-name: fadeOutDown;
}

@-webkit-keyframes fadeOutDownBig {
  0% {
    opacity: 1;
  }

  100% {
    opacity: 0;
    -webkit-transform: translate3d(0, 2000px, 0);
    transform: translate3d(0, 2000px, 0);
  }
}

@keyframes fadeOutDownBig {
  0% {
    opacity: 1;
  }

  100% {
    opacity: 0;
    -webkit-transform: translate3d(0, 2000px, 0);
    transform: translate3d(0, 2000px, 0);
  }
}

.fadeOutDownBig {
  -webkit-animation-name: fadeOutDownBig;
  animation-name: fadeOutDownBig;
}

@-webkit-keyframes fadeOutLeft {
  0% {
    opacity: 1;
  }

  100% {
    opacity: 0;
    -webkit-transform: translate3d(-100%, 0, 0);
    transform: translate3d(-100%, 0, 0);
  }
}

@keyframes fadeOutLeft {
  0% {
    opacity: 1;
  }

  100% {
    opacity: 0;
    -webkit-transform: translate3d(-100%, 0, 0);
    transform: translate3d(-100%, 0, 0);
  }
}

.fadeOutLeft {
  -webkit-animation-name: fadeOutLeft;
  animation-name: fadeOutLeft;
}

@-webkit-keyframes fadeOutLeftBig {
  0% {
    opacity: 1;
  }

  100% {
    opacity: 0;
    -webkit-transform: translate3d(-2000px, 0, 0);
    transform: translate3d(-2000px, 0, 0);
  }
}

@keyframes fadeOutLeftBig {
  0% {
    opacity: 1;
  }

  100% {
    opacity: 0;
    -webkit-transform: translate3d(-2000px, 0, 0);
    transform: translate3d(-2000px, 0, 0);
  }
}

.fadeOutLeftBig {
  -webkit-animation-name: fadeOutLeftBig;
  animation-name: fadeOutLeftBig;
}

@-webkit-keyframes fadeOutRight {
  0% {
    opacity: 1;
  }

  100% {
    opacity: 0;
    -webkit-transform: translate3d(100%, 0, 0);
    transform: translate3d(100%, 0, 0);
  }
}

@keyframes fadeOutRight {
  0% {
    opacity: 1;
  }

  100% {
    opacity: 0;
    -webkit-transform: translate3d(100%, 0, 0);
    transform: translate3d(100%, 0, 0);
  }
}

.fadeOutRight {
  -webkit-animation-name: fadeOutRight;
  animation-name: fadeOutRight;
}

@-webkit-keyframes fadeOutRightBig {
  0% {
    opacity: 1;
  }

  100% {
    opacity: 0;
    -webkit-transform: translate3d(2000px, 0, 0);
    transform: translate3d(2000px, 0, 0);
  }
}

@keyframes fadeOutRightBig {
  0% {
    opacity: 1;
  }

  100% {
    opacity: 0;
    -webkit-transform: translate3d(2000px, 0, 0);
    transform: translate3d(2000px, 0, 0);
  }
}

.fadeOutRightBig {
  -webkit-animation-name: fadeOutRightBig;
  animation-name: fadeOutRightBig;
}

@-webkit-keyframes fadeOutUp {
  0% {
    opacity: 1;
  }

  100% {
    opacity: 0;
    -webkit-transform: translate3d(0, -100%, 0);
    transform: translate3d(0, -100%, 0);
  }
}

@keyframes fadeOutUp {
  0% {
    opacity: 1;
  }

  100% {
    opacity: 0;
    -webkit-transform: translate3d(0, -100%, 0);
    transform: translate3d(0, -100%, 0);
  }
}

.fadeOutUp {
  -webkit-animation-name: fadeOutUp;
  animation-name: fadeOutUp;
}

@-webkit-keyframes fadeOutUpBig {
  0% {
    opacity: 1;
  }

  100% {
    opacity: 0;
    -webkit-transform: translate3d(0, -2000px, 0);
    transform: translate3d(0, -2000px, 0);
  }
}

@keyframes fadeOutUpBig {
  0% {
    opacity: 1;
  }

  100% {
    opacity: 0;
    -webkit-transform: translate3d(0, -2000px, 0);
    transform: translate3d(0, -2000px, 0);
  }
}

.fadeOutUpBig {
  -webkit-animation-name: fadeOutUpBig;
  animation-name: fadeOutUpBig;
}

@-webkit-keyframes flip {
  0% {
    -webkit-transform: perspective(400px) rotate3d(0, 1, 0, -360deg);
    transform: perspective(400px) rotate3d(0, 1, 0, -360deg);
    -webkit-animation-timing-function: ease-out;
    animation-timing-function: ease-out;
  }

  40% {
    -webkit-transform: perspective(400px) translate3d(0, 0, 150px) rotate3d(0, 1, 0, -190deg);
    transform: perspective(400px) translate3d(0, 0, 150px) rotate3d(0, 1, 0, -190deg);
    -webkit-animation-timing-function: ease-out;
    animation-timing-function: ease-out;
  }

  50% {
    -webkit-transform: perspective(400px) translate3d(0, 0, 150px) rotate3d(0, 1, 0, -170deg);
    transform: perspective(400px) translate3d(0, 0, 150px) rotate3d(0, 1, 0, -170deg);
    -webkit-animation-timing-function: ease-in;
    animation-timing-function: ease-in;
  }

  80% {
    -webkit-transform: perspective(400px) scale3d(.95, .95, .95);
    transform: perspective(400px) scale3d(.95, .95, .95);
    -webkit-animation-timing-function: ease-in;
    animation-timing-function: ease-in;
  }

  100% {
    -webkit-transform: perspective(400px);
    transform: perspective(400px);
    -webkit-animation-timing-function: ease-in;
    animation-timing-function: ease-in;
  }
}

@keyframes flip {
  0% {
    -webkit-transform: perspective(400px) rotate3d(0, 1, 0, -360deg);
    transform: perspective(400px) rotate3d(0, 1, 0, -360deg);
    -webkit-animation-timing-function: ease-out;
    animation-timing-function: ease-out;
  }

  40% {
    -webkit-transform: perspective(400px) translate3d(0, 0, 150px) rotate3d(0, 1, 0, -190deg);
    transform: perspective(400px) translate3d(0, 0, 150px) rotate3d(0, 1, 0, -190deg);
    -webkit-animation-timing-function: ease-out;
    animation-timing-function: ease-out;
  }

  50% {
    -webkit-transform: perspective(400px) translate3d(0, 0, 150px) rotate3d(0, 1, 0, -170deg);
    transform: perspective(400px) translate3d(0, 0, 150px) rotate3d(0, 1, 0, -170deg);
    -webkit-animation-timing-function: ease-in;
    animation-timing-function: ease-in;
  }

  80% {
    -webkit-transform: perspective(400px) scale3d(.95, .95, .95);
    transform: perspective(400px) scale3d(.95, .95, .95);
    -webkit-animation-timing-function: ease-in;
    animation-timing-function: ease-in;
  }

  100% {
    -webkit-transform: perspective(400px);
    transform: perspective(400px);
    -webkit-animation-timing-function: ease-in;
    animation-timing-function: ease-in;
  }
}

.animated.flip {
  -webkit-backface-visibility: visible;
  backface-visibility: visible;
  -webkit-animation-name: flip;
  animation-name: flip;
}

@-webkit-keyframes flipInX {
  0% {
    -webkit-transform: perspective(400px) rotate3d(1, 0, 0, 90deg);
    transform: perspective(400px) rotate3d(1, 0, 0, 90deg);
    -webkit-animation-timing-function: ease-in;
    animation-timing-function: ease-in;
    opacity: 0;
  }

  40% {
    -webkit-transform: perspective(400px) rotate3d(1, 0, 0, -20deg);
    transform: perspective(400px) rotate3d(1, 0, 0, -20deg);
    -webkit-animation-timing-function: ease-in;
    animation-timing-function: ease-in;
  }

  60% {
    -webkit-transform: perspective(400px) rotate3d(1, 0, 0, 10deg);
    transform: perspective(400px) rotate3d(1, 0, 0, 10deg);
    opacity: 1;
  }

  80% {
    -webkit-transform: perspective(400px) rotate3d(1, 0, 0, -5deg);
    transform: perspective(400px) rotate3d(1, 0, 0, -5deg);
  }

  100% {
    -webkit-transform: perspective(400px);
    transform: perspective(400px);
  }
}

@keyframes flipInX {
  0% {
    -webkit-transform: perspective(400px) rotate3d(1, 0, 0, 90deg);
    transform: perspective(400px) rotate3d(1, 0, 0, 90deg);
    -webkit-animation-timing-function: ease-in;
    animation-timing-function: ease-in;
    opacity: 0;
  }

  40% {
    -webkit-transform: perspective(400px) rotate3d(1, 0, 0, -20deg);
    transform: perspective(400px) rotate3d(1, 0, 0, -20deg);
    -webkit-animation-timing-function: ease-in;
    animation-timing-function: ease-in;
  }

  60% {
    -webkit-transform: perspective(400px) rotate3d(1, 0, 0, 10deg);
    transform: perspective(400px) rotate3d(1, 0, 0, 10deg);
    opacity: 1;
  }

  80% {
    -webkit-transform: perspective(400px) rotate3d(1, 0, 0, -5deg);
    transform: perspective(400px) rotate3d(1, 0, 0, -5deg);
  }

  100% {
    -webkit-transform: perspective(400px);
    transform: perspective(400px);
  }
}

.flipInX {
  -webkit-backface-visibility: visible !important;
  backface-visibility: visible !important;
  -webkit-animation-name: flipInX;
  animation-name: flipInX;
}

@-webkit-keyframes flipInY {
  0% {
    -webkit-transform: perspective(400px) rotate3d(0, 1, 0, 90deg);
    transform: perspective(400px) rotate3d(0, 1, 0, 90deg);
    -webkit-animation-timing-function: ease-in;
    animation-timing-function: ease-in;
    opacity: 0;
  }

  40% {
    -webkit-transform: perspective(400px) rotate3d(0, 1, 0, -20deg);
    transform: perspective(400px) rotate3d(0, 1, 0, -20deg);
    -webkit-animation-timing-function: ease-in;
    animation-timing-function: ease-in;
  }

  60% {
    -webkit-transform: perspective(400px) rotate3d(0, 1, 0, 10deg);
    transform: perspective(400px) rotate3d(0, 1, 0, 10deg);
    opacity: 1;
  }

  80% {
    -webkit-transform: perspective(400px) rotate3d(0, 1, 0, -5deg);
    transform: perspective(400px) rotate3d(0, 1, 0, -5deg);
  }

  100% {
    -webkit-transform: perspective(400px);
    transform: perspective(400px);
  }
}

@keyframes flipInY {
  0% {
    -webkit-transform: perspective(400px) rotate3d(0, 1, 0, 90deg);
    transform: perspective(400px) rotate3d(0, 1, 0, 90deg);
    -webkit-animation-timing-function: ease-in;
    animation-timing-function: ease-in;
    opacity: 0;
  }

  40% {
    -webkit-transform: perspective(400px) rotate3d(0, 1, 0, -20deg);
    transform: perspective(400px) rotate3d(0, 1, 0, -20deg);
    -webkit-animation-timing-function: ease-in;
    animation-timing-function: ease-in;
  }

  60% {
    -webkit-transform: perspective(400px) rotate3d(0, 1, 0, 10deg);
    transform: perspective(400px) rotate3d(0, 1, 0, 10deg);
    opacity: 1;
  }

  80% {
    -webkit-transform: perspective(400px) rotate3d(0, 1, 0, -5deg);
    transform: perspective(400px) rotate3d(0, 1, 0, -5deg);
  }

  100% {
    -webkit-transform: perspective(400px);
    transform: perspective(400px);
  }
}

.flipInY {
  -webkit-backface-visibility: visible !important;
  backface-visibility: visible !important;
  -webkit-animation-name: flipInY;
  animation-name: flipInY;
}

@-webkit-keyframes flipOutX {
  0% {
    -webkit-transform: perspective(400px);
    transform: perspective(400px);
  }

  30% {
    -webkit-transform: perspective(400px) rotate3d(1, 0, 0, -20deg);
    transform: perspective(400px) rotate3d(1, 0, 0, -20deg);
    opacity: 1;
  }

  100% {
    -webkit-transform: perspective(400px) rotate3d(1, 0, 0, 90deg);
    transform: perspective(400px) rotate3d(1, 0, 0, 90deg);
    opacity: 0;
  }
}

@keyframes flipOutX {
  0% {
    -webkit-transform: perspective(400px);
    transform: perspective(400px);
  }

  30% {
    -webkit-transform: perspective(400px) rotate3d(1, 0, 0, -20deg);
    transform: perspective(400px) rotate3d(1, 0, 0, -20deg);
    opacity: 1;
  }

  100% {
    -webkit-transform: perspective(400px) rotate3d(1, 0, 0, 90deg);
    transform: perspective(400px) rotate3d(1, 0, 0, 90deg);
    opacity: 0;
  }
}

.flipOutX {
  -webkit-animation-name: flipOutX;
  animation-name: flipOutX;
  -webkit-backface-visibility: visible !important;
  backface-visibility: visible !important;
}

@-webkit-keyframes flipOutY {
  0% {
    -webkit-transform: perspective(400px);
    transform: perspective(400px);
  }

  30% {
    -webkit-transform: perspective(400px) rotate3d(0, 1, 0, -15deg);
    transform: perspective(400px) rotate3d(0, 1, 0, -15deg);
    opacity: 1;
  }

  100% {
    -webkit-transform: perspective(400px) rotate3d(0, 1, 0, 90deg);
    transform: perspective(400px) rotate3d(0, 1, 0, 90deg);
    opacity: 0;
  }
}

@keyframes flipOutY {
  0% {
    -webkit-transform: perspective(400px);
    transform: perspective(400px);
  }

  30% {
    -webkit-transform: perspective(400px) rotate3d(0, 1, 0, -15deg);
    transform: perspective(400px) rotate3d(0, 1, 0, -15deg);
    opacity: 1;
  }

  100% {
    -webkit-transform: perspective(400px) rotate3d(0, 1, 0, 90deg);
    transform: perspective(400px) rotate3d(0, 1, 0, 90deg);
    opacity: 0;
  }
}

.flipOutY {
  -webkit-backface-visibility: visible !important;
  backface-visibility: visible !important;
  -webkit-animation-name: flipOutY;
  animation-name: flipOutY;
}

@-webkit-keyframes lightSpeedIn {
  0% {
    -webkit-transform: translate3d(100%, 0, 0) skewX(-30deg);
    transform: translate3d(100%, 0, 0) skewX(-30deg);
    opacity: 0;
  }

  60% {
    -webkit-transform: skewX(20deg);
    transform: skewX(20deg);
    opacity: 1;
  }

  80% {
    -webkit-transform: skewX(-5deg);
    transform: skewX(-5deg);
    opacity: 1;
  }

  100% {
    -webkit-transform: none;
    transform: none;
    opacity: 1;
  }
}

@keyframes lightSpeedIn {
  0% {
    -webkit-transform: translate3d(100%, 0, 0) skewX(-30deg);
    transform: translate3d(100%, 0, 0) skewX(-30deg);
    opacity: 0;
  }

  60% {
    -webkit-transform: skewX(20deg);
    transform: skewX(20deg);
    opacity: 1;
  }

  80% {
    -webkit-transform: skewX(-5deg);
    transform: skewX(-5deg);
    opacity: 1;
  }

  100% {
    -webkit-transform: none;
    transform: none;
    opacity: 1;
  }
}

.lightSpeedIn {
  -webkit-animation-name: lightSpeedIn;
  animation-name: lightSpeedIn;
  -webkit-animation-timing-function: ease-out;
  animation-timing-function: ease-out;
}

@-webkit-keyframes lightSpeedOut {
  0% {
    opacity: 1;
  }

  100% {
    -webkit-transform: translate3d(100%, 0, 0) skewX(30deg);
    transform: translate3d(100%, 0, 0) skewX(30deg);
    opacity: 0;
  }
}

@keyframes lightSpeedOut {
  0% {
    opacity: 1;
  }

  100% {
    -webkit-transform: translate3d(100%, 0, 0) skewX(30deg);
    transform: translate3d(100%, 0, 0) skewX(30deg);
    opacity: 0;
  }
}

.lightSpeedOut {
  -webkit-animation-name: lightSpeedOut;
  animation-name: lightSpeedOut;
  -webkit-animation-timing-function: ease-in;
  animation-timing-function: ease-in;
}

@-webkit-keyframes rotateIn {
  0% {
    -webkit-transform-origin: center;
    transform-origin: center;
    -webkit-transform: rotate3d(0, 0, 1, -200deg);
    transform: rotate3d(0, 0, 1, -200deg);
    opacity: 0;
  }

  100% {
    -webkit-transform-origin: center;
    transform-origin: center;
    -webkit-transform: none;
    transform: none;
    opacity: 1;
  }
}

@keyframes rotateIn {
  0% {
    -webkit-transform-origin: center;
    transform-origin: center;
    -webkit-transform: rotate3d(0, 0, 1, -200deg);
    transform: rotate3d(0, 0, 1, -200deg);
    opacity: 0;
  }

  100% {
    -webkit-transform-origin: center;
    transform-origin: center;
    -webkit-transform: none;
    transform: none;
    opacity: 1;
  }
}

.rotateIn {
  -webkit-animation-name: rotateIn;
  animation-name: rotateIn;
}

@-webkit-keyframes rotateInDownLeft {
  0% {
    -webkit-transform-origin: left bottom;
    transform-origin: left bottom;
    -webkit-transform: rotate3d(0, 0, 1, -45deg);
    transform: rotate3d(0, 0, 1, -45deg);
    opacity: 0;
  }

  100% {
    -webkit-transform-origin: left bottom;
    transform-origin: left bottom;
    -webkit-transform: none;
    transform: none;
    opacity: 1;
  }
}

@keyframes rotateInDownLeft {
  0% {
    -webkit-transform-origin: left bottom;
    transform-origin: left bottom;
    -webkit-transform: rotate3d(0, 0, 1, -45deg);
    transform: rotate3d(0, 0, 1, -45deg);
    opacity: 0;
  }

  100% {
    -webkit-transform-origin: left bottom;
    transform-origin: left bottom;
    -webkit-transform: none;
    transform: none;
    opacity: 1;
  }
}

.rotateInDownLeft {
  -webkit-animation-name: rotateInDownLeft;
  animation-name: rotateInDownLeft;
}

@-webkit-keyframes rotateInDownRight {
  0% {
    -webkit-transform-origin: right bottom;
    transform-origin: right bottom;
    -webkit-transform: rotate3d(0, 0, 1, 45deg);
    transform: rotate3d(0, 0, 1, 45deg);
    opacity: 0;
  }

  100% {
    -webkit-transform-origin: right bottom;
    transform-origin: right bottom;
    -webkit-transform: none;
    transform: none;
    opacity: 1;
  }
}

@keyframes rotateInDownRight {
  0% {
    -webkit-transform-origin: right bottom;
    transform-origin: right bottom;
    -webkit-transform: rotate3d(0, 0, 1, 45deg);
    transform: rotate3d(0, 0, 1, 45deg);
    opacity: 0;
  }

  100% {
    -webkit-transform-origin: right bottom;
    transform-origin: right bottom;
    -webkit-transform: none;
    transform: none;
    opacity: 1;
  }
}

.rotateInDownRight {
  -webkit-animation-name: rotateInDownRight;
  animation-name: rotateInDownRight;
}

@-webkit-keyframes rotateInUpLeft {
  0% {
    -webkit-transform-origin: left bottom;
    transform-origin: left bottom;
    -webkit-transform: rotate3d(0, 0, 1, 45deg);
    transform: rotate3d(0, 0, 1, 45deg);
    opacity: 0;
  }

  100% {
    -webkit-transform-origin: left bottom;
    transform-origin: left bottom;
    -webkit-transform: none;
    transform: none;
    opacity: 1;
  }
}

@keyframes rotateInUpLeft {
  0% {
    -webkit-transform-origin: left bottom;
    transform-origin: left bottom;
    -webkit-transform: rotate3d(0, 0, 1, 45deg);
    transform: rotate3d(0, 0, 1, 45deg);
    opacity: 0;
  }

  100% {
    -webkit-transform-origin: left bottom;
    transform-origin: left bottom;
    -webkit-transform: none;
    transform: none;
    opacity: 1;
  }
}

.rotateInUpLeft {
  -webkit-animation-name: rotateInUpLeft;
  animation-name: rotateInUpLeft;
}

@-webkit-keyframes rotateInUpRight {
  0% {
    -webkit-transform-origin: right bottom;
    transform-origin: right bottom;
    -webkit-transform: rotate3d(0, 0, 1, -90deg);
    transform: rotate3d(0, 0, 1, -90deg);
    opacity: 0;
  }

  100% {
    -webkit-transform-origin: right bottom;
    transform-origin: right bottom;
    -webkit-transform: none;
    transform: none;
    opacity: 1;
  }
}

@keyframes rotateInUpRight {
  0% {
    -webkit-transform-origin: right bottom;
    transform-origin: right bottom;
    -webkit-transform: rotate3d(0, 0, 1, -90deg);
    transform: rotate3d(0, 0, 1, -90deg);
    opacity: 0;
  }

  100% {
    -webkit-transform-origin: right bottom;
    transform-origin: right bottom;
    -webkit-transform: none;
    transform: none;
    opacity: 1;
  }
}

.rotateInUpRight {
  -webkit-animation-name: rotateInUpRight;
  animation-name: rotateInUpRight;
}

@-webkit-keyframes rotateOut {
  0% {
    -webkit-transform-origin: center;
    transform-origin: center;
    opacity: 1;
  }

  100% {
    -webkit-transform-origin: center;
    transform-origin: center;
    -webkit-transform: rotate3d(0, 0, 1, 200deg);
    transform: rotate3d(0, 0, 1, 200deg);
    opacity: 0;
  }
}

@keyframes rotateOut {
  0% {
    -webkit-transform-origin: center;
    transform-origin: center;
    opacity: 1;
  }

  100% {
    -webkit-transform-origin: center;
    transform-origin: center;
    -webkit-transform: rotate3d(0, 0, 1, 200deg);
    transform: rotate3d(0, 0, 1, 200deg);
    opacity: 0;
  }
}

.rotateOut {
  -webkit-animation-name: rotateOut;
  animation-name: rotateOut;
}

@-webkit-keyframes rotateOutDownLeft {
  0% {
    -webkit-transform-origin: left bottom;
    transform-origin: left bottom;
    opacity: 1;
  }

  100% {
    -webkit-transform-origin: left bottom;
    transform-origin: left bottom;
    -webkit-transform: rotate3d(0, 0, 1, 45deg);
    transform: rotate3d(0, 0, 1, 45deg);
    opacity: 0;
  }
}

@keyframes rotateOutDownLeft {
  0% {
    -webkit-transform-origin: left bottom;
    transform-origin: left bottom;
    opacity: 1;
  }

  100% {
    -webkit-transform-origin: left bottom;
    transform-origin: left bottom;
    -webkit-transform: rotate3d(0, 0, 1, 45deg);
    transform: rotate3d(0, 0, 1, 45deg);
    opacity: 0;
  }
}

.rotateOutDownLeft {
  -webkit-animation-name: rotateOutDownLeft;
  animation-name: rotateOutDownLeft;
}

@-webkit-keyframes rotateOutDownRight {
  0% {
    -webkit-transform-origin: right bottom;
    transform-origin: right bottom;
    opacity: 1;
  }

  100% {
    -webkit-transform-origin: right bottom;
    transform-origin: right bottom;
    -webkit-transform: rotate3d(0, 0, 1, -45deg);
    transform: rotate3d(0, 0, 1, -45deg);
    opacity: 0;
  }
}

@keyframes rotateOutDownRight {
  0% {
    -webkit-transform-origin: right bottom;
    transform-origin: right bottom;
    opacity: 1;
  }

  100% {
    -webkit-transform-origin: right bottom;
    transform-origin: right bottom;
    -webkit-transform: rotate3d(0, 0, 1, -45deg);
    transform: rotate3d(0, 0, 1, -45deg);
    opacity: 0;
  }
}

.rotateOutDownRight {
  -webkit-animation-name: rotateOutDownRight;
  animation-name: rotateOutDownRight;
}

@-webkit-keyframes rotateOutUpLeft {
  0% {
    -webkit-transform-origin: left bottom;
    transform-origin: left bottom;
    opacity: 1;
  }

  100% {
    -webkit-transform-origin: left bottom;
    transform-origin: left bottom;
    -webkit-transform: rotate3d(0, 0, 1, -45deg);
    transform: rotate3d(0, 0, 1, -45deg);
    opacity: 0;
  }
}

@keyframes rotateOutUpLeft {
  0% {
    -webkit-transform-origin: left bottom;
    transform-origin: left bottom;
    opacity: 1;
  }

  100% {
    -webkit-transform-origin: left bottom;
    transform-origin: left bottom;
    -webkit-transform: rotate3d(0, 0, 1, -45deg);
    transform: rotate3d(0, 0, 1, -45deg);
    opacity: 0;
  }
}

.rotateOutUpLeft {
  -webkit-animation-name: rotateOutUpLeft;
  animation-name: rotateOutUpLeft;
}

@-webkit-keyframes rotateOutUpRight {
  0% {
    -webkit-transform-origin: right bottom;
    transform-origin: right bottom;
    opacity: 1;
  }

  100% {
    -webkit-transform-origin: right bottom;
    transform-origin: right bottom;
    -webkit-transform: rotate3d(0, 0, 1, 90deg);
    transform: rotate3d(0, 0, 1, 90deg);
    opacity: 0;
  }
}

@keyframes rotateOutUpRight {
  0% {
    -webkit-transform-origin: right bottom;
    transform-origin: right bottom;
    opacity: 1;
  }

  100% {
    -webkit-transform-origin: right bottom;
    transform-origin: right bottom;
    -webkit-transform: rotate3d(0, 0, 1, 90deg);
    transform: rotate3d(0, 0, 1, 90deg);
    opacity: 0;
  }
}

.rotateOutUpRight {
  -webkit-animation-name: rotateOutUpRight;
  animation-name: rotateOutUpRight;
}

@-webkit-keyframes hinge {
  0% {
    -webkit-transform-origin: top left;
    transform-origin: top left;
    -webkit-animation-timing-function: ease-in-out;
    animation-timing-function: ease-in-out;
  }

  20%, 60% {
    -webkit-transform: rotate3d(0, 0, 1, 80deg);
    transform: rotate3d(0, 0, 1, 80deg);
    -webkit-transform-origin: top left;
    transform-origin: top left;
    -webkit-animation-timing-function: ease-in-out;
    animation-timing-function: ease-in-out;
  }

  40%, 80% {
    -webkit-transform: rotate3d(0, 0, 1, 60deg);
    transform: rotate3d(0, 0, 1, 60deg);
    -webkit-transform-origin: top left;
    transform-origin: top left;
    -webkit-animation-timing-function: ease-in-out;
    animation-timing-function: ease-in-out;
    opacity: 1;
  }

  100% {
    -webkit-transform: translate3d(0, 700px, 0);
    transform: translate3d(0, 700px, 0);
    opacity: 0;
  }
}

@keyframes hinge {
  0% {
    -webkit-transform-origin: top left;
    transform-origin: top left;
    -webkit-animation-timing-function: ease-in-out;
    animation-timing-function: ease-in-out;
  }

  20%, 60% {
    -webkit-transform: rotate3d(0, 0, 1, 80deg);
    transform: rotate3d(0, 0, 1, 80deg);
    -webkit-transform-origin: top left;
    transform-origin: top left;
    -webkit-animation-timing-function: ease-in-out;
    animation-timing-function: ease-in-out;
  }

  40%, 80% {
    -webkit-transform: rotate3d(0, 0, 1, 60deg);
    transform: rotate3d(0, 0, 1, 60deg);
    -webkit-transform-origin: top left;
    transform-origin: top left;
    -webkit-animation-timing-function: ease-in-out;
    animation-timing-function: ease-in-out;
    opacity: 1;
  }

  100% {
    -webkit-transform: translate3d(0, 700px, 0);
    transform: translate3d(0, 700px, 0);
    opacity: 0;
  }
}

.hinge {
  -webkit-animation-name: hinge;
  animation-name: hinge;
}

/* originally authored by Nick Pettit - https://github.com/nickpettit/glide */

@-webkit-keyframes rollIn {
  0% {
    opacity: 0;
    -webkit-transform: translate3d(-100%, 0, 0) rotate3d(0, 0, 1, -120deg);
    transform: translate3d(-100%, 0, 0) rotate3d(0, 0, 1, -120deg);
  }

  100% {
    opacity: 1;
    -webkit-transform: none;
    transform: none;
  }
}

@keyframes rollIn {
  0% {
    opacity: 0;
    -webkit-transform: translate3d(-100%, 0, 0) rotate3d(0, 0, 1, -120deg);
    transform: translate3d(-100%, 0, 0) rotate3d(0, 0, 1, -120deg);
  }

  100% {
    opacity: 1;
    -webkit-transform: none;
    transform: none;
  }
}

.rollIn {
  -webkit-animation-name: rollIn;
  animation-name: rollIn;
}

/* originally authored by Nick Pettit - https://github.com/nickpettit/glide */

@-webkit-keyframes rollOut {
  0% {
    opacity: 1;
  }

  100% {
    opacity: 0;
    -webkit-transform: translate3d(100%, 0, 0) rotate3d(0, 0, 1, 120deg);
    transform: translate3d(100%, 0, 0) rotate3d(0, 0, 1, 120deg);
  }
}

@keyframes rollOut {
  0% {
    opacity: 1;
  }

  100% {
    opacity: 0;
    -webkit-transform: translate3d(100%, 0, 0) rotate3d(0, 0, 1, 120deg);
    transform: translate3d(100%, 0, 0) rotate3d(0, 0, 1, 120deg);
  }
}

.rollOut {
  -webkit-animation-name: rollOut;
  animation-name: rollOut;
}

@-webkit-keyframes zoomIn {
  0% {
    opacity: 0;
    -webkit-transform: scale3d(.3, .3, .3);
    transform: scale3d(.3, .3, .3);
  }

  50% {
    opacity: 1;
  }
}

@keyframes zoomIn {
  0% {
    opacity: 0;
    -webkit-transform: scale3d(.3, .3, .3);
    transform: scale3d(.3, .3, .3);
  }

  50% {
    opacity: 1;
  }
}

.zoomIn {
  -webkit-animation-name: zoomIn;
  animation-name: zoomIn;
}

@-webkit-keyframes zoomInDown {
  0% {
    opacity: 0;
    -webkit-transform: scale3d(.1, .1, .1) translate3d(0, -1000px, 0);
    transform: scale3d(.1, .1, .1) translate3d(0, -1000px, 0);
    -webkit-animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190);
    animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190);
  }

  60% {
    opacity: 1;
    -webkit-transform: scale3d(.475, .475, .475) translate3d(0, 60px, 0);
    transform: scale3d(.475, .475, .475) translate3d(0, 60px, 0);
    -webkit-animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1);
    animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1);
  }
}

@keyframes zoomInDown {
  0% {
    opacity: 0;
    -webkit-transform: scale3d(.1, .1, .1) translate3d(0, -1000px, 0);
    transform: scale3d(.1, .1, .1) translate3d(0, -1000px, 0);
    -webkit-animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190);
    animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190);
  }

  60% {
    opacity: 1;
    -webkit-transform: scale3d(.475, .475, .475) translate3d(0, 60px, 0);
    transform: scale3d(.475, .475, .475) translate3d(0, 60px, 0);
    -webkit-animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1);
    animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1);
  }
}

.zoomInDown {
  -webkit-animation-name: zoomInDown;
  animation-name: zoomInDown;
}

@-webkit-keyframes zoomInLeft {
  0% {
    opacity: 0;
    -webkit-transform: scale3d(.1, .1, .1) translate3d(-1000px, 0, 0);
    transform: scale3d(.1, .1, .1) translate3d(-1000px, 0, 0);
    -webkit-animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190);
    animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190);
  }

  60% {
    opacity: 1;
    -webkit-transform: scale3d(.475, .475, .475) translate3d(10px, 0, 0);
    transform: scale3d(.475, .475, .475) translate3d(10px, 0, 0);
    -webkit-animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1);
    animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1);
  }
}

@keyframes zoomInLeft {
  0% {
    opacity: 0;
    -webkit-transform: scale3d(.1, .1, .1) translate3d(-1000px, 0, 0);
    transform: scale3d(.1, .1, .1) translate3d(-1000px, 0, 0);
    -webkit-animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190);
    animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190);
  }

  60% {
    opacity: 1;
    -webkit-transform: scale3d(.475, .475, .475) translate3d(10px, 0, 0);
    transform: scale3d(.475, .475, .475) translate3d(10px, 0, 0);
    -webkit-animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1);
    animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1);
  }
}

.zoomInLeft {
  -webkit-animation-name: zoomInLeft;
  animation-name: zoomInLeft;
}

@-webkit-keyframes zoomInRight {
  0% {
    opacity: 0;
    -webkit-transform: scale3d(.1, .1, .1) translate3d(1000px, 0, 0);
    transform: scale3d(.1, .1, .1) translate3d(1000px, 0, 0);
    -webkit-animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190);
    animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190);
  }

  60% {
    opacity: 1;
    -webkit-transform: scale3d(.475, .475, .475) translate3d(-10px, 0, 0);
    transform: scale3d(.475, .475, .475) translate3d(-10px, 0, 0);
    -webkit-animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1);
    animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1);
  }
}

@keyframes zoomInRight {
  0% {
    opacity: 0;
    -webkit-transform: scale3d(.1, .1, .1) translate3d(1000px, 0, 0);
    transform: scale3d(.1, .1, .1) translate3d(1000px, 0, 0);
    -webkit-animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190);
    animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190);
  }

  60% {
    opacity: 1;
    -webkit-transform: scale3d(.475, .475, .475) translate3d(-10px, 0, 0);
    transform: scale3d(.475, .475, .475) translate3d(-10px, 0, 0);
    -webkit-animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1);
    animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1);
  }
}

.zoomInRight {
  -webkit-animation-name: zoomInRight;
  animation-name: zoomInRight;
}

@-webkit-keyframes zoomInUp {
  0% {
    opacity: 0;
    -webkit-transform: scale3d(.1, .1, .1) translate3d(0, 1000px, 0);
    transform: scale3d(.1, .1, .1) translate3d(0, 1000px, 0);
    -webkit-animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190);
    animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190);
  }

  60% {
    opacity: 1;
    -webkit-transform: scale3d(.475, .475, .475) translate3d(0, -60px, 0);
    transform: scale3d(.475, .475, .475) translate3d(0, -60px, 0);
    -webkit-animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1);
    animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1);
  }
}

@keyframes zoomInUp {
  0% {
    opacity: 0;
    -webkit-transform: scale3d(.1, .1, .1) translate3d(0, 1000px, 0);
    transform: scale3d(.1, .1, .1) translate3d(0, 1000px, 0);
    -webkit-animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190);
    animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190);
  }

  60% {
    opacity: 1;
    -webkit-transform: scale3d(.475, .475, .475) translate3d(0, -60px, 0);
    transform: scale3d(.475, .475, .475) translate3d(0, -60px, 0);
    -webkit-animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1);
    animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1);
  }
}

.zoomInUp {
  -webkit-animation-name: zoomInUp;
  animation-name: zoomInUp;
}

@-webkit-keyframes zoomOut {
  0% {
    opacity: 1;
  }

  50% {
    opacity: 0;
    -webkit-transform: scale3d(.3, .3, .3);
    transform: scale3d(.3, .3, .3);
  }

  100% {
    opacity: 0;
  }
}

@keyframes zoomOut {
  0% {
    opacity: 1;
  }

  50% {
    opacity: 0;
    -webkit-transform: scale3d(.3, .3, .3);
    transform: scale3d(.3, .3, .3);
  }

  100% {
    opacity: 0;
  }
}

.zoomOut {
  -webkit-animation-name: zoomOut;
  animation-name: zoomOut;
}

@-webkit-keyframes zoomOutDown {
  40% {
    opacity: 1;
    -webkit-transform: scale3d(.475, .475, .475) translate3d(0, -60px, 0);
    transform: scale3d(.475, .475, .475) translate3d(0, -60px, 0);
    -webkit-animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190);
    animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190);
  }

  100% {
    opacity: 0;
    -webkit-transform: scale3d(.1, .1, .1) translate3d(0, 2000px, 0);
    transform: scale3d(.1, .1, .1) translate3d(0, 2000px, 0);
    -webkit-transform-origin: center bottom;
    transform-origin: center bottom;
    -webkit-animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1);
    animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1);
  }
}

@keyframes zoomOutDown {
  40% {
    opacity: 1;
    -webkit-transform: scale3d(.475, .475, .475) translate3d(0, -60px, 0);
    transform: scale3d(.475, .475, .475) translate3d(0, -60px, 0);
    -webkit-animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190);
    animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190);
  }

  100% {
    opacity: 0;
    -webkit-transform: scale3d(.1, .1, .1) translate3d(0, 2000px, 0);
    transform: scale3d(.1, .1, .1) translate3d(0, 2000px, 0);
    -webkit-transform-origin: center bottom;
    transform-origin: center bottom;
    -webkit-animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1);
    animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1);
  }
}

.zoomOutDown {
  -webkit-animation-name: zoomOutDown;
  animation-name: zoomOutDown;
}

@-webkit-keyframes zoomOutLeft {
  40% {
    opacity: 1;
    -webkit-transform: scale3d(.475, .475, .475) translate3d(42px, 0, 0);
    transform: scale3d(.475, .475, .475) translate3d(42px, 0, 0);
  }

  100% {
    opacity: 0;
    -webkit-transform: scale(.1) translate3d(-2000px, 0, 0);
    transform: scale(.1) translate3d(-2000px, 0, 0);
    -webkit-transform-origin: left center;
    transform-origin: left center;
  }
}

@keyframes zoomOutLeft {
  40% {
    opacity: 1;
    -webkit-transform: scale3d(.475, .475, .475) translate3d(42px, 0, 0);
    transform: scale3d(.475, .475, .475) translate3d(42px, 0, 0);
  }

  100% {
    opacity: 0;
    -webkit-transform: scale(.1) translate3d(-2000px, 0, 0);
    transform: scale(.1) translate3d(-2000px, 0, 0);
    -webkit-transform-origin: left center;
    transform-origin: left center;
  }
}

.zoomOutLeft {
  -webkit-animation-name: zoomOutLeft;
  animation-name: zoomOutLeft;
}

@-webkit-keyframes zoomOutRight {
  40% {
    opacity: 1;
    -webkit-transform: scale3d(.475, .475, .475) translate3d(-42px, 0, 0);
    transform: scale3d(.475, .475, .475) translate3d(-42px, 0, 0);
  }

  100% {
    opacity: 0;
    -webkit-transform: scale(.1) translate3d(2000px, 0, 0);
    transform: scale(.1) translate3d(2000px, 0, 0);
    -webkit-transform-origin: right center;
    transform-origin: right center;
  }
}

@keyframes zoomOutRight {
  40% {
    opacity: 1;
    -webkit-transform: scale3d(.475, .475, .475) translate3d(-42px, 0, 0);
    transform: scale3d(.475, .475, .475) translate3d(-42px, 0, 0);
  }

  100% {
    opacity: 0;
    -webkit-transform: scale(.1) translate3d(2000px, 0, 0);
    transform: scale(.1) translate3d(2000px, 0, 0);
    -webkit-transform-origin: right center;
    transform-origin: right center;
  }
}

.zoomOutRight {
  -webkit-animation-name: zoomOutRight;
  animation-name: zoomOutRight;
}

@-webkit-keyframes zoomOutUp {
  40% {
    opacity: 1;
    -webkit-transform: scale3d(.475, .475, .475) translate3d(0, 60px, 0);
    transform: scale3d(.475, .475, .475) translate3d(0, 60px, 0);
    -webkit-animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190);
    animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190);
  }

  100% {
    opacity: 0;
    -webkit-transform: scale3d(.1, .1, .1) translate3d(0, -2000px, 0);
    transform: scale3d(.1, .1, .1) translate3d(0, -2000px, 0);
    -webkit-transform-origin: center bottom;
    transform-origin: center bottom;
    -webkit-animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1);
    animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1);
  }
}

@keyframes zoomOutUp {
  40% {
    opacity: 1;
    -webkit-transform: scale3d(.475, .475, .475) translate3d(0, 60px, 0);
    transform: scale3d(.475, .475, .475) translate3d(0, 60px, 0);
    -webkit-animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190);
    animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190);
  }

  100% {
    opacity: 0;
    -webkit-transform: scale3d(.1, .1, .1) translate3d(0, -2000px, 0);
    transform: scale3d(.1, .1, .1) translate3d(0, -2000px, 0);
    -webkit-transform-origin: center bottom;
    transform-origin: center bottom;
    -webkit-animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1);
    animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1);
  }
}

.zoomOutUp {
  -webkit-animation-name: zoomOutUp;
  animation-name: zoomOutUp;
}

@-webkit-keyframes slideInDown {
  0% {
    -webkit-transform: translate3d(0, -100%, 0);
    transform: translate3d(0, -100%, 0);
    visibility: visible;
  }

  100% {
    -webkit-transform: translate3d(0, 0, 0);
    transform: translate3d(0, 0, 0);
  }
}

@keyframes slideInDown {
  0% {
    -webkit-transform: translate3d(0, -100%, 0);
    transform: translate3d(0, -100%, 0);
    visibility: visible;
  }

  100% {
    -webkit-transform: translate3d(0, 0, 0);
    transform: translate3d(0, 0, 0);
  }
}

.slideInDown {
  -webkit-animation-name: slideInDown;
  animation-name: slideInDown;
}

@-webkit-keyframes slideInLeft {
  0% {
    -webkit-transform: translate3d(-100%, 0, 0);
    transform: translate3d(-100%, 0, 0);
    visibility: visible;
  }

  100% {
    -webkit-transform: translate3d(0, 0, 0);
    transform: translate3d(0, 0, 0);
  }
}

@keyframes slideInLeft {
  0% {
    -webkit-transform: translate3d(-100%, 0, 0);
    transform: translate3d(-100%, 0, 0);
    visibility: visible;
  }

  100% {
    -webkit-transform: translate3d(0, 0, 0);
    transform: translate3d(0, 0, 0);
  }
}

.slideInLeft {
  -webkit-animation-name: slideInLeft;
  animation-name: slideInLeft;
}

@-webkit-keyframes slideInRight {
  0% {
    -webkit-transform: translate3d(100%, 0, 0);
    transform: translate3d(100%, 0, 0);
    visibility: visible;
  }

  100% {
    -webkit-transform: translate3d(0, 0, 0);
    transform: translate3d(0, 0, 0);
  }
}

@keyframes slideInRight {
  0% {
    -webkit-transform: translate3d(100%, 0, 0);
    transform: translate3d(100%, 0, 0);
    visibility: visible;
  }

  100% {
    -webkit-transform: translate3d(0, 0, 0);
    transform: translate3d(0, 0, 0);
  }
}

.slideInRight {
  -webkit-animation-name: slideInRight;
  animation-name: slideInRight;
}

@-webkit-keyframes slideInUp {
  0% {
    -webkit-transform: translate3d(0, 100%, 0);
    transform: translate3d(0, 100%, 0);
    visibility: visible;
  }

  100% {
    -webkit-transform: translate3d(0, 0, 0);
    transform: translate3d(0, 0, 0);
  }
}

@keyframes slideInUp {
  0% {
    -webkit-transform: translate3d(0, 100%, 0);
    transform: translate3d(0, 100%, 0);
    visibility: visible;
  }

  100% {
    -webkit-transform: translate3d(0, 0, 0);
    transform: translate3d(0, 0, 0);
  }
}

.slideInUp {
  -webkit-animation-name: slideInUp;
  animation-name: slideInUp;
}

@-webkit-keyframes slideOutDown {
  0% {
    -webkit-transform: translate3d(0, 0, 0);
    transform: translate3d(0, 0, 0);
  }

  100% {
    visibility: hidden;
    -webkit-transform: translate3d(0, 100%, 0);
    transform: translate3d(0, 100%, 0);
  }
}

@keyframes slideOutDown {
  0% {
    -webkit-transform: translate3d(0, 0, 0);
    transform: translate3d(0, 0, 0);
  }

  100% {
    visibility: hidden;
    -webkit-transform: translate3d(0, 100%, 0);
    transform: translate3d(0, 100%, 0);
  }
}

.slideOutDown {
  -webkit-animation-name: slideOutDown;
  animation-name: slideOutDown;
}

@-webkit-keyframes slideOutLeft {
  0% {
    -webkit-transform: translate3d(0, 0, 0);
    transform: translate3d(0, 0, 0);
  }

  100% {
    visibility: hidden;
    -webkit-transform: translate3d(-100%, 0, 0);
    transform: translate3d(-100%, 0, 0);
  }
}

@keyframes slideOutLeft {
  0% {
    -webkit-transform: translate3d(0, 0, 0);
    transform: translate3d(0, 0, 0);
  }

  100% {
    visibility: hidden;
    -webkit-transform: translate3d(-100%, 0, 0);
    transform: translate3d(-100%, 0, 0);
  }
}

.slideOutLeft {
  -webkit-animation-name: slideOutLeft;
  animation-name: slideOutLeft;
}

@-webkit-keyframes slideOutRight {
  0% {
    -webkit-transform: translate3d(0, 0, 0);
    transform: translate3d(0, 0, 0);
  }

  100% {
    visibility: hidden;
    -webkit-transform: translate3d(100%, 0, 0);
    transform: translate3d(100%, 0, 0);
  }
}

@keyframes slideOutRight {
  0% {
    -webkit-transform: translate3d(0, 0, 0);
    transform: translate3d(0, 0, 0);
  }

  100% {
    visibility: hidden;
    -webkit-transform: translate3d(100%, 0, 0);
    transform: translate3d(100%, 0, 0);
  }
}

.slideOutRight {
  -webkit-animation-name: slideOutRight;
  animation-name: slideOutRight;
}

@-webkit-keyframes slideOutUp {
  0% {
    -webkit-transform: translate3d(0, 0, 0);
    transform: translate3d(0, 0, 0);
  }

  100% {
    visibility: hidden;
    -webkit-transform: translate3d(0, -100%, 0);
    transform: translate3d(0, -100%, 0);
  }
}

@keyframes slideOutUp {
  0% {
    -webkit-transform: translate3d(0, 0, 0);
    transform: translate3d(0, 0, 0);
  }

  100% {
    visibility: hidden;
    -webkit-transform: translate3d(0, -100%, 0);
    transform: translate3d(0, -100%, 0);
  }
}

.slideOutUp {
  -webkit-animation-name: slideOutUp;
  animation-name: slideOutUp;
}

[data-notify="progressbar"] {
	margin-bottom: 0px;
	position: absolute;
	bottom: 0px;
	left: 0px;
	width: 100%;
	height: 5px;
}
@charset "UTF-8";
/* ================ ============= ================ ======
--------------- Table of Contents ------------------
    1. Minicart Icon
    2. FontAwesome Icon
    3. Elusive Icon
-----------------------------------------------------
========== ==========  ============ =============*/

@font-face {
    font-family: "minicart-font";
    src: url('../public/fonts/minicart-fontc619.eot?v=1.0');
    src: url('../public/fonts/minicart-fontd41d.eot?#iefix&v=1.0') format('embedded-opentype'), url('../public/fonts/minicart-fontc619.woff?v=1.0') format('woff'), url('../public/fonts/minicart-fontc619.ttf?v=1.0') format('truetype'), url('../public/fonts/minicart-fontc619.svg?v=1.0#minicart-font') format('svg');
    font-weight: normal;
    font-style: normal;
}

.minicart-icon:before {
    font-family: "minicart-font" !important;
    font-style: normal !important;
    font-weight: normal !important;
    font-variant: normal !important;
    text-transform: none !important;
    speak: none;
    line-height: 1;
    -webkit-font-smoothing: antialiased;
    -moz-osx-font-smoothing: grayscale;
}

.minicart-icon:before {
    content: "\e800";
}

/*!
 * Font Awesome Free 6.2.1 by @fontawesome - https://fontawesome.com
 * License - https://fontawesome.com/license/free (Icons: CC BY 4.0, Fonts: SIL OFL 1.1, Code: MIT License)
 * Copyright 2022 Fonticons, Inc.
 */
 .fa {
    font-family: var(--fa-style-family, "Font Awesome 6 Free");
    font-weight: var(--fa-style, 900); }
  
  .fa,
  .fa-classic,
  .fa-sharp,
  .fas,
  .fa-solid,
  .far,
  .fa-regular,
  .fab,
  .fa-brands {
    -moz-osx-font-smoothing: grayscale;
    -webkit-font-smoothing: antialiased;
    display: var(--fa-display, inline-block);
    font-style: normal;
    font-variant: normal;
    line-height: 1;
    text-rendering: auto; }
  
  .fas,
  .fa-classic,
  .fa-solid,
  .far,
  .fa-regular {
    font-family: 'Font Awesome 6 Free'; }
  
  .fab,
  .fa-brands {
    font-family: 'Font Awesome 6 Brands'; }
  
  .fa-1x {
    font-size: 1em; }
  
  .fa-2x {
    font-size: 2em; }
  
  .fa-3x {
    font-size: 3em; }
  
  .fa-4x {
    font-size: 4em; }
  
  .fa-5x {
    font-size: 5em; }
  
  .fa-6x {
    font-size: 6em; }
  
  .fa-7x {
    font-size: 7em; }
  
  .fa-8x {
    font-size: 8em; }
  
  .fa-9x {
    font-size: 9em; }
  
  .fa-10x {
    font-size: 10em; }
  
  .fa-2xs {
    font-size: 0.625em;
    line-height: 0.1em;
    vertical-align: 0.225em; }
  
  .fa-xs {
    font-size: 0.75em;
    line-height: 0.08333em;
    vertical-align: 0.125em; }
  
  .fa-sm {
    font-size: 0.875em;
    line-height: 0.07143em;
    vertical-align: 0.05357em; }
  
  .fa-lg {
    font-size: 1.25em;
    line-height: 0.05em;
    vertical-align: -0.075em; }
  
  .fa-xl {
    font-size: 1.5em;
    line-height: 0.04167em;
    vertical-align: -0.125em; }
  
  .fa-2xl {
    font-size: 2em;
    line-height: 0.03125em;
    vertical-align: -0.1875em; }
  
  .fa-fw {
    text-align: center;
    width: 1.25em; }
  
  .fa-ul {
    list-style-type: none;
    margin-left: var(--fa-li-margin, 2.5em);
    padding-left: 0; }
    .fa-ul > li {
      position: relative; }
  
  .fa-li {
    left: calc(var(--fa-li-width, 2em) * -1);
    position: absolute;
    text-align: center;
    width: var(--fa-li-width, 2em);
    line-height: inherit; }
  
  .fa-border {
    border-color: var(--fa-border-color, #eee);
    border-radius: var(--fa-border-radius, 0.1em);
    border-style: var(--fa-border-style, solid);
    border-width: var(--fa-border-width, 0.08em);
    padding: var(--fa-border-padding, 0.2em 0.25em 0.15em); }
  
  .fa-pull-left {
    float: left;
    margin-right: var(--fa-pull-margin, 0.3em); }
  
  .fa-pull-right {
    float: right;
    margin-left: var(--fa-pull-margin, 0.3em); }
  
  .fa-beat {
    -webkit-animation-name: fa-beat;
            animation-name: fa-beat;
    -webkit-animation-delay: var(--fa-animation-delay, 0s);
            animation-delay: var(--fa-animation-delay, 0s);
    -webkit-animation-direction: var(--fa-animation-direction, normal);
            animation-direction: var(--fa-animation-direction, normal);
    -webkit-animation-duration: var(--fa-animation-duration, 1s);
            animation-duration: var(--fa-animation-duration, 1s);
    -webkit-animation-iteration-count: var(--fa-animation-iteration-count, infinite);
            animation-iteration-count: var(--fa-animation-iteration-count, infinite);
    -webkit-animation-timing-function: var(--fa-animation-timing, ease-in-out);
            animation-timing-function: var(--fa-animation-timing, ease-in-out); }
  
  .fa-bounce {
    -webkit-animation-name: fa-bounce;
            animation-name: fa-bounce;
    -webkit-animation-delay: var(--fa-animation-delay, 0s);
            animation-delay: var(--fa-animation-delay, 0s);
    -webkit-animation-direction: var(--fa-animation-direction, normal);
            animation-direction: var(--fa-animation-direction, normal);
    -webkit-animation-duration: var(--fa-animation-duration, 1s);
            animation-duration: var(--fa-animation-duration, 1s);
    -webkit-animation-iteration-count: var(--fa-animation-iteration-count, infinite);
            animation-iteration-count: var(--fa-animation-iteration-count, infinite);
    -webkit-animation-timing-function: var(--fa-animation-timing, cubic-bezier(0.28, 0.84, 0.42, 1));
            animation-timing-function: var(--fa-animation-timing, cubic-bezier(0.28, 0.84, 0.42, 1)); }
  
  .fa-fade {
    -webkit-animation-name: fa-fade;
            animation-name: fa-fade;
    -webkit-animation-delay: var(--fa-animation-delay, 0s);
            animation-delay: var(--fa-animation-delay, 0s);
    -webkit-animation-direction: var(--fa-animation-direction, normal);
            animation-direction: var(--fa-animation-direction, normal);
    -webkit-animation-duration: var(--fa-animation-duration, 1s);
            animation-duration: var(--fa-animation-duration, 1s);
    -webkit-animation-iteration-count: var(--fa-animation-iteration-count, infinite);
            animation-iteration-count: var(--fa-animation-iteration-count, infinite);
    -webkit-animation-timing-function: var(--fa-animation-timing, cubic-bezier(0.4, 0, 0.6, 1));
            animation-timing-function: var(--fa-animation-timing, cubic-bezier(0.4, 0, 0.6, 1)); }
  
  .fa-beat-fade {
    -webkit-animation-name: fa-beat-fade;
            animation-name: fa-beat-fade;
    -webkit-animation-delay: var(--fa-animation-delay, 0s);
            animation-delay: var(--fa-animation-delay, 0s);
    -webkit-animation-direction: var(--fa-animation-direction, normal);
            animation-direction: var(--fa-animation-direction, normal);
    -webkit-animation-duration: var(--fa-animation-duration, 1s);
            animation-duration: var(--fa-animation-duration, 1s);
    -webkit-animation-iteration-count: var(--fa-animation-iteration-count, infinite);
            animation-iteration-count: var(--fa-animation-iteration-count, infinite);
    -webkit-animation-timing-function: var(--fa-animation-timing, cubic-bezier(0.4, 0, 0.6, 1));
            animation-timing-function: var(--fa-animation-timing, cubic-bezier(0.4, 0, 0.6, 1)); }
  
  .fa-flip {
    -webkit-animation-name: fa-flip;
            animation-name: fa-flip;
    -webkit-animation-delay: var(--fa-animation-delay, 0s);
            animation-delay: var(--fa-animation-delay, 0s);
    -webkit-animation-direction: var(--fa-animation-direction, normal);
            animation-direction: var(--fa-animation-direction, normal);
    -webkit-animation-duration: var(--fa-animation-duration, 1s);
            animation-duration: var(--fa-animation-duration, 1s);
    -webkit-animation-iteration-count: var(--fa-animation-iteration-count, infinite);
            animation-iteration-count: var(--fa-animation-iteration-count, infinite);
    -webkit-animation-timing-function: var(--fa-animation-timing, ease-in-out);
            animation-timing-function: var(--fa-animation-timing, ease-in-out); }
  
  .fa-shake {
    -webkit-animation-name: fa-shake;
            animation-name: fa-shake;
    -webkit-animation-delay: var(--fa-animation-delay, 0s);
            animation-delay: var(--fa-animation-delay, 0s);
    -webkit-animation-direction: var(--fa-animation-direction, normal);
            animation-direction: var(--fa-animation-direction, normal);
    -webkit-animation-duration: var(--fa-animation-duration, 1s);
            animation-duration: var(--fa-animation-duration, 1s);
    -webkit-animation-iteration-count: var(--fa-animation-iteration-count, infinite);
            animation-iteration-count: var(--fa-animation-iteration-count, infinite);
    -webkit-animation-timing-function: var(--fa-animation-timing, linear);
            animation-timing-function: var(--fa-animation-timing, linear); }
  
  .fa-spin {
    -webkit-animation-name: fa-spin;
            animation-name: fa-spin;
    -webkit-animation-delay: var(--fa-animation-delay, 0s);
            animation-delay: var(--fa-animation-delay, 0s);
    -webkit-animation-direction: var(--fa-animation-direction, normal);
            animation-direction: var(--fa-animation-direction, normal);
    -webkit-animation-duration: var(--fa-animation-duration, 2s);
            animation-duration: var(--fa-animation-duration, 2s);
    -webkit-animation-iteration-count: var(--fa-animation-iteration-count, infinite);
            animation-iteration-count: var(--fa-animation-iteration-count, infinite);
    -webkit-animation-timing-function: var(--fa-animation-timing, linear);
            animation-timing-function: var(--fa-animation-timing, linear); }
  
  .fa-spin-reverse {
    --fa-animation-direction: reverse; }
  
  .fa-pulse,
  .fa-spin-pulse {
    -webkit-animation-name: fa-spin;
            animation-name: fa-spin;
    -webkit-animation-direction: var(--fa-animation-direction, normal);
            animation-direction: var(--fa-animation-direction, normal);
    -webkit-animation-duration: var(--fa-animation-duration, 1s);
            animation-duration: var(--fa-animation-duration, 1s);
    -webkit-animation-iteration-count: var(--fa-animation-iteration-count, infinite);
            animation-iteration-count: var(--fa-animation-iteration-count, infinite);
    -webkit-animation-timing-function: var(--fa-animation-timing, steps(8));
            animation-timing-function: var(--fa-animation-timing, steps(8)); }
  
  @media (prefers-reduced-motion: reduce) {
    .fa-beat,
    .fa-bounce,
    .fa-fade,
    .fa-beat-fade,
    .fa-flip,
    .fa-pulse,
    .fa-shake,
    .fa-spin,
    .fa-spin-pulse {
      -webkit-animation-delay: -1ms;
              animation-delay: -1ms;
      -webkit-animation-duration: 1ms;
              animation-duration: 1ms;
      -webkit-animation-iteration-count: 1;
              animation-iteration-count: 1;
      transition-delay: 0s;
      transition-duration: 0s; } }
  
  @-webkit-keyframes fa-beat {
    0%, 90% {
      -webkit-transform: scale(1);
              transform: scale(1); }
    45% {
      -webkit-transform: scale(var(--fa-beat-scale, 1.25));
              transform: scale(var(--fa-beat-scale, 1.25)); } }
  
  @keyframes fa-beat {
    0%, 90% {
      -webkit-transform: scale(1);
              transform: scale(1); }
    45% {
      -webkit-transform: scale(var(--fa-beat-scale, 1.25));
              transform: scale(var(--fa-beat-scale, 1.25)); } }
  
  @-webkit-keyframes fa-bounce {
    0% {
      -webkit-transform: scale(1, 1) translateY(0);
              transform: scale(1, 1) translateY(0); }
    10% {
      -webkit-transform: scale(var(--fa-bounce-start-scale-x, 1.1), var(--fa-bounce-start-scale-y, 0.9)) translateY(0);
              transform: scale(var(--fa-bounce-start-scale-x, 1.1), var(--fa-bounce-start-scale-y, 0.9)) translateY(0); }
    30% {
      -webkit-transform: scale(var(--fa-bounce-jump-scale-x, 0.9), var(--fa-bounce-jump-scale-y, 1.1)) translateY(var(--fa-bounce-height, -0.5em));
              transform: scale(var(--fa-bounce-jump-scale-x, 0.9), var(--fa-bounce-jump-scale-y, 1.1)) translateY(var(--fa-bounce-height, -0.5em)); }
    50% {
      -webkit-transform: scale(var(--fa-bounce-land-scale-x, 1.05), var(--fa-bounce-land-scale-y, 0.95)) translateY(0);
              transform: scale(var(--fa-bounce-land-scale-x, 1.05), var(--fa-bounce-land-scale-y, 0.95)) translateY(0); }
    57% {
      -webkit-transform: scale(1, 1) translateY(var(--fa-bounce-rebound, -0.125em));
              transform: scale(1, 1) translateY(var(--fa-bounce-rebound, -0.125em)); }
    64% {
      -webkit-transform: scale(1, 1) translateY(0);
              transform: scale(1, 1) translateY(0); }
    100% {
      -webkit-transform: scale(1, 1) translateY(0);
              transform: scale(1, 1) translateY(0); } }
  
  @keyframes fa-bounce {
    0% {
      -webkit-transform: scale(1, 1) translateY(0);
              transform: scale(1, 1) translateY(0); }
    10% {
      -webkit-transform: scale(var(--fa-bounce-start-scale-x, 1.1), var(--fa-bounce-start-scale-y, 0.9)) translateY(0);
              transform: scale(var(--fa-bounce-start-scale-x, 1.1), var(--fa-bounce-start-scale-y, 0.9)) translateY(0); }
    30% {
      -webkit-transform: scale(var(--fa-bounce-jump-scale-x, 0.9), var(--fa-bounce-jump-scale-y, 1.1)) translateY(var(--fa-bounce-height, -0.5em));
              transform: scale(var(--fa-bounce-jump-scale-x, 0.9), var(--fa-bounce-jump-scale-y, 1.1)) translateY(var(--fa-bounce-height, -0.5em)); }
    50% {
      -webkit-transform: scale(var(--fa-bounce-land-scale-x, 1.05), var(--fa-bounce-land-scale-y, 0.95)) translateY(0);
              transform: scale(var(--fa-bounce-land-scale-x, 1.05), var(--fa-bounce-land-scale-y, 0.95)) translateY(0); }
    57% {
      -webkit-transform: scale(1, 1) translateY(var(--fa-bounce-rebound, -0.125em));
              transform: scale(1, 1) translateY(var(--fa-bounce-rebound, -0.125em)); }
    64% {
      -webkit-transform: scale(1, 1) translateY(0);
              transform: scale(1, 1) translateY(0); }
    100% {
      -webkit-transform: scale(1, 1) translateY(0);
              transform: scale(1, 1) translateY(0); } }
  
  @-webkit-keyframes fa-fade {
    50% {
      opacity: var(--fa-fade-opacity, 0.4); } }
  
  @keyframes fa-fade {
    50% {
      opacity: var(--fa-fade-opacity, 0.4); } }
  
  @-webkit-keyframes fa-beat-fade {
    0%, 100% {
      opacity: var(--fa-beat-fade-opacity, 0.4);
      -webkit-transform: scale(1);
              transform: scale(1); }
    50% {
      opacity: 1;
      -webkit-transform: scale(var(--fa-beat-fade-scale, 1.125));
              transform: scale(var(--fa-beat-fade-scale, 1.125)); } }
  
  @keyframes fa-beat-fade {
    0%, 100% {
      opacity: var(--fa-beat-fade-opacity, 0.4);
      -webkit-transform: scale(1);
              transform: scale(1); }
    50% {
      opacity: 1;
      -webkit-transform: scale(var(--fa-beat-fade-scale, 1.125));
              transform: scale(var(--fa-beat-fade-scale, 1.125)); } }
  
  @-webkit-keyframes fa-flip {
    50% {
      -webkit-transform: rotate3d(var(--fa-flip-x, 0), var(--fa-flip-y, 1), var(--fa-flip-z, 0), var(--fa-flip-angle, -180deg));
              transform: rotate3d(var(--fa-flip-x, 0), var(--fa-flip-y, 1), var(--fa-flip-z, 0), var(--fa-flip-angle, -180deg)); } }
  
  @keyframes fa-flip {
    50% {
      -webkit-transform: rotate3d(var(--fa-flip-x, 0), var(--fa-flip-y, 1), var(--fa-flip-z, 0), var(--fa-flip-angle, -180deg));
              transform: rotate3d(var(--fa-flip-x, 0), var(--fa-flip-y, 1), var(--fa-flip-z, 0), var(--fa-flip-angle, -180deg)); } }
  
  @-webkit-keyframes fa-shake {
    0% {
      -webkit-transform: rotate(-15deg);
              transform: rotate(-15deg); }
    4% {
      -webkit-transform: rotate(15deg);
              transform: rotate(15deg); }
    8%, 24% {
      -webkit-transform: rotate(-18deg);
              transform: rotate(-18deg); }
    12%, 28% {
      -webkit-transform: rotate(18deg);
              transform: rotate(18deg); }
    16% {
      -webkit-transform: rotate(-22deg);
              transform: rotate(-22deg); }
    20% {
      -webkit-transform: rotate(22deg);
              transform: rotate(22deg); }
    32% {
      -webkit-transform: rotate(-12deg);
              transform: rotate(-12deg); }
    36% {
      -webkit-transform: rotate(12deg);
              transform: rotate(12deg); }
    40%, 100% {
      -webkit-transform: rotate(0deg);
              transform: rotate(0deg); } }
  
  @keyframes fa-shake {
    0% {
      -webkit-transform: rotate(-15deg);
              transform: rotate(-15deg); }
    4% {
      -webkit-transform: rotate(15deg);
              transform: rotate(15deg); }
    8%, 24% {
      -webkit-transform: rotate(-18deg);
              transform: rotate(-18deg); }
    12%, 28% {
      -webkit-transform: rotate(18deg);
              transform: rotate(18deg); }
    16% {
      -webkit-transform: rotate(-22deg);
              transform: rotate(-22deg); }
    20% {
      -webkit-transform: rotate(22deg);
              transform: rotate(22deg); }
    32% {
      -webkit-transform: rotate(-12deg);
              transform: rotate(-12deg); }
    36% {
      -webkit-transform: rotate(12deg);
              transform: rotate(12deg); }
    40%, 100% {
      -webkit-transform: rotate(0deg);
              transform: rotate(0deg); } }
  
  @-webkit-keyframes fa-spin {
    0% {
      -webkit-transform: rotate(0deg);
              transform: rotate(0deg); }
    100% {
      -webkit-transform: rotate(360deg);
              transform: rotate(360deg); } }
  
  @keyframes fa-spin {
    0% {
      -webkit-transform: rotate(0deg);
              transform: rotate(0deg); }
    100% {
      -webkit-transform: rotate(360deg);
              transform: rotate(360deg); } }
  
  .fa-rotate-90 {
    -webkit-transform: rotate(90deg);
            transform: rotate(90deg); }
  
  .fa-rotate-180 {
    -webkit-transform: rotate(180deg);
            transform: rotate(180deg); }
  
  .fa-rotate-270 {
    -webkit-transform: rotate(270deg);
            transform: rotate(270deg); }
  
  .fa-flip-horizontal {
    -webkit-transform: scale(-1, 1);
            transform: scale(-1, 1); }
  
  .fa-flip-vertical {
    -webkit-transform: scale(1, -1);
            transform: scale(1, -1); }
  
  .fa-flip-both,
  .fa-flip-horizontal.fa-flip-vertical {
    -webkit-transform: scale(-1, -1);
            transform: scale(-1, -1); }
  
  .fa-rotate-by {
    -webkit-transform: rotate(var(--fa-rotate-angle, none));
            transform: rotate(var(--fa-rotate-angle, none)); }
  
  .fa-stack {
    display: inline-block;
    height: 2em;
    line-height: 2em;
    position: relative;
    vertical-align: middle;
    width: 2.5em; }
  
  .fa-stack-1x,
  .fa-stack-2x {
    left: 0;
    position: absolute;
    text-align: center;
    width: 100%;
    z-index: var(--fa-stack-z-index, auto); }
  
  .fa-stack-1x {
    line-height: inherit; }
  
  .fa-stack-2x {
    font-size: 2em; }
  
  .fa-inverse {
    color: var(--fa-inverse, #fff); }
  
  /* Font Awesome uses the Unicode Private Use Area (PUA) to ensure screen
  readers do not read off random characters that represent icons */
  .fa-0::before {
    content: "\30"; }
  
  .fa-1::before {
    content: "\31"; }
  
  .fa-2::before {
    content: "\32"; }
  
  .fa-3::before {
    content: "\33"; }
  
  .fa-4::before {
    content: "\34"; }
  
  .fa-5::before {
    content: "\35"; }
  
  .fa-6::before {
    content: "\36"; }
  
  .fa-7::before {
    content: "\37"; }
  
  .fa-8::before {
    content: "\38"; }
  
  .fa-9::before {
    content: "\39"; }
  
  .fa-fill-drip::before {
    content: "\f576"; }
  
  .fa-arrows-to-circle::before {
    content: "\e4bd"; }
  
  .fa-circle-chevron-right::before {
    content: "\f138"; }
  
  .fa-chevron-circle-right::before {
    content: "\f138"; }
  
  .fa-at::before {
    content: "\40"; }
  
  .fa-trash-can::before {
    content: "\f2ed"; }
  
  .fa-trash-alt::before {
    content: "\f2ed"; }
  
  .fa-text-height::before {
    content: "\f034"; }
  
  .fa-user-xmark::before {
    content: "\f235"; }
  
  .fa-user-times::before {
    content: "\f235"; }
  
  .fa-stethoscope::before {
    content: "\f0f1"; }
  
  .fa-message::before {
    content: "\f27a"; }
  
  .fa-comment-alt::before {
    content: "\f27a"; }
  
  .fa-info::before {
    content: "\f129"; }
  
  .fa-down-left-and-up-right-to-center::before {
    content: "\f422"; }
  
  .fa-compress-alt::before {
    content: "\f422"; }
  
  .fa-explosion::before {
    content: "\e4e9"; }
  
  .fa-file-lines::before {
    content: "\f15c"; }
  
  .fa-file-alt::before {
    content: "\f15c"; }
  
  .fa-file-text::before {
    content: "\f15c"; }
  
  .fa-wave-square::before {
    content: "\f83e"; }
  
  .fa-ring::before {
    content: "\f70b"; }
  
  .fa-building-un::before {
    content: "\e4d9"; }
  
  .fa-dice-three::before {
    content: "\f527"; }
  
  .fa-calendar-days::before {
    content: "\f073"; }
  
  .fa-calendar-alt::before {
    content: "\f073"; }
  
  .fa-anchor-circle-check::before {
    content: "\e4aa"; }
  
  .fa-building-circle-arrow-right::before {
    content: "\e4d1"; }
  
  .fa-volleyball::before {
    content: "\f45f"; }
  
  .fa-volleyball-ball::before {
    content: "\f45f"; }
  
  .fa-arrows-up-to-line::before {
    content: "\e4c2"; }
  
  .fa-sort-down::before {
    content: "\f0dd"; }
  
  .fa-sort-desc::before {
    content: "\f0dd"; }
  
  .fa-circle-minus::before {
    content: "\f056"; }
  
  .fa-minus-circle::before {
    content: "\f056"; }
  
  .fa-door-open::before {
    content: "\f52b"; }
  
  .fa-right-from-bracket::before {
    content: "\f2f5"; }
  
  .fa-sign-out-alt::before {
    content: "\f2f5"; }
  
  .fa-atom::before {
    content: "\f5d2"; }
  
  .fa-soap::before {
    content: "\e06e"; }
  
  .fa-icons::before {
    content: "\f86d"; }
  
  .fa-heart-music-camera-bolt::before {
    content: "\f86d"; }
  
  .fa-microphone-lines-slash::before {
    content: "\f539"; }
  
  .fa-microphone-alt-slash::before {
    content: "\f539"; }
  
  .fa-bridge-circle-check::before {
    content: "\e4c9"; }
  
  .fa-pump-medical::before {
    content: "\e06a"; }
  
  .fa-fingerprint::before {
    content: "\f577"; }
  
  .fa-hand-point-right::before {
    content: "\f0a4"; }
  
  .fa-magnifying-glass-location::before {
    content: "\f689"; }
  
  .fa-search-location::before {
    content: "\f689"; }
  
  .fa-forward-step::before {
    content: "\f051"; }
  
  .fa-step-forward::before {
    content: "\f051"; }
  
  .fa-face-smile-beam::before {
    content: "\f5b8"; }
  
  .fa-smile-beam::before {
    content: "\f5b8"; }
  
  .fa-flag-checkered::before {
    content: "\f11e"; }
  
  .fa-football::before {
    content: "\f44e"; }
  
  .fa-football-ball::before {
    content: "\f44e"; }
  
  .fa-school-circle-exclamation::before {
    content: "\e56c"; }
  
  .fa-crop::before {
    content: "\f125"; }
  
  .fa-angles-down::before {
    content: "\f103"; }
  
  .fa-angle-double-down::before {
    content: "\f103"; }
  
  .fa-users-rectangle::before {
    content: "\e594"; }
  
  .fa-people-roof::before {
    content: "\e537"; }
  
  .fa-people-line::before {
    content: "\e534"; }
  
  .fa-beer-mug-empty::before {
    content: "\f0fc"; }
  
  .fa-beer::before {
    content: "\f0fc"; }
  
  .fa-diagram-predecessor::before {
    content: "\e477"; }
  
  .fa-arrow-up-long::before {
    content: "\f176"; }
  
  .fa-long-arrow-up::before {
    content: "\f176"; }
  
  .fa-fire-flame-simple::before {
    content: "\f46a"; }
  
  .fa-burn::before {
    content: "\f46a"; }
  
  .fa-person::before {
    content: "\f183"; }
  
  .fa-male::before {
    content: "\f183"; }
  
  .fa-laptop::before {
    content: "\f109"; }
  
  .fa-file-csv::before {
    content: "\f6dd"; }
  
  .fa-menorah::before {
    content: "\f676"; }
  
  .fa-truck-plane::before {
    content: "\e58f"; }
  
  .fa-record-vinyl::before {
    content: "\f8d9"; }
  
  .fa-face-grin-stars::before {
    content: "\f587"; }
  
  .fa-grin-stars::before {
    content: "\f587"; }
  
  .fa-bong::before {
    content: "\f55c"; }
  
  .fa-spaghetti-monster-flying::before {
    content: "\f67b"; }
  
  .fa-pastafarianism::before {
    content: "\f67b"; }
  
  .fa-arrow-down-up-across-line::before {
    content: "\e4af"; }
  
  .fa-spoon::before {
    content: "\f2e5"; }
  
  .fa-utensil-spoon::before {
    content: "\f2e5"; }
  
  .fa-jar-wheat::before {
    content: "\e517"; }
  
  .fa-envelopes-bulk::before {
    content: "\f674"; }
  
  .fa-mail-bulk::before {
    content: "\f674"; }
  
  .fa-file-circle-exclamation::before {
    content: "\e4eb"; }
  
  .fa-circle-h::before {
    content: "\f47e"; }
  
  .fa-hospital-symbol::before {
    content: "\f47e"; }
  
  .fa-pager::before {
    content: "\f815"; }
  
  .fa-address-book::before {
    content: "\f2b9"; }
  
  .fa-contact-book::before {
    content: "\f2b9"; }
  
  .fa-strikethrough::before {
    content: "\f0cc"; }
  
  .fa-k::before {
    content: "\4b"; }
  
  .fa-landmark-flag::before {
    content: "\e51c"; }
  
  .fa-pencil::before {
    content: "\f303"; }
  
  .fa-pencil-alt::before {
    content: "\f303"; }
  
  .fa-backward::before {
    content: "\f04a"; }
  
  .fa-caret-right::before {
    content: "\f0da"; }
  
  .fa-comments::before {
    content: "\f086"; }
  
  .fa-paste::before {
    content: "\f0ea"; }
  
  .fa-file-clipboard::before {
    content: "\f0ea"; }
  
  .fa-code-pull-request::before {
    content: "\e13c"; }
  
  .fa-clipboard-list::before {
    content: "\f46d"; }
  
  .fa-truck-ramp-box::before {
    content: "\f4de"; }
  
  .fa-truck-loading::before {
    content: "\f4de"; }
  
  .fa-user-check::before {
    content: "\f4fc"; }
  
  .fa-vial-virus::before {
    content: "\e597"; }
  
  .fa-sheet-plastic::before {
    content: "\e571"; }
  
  .fa-blog::before {
    content: "\f781"; }
  
  .fa-user-ninja::before {
    content: "\f504"; }
  
  .fa-person-arrow-up-from-line::before {
    content: "\e539"; }
  
  .fa-scroll-torah::before {
    content: "\f6a0"; }
  
  .fa-torah::before {
    content: "\f6a0"; }
  
  .fa-broom-ball::before {
    content: "\f458"; }
  
  .fa-quidditch::before {
    content: "\f458"; }
  
  .fa-quidditch-broom-ball::before {
    content: "\f458"; }
  
  .fa-toggle-off::before {
    content: "\f204"; }
  
  .fa-box-archive::before {
    content: "\f187"; }
  
  .fa-archive::before {
    content: "\f187"; }
  
  .fa-person-drowning::before {
    content: "\e545"; }
  
  .fa-arrow-down-9-1::before {
    content: "\f886"; }
  
  .fa-sort-numeric-desc::before {
    content: "\f886"; }
  
  .fa-sort-numeric-down-alt::before {
    content: "\f886"; }
  
  .fa-face-grin-tongue-squint::before {
    content: "\f58a"; }
  
  .fa-grin-tongue-squint::before {
    content: "\f58a"; }
  
  .fa-spray-can::before {
    content: "\f5bd"; }
  
  .fa-truck-monster::before {
    content: "\f63b"; }
  
  .fa-w::before {
    content: "\57"; }
  
  .fa-earth-africa::before {
    content: "\f57c"; }
  
  .fa-globe-africa::before {
    content: "\f57c"; }
  
  .fa-rainbow::before {
    content: "\f75b"; }
  
  .fa-circle-notch::before {
    content: "\f1ce"; }
  
  .fa-tablet-screen-button::before {
    content: "\f3fa"; }
  
  .fa-tablet-alt::before {
    content: "\f3fa"; }
  
  .fa-paw::before {
    content: "\f1b0"; }
  
  .fa-cloud::before {
    content: "\f0c2"; }
  
  .fa-trowel-bricks::before {
    content: "\e58a"; }
  
  .fa-face-flushed::before {
    content: "\f579"; }
  
  .fa-flushed::before {
    content: "\f579"; }
  
  .fa-hospital-user::before {
    content: "\f80d"; }
  
  .fa-tent-arrow-left-right::before {
    content: "\e57f"; }
  
  .fa-gavel::before {
    content: "\f0e3"; }
  
  .fa-legal::before {
    content: "\f0e3"; }
  
  .fa-binoculars::before {
    content: "\f1e5"; }
  
  .fa-microphone-slash::before {
    content: "\f131"; }
  
  .fa-box-tissue::before {
    content: "\e05b"; }
  
  .fa-motorcycle::before {
    content: "\f21c"; }
  
  .fa-bell-concierge::before {
    content: "\f562"; }
  
  .fa-concierge-bell::before {
    content: "\f562"; }
  
  .fa-pen-ruler::before {
    content: "\f5ae"; }
  
  .fa-pencil-ruler::before {
    content: "\f5ae"; }
  
  .fa-people-arrows::before {
    content: "\e068"; }
  
  .fa-people-arrows-left-right::before {
    content: "\e068"; }
  
  .fa-mars-and-venus-burst::before {
    content: "\e523"; }
  
  .fa-square-caret-right::before {
    content: "\f152"; }
  
  .fa-caret-square-right::before {
    content: "\f152"; }
  
  .fa-scissors::before {
    content: "\f0c4"; }
  
  .fa-cut::before {
    content: "\f0c4"; }
  
  .fa-sun-plant-wilt::before {
    content: "\e57a"; }
  
  .fa-toilets-portable::before {
    content: "\e584"; }
  
  .fa-hockey-puck::before {
    content: "\f453"; }
  
  .fa-table::before {
    content: "\f0ce"; }
  
  .fa-magnifying-glass-arrow-right::before {
    content: "\e521"; }
  
  .fa-tachograph-digital::before {
    content: "\f566"; }
  
  .fa-digital-tachograph::before {
    content: "\f566"; }
  
  .fa-users-slash::before {
    content: "\e073"; }
  
  .fa-clover::before {
    content: "\e139"; }
  
  .fa-reply::before {
    content: "\f3e5"; }
  
  .fa-mail-reply::before {
    content: "\f3e5"; }
  
  .fa-star-and-crescent::before {
    content: "\f699"; }
  
  .fa-house-fire::before {
    content: "\e50c"; }
  
  .fa-square-minus::before {
    content: "\f146"; }
  
  .fa-minus-square::before {
    content: "\f146"; }
  
  .fa-helicopter::before {
    content: "\f533"; }
  
  .fa-compass::before {
    content: "\f14e"; }
  
  .fa-square-caret-down::before {
    content: "\f150"; }
  
  .fa-caret-square-down::before {
    content: "\f150"; }
  
  .fa-file-circle-question::before {
    content: "\e4ef"; }
  
  .fa-laptop-code::before {
    content: "\f5fc"; }
  
  .fa-swatchbook::before {
    content: "\f5c3"; }
  
  .fa-prescription-bottle::before {
    content: "\f485"; }
  
  .fa-bars::before {
    content: "\f0c9"; }
  
  .fa-navicon::before {
    content: "\f0c9"; }
  
  .fa-people-group::before {
    content: "\e533"; }
  
  .fa-hourglass-end::before {
    content: "\f253"; }
  
  .fa-hourglass-3::before {
    content: "\f253"; }
  
  .fa-heart-crack::before {
    content: "\f7a9"; }
  
  .fa-heart-broken::before {
    content: "\f7a9"; }
  
  .fa-square-up-right::before {
    content: "\f360"; }
  
  .fa-external-link-square-alt::before {
    content: "\f360"; }
  
  .fa-face-kiss-beam::before {
    content: "\f597"; }
  
  .fa-kiss-beam::before {
    content: "\f597"; }
  
  .fa-film::before {
    content: "\f008"; }
  
  .fa-ruler-horizontal::before {
    content: "\f547"; }
  
  .fa-people-robbery::before {
    content: "\e536"; }
  
  .fa-lightbulb::before {
    content: "\f0eb"; }
  
  .fa-caret-left::before {
    content: "\f0d9"; }
  
  .fa-circle-exclamation::before {
    content: "\f06a"; }
  
  .fa-exclamation-circle::before {
    content: "\f06a"; }
  
  .fa-school-circle-xmark::before {
    content: "\e56d"; }
  
  .fa-arrow-right-from-bracket::before {
    content: "\f08b"; }
  
  .fa-sign-out::before {
    content: "\f08b"; }
  
  .fa-circle-chevron-down::before {
    content: "\f13a"; }
  
  .fa-chevron-circle-down::before {
    content: "\f13a"; }
  
  .fa-unlock-keyhole::before {
    content: "\f13e"; }
  
  .fa-unlock-alt::before {
    content: "\f13e"; }
  
  .fa-cloud-showers-heavy::before {
    content: "\f740"; }
  
  .fa-headphones-simple::before {
    content: "\f58f"; }
  
  .fa-headphones-alt::before {
    content: "\f58f"; }
  
  .fa-sitemap::before {
    content: "\f0e8"; }
  
  .fa-circle-dollar-to-slot::before {
    content: "\f4b9"; }
  
  .fa-donate::before {
    content: "\f4b9"; }
  
  .fa-memory::before {
    content: "\f538"; }
  
  .fa-road-spikes::before {
    content: "\e568"; }
  
  .fa-fire-burner::before {
    content: "\e4f1"; }
  
  .fa-flag::before {
    content: "\f024"; }
  
  .fa-hanukiah::before {
    content: "\f6e6"; }
  
  .fa-feather::before {
    content: "\f52d"; }
  
  .fa-volume-low::before {
    content: "\f027"; }
  
  .fa-volume-down::before {
    content: "\f027"; }
  
  .fa-comment-slash::before {
    content: "\f4b3"; }
  
  .fa-cloud-sun-rain::before {
    content: "\f743"; }
  
  .fa-compress::before {
    content: "\f066"; }
  
  .fa-wheat-awn::before {
    content: "\e2cd"; }
  
  .fa-wheat-alt::before {
    content: "\e2cd"; }
  
  .fa-ankh::before {
    content: "\f644"; }
  
  .fa-hands-holding-child::before {
    content: "\e4fa"; }
  
  .fa-asterisk::before {
    content: "\2a"; }
  
  .fa-square-check::before {
    content: "\f14a"; }
  
  .fa-check-square::before {
    content: "\f14a"; }
  
  .fa-peseta-sign::before {
    content: "\e221"; }
  
  .fa-heading::before {
    content: "\f1dc"; }
  
  .fa-header::before {
    content: "\f1dc"; }
  
  .fa-ghost::before {
    content: "\f6e2"; }
  
  .fa-list::before {
    content: "\f03a"; }
  
  .fa-list-squares::before {
    content: "\f03a"; }
  
  .fa-square-phone-flip::before {
    content: "\f87b"; }
  
  .fa-phone-square-alt::before {
    content: "\f87b"; }
  
  .fa-cart-plus::before {
    content: "\f217"; }
  
  .fa-gamepad::before {
    content: "\f11b"; }
  
  .fa-circle-dot::before {
    content: "\f192"; }
  
  .fa-dot-circle::before {
    content: "\f192"; }
  
  .fa-face-dizzy::before {
    content: "\f567"; }
  
  .fa-dizzy::before {
    content: "\f567"; }
  
  .fa-egg::before {
    content: "\f7fb"; }
  
  .fa-house-medical-circle-xmark::before {
    content: "\e513"; }
  
  .fa-campground::before {
    content: "\f6bb"; }
  
  .fa-folder-plus::before {
    content: "\f65e"; }
  
  .fa-futbol::before {
    content: "\f1e3"; }
  
  .fa-futbol-ball::before {
    content: "\f1e3"; }
  
  .fa-soccer-ball::before {
    content: "\f1e3"; }
  
  .fa-paintbrush::before {
    content: "\f1fc"; }
  
  .fa-paint-brush::before {
    content: "\f1fc"; }
  
  .fa-lock::before {
    content: "\f023"; }
  
  .fa-gas-pump::before {
    content: "\f52f"; }
  
  .fa-hot-tub-person::before {
    content: "\f593"; }
  
  .fa-hot-tub::before {
    content: "\f593"; }
  
  .fa-map-location::before {
    content: "\f59f"; }
  
  .fa-map-marked::before {
    content: "\f59f"; }
  
  .fa-house-flood-water::before {
    content: "\e50e"; }
  
  .fa-tree::before {
    content: "\f1bb"; }
  
  .fa-bridge-lock::before {
    content: "\e4cc"; }
  
  .fa-sack-dollar::before {
    content: "\f81d"; }
  
  .fa-pen-to-square::before {
    content: "\f044"; }
  
  .fa-edit::before {
    content: "\f044"; }
  
  .fa-car-side::before {
    content: "\f5e4"; }
  
  .fa-share-nodes::before {
    content: "\f1e0"; }
  
  .fa-share-alt::before {
    content: "\f1e0"; }
  
  .fa-heart-circle-minus::before {
    content: "\e4ff"; }
  
  .fa-hourglass-half::before {
    content: "\f252"; }
  
  .fa-hourglass-2::before {
    content: "\f252"; }
  
  .fa-microscope::before {
    content: "\f610"; }
  
  .fa-sink::before {
    content: "\e06d"; }
  
  .fa-bag-shopping::before {
    content: "\f290"; }
  
  .fa-shopping-bag::before {
    content: "\f290"; }
  
  .fa-arrow-down-z-a::before {
    content: "\f881"; }
  
  .fa-sort-alpha-desc::before {
    content: "\f881"; }
  
  .fa-sort-alpha-down-alt::before {
    content: "\f881"; }
  
  .fa-mitten::before {
    content: "\f7b5"; }
  
  .fa-person-rays::before {
    content: "\e54d"; }
  
  .fa-users::before {
    content: "\f0c0"; }
  
  .fa-eye-slash::before {
    content: "\f070"; }
  
  .fa-flask-vial::before {
    content: "\e4f3"; }
  
  .fa-hand::before {
    content: "\f256"; }
  
  .fa-hand-paper::before {
    content: "\f256"; }
  
  .fa-om::before {
    content: "\f679"; }
  
  .fa-worm::before {
    content: "\e599"; }
  
  .fa-house-circle-xmark::before {
    content: "\e50b"; }
  
  .fa-plug::before {
    content: "\f1e6"; }
  
  .fa-chevron-up::before {
    content: "\f077"; }
  
  .fa-hand-spock::before {
    content: "\f259"; }
  
  .fa-stopwatch::before {
    content: "\f2f2"; }
  
  .fa-face-kiss::before {
    content: "\f596"; }
  
  .fa-kiss::before {
    content: "\f596"; }
  
  .fa-bridge-circle-xmark::before {
    content: "\e4cb"; }
  
  .fa-face-grin-tongue::before {
    content: "\f589"; }
  
  .fa-grin-tongue::before {
    content: "\f589"; }
  
  .fa-chess-bishop::before {
    content: "\f43a"; }
  
  .fa-face-grin-wink::before {
    content: "\f58c"; }
  
  .fa-grin-wink::before {
    content: "\f58c"; }
  
  .fa-ear-deaf::before {
    content: "\f2a4"; }
  
  .fa-deaf::before {
    content: "\f2a4"; }
  
  .fa-deafness::before {
    content: "\f2a4"; }
  
  .fa-hard-of-hearing::before {
    content: "\f2a4"; }
  
  .fa-road-circle-check::before {
    content: "\e564"; }
  
  .fa-dice-five::before {
    content: "\f523"; }
  
  .fa-square-rss::before {
    content: "\f143"; }
  
  .fa-rss-square::before {
    content: "\f143"; }
  
  .fa-land-mine-on::before {
    content: "\e51b"; }
  
  .fa-i-cursor::before {
    content: "\f246"; }
  
  .fa-stamp::before {
    content: "\f5bf"; }
  
  .fa-stairs::before {
    content: "\e289"; }
  
  .fa-i::before {
    content: "\49"; }
  
  .fa-hryvnia-sign::before {
    content: "\f6f2"; }
  
  .fa-hryvnia::before {
    content: "\f6f2"; }
  
  .fa-pills::before {
    content: "\f484"; }
  
  .fa-face-grin-wide::before {
    content: "\f581"; }
  
  .fa-grin-alt::before {
    content: "\f581"; }
  
  .fa-tooth::before {
    content: "\f5c9"; }
  
  .fa-v::before {
    content: "\56"; }
  
  .fa-bangladeshi-taka-sign::before {
    content: "\e2e6"; }
  
  .fa-bicycle::before {
    content: "\f206"; }
  
  .fa-staff-snake::before {
    content: "\e579"; }
  
  .fa-rod-asclepius::before {
    content: "\e579"; }
  
  .fa-rod-snake::before {
    content: "\e579"; }
  
  .fa-staff-aesculapius::before {
    content: "\e579"; }
  
  .fa-head-side-cough-slash::before {
    content: "\e062"; }
  
  .fa-truck-medical::before {
    content: "\f0f9"; }
  
  .fa-ambulance::before {
    content: "\f0f9"; }
  
  .fa-wheat-awn-circle-exclamation::before {
    content: "\e598"; }
  
  .fa-snowman::before {
    content: "\f7d0"; }
  
  .fa-mortar-pestle::before {
    content: "\f5a7"; }
  
  .fa-road-barrier::before {
    content: "\e562"; }
  
  .fa-school::before {
    content: "\f549"; }
  
  .fa-igloo::before {
    content: "\f7ae"; }
  
  .fa-joint::before {
    content: "\f595"; }
  
  .fa-angle-right::before {
    content: "\f105"; }
  
  .fa-horse::before {
    content: "\f6f0"; }
  
  .fa-q::before {
    content: "\51"; }
  
  .fa-g::before {
    content: "\47"; }
  
  .fa-notes-medical::before {
    content: "\f481"; }
  
  .fa-temperature-half::before {
    content: "\f2c9"; }
  
  .fa-temperature-2::before {
    content: "\f2c9"; }
  
  .fa-thermometer-2::before {
    content: "\f2c9"; }
  
  .fa-thermometer-half::before {
    content: "\f2c9"; }
  
  .fa-dong-sign::before {
    content: "\e169"; }
  
  .fa-capsules::before {
    content: "\f46b"; }
  
  .fa-poo-storm::before {
    content: "\f75a"; }
  
  .fa-poo-bolt::before {
    content: "\f75a"; }
  
  .fa-face-frown-open::before {
    content: "\f57a"; }
  
  .fa-frown-open::before {
    content: "\f57a"; }
  
  .fa-hand-point-up::before {
    content: "\f0a6"; }
  
  .fa-money-bill::before {
    content: "\f0d6"; }
  
  .fa-bookmark::before {
    content: "\f02e"; }
  
  .fa-align-justify::before {
    content: "\f039"; }
  
  .fa-umbrella-beach::before {
    content: "\f5ca"; }
  
  .fa-helmet-un::before {
    content: "\e503"; }
  
  .fa-bullseye::before {
    content: "\f140"; }
  
  .fa-bacon::before {
    content: "\f7e5"; }
  
  .fa-hand-point-down::before {
    content: "\f0a7"; }
  
  .fa-arrow-up-from-bracket::before {
    content: "\e09a"; }
  
  .fa-folder::before {
    content: "\f07b"; }
  
  .fa-folder-blank::before {
    content: "\f07b"; }
  
  .fa-file-waveform::before {
    content: "\f478"; }
  
  .fa-file-medical-alt::before {
    content: "\f478"; }
  
  .fa-radiation::before {
    content: "\f7b9"; }
  
  .fa-chart-simple::before {
    content: "\e473"; }
  
  .fa-mars-stroke::before {
    content: "\f229"; }
  
  .fa-vial::before {
    content: "\f492"; }
  
  .fa-gauge::before {
    content: "\f624"; }
  
  .fa-dashboard::before {
    content: "\f624"; }
  
  .fa-gauge-med::before {
    content: "\f624"; }
  
  .fa-tachometer-alt-average::before {
    content: "\f624"; }
  
  .fa-wand-magic-sparkles::before {
    content: "\e2ca"; }
  
  .fa-magic-wand-sparkles::before {
    content: "\e2ca"; }
  
  .fa-e::before {
    content: "\45"; }
  
  .fa-pen-clip::before {
    content: "\f305"; }
  
  .fa-pen-alt::before {
    content: "\f305"; }
  
  .fa-bridge-circle-exclamation::before {
    content: "\e4ca"; }
  
  .fa-user::before {
    content: "\f007"; }
  
  .fa-school-circle-check::before {
    content: "\e56b"; }
  
  .fa-dumpster::before {
    content: "\f793"; }
  
  .fa-van-shuttle::before {
    content: "\f5b6"; }
  
  .fa-shuttle-van::before {
    content: "\f5b6"; }
  
  .fa-building-user::before {
    content: "\e4da"; }
  
  .fa-square-caret-left::before {
    content: "\f191"; }
  
  .fa-caret-square-left::before {
    content: "\f191"; }
  
  .fa-highlighter::before {
    content: "\f591"; }
  
  .fa-key::before {
    content: "\f084"; }
  
  .fa-bullhorn::before {
    content: "\f0a1"; }
  
  .fa-globe::before {
    content: "\f0ac"; }
  
  .fa-synagogue::before {
    content: "\f69b"; }
  
  .fa-person-half-dress::before {
    content: "\e548"; }
  
  .fa-road-bridge::before {
    content: "\e563"; }
  
  .fa-location-arrow::before {
    content: "\f124"; }
  
  .fa-c::before {
    content: "\43"; }
  
  .fa-tablet-button::before {
    content: "\f10a"; }
  
  .fa-building-lock::before {
    content: "\e4d6"; }
  
  .fa-pizza-slice::before {
    content: "\f818"; }
  
  .fa-money-bill-wave::before {
    content: "\f53a"; }
  
  .fa-chart-area::before {
    content: "\f1fe"; }
  
  .fa-area-chart::before {
    content: "\f1fe"; }
  
  .fa-house-flag::before {
    content: "\e50d"; }
  
  .fa-person-circle-minus::before {
    content: "\e540"; }
  
  .fa-ban::before {
    content: "\f05e"; }
  
  .fa-cancel::before {
    content: "\f05e"; }
  
  .fa-camera-rotate::before {
    content: "\e0d8"; }
  
  .fa-spray-can-sparkles::before {
    content: "\f5d0"; }
  
  .fa-air-freshener::before {
    content: "\f5d0"; }
  
  .fa-star::before {
    content: "\f005"; }
  
  .fa-repeat::before {
    content: "\f363"; }
  
  .fa-cross::before {
    content: "\f654"; }
  
  .fa-box::before {
    content: "\f466"; }
  
  .fa-venus-mars::before {
    content: "\f228"; }
  
  .fa-arrow-pointer::before {
    content: "\f245"; }
  
  .fa-mouse-pointer::before {
    content: "\f245"; }
  
  .fa-maximize::before {
    content: "\f31e"; }
  
  .fa-expand-arrows-alt::before {
    content: "\f31e"; }
  
  .fa-charging-station::before {
    content: "\f5e7"; }
  
  .fa-shapes::before {
    content: "\f61f"; }
  
  .fa-triangle-circle-square::before {
    content: "\f61f"; }
  
  .fa-shuffle::before {
    content: "\f074"; }
  
  .fa-random::before {
    content: "\f074"; }
  
  .fa-person-running::before {
    content: "\f70c"; }
  
  .fa-running::before {
    content: "\f70c"; }
  
  .fa-mobile-retro::before {
    content: "\e527"; }
  
  .fa-grip-lines-vertical::before {
    content: "\f7a5"; }
  
  .fa-spider::before {
    content: "\f717"; }
  
  .fa-hands-bound::before {
    content: "\e4f9"; }
  
  .fa-file-invoice-dollar::before {
    content: "\f571"; }
  
  .fa-plane-circle-exclamation::before {
    content: "\e556"; }
  
  .fa-x-ray::before {
    content: "\f497"; }
  
  .fa-spell-check::before {
    content: "\f891"; }
  
  .fa-slash::before {
    content: "\f715"; }
  
  .fa-computer-mouse::before {
    content: "\f8cc"; }
  
  .fa-mouse::before {
    content: "\f8cc"; }
  
  .fa-arrow-right-to-bracket::before {
    content: "\f090"; }
  
  .fa-sign-in::before {
    content: "\f090"; }
  
  .fa-shop-slash::before {
    content: "\e070"; }
  
  .fa-store-alt-slash::before {
    content: "\e070"; }
  
  .fa-server::before {
    content: "\f233"; }
  
  .fa-virus-covid-slash::before {
    content: "\e4a9"; }
  
  .fa-shop-lock::before {
    content: "\e4a5"; }
  
  .fa-hourglass-start::before {
    content: "\f251"; }
  
  .fa-hourglass-1::before {
    content: "\f251"; }
  
  .fa-blender-phone::before {
    content: "\f6b6"; }
  
  .fa-building-wheat::before {
    content: "\e4db"; }
  
  .fa-person-breastfeeding::before {
    content: "\e53a"; }
  
  .fa-right-to-bracket::before {
    content: "\f2f6"; }
  
  .fa-sign-in-alt::before {
    content: "\f2f6"; }
  
  .fa-venus::before {
    content: "\f221"; }
  
  .fa-passport::before {
    content: "\f5ab"; }
  
  .fa-heart-pulse::before {
    content: "\f21e"; }
  
  .fa-heartbeat::before {
    content: "\f21e"; }
  
  .fa-people-carry-box::before {
    content: "\f4ce"; }
  
  .fa-people-carry::before {
    content: "\f4ce"; }
  
  .fa-temperature-high::before {
    content: "\f769"; }
  
  .fa-microchip::before {
    content: "\f2db"; }
  
  .fa-crown::before {
    content: "\f521"; }
  
  .fa-weight-hanging::before {
    content: "\f5cd"; }
  
  .fa-xmarks-lines::before {
    content: "\e59a"; }
  
  .fa-file-prescription::before {
    content: "\f572"; }
  
  .fa-weight-scale::before {
    content: "\f496"; }
  
  .fa-weight::before {
    content: "\f496"; }
  
  .fa-user-group::before {
    content: "\f500"; }
  
  .fa-user-friends::before {
    content: "\f500"; }
  
  .fa-arrow-up-a-z::before {
    content: "\f15e"; }
  
  .fa-sort-alpha-up::before {
    content: "\f15e"; }
  
  .fa-chess-knight::before {
    content: "\f441"; }
  
  .fa-face-laugh-squint::before {
    content: "\f59b"; }
  
  .fa-laugh-squint::before {
    content: "\f59b"; }
  
  .fa-wheelchair::before {
    content: "\f193"; }
  
  .fa-circle-arrow-up::before {
    content: "\f0aa"; }
  
  .fa-arrow-circle-up::before {
    content: "\f0aa"; }
  
  .fa-toggle-on::before {
    content: "\f205"; }
  
  .fa-person-walking::before {
    content: "\f554"; }
  
  .fa-walking::before {
    content: "\f554"; }
  
  .fa-l::before {
    content: "\4c"; }
  
  .fa-fire::before {
    content: "\f06d"; }
  
  .fa-bed-pulse::before {
    content: "\f487"; }
  
  .fa-procedures::before {
    content: "\f487"; }
  
  .fa-shuttle-space::before {
    content: "\f197"; }
  
  .fa-space-shuttle::before {
    content: "\f197"; }
  
  .fa-face-laugh::before {
    content: "\f599"; }
  
  .fa-laugh::before {
    content: "\f599"; }
  
  .fa-folder-open::before {
    content: "\f07c"; }
  
  .fa-heart-circle-plus::before {
    content: "\e500"; }
  
  .fa-code-fork::before {
    content: "\e13b"; }
  
  .fa-city::before {
    content: "\f64f"; }
  
  .fa-microphone-lines::before {
    content: "\f3c9"; }
  
  .fa-microphone-alt::before {
    content: "\f3c9"; }
  
  .fa-pepper-hot::before {
    content: "\f816"; }
  
  .fa-unlock::before {
    content: "\f09c"; }
  
  .fa-colon-sign::before {
    content: "\e140"; }
  
  .fa-headset::before {
    content: "\f590"; }
  
  .fa-store-slash::before {
    content: "\e071"; }
  
  .fa-road-circle-xmark::before {
    content: "\e566"; }
  
  .fa-user-minus::before {
    content: "\f503"; }
  
  .fa-mars-stroke-up::before {
    content: "\f22a"; }
  
  .fa-mars-stroke-v::before {
    content: "\f22a"; }
  
  .fa-champagne-glasses::before {
    content: "\f79f"; }
  
  .fa-glass-cheers::before {
    content: "\f79f"; }
  
  .fa-clipboard::before {
    content: "\f328"; }
  
  .fa-house-circle-exclamation::before {
    content: "\e50a"; }
  
  .fa-file-arrow-up::before {
    content: "\f574"; }
  
  .fa-file-upload::before {
    content: "\f574"; }
  
  .fa-wifi::before {
    content: "\f1eb"; }
  
  .fa-wifi-3::before {
    content: "\f1eb"; }
  
  .fa-wifi-strong::before {
    content: "\f1eb"; }
  
  .fa-bath::before {
    content: "\f2cd"; }
  
  .fa-bathtub::before {
    content: "\f2cd"; }
  
  .fa-underline::before {
    content: "\f0cd"; }
  
  .fa-user-pen::before {
    content: "\f4ff"; }
  
  .fa-user-edit::before {
    content: "\f4ff"; }
  
  .fa-signature::before {
    content: "\f5b7"; }
  
  .fa-stroopwafel::before {
    content: "\f551"; }
  
  .fa-bold::before {
    content: "\f032"; }
  
  .fa-anchor-lock::before {
    content: "\e4ad"; }
  
  .fa-building-ngo::before {
    content: "\e4d7"; }
  
  .fa-manat-sign::before {
    content: "\e1d5"; }
  
  .fa-not-equal::before {
    content: "\f53e"; }
  
  .fa-border-top-left::before {
    content: "\f853"; }
  
  .fa-border-style::before {
    content: "\f853"; }
  
  .fa-map-location-dot::before {
    content: "\f5a0"; }
  
  .fa-map-marked-alt::before {
    content: "\f5a0"; }
  
  .fa-jedi::before {
    content: "\f669"; }
  
  .fa-square-poll-vertical::before {
    content: "\f681"; }
  
  .fa-poll::before {
    content: "\f681"; }
  
  .fa-mug-hot::before {
    content: "\f7b6"; }
  
  .fa-car-battery::before {
    content: "\f5df"; }
  
  .fa-battery-car::before {
    content: "\f5df"; }
  
  .fa-gift::before {
    content: "\f06b"; }
  
  .fa-dice-two::before {
    content: "\f528"; }
  
  .fa-chess-queen::before {
    content: "\f445"; }
  
  .fa-glasses::before {
    content: "\f530"; }
  
  .fa-chess-board::before {
    content: "\f43c"; }
  
  .fa-building-circle-check::before {
    content: "\e4d2"; }
  
  .fa-person-chalkboard::before {
    content: "\e53d"; }
  
  .fa-mars-stroke-right::before {
    content: "\f22b"; }
  
  .fa-mars-stroke-h::before {
    content: "\f22b"; }
  
  .fa-hand-back-fist::before {
    content: "\f255"; }
  
  .fa-hand-rock::before {
    content: "\f255"; }
  
  .fa-square-caret-up::before {
    content: "\f151"; }
  
  .fa-caret-square-up::before {
    content: "\f151"; }
  
  .fa-cloud-showers-water::before {
    content: "\e4e4"; }
  
  .fa-chart-bar::before {
    content: "\f080"; }
  
  .fa-bar-chart::before {
    content: "\f080"; }
  
  .fa-hands-bubbles::before {
    content: "\e05e"; }
  
  .fa-hands-wash::before {
    content: "\e05e"; }
  
  .fa-less-than-equal::before {
    content: "\f537"; }
  
  .fa-train::before {
    content: "\f238"; }
  
  .fa-eye-low-vision::before {
    content: "\f2a8"; }
  
  .fa-low-vision::before {
    content: "\f2a8"; }
  
  .fa-crow::before {
    content: "\f520"; }
  
  .fa-sailboat::before {
    content: "\e445"; }
  
  .fa-window-restore::before {
    content: "\f2d2"; }
  
  .fa-square-plus::before {
    content: "\f0fe"; }
  
  .fa-plus-square::before {
    content: "\f0fe"; }
  
  .fa-torii-gate::before {
    content: "\f6a1"; }
  
  .fa-frog::before {
    content: "\f52e"; }
  
  .fa-bucket::before {
    content: "\e4cf"; }
  
  .fa-image::before {
    content: "\f03e"; }
  
  .fa-microphone::before {
    content: "\f130"; }
  
  .fa-cow::before {
    content: "\f6c8"; }
  
  .fa-caret-up::before {
    content: "\f0d8"; }
  
  .fa-screwdriver::before {
    content: "\f54a"; }
  
  .fa-folder-closed::before {
    content: "\e185"; }
  
  .fa-house-tsunami::before {
    content: "\e515"; }
  
  .fa-square-nfi::before {
    content: "\e576"; }
  
  .fa-arrow-up-from-ground-water::before {
    content: "\e4b5"; }
  
  .fa-martini-glass::before {
    content: "\f57b"; }
  
  .fa-glass-martini-alt::before {
    content: "\f57b"; }
  
  .fa-rotate-left::before {
    content: "\f2ea"; }
  
  .fa-rotate-back::before {
    content: "\f2ea"; }
  
  .fa-rotate-backward::before {
    content: "\f2ea"; }
  
  .fa-undo-alt::before {
    content: "\f2ea"; }
  
  .fa-table-columns::before {
    content: "\f0db"; }
  
  .fa-columns::before {
    content: "\f0db"; }
  
  .fa-lemon::before {
    content: "\f094"; }
  
  .fa-head-side-mask::before {
    content: "\e063"; }
  
  .fa-handshake::before {
    content: "\f2b5"; }
  
  .fa-gem::before {
    content: "\f3a5"; }
  
  .fa-dolly::before {
    content: "\f472"; }
  
  .fa-dolly-box::before {
    content: "\f472"; }
  
  .fa-smoking::before {
    content: "\f48d"; }
  
  .fa-minimize::before {
    content: "\f78c"; }
  
  .fa-compress-arrows-alt::before {
    content: "\f78c"; }
  
  .fa-monument::before {
    content: "\f5a6"; }
  
  .fa-snowplow::before {
    content: "\f7d2"; }
  
  .fa-angles-right::before {
    content: "\f101"; }
  
  .fa-angle-double-right::before {
    content: "\f101"; }
  
  .fa-cannabis::before {
    content: "\f55f"; }
  
  .fa-circle-play::before {
    content: "\f144"; }
  
  .fa-play-circle::before {
    content: "\f144"; }
  
  .fa-tablets::before {
    content: "\f490"; }
  
  .fa-ethernet::before {
    content: "\f796"; }
  
  .fa-euro-sign::before {
    content: "\f153"; }
  
  .fa-eur::before {
    content: "\f153"; }
  
  .fa-euro::before {
    content: "\f153"; }
  
  .fa-chair::before {
    content: "\f6c0"; }
  
  .fa-circle-check::before {
    content: "\f058"; }
  
  .fa-check-circle::before {
    content: "\f058"; }
  
  .fa-circle-stop::before {
    content: "\f28d"; }
  
  .fa-stop-circle::before {
    content: "\f28d"; }
  
  .fa-compass-drafting::before {
    content: "\f568"; }
  
  .fa-drafting-compass::before {
    content: "\f568"; }
  
  .fa-plate-wheat::before {
    content: "\e55a"; }
  
  .fa-icicles::before {
    content: "\f7ad"; }
  
  .fa-person-shelter::before {
    content: "\e54f"; }
  
  .fa-neuter::before {
    content: "\f22c"; }
  
  .fa-id-badge::before {
    content: "\f2c1"; }
  
  .fa-marker::before {
    content: "\f5a1"; }
  
  .fa-face-laugh-beam::before {
    content: "\f59a"; }
  
  .fa-laugh-beam::before {
    content: "\f59a"; }
  
  .fa-helicopter-symbol::before {
    content: "\e502"; }
  
  .fa-universal-access::before {
    content: "\f29a"; }
  
  .fa-circle-chevron-up::before {
    content: "\f139"; }
  
  .fa-chevron-circle-up::before {
    content: "\f139"; }
  
  .fa-lari-sign::before {
    content: "\e1c8"; }
  
  .fa-volcano::before {
    content: "\f770"; }
  
  .fa-person-walking-dashed-line-arrow-right::before {
    content: "\e553"; }
  
  .fa-sterling-sign::before {
    content: "\f154"; }
  
  .fa-gbp::before {
    content: "\f154"; }
  
  .fa-pound-sign::before {
    content: "\f154"; }
  
  .fa-viruses::before {
    content: "\e076"; }
  
  .fa-square-person-confined::before {
    content: "\e577"; }
  
  .fa-user-tie::before {
    content: "\f508"; }
  
  .fa-arrow-down-long::before {
    content: "\f175"; }
  
  .fa-long-arrow-down::before {
    content: "\f175"; }
  
  .fa-tent-arrow-down-to-line::before {
    content: "\e57e"; }
  
  .fa-certificate::before {
    content: "\f0a3"; }
  
  .fa-reply-all::before {
    content: "\f122"; }
  
  .fa-mail-reply-all::before {
    content: "\f122"; }
  
  .fa-suitcase::before {
    content: "\f0f2"; }
  
  .fa-person-skating::before {
    content: "\f7c5"; }
  
  .fa-skating::before {
    content: "\f7c5"; }
  
  .fa-filter-circle-dollar::before {
    content: "\f662"; }
  
  .fa-funnel-dollar::before {
    content: "\f662"; }
  
  .fa-camera-retro::before {
    content: "\f083"; }
  
  .fa-circle-arrow-down::before {
    content: "\f0ab"; }
  
  .fa-arrow-circle-down::before {
    content: "\f0ab"; }
  
  .fa-file-import::before {
    content: "\f56f"; }
  
  .fa-arrow-right-to-file::before {
    content: "\f56f"; }
  
  .fa-square-arrow-up-right::before {
    content: "\f14c"; }
  
  .fa-external-link-square::before {
    content: "\f14c"; }
  
  .fa-box-open::before {
    content: "\f49e"; }
  
  .fa-scroll::before {
    content: "\f70e"; }
  
  .fa-spa::before {
    content: "\f5bb"; }
  
  .fa-location-pin-lock::before {
    content: "\e51f"; }
  
  .fa-pause::before {
    content: "\f04c"; }
  
  .fa-hill-avalanche::before {
    content: "\e507"; }
  
  .fa-temperature-empty::before {
    content: "\f2cb"; }
  
  .fa-temperature-0::before {
    content: "\f2cb"; }
  
  .fa-thermometer-0::before {
    content: "\f2cb"; }
  
  .fa-thermometer-empty::before {
    content: "\f2cb"; }
  
  .fa-bomb::before {
    content: "\f1e2"; }
  
  .fa-registered::before {
    content: "\f25d"; }
  
  .fa-address-card::before {
    content: "\f2bb"; }
  
  .fa-contact-card::before {
    content: "\f2bb"; }
  
  .fa-vcard::before {
    content: "\f2bb"; }
  
  .fa-scale-unbalanced-flip::before {
    content: "\f516"; }
  
  .fa-balance-scale-right::before {
    content: "\f516"; }
  
  .fa-subscript::before {
    content: "\f12c"; }
  
  .fa-diamond-turn-right::before {
    content: "\f5eb"; }
  
  .fa-directions::before {
    content: "\f5eb"; }
  
  .fa-burst::before {
    content: "\e4dc"; }
  
  .fa-house-laptop::before {
    content: "\e066"; }
  
  .fa-laptop-house::before {
    content: "\e066"; }
  
  .fa-face-tired::before {
    content: "\f5c8"; }
  
  .fa-tired::before {
    content: "\f5c8"; }
  
  .fa-money-bills::before {
    content: "\e1f3"; }
  
  .fa-smog::before {
    content: "\f75f"; }
  
  .fa-crutch::before {
    content: "\f7f7"; }
  
  .fa-cloud-arrow-up::before {
    content: "\f0ee"; }
  
  .fa-cloud-upload::before {
    content: "\f0ee"; }
  
  .fa-cloud-upload-alt::before {
    content: "\f0ee"; }
  
  .fa-palette::before {
    content: "\f53f"; }
  
  .fa-arrows-turn-right::before {
    content: "\e4c0"; }
  
  .fa-vest::before {
    content: "\e085"; }
  
  .fa-ferry::before {
    content: "\e4ea"; }
  
  .fa-arrows-down-to-people::before {
    content: "\e4b9"; }
  
  .fa-seedling::before {
    content: "\f4d8"; }
  
  .fa-sprout::before {
    content: "\f4d8"; }
  
  .fa-left-right::before {
    content: "\f337"; }
  
  .fa-arrows-alt-h::before {
    content: "\f337"; }
  
  .fa-boxes-packing::before {
    content: "\e4c7"; }
  
  .fa-circle-arrow-left::before {
    content: "\f0a8"; }
  
  .fa-arrow-circle-left::before {
    content: "\f0a8"; }
  
  .fa-group-arrows-rotate::before {
    content: "\e4f6"; }
  
  .fa-bowl-food::before {
    content: "\e4c6"; }
  
  .fa-candy-cane::before {
    content: "\f786"; }
  
  .fa-arrow-down-wide-short::before {
    content: "\f160"; }
  
  .fa-sort-amount-asc::before {
    content: "\f160"; }
  
  .fa-sort-amount-down::before {
    content: "\f160"; }
  
  .fa-cloud-bolt::before {
    content: "\f76c"; }
  
  .fa-thunderstorm::before {
    content: "\f76c"; }
  
  .fa-text-slash::before {
    content: "\f87d"; }
  
  .fa-remove-format::before {
    content: "\f87d"; }
  
  .fa-face-smile-wink::before {
    content: "\f4da"; }
  
  .fa-smile-wink::before {
    content: "\f4da"; }
  
  .fa-file-word::before {
    content: "\f1c2"; }
  
  .fa-file-powerpoint::before {
    content: "\f1c4"; }
  
  .fa-arrows-left-right::before {
    content: "\f07e"; }
  
  .fa-arrows-h::before {
    content: "\f07e"; }
  
  .fa-house-lock::before {
    content: "\e510"; }
  
  .fa-cloud-arrow-down::before {
    content: "\f0ed"; }
  
  .fa-cloud-download::before {
    content: "\f0ed"; }
  
  .fa-cloud-download-alt::before {
    content: "\f0ed"; }
  
  .fa-children::before {
    content: "\e4e1"; }
  
  .fa-chalkboard::before {
    content: "\f51b"; }
  
  .fa-blackboard::before {
    content: "\f51b"; }
  
  .fa-user-large-slash::before {
    content: "\f4fa"; }
  
  .fa-user-alt-slash::before {
    content: "\f4fa"; }
  
  .fa-envelope-open::before {
    content: "\f2b6"; }
  
  .fa-handshake-simple-slash::before {
    content: "\e05f"; }
  
  .fa-handshake-alt-slash::before {
    content: "\e05f"; }
  
  .fa-mattress-pillow::before {
    content: "\e525"; }
  
  .fa-guarani-sign::before {
    content: "\e19a"; }
  
  .fa-arrows-rotate::before {
    content: "\f021"; }
  
  .fa-refresh::before {
    content: "\f021"; }
  
  .fa-sync::before {
    content: "\f021"; }
  
  .fa-fire-extinguisher::before {
    content: "\f134"; }
  
  .fa-cruzeiro-sign::before {
    content: "\e152"; }
  
  .fa-greater-than-equal::before {
    content: "\f532"; }
  
  .fa-shield-halved::before {
    content: "\f3ed"; }
  
  .fa-shield-alt::before {
    content: "\f3ed"; }
  
  .fa-book-atlas::before {
    content: "\f558"; }
  
  .fa-atlas::before {
    content: "\f558"; }
  
  .fa-virus::before {
    content: "\e074"; }
  
  .fa-envelope-circle-check::before {
    content: "\e4e8"; }
  
  .fa-layer-group::before {
    content: "\f5fd"; }
  
  .fa-arrows-to-dot::before {
    content: "\e4be"; }
  
  .fa-archway::before {
    content: "\f557"; }
  
  .fa-heart-circle-check::before {
    content: "\e4fd"; }
  
  .fa-house-chimney-crack::before {
    content: "\f6f1"; }
  
  .fa-house-damage::before {
    content: "\f6f1"; }
  
  .fa-file-zipper::before {
    content: "\f1c6"; }
  
  .fa-file-archive::before {
    content: "\f1c6"; }
  
  .fa-square::before {
    content: "\f0c8"; }
  
  .fa-martini-glass-empty::before {
    content: "\f000"; }
  
  .fa-glass-martini::before {
    content: "\f000"; }
  
  .fa-couch::before {
    content: "\f4b8"; }
  
  .fa-cedi-sign::before {
    content: "\e0df"; }
  
  .fa-italic::before {
    content: "\f033"; }
  
  .fa-church::before {
    content: "\f51d"; }
  
  .fa-comments-dollar::before {
    content: "\f653"; }
  
  .fa-democrat::before {
    content: "\f747"; }
  
  .fa-z::before {
    content: "\5a"; }
  
  .fa-person-skiing::before {
    content: "\f7c9"; }
  
  .fa-skiing::before {
    content: "\f7c9"; }
  
  .fa-road-lock::before {
    content: "\e567"; }
  
  .fa-a::before {
    content: "\41"; }
  
  .fa-temperature-arrow-down::before {
    content: "\e03f"; }
  
  .fa-temperature-down::before {
    content: "\e03f"; }
  
  .fa-feather-pointed::before {
    content: "\f56b"; }
  
  .fa-feather-alt::before {
    content: "\f56b"; }
  
  .fa-p::before {
    content: "\50"; }
  
  .fa-snowflake::before {
    content: "\f2dc"; }
  
  .fa-newspaper::before {
    content: "\f1ea"; }
  
  .fa-rectangle-ad::before {
    content: "\f641"; }
  
  .fa-ad::before {
    content: "\f641"; }
  
  .fa-circle-arrow-right::before {
    content: "\f0a9"; }
  
  .fa-arrow-circle-right::before {
    content: "\f0a9"; }
  
  .fa-filter-circle-xmark::before {
    content: "\e17b"; }
  
  .fa-locust::before {
    content: "\e520"; }
  
  .fa-sort::before {
    content: "\f0dc"; }
  
  .fa-unsorted::before {
    content: "\f0dc"; }
  
  .fa-list-ol::before {
    content: "\f0cb"; }
  
  .fa-list-1-2::before {
    content: "\f0cb"; }
  
  .fa-list-numeric::before {
    content: "\f0cb"; }
  
  .fa-person-dress-burst::before {
    content: "\e544"; }
  
  .fa-money-check-dollar::before {
    content: "\f53d"; }
  
  .fa-money-check-alt::before {
    content: "\f53d"; }
  
  .fa-vector-square::before {
    content: "\f5cb"; }
  
  .fa-bread-slice::before {
    content: "\f7ec"; }
  
  .fa-language::before {
    content: "\f1ab"; }
  
  .fa-face-kiss-wink-heart::before {
    content: "\f598"; }
  
  .fa-kiss-wink-heart::before {
    content: "\f598"; }
  
  .fa-filter::before {
    content: "\f0b0"; }
  
  .fa-question::before {
    content: "\3f"; }
  
  .fa-file-signature::before {
    content: "\f573"; }
  
  .fa-up-down-left-right::before {
    content: "\f0b2"; }
  
  .fa-arrows-alt::before {
    content: "\f0b2"; }
  
  .fa-house-chimney-user::before {
    content: "\e065"; }
  
  .fa-hand-holding-heart::before {
    content: "\f4be"; }
  
  .fa-puzzle-piece::before {
    content: "\f12e"; }
  
  .fa-money-check::before {
    content: "\f53c"; }
  
  .fa-star-half-stroke::before {
    content: "\f5c0"; }
  
  .fa-star-half-alt::before {
    content: "\f5c0"; }
  
  .fa-code::before {
    content: "\f121"; }
  
  .fa-whiskey-glass::before {
    content: "\f7a0"; }
  
  .fa-glass-whiskey::before {
    content: "\f7a0"; }
  
  .fa-building-circle-exclamation::before {
    content: "\e4d3"; }
  
  .fa-magnifying-glass-chart::before {
    content: "\e522"; }
  
  .fa-arrow-up-right-from-square::before {
    content: "\f08e"; }
  
  .fa-external-link::before {
    content: "\f08e"; }
  
  .fa-cubes-stacked::before {
    content: "\e4e6"; }
  
  .fa-won-sign::before {
    content: "\f159"; }
  
  .fa-krw::before {
    content: "\f159"; }
  
  .fa-won::before {
    content: "\f159"; }
  
  .fa-virus-covid::before {
    content: "\e4a8"; }
  
  .fa-austral-sign::before {
    content: "\e0a9"; }
  
  .fa-f::before {
    content: "\46"; }
  
  .fa-leaf::before {
    content: "\f06c"; }
  
  .fa-road::before {
    content: "\f018"; }
  
  .fa-taxi::before {
    content: "\f1ba"; }
  
  .fa-cab::before {
    content: "\f1ba"; }
  
  .fa-person-circle-plus::before {
    content: "\e541"; }
  
  .fa-chart-pie::before {
    content: "\f200"; }
  
  .fa-pie-chart::before {
    content: "\f200"; }
  
  .fa-bolt-lightning::before {
    content: "\e0b7"; }
  
  .fa-sack-xmark::before {
    content: "\e56a"; }
  
  .fa-file-excel::before {
    content: "\f1c3"; }
  
  .fa-file-contract::before {
    content: "\f56c"; }
  
  .fa-fish-fins::before {
    content: "\e4f2"; }
  
  .fa-building-flag::before {
    content: "\e4d5"; }
  
  .fa-face-grin-beam::before {
    content: "\f582"; }
  
  .fa-grin-beam::before {
    content: "\f582"; }
  
  .fa-object-ungroup::before {
    content: "\f248"; }
  
  .fa-poop::before {
    content: "\f619"; }
  
  .fa-location-pin::before {
    content: "\f041"; }
  
  .fa-map-marker::before {
    content: "\f041"; }
  
  .fa-kaaba::before {
    content: "\f66b"; }
  
  .fa-toilet-paper::before {
    content: "\f71e"; }
  
  .fa-helmet-safety::before {
    content: "\f807"; }
  
  .fa-hard-hat::before {
    content: "\f807"; }
  
  .fa-hat-hard::before {
    content: "\f807"; }
  
  .fa-eject::before {
    content: "\f052"; }
  
  .fa-circle-right::before {
    content: "\f35a"; }
  
  .fa-arrow-alt-circle-right::before {
    content: "\f35a"; }
  
  .fa-plane-circle-check::before {
    content: "\e555"; }
  
  .fa-face-rolling-eyes::before {
    content: "\f5a5"; }
  
  .fa-meh-rolling-eyes::before {
    content: "\f5a5"; }
  
  .fa-object-group::before {
    content: "\f247"; }
  
  .fa-chart-line::before {
    content: "\f201"; }
  
  .fa-line-chart::before {
    content: "\f201"; }
  
  .fa-mask-ventilator::before {
    content: "\e524"; }
  
  .fa-arrow-right::before {
    content: "\f061"; }
  
  .fa-signs-post::before {
    content: "\f277"; }
  
  .fa-map-signs::before {
    content: "\f277"; }
  
  .fa-cash-register::before {
    content: "\f788"; }
  
  .fa-person-circle-question::before {
    content: "\e542"; }
  
  .fa-h::before {
    content: "\48"; }
  
  .fa-tarp::before {
    content: "\e57b"; }
  
  .fa-screwdriver-wrench::before {
    content: "\f7d9"; }
  
  .fa-tools::before {
    content: "\f7d9"; }
  
  .fa-arrows-to-eye::before {
    content: "\e4bf"; }
  
  .fa-plug-circle-bolt::before {
    content: "\e55b"; }
  
  .fa-heart::before {
    content: "\f004"; }
  
  .fa-mars-and-venus::before {
    content: "\f224"; }
  
  .fa-house-user::before {
    content: "\e1b0"; }
  
  .fa-home-user::before {
    content: "\e1b0"; }
  
  .fa-dumpster-fire::before {
    content: "\f794"; }
  
  .fa-house-crack::before {
    content: "\e3b1"; }
  
  .fa-martini-glass-citrus::before {
    content: "\f561"; }
  
  .fa-cocktail::before {
    content: "\f561"; }
  
  .fa-face-surprise::before {
    content: "\f5c2"; }
  
  .fa-surprise::before {
    content: "\f5c2"; }
  
  .fa-bottle-water::before {
    content: "\e4c5"; }
  
  .fa-circle-pause::before {
    content: "\f28b"; }
  
  .fa-pause-circle::before {
    content: "\f28b"; }
  
  .fa-toilet-paper-slash::before {
    content: "\e072"; }
  
  .fa-apple-whole::before {
    content: "\f5d1"; }
  
  .fa-apple-alt::before {
    content: "\f5d1"; }
  
  .fa-kitchen-set::before {
    content: "\e51a"; }
  
  .fa-r::before {
    content: "\52"; }
  
  .fa-temperature-quarter::before {
    content: "\f2ca"; }
  
  .fa-temperature-1::before {
    content: "\f2ca"; }
  
  .fa-thermometer-1::before {
    content: "\f2ca"; }
  
  .fa-thermometer-quarter::before {
    content: "\f2ca"; }
  
  .fa-cube::before {
    content: "\f1b2"; }
  
  .fa-bitcoin-sign::before {
    content: "\e0b4"; }
  
  .fa-shield-dog::before {
    content: "\e573"; }
  
  .fa-solar-panel::before {
    content: "\f5ba"; }
  
  .fa-lock-open::before {
    content: "\f3c1"; }
  
  .fa-elevator::before {
    content: "\e16d"; }
  
  .fa-money-bill-transfer::before {
    content: "\e528"; }
  
  .fa-money-bill-trend-up::before {
    content: "\e529"; }
  
  .fa-house-flood-water-circle-arrow-right::before {
    content: "\e50f"; }
  
  .fa-square-poll-horizontal::before {
    content: "\f682"; }
  
  .fa-poll-h::before {
    content: "\f682"; }
  
  .fa-circle::before {
    content: "\f111"; }
  
  .fa-backward-fast::before {
    content: "\f049"; }
  
  .fa-fast-backward::before {
    content: "\f049"; }
  
  .fa-recycle::before {
    content: "\f1b8"; }
  
  .fa-user-astronaut::before {
    content: "\f4fb"; }
  
  .fa-plane-slash::before {
    content: "\e069"; }
  
  .fa-trademark::before {
    content: "\f25c"; }
  
  .fa-basketball::before {
    content: "\f434"; }
  
  .fa-basketball-ball::before {
    content: "\f434"; }
  
  .fa-satellite-dish::before {
    content: "\f7c0"; }
  
  .fa-circle-up::before {
    content: "\f35b"; }
  
  .fa-arrow-alt-circle-up::before {
    content: "\f35b"; }
  
  .fa-mobile-screen-button::before {
    content: "\f3cd"; }
  
  .fa-mobile-alt::before {
    content: "\f3cd"; }
  
  .fa-volume-high::before {
    content: "\f028"; }
  
  .fa-volume-up::before {
    content: "\f028"; }
  
  .fa-users-rays::before {
    content: "\e593"; }
  
  .fa-wallet::before {
    content: "\f555"; }
  
  .fa-clipboard-check::before {
    content: "\f46c"; }
  
  .fa-file-audio::before {
    content: "\f1c7"; }
  
  .fa-burger::before {
    content: "\f805"; }
  
  .fa-hamburger::before {
    content: "\f805"; }
  
  .fa-wrench::before {
    content: "\f0ad"; }
  
  .fa-bugs::before {
    content: "\e4d0"; }
  
  .fa-rupee-sign::before {
    content: "\f156"; }
  
  .fa-rupee::before {
    content: "\f156"; }
  
  .fa-file-image::before {
    content: "\f1c5"; }
  
  .fa-circle-question::before {
    content: "\f059"; }
  
  .fa-question-circle::before {
    content: "\f059"; }
  
  .fa-plane-departure::before {
    content: "\f5b0"; }
  
  .fa-handshake-slash::before {
    content: "\e060"; }
  
  .fa-book-bookmark::before {
    content: "\e0bb"; }
  
  .fa-code-branch::before {
    content: "\f126"; }
  
  .fa-hat-cowboy::before {
    content: "\f8c0"; }
  
  .fa-bridge::before {
    content: "\e4c8"; }
  
  .fa-phone-flip::before {
    content: "\f879"; }
  
  .fa-phone-alt::before {
    content: "\f879"; }
  
  .fa-truck-front::before {
    content: "\e2b7"; }
  
  .fa-cat::before {
    content: "\f6be"; }
  
  .fa-anchor-circle-exclamation::before {
    content: "\e4ab"; }
  
  .fa-truck-field::before {
    content: "\e58d"; }
  
  .fa-route::before {
    content: "\f4d7"; }
  
  .fa-clipboard-question::before {
    content: "\e4e3"; }
  
  .fa-panorama::before {
    content: "\e209"; }
  
  .fa-comment-medical::before {
    content: "\f7f5"; }
  
  .fa-teeth-open::before {
    content: "\f62f"; }
  
  .fa-file-circle-minus::before {
    content: "\e4ed"; }
  
  .fa-tags::before {
    content: "\f02c"; }
  
  .fa-wine-glass::before {
    content: "\f4e3"; }
  
  .fa-forward-fast::before {
    content: "\f050"; }
  
  .fa-fast-forward::before {
    content: "\f050"; }
  
  .fa-face-meh-blank::before {
    content: "\f5a4"; }
  
  .fa-meh-blank::before {
    content: "\f5a4"; }
  
  .fa-square-parking::before {
    content: "\f540"; }
  
  .fa-parking::before {
    content: "\f540"; }
  
  .fa-house-signal::before {
    content: "\e012"; }
  
  .fa-bars-progress::before {
    content: "\f828"; }
  
  .fa-tasks-alt::before {
    content: "\f828"; }
  
  .fa-faucet-drip::before {
    content: "\e006"; }
  
  .fa-cart-flatbed::before {
    content: "\f474"; }
  
  .fa-dolly-flatbed::before {
    content: "\f474"; }
  
  .fa-ban-smoking::before {
    content: "\f54d"; }
  
  .fa-smoking-ban::before {
    content: "\f54d"; }
  
  .fa-terminal::before {
    content: "\f120"; }
  
  .fa-mobile-button::before {
    content: "\f10b"; }
  
  .fa-house-medical-flag::before {
    content: "\e514"; }
  
  .fa-basket-shopping::before {
    content: "\f291"; }
  
  .fa-shopping-basket::before {
    content: "\f291"; }
  
  .fa-tape::before {
    content: "\f4db"; }
  
  .fa-bus-simple::before {
    content: "\f55e"; }
  
  .fa-bus-alt::before {
    content: "\f55e"; }
  
  .fa-eye::before {
    content: "\f06e"; }
  
  .fa-face-sad-cry::before {
    content: "\f5b3"; }
  
  .fa-sad-cry::before {
    content: "\f5b3"; }
  
  .fa-audio-description::before {
    content: "\f29e"; }
  
  .fa-person-military-to-person::before {
    content: "\e54c"; }
  
  .fa-file-shield::before {
    content: "\e4f0"; }
  
  .fa-user-slash::before {
    content: "\f506"; }
  
  .fa-pen::before {
    content: "\f304"; }
  
  .fa-tower-observation::before {
    content: "\e586"; }
  
  .fa-file-code::before {
    content: "\f1c9"; }
  
  .fa-signal::before {
    content: "\f012"; }
  
  .fa-signal-5::before {
    content: "\f012"; }
  
  .fa-signal-perfect::before {
    content: "\f012"; }
  
  .fa-bus::before {
    content: "\f207"; }
  
  .fa-heart-circle-xmark::before {
    content: "\e501"; }
  
  .fa-house-chimney::before {
    content: "\e3af"; }
  
  .fa-home-lg::before {
    content: "\e3af"; }
  
  .fa-window-maximize::before {
    content: "\f2d0"; }
  
  .fa-face-frown::before {
    content: "\f119"; }
  
  .fa-frown::before {
    content: "\f119"; }
  
  .fa-prescription::before {
    content: "\f5b1"; }
  
  .fa-shop::before {
    content: "\f54f"; }
  
  .fa-store-alt::before {
    content: "\f54f"; }
  
  .fa-floppy-disk::before {
    content: "\f0c7"; }
  
  .fa-save::before {
    content: "\f0c7"; }
  
  .fa-vihara::before {
    content: "\f6a7"; }
  
  .fa-scale-unbalanced::before {
    content: "\f515"; }
  
  .fa-balance-scale-left::before {
    content: "\f515"; }
  
  .fa-sort-up::before {
    content: "\f0de"; }
  
  .fa-sort-asc::before {
    content: "\f0de"; }
  
  .fa-comment-dots::before {
    content: "\f4ad"; }
  
  .fa-commenting::before {
    content: "\f4ad"; }
  
  .fa-plant-wilt::before {
    content: "\e5aa"; }
  
  .fa-diamond::before {
    content: "\f219"; }
  
  .fa-face-grin-squint::before {
    content: "\f585"; }
  
  .fa-grin-squint::before {
    content: "\f585"; }
  
  .fa-hand-holding-dollar::before {
    content: "\f4c0"; }
  
  .fa-hand-holding-usd::before {
    content: "\f4c0"; }
  
  .fa-bacterium::before {
    content: "\e05a"; }
  
  .fa-hand-pointer::before {
    content: "\f25a"; }
  
  .fa-drum-steelpan::before {
    content: "\f56a"; }
  
  .fa-hand-scissors::before {
    content: "\f257"; }
  
  .fa-hands-praying::before {
    content: "\f684"; }
  
  .fa-praying-hands::before {
    content: "\f684"; }
  
  .fa-arrow-rotate-right::before {
    content: "\f01e"; }
  
  .fa-arrow-right-rotate::before {
    content: "\f01e"; }
  
  .fa-arrow-rotate-forward::before {
    content: "\f01e"; }
  
  .fa-redo::before {
    content: "\f01e"; }
  
  .fa-biohazard::before {
    content: "\f780"; }
  
  .fa-location-crosshairs::before {
    content: "\f601"; }
  
  .fa-location::before {
    content: "\f601"; }
  
  .fa-mars-double::before {
    content: "\f227"; }
  
  .fa-child-dress::before {
    content: "\e59c"; }
  
  .fa-users-between-lines::before {
    content: "\e591"; }
  
  .fa-lungs-virus::before {
    content: "\e067"; }
  
  .fa-face-grin-tears::before {
    content: "\f588"; }
  
  .fa-grin-tears::before {
    content: "\f588"; }
  
  .fa-phone::before {
    content: "\f095"; }
  
  .fa-calendar-xmark::before {
    content: "\f273"; }
  
  .fa-calendar-times::before {
    content: "\f273"; }
  
  .fa-child-reaching::before {
    content: "\e59d"; }
  
  .fa-head-side-virus::before {
    content: "\e064"; }
  
  .fa-user-gear::before {
    content: "\f4fe"; }
  
  .fa-user-cog::before {
    content: "\f4fe"; }
  
  .fa-arrow-up-1-9::before {
    content: "\f163"; }
  
  .fa-sort-numeric-up::before {
    content: "\f163"; }
  
  .fa-door-closed::before {
    content: "\f52a"; }
  
  .fa-shield-virus::before {
    content: "\e06c"; }
  
  .fa-dice-six::before {
    content: "\f526"; }
  
  .fa-mosquito-net::before {
    content: "\e52c"; }
  
  .fa-bridge-water::before {
    content: "\e4ce"; }
  
  .fa-person-booth::before {
    content: "\f756"; }
  
  .fa-text-width::before {
    content: "\f035"; }
  
  .fa-hat-wizard::before {
    content: "\f6e8"; }
  
  .fa-pen-fancy::before {
    content: "\f5ac"; }
  
  .fa-person-digging::before {
    content: "\f85e"; }
  
  .fa-digging::before {
    content: "\f85e"; }
  
  .fa-trash::before {
    content: "\f1f8"; }
  
  .fa-gauge-simple::before {
    content: "\f629"; }
  
  .fa-gauge-simple-med::before {
    content: "\f629"; }
  
  .fa-tachometer-average::before {
    content: "\f629"; }
  
  .fa-book-medical::before {
    content: "\f7e6"; }
  
  .fa-poo::before {
    content: "\f2fe"; }
  
  .fa-quote-right::before {
    content: "\f10e"; }
  
  .fa-quote-right-alt::before {
    content: "\f10e"; }
  
  .fa-shirt::before {
    content: "\f553"; }
  
  .fa-t-shirt::before {
    content: "\f553"; }
  
  .fa-tshirt::before {
    content: "\f553"; }
  
  .fa-cubes::before {
    content: "\f1b3"; }
  
  .fa-divide::before {
    content: "\f529"; }
  
  .fa-tenge-sign::before {
    content: "\f7d7"; }
  
  .fa-tenge::before {
    content: "\f7d7"; }
  
  .fa-headphones::before {
    content: "\f025"; }
  
  .fa-hands-holding::before {
    content: "\f4c2"; }
  
  .fa-hands-clapping::before {
    content: "\e1a8"; }
  
  .fa-republican::before {
    content: "\f75e"; }
  
  .fa-arrow-left::before {
    content: "\f060"; }
  
  .fa-person-circle-xmark::before {
    content: "\e543"; }
  
  .fa-ruler::before {
    content: "\f545"; }
  
  .fa-align-left::before {
    content: "\f036"; }
  
  .fa-dice-d6::before {
    content: "\f6d1"; }
  
  .fa-restroom::before {
    content: "\f7bd"; }
  
  .fa-j::before {
    content: "\4a"; }
  
  .fa-users-viewfinder::before {
    content: "\e595"; }
  
  .fa-file-video::before {
    content: "\f1c8"; }
  
  .fa-up-right-from-square::before {
    content: "\f35d"; }
  
  .fa-external-link-alt::before {
    content: "\f35d"; }
  
  .fa-table-cells::before {
    content: "\f00a"; }
  
  .fa-th::before {
    content: "\f00a"; }
  
  .fa-file-pdf::before {
    content: "\f1c1"; }
  
  .fa-book-bible::before {
    content: "\f647"; }
  
  .fa-bible::before {
    content: "\f647"; }
  
  .fa-o::before {
    content: "\4f"; }
  
  .fa-suitcase-medical::before {
    content: "\f0fa"; }
  
  .fa-medkit::before {
    content: "\f0fa"; }
  
  .fa-user-secret::before {
    content: "\f21b"; }
  
  .fa-otter::before {
    content: "\f700"; }
  
  .fa-person-dress::before {
    content: "\f182"; }
  
  .fa-female::before {
    content: "\f182"; }
  
  .fa-comment-dollar::before {
    content: "\f651"; }
  
  .fa-business-time::before {
    content: "\f64a"; }
  
  .fa-briefcase-clock::before {
    content: "\f64a"; }
  
  .fa-table-cells-large::before {
    content: "\f009"; }
  
  .fa-th-large::before {
    content: "\f009"; }
  
  .fa-book-tanakh::before {
    content: "\f827"; }
  
  .fa-tanakh::before {
    content: "\f827"; }
  
  .fa-phone-volume::before {
    content: "\f2a0"; }
  
  .fa-volume-control-phone::before {
    content: "\f2a0"; }
  
  .fa-hat-cowboy-side::before {
    content: "\f8c1"; }
  
  .fa-clipboard-user::before {
    content: "\f7f3"; }
  
  .fa-child::before {
    content: "\f1ae"; }
  
  .fa-lira-sign::before {
    content: "\f195"; }
  
  .fa-satellite::before {
    content: "\f7bf"; }
  
  .fa-plane-lock::before {
    content: "\e558"; }
  
  .fa-tag::before {
    content: "\f02b"; }
  
  .fa-comment::before {
    content: "\f075"; }
  
  .fa-cake-candles::before {
    content: "\f1fd"; }
  
  .fa-birthday-cake::before {
    content: "\f1fd"; }
  
  .fa-cake::before {
    content: "\f1fd"; }
  
  .fa-envelope::before {
    content: "\f0e0"; }
  
  .fa-angles-up::before {
    content: "\f102"; }
  
  .fa-angle-double-up::before {
    content: "\f102"; }
  
  .fa-paperclip::before {
    content: "\f0c6"; }
  
  .fa-arrow-right-to-city::before {
    content: "\e4b3"; }
  
  .fa-ribbon::before {
    content: "\f4d6"; }
  
  .fa-lungs::before {
    content: "\f604"; }
  
  .fa-arrow-up-9-1::before {
    content: "\f887"; }
  
  .fa-sort-numeric-up-alt::before {
    content: "\f887"; }
  
  .fa-litecoin-sign::before {
    content: "\e1d3"; }
  
  .fa-border-none::before {
    content: "\f850"; }
  
  .fa-circle-nodes::before {
    content: "\e4e2"; }
  
  .fa-parachute-box::before {
    content: "\f4cd"; }
  
  .fa-indent::before {
    content: "\f03c"; }
  
  .fa-truck-field-un::before {
    content: "\e58e"; }
  
  .fa-hourglass::before {
    content: "\f254"; }
  
  .fa-hourglass-empty::before {
    content: "\f254"; }
  
  .fa-mountain::before {
    content: "\f6fc"; }
  
  .fa-user-doctor::before {
    content: "\f0f0"; }
  
  .fa-user-md::before {
    content: "\f0f0"; }
  
  .fa-circle-info::before {
    content: "\f05a"; }
  
  .fa-info-circle::before {
    content: "\f05a"; }
  
  .fa-cloud-meatball::before {
    content: "\f73b"; }
  
  .fa-camera::before {
    content: "\f030"; }
  
  .fa-camera-alt::before {
    content: "\f030"; }
  
  .fa-square-virus::before {
    content: "\e578"; }
  
  .fa-meteor::before {
    content: "\f753"; }
  
  .fa-car-on::before {
    content: "\e4dd"; }
  
  .fa-sleigh::before {
    content: "\f7cc"; }
  
  .fa-arrow-down-1-9::before {
    content: "\f162"; }
  
  .fa-sort-numeric-asc::before {
    content: "\f162"; }
  
  .fa-sort-numeric-down::before {
    content: "\f162"; }
  
  .fa-hand-holding-droplet::before {
    content: "\f4c1"; }
  
  .fa-hand-holding-water::before {
    content: "\f4c1"; }
  
  .fa-water::before {
    content: "\f773"; }
  
  .fa-calendar-check::before {
    content: "\f274"; }
  
  .fa-braille::before {
    content: "\f2a1"; }
  
  .fa-prescription-bottle-medical::before {
    content: "\f486"; }
  
  .fa-prescription-bottle-alt::before {
    content: "\f486"; }
  
  .fa-landmark::before {
    content: "\f66f"; }
  
  .fa-truck::before {
    content: "\f0d1"; }
  
  .fa-crosshairs::before {
    content: "\f05b"; }
  
  .fa-person-cane::before {
    content: "\e53c"; }
  
  .fa-tent::before {
    content: "\e57d"; }
  
  .fa-vest-patches::before {
    content: "\e086"; }
  
  .fa-check-double::before {
    content: "\f560"; }
  
  .fa-arrow-down-a-z::before {
    content: "\f15d"; }
  
  .fa-sort-alpha-asc::before {
    content: "\f15d"; }
  
  .fa-sort-alpha-down::before {
    content: "\f15d"; }
  
  .fa-money-bill-wheat::before {
    content: "\e52a"; }
  
  .fa-cookie::before {
    content: "\f563"; }
  
  .fa-arrow-rotate-left::before {
    content: "\f0e2"; }
  
  .fa-arrow-left-rotate::before {
    content: "\f0e2"; }
  
  .fa-arrow-rotate-back::before {
    content: "\f0e2"; }
  
  .fa-arrow-rotate-backward::before {
    content: "\f0e2"; }
  
  .fa-undo::before {
    content: "\f0e2"; }
  
  .fa-hard-drive::before {
    content: "\f0a0"; }
  
  .fa-hdd::before {
    content: "\f0a0"; }
  
  .fa-face-grin-squint-tears::before {
    content: "\f586"; }
  
  .fa-grin-squint-tears::before {
    content: "\f586"; }
  
  .fa-dumbbell::before {
    content: "\f44b"; }
  
  .fa-rectangle-list::before {
    content: "\f022"; }
  
  .fa-list-alt::before {
    content: "\f022"; }
  
  .fa-tarp-droplet::before {
    content: "\e57c"; }
  
  .fa-house-medical-circle-check::before {
    content: "\e511"; }
  
  .fa-person-skiing-nordic::before {
    content: "\f7ca"; }
  
  .fa-skiing-nordic::before {
    content: "\f7ca"; }
  
  .fa-calendar-plus::before {
    content: "\f271"; }
  
  .fa-plane-arrival::before {
    content: "\f5af"; }
  
  .fa-circle-left::before {
    content: "\f359"; }
  
  .fa-arrow-alt-circle-left::before {
    content: "\f359"; }
  
  .fa-train-subway::before {
    content: "\f239"; }
  
  .fa-subway::before {
    content: "\f239"; }
  
  .fa-chart-gantt::before {
    content: "\e0e4"; }
  
  .fa-indian-rupee-sign::before {
    content: "\e1bc"; }
  
  .fa-indian-rupee::before {
    content: "\e1bc"; }
  
  .fa-inr::before {
    content: "\e1bc"; }
  
  .fa-crop-simple::before {
    content: "\f565"; }
  
  .fa-crop-alt::before {
    content: "\f565"; }
  
  .fa-money-bill-1::before {
    content: "\f3d1"; }
  
  .fa-money-bill-alt::before {
    content: "\f3d1"; }
  
  .fa-left-long::before {
    content: "\f30a"; }
  
  .fa-long-arrow-alt-left::before {
    content: "\f30a"; }
  
  .fa-dna::before {
    content: "\f471"; }
  
  .fa-virus-slash::before {
    content: "\e075"; }
  
  .fa-minus::before {
    content: "\f068"; }
  
  .fa-subtract::before {
    content: "\f068"; }
  
  .fa-chess::before {
    content: "\f439"; }
  
  .fa-arrow-left-long::before {
    content: "\f177"; }
  
  .fa-long-arrow-left::before {
    content: "\f177"; }
  
  .fa-plug-circle-check::before {
    content: "\e55c"; }
  
  .fa-street-view::before {
    content: "\f21d"; }
  
  .fa-franc-sign::before {
    content: "\e18f"; }
  
  .fa-volume-off::before {
    content: "\f026"; }
  
  .fa-hands-asl-interpreting::before {
    content: "\f2a3"; }
  
  .fa-american-sign-language-interpreting::before {
    content: "\f2a3"; }
  
  .fa-asl-interpreting::before {
    content: "\f2a3"; }
  
  .fa-hands-american-sign-language-interpreting::before {
    content: "\f2a3"; }
  
  .fa-gear::before {
    content: "\f013"; }
  
  .fa-cog::before {
    content: "\f013"; }
  
  .fa-droplet-slash::before {
    content: "\f5c7"; }
  
  .fa-tint-slash::before {
    content: "\f5c7"; }
  
  .fa-mosque::before {
    content: "\f678"; }
  
  .fa-mosquito::before {
    content: "\e52b"; }
  
  .fa-star-of-david::before {
    content: "\f69a"; }
  
  .fa-person-military-rifle::before {
    content: "\e54b"; }
  
  .fa-cart-shopping::before {
    content: "\f07a"; }
  
  .fa-shopping-cart::before {
    content: "\f07a"; }
  
  .fa-vials::before {
    content: "\f493"; }
  
  .fa-plug-circle-plus::before {
    content: "\e55f"; }
  
  .fa-place-of-worship::before {
    content: "\f67f"; }
  
  .fa-grip-vertical::before {
    content: "\f58e"; }
  
  .fa-arrow-turn-up::before {
    content: "\f148"; }
  
  .fa-level-up::before {
    content: "\f148"; }
  
  .fa-u::before {
    content: "\55"; }
  
  .fa-square-root-variable::before {
    content: "\f698"; }
  
  .fa-square-root-alt::before {
    content: "\f698"; }
  
  .fa-clock::before {
    content: "\f017"; }
  
  .fa-clock-four::before {
    content: "\f017"; }
  
  .fa-backward-step::before {
    content: "\f048"; }
  
  .fa-step-backward::before {
    content: "\f048"; }
  
  .fa-pallet::before {
    content: "\f482"; }
  
  .fa-faucet::before {
    content: "\e005"; }
  
  .fa-baseball-bat-ball::before {
    content: "\f432"; }
  
  .fa-s::before {
    content: "\53"; }
  
  .fa-timeline::before {
    content: "\e29c"; }
  
  .fa-keyboard::before {
    content: "\f11c"; }
  
  .fa-caret-down::before {
    content: "\f0d7"; }
  
  .fa-house-chimney-medical::before {
    content: "\f7f2"; }
  
  .fa-clinic-medical::before {
    content: "\f7f2"; }
  
  .fa-temperature-three-quarters::before {
    content: "\f2c8"; }
  
  .fa-temperature-3::before {
    content: "\f2c8"; }
  
  .fa-thermometer-3::before {
    content: "\f2c8"; }
  
  .fa-thermometer-three-quarters::before {
    content: "\f2c8"; }
  
  .fa-mobile-screen::before {
    content: "\f3cf"; }
  
  .fa-mobile-android-alt::before {
    content: "\f3cf"; }
  
  .fa-plane-up::before {
    content: "\e22d"; }
  
  .fa-piggy-bank::before {
    content: "\f4d3"; }
  
  .fa-battery-half::before {
    content: "\f242"; }
  
  .fa-battery-3::before {
    content: "\f242"; }
  
  .fa-mountain-city::before {
    content: "\e52e"; }
  
  .fa-coins::before {
    content: "\f51e"; }
  
  .fa-khanda::before {
    content: "\f66d"; }
  
  .fa-sliders::before {
    content: "\f1de"; }
  
  .fa-sliders-h::before {
    content: "\f1de"; }
  
  .fa-folder-tree::before {
    content: "\f802"; }
  
  .fa-network-wired::before {
    content: "\f6ff"; }
  
  .fa-map-pin::before {
    content: "\f276"; }
  
  .fa-hamsa::before {
    content: "\f665"; }
  
  .fa-cent-sign::before {
    content: "\e3f5"; }
  
  .fa-flask::before {
    content: "\f0c3"; }
  
  .fa-person-pregnant::before {
    content: "\e31e"; }
  
  .fa-wand-sparkles::before {
    content: "\f72b"; }
  
  .fa-ellipsis-vertical::before {
    content: "\f142"; }
  
  .fa-ellipsis-v::before {
    content: "\f142"; }
  
  .fa-ticket::before {
    content: "\f145"; }
  
  .fa-power-off::before {
    content: "\f011"; }
  
  .fa-right-long::before {
    content: "\f30b"; }
  
  .fa-long-arrow-alt-right::before {
    content: "\f30b"; }
  
  .fa-flag-usa::before {
    content: "\f74d"; }
  
  .fa-laptop-file::before {
    content: "\e51d"; }
  
  .fa-tty::before {
    content: "\f1e4"; }
  
  .fa-teletype::before {
    content: "\f1e4"; }
  
  .fa-diagram-next::before {
    content: "\e476"; }
  
  .fa-person-rifle::before {
    content: "\e54e"; }
  
  .fa-house-medical-circle-exclamation::before {
    content: "\e512"; }
  
  .fa-closed-captioning::before {
    content: "\f20a"; }
  
  .fa-person-hiking::before {
    content: "\f6ec"; }
  
  .fa-hiking::before {
    content: "\f6ec"; }
  
  .fa-venus-double::before {
    content: "\f226"; }
  
  .fa-images::before {
    content: "\f302"; }
  
  .fa-calculator::before {
    content: "\f1ec"; }
  
  .fa-people-pulling::before {
    content: "\e535"; }
  
  .fa-n::before {
    content: "\4e"; }
  
  .fa-cable-car::before {
    content: "\f7da"; }
  
  .fa-tram::before {
    content: "\f7da"; }
  
  .fa-cloud-rain::before {
    content: "\f73d"; }
  
  .fa-building-circle-xmark::before {
    content: "\e4d4"; }
  
  .fa-ship::before {
    content: "\f21a"; }
  
  .fa-arrows-down-to-line::before {
    content: "\e4b8"; }
  
  .fa-download::before {
    content: "\f019"; }
  
  .fa-face-grin::before {
    content: "\f580"; }
  
  .fa-grin::before {
    content: "\f580"; }
  
  .fa-delete-left::before {
    content: "\f55a"; }
  
  .fa-backspace::before {
    content: "\f55a"; }
  
  .fa-eye-dropper::before {
    content: "\f1fb"; }
  
  .fa-eye-dropper-empty::before {
    content: "\f1fb"; }
  
  .fa-eyedropper::before {
    content: "\f1fb"; }
  
  .fa-file-circle-check::before {
    content: "\e5a0"; }
  
  .fa-forward::before {
    content: "\f04e"; }
  
  .fa-mobile::before {
    content: "\f3ce"; }
  
  .fa-mobile-android::before {
    content: "\f3ce"; }
  
  .fa-mobile-phone::before {
    content: "\f3ce"; }
  
  .fa-face-meh::before {
    content: "\f11a"; }
  
  .fa-meh::before {
    content: "\f11a"; }
  
  .fa-align-center::before {
    content: "\f037"; }
  
  .fa-book-skull::before {
    content: "\f6b7"; }
  
  .fa-book-dead::before {
    content: "\f6b7"; }
  
  .fa-id-card::before {
    content: "\f2c2"; }
  
  .fa-drivers-license::before {
    content: "\f2c2"; }
  
  .fa-outdent::before {
    content: "\f03b"; }
  
  .fa-dedent::before {
    content: "\f03b"; }
  
  .fa-heart-circle-exclamation::before {
    content: "\e4fe"; }
  
  .fa-house::before {
    content: "\f015"; }
  
  .fa-home::before {
    content: "\f015"; }
  
  .fa-home-alt::before {
    content: "\f015"; }
  
  .fa-home-lg-alt::before {
    content: "\f015"; }
  
  .fa-calendar-week::before {
    content: "\f784"; }
  
  .fa-laptop-medical::before {
    content: "\f812"; }
  
  .fa-b::before {
    content: "\42"; }
  
  .fa-file-medical::before {
    content: "\f477"; }
  
  .fa-dice-one::before {
    content: "\f525"; }
  
  .fa-kiwi-bird::before {
    content: "\f535"; }
  
  .fa-arrow-right-arrow-left::before {
    content: "\f0ec"; }
  
  .fa-exchange::before {
    content: "\f0ec"; }
  
  .fa-rotate-right::before {
    content: "\f2f9"; }
  
  .fa-redo-alt::before {
    content: "\f2f9"; }
  
  .fa-rotate-forward::before {
    content: "\f2f9"; }
  
  .fa-utensils::before {
    content: "\f2e7"; }
  
  .fa-cutlery::before {
    content: "\f2e7"; }
  
  .fa-arrow-up-wide-short::before {
    content: "\f161"; }
  
  .fa-sort-amount-up::before {
    content: "\f161"; }
  
  .fa-mill-sign::before {
    content: "\e1ed"; }
  
  .fa-bowl-rice::before {
    content: "\e2eb"; }
  
  .fa-skull::before {
    content: "\f54c"; }
  
  .fa-tower-broadcast::before {
    content: "\f519"; }
  
  .fa-broadcast-tower::before {
    content: "\f519"; }
  
  .fa-truck-pickup::before {
    content: "\f63c"; }
  
  .fa-up-long::before {
    content: "\f30c"; }
  
  .fa-long-arrow-alt-up::before {
    content: "\f30c"; }
  
  .fa-stop::before {
    content: "\f04d"; }
  
  .fa-code-merge::before {
    content: "\f387"; }
  
  .fa-upload::before {
    content: "\f093"; }
  
  .fa-hurricane::before {
    content: "\f751"; }
  
  .fa-mound::before {
    content: "\e52d"; }
  
  .fa-toilet-portable::before {
    content: "\e583"; }
  
  .fa-compact-disc::before {
    content: "\f51f"; }
  
  .fa-file-arrow-down::before {
    content: "\f56d"; }
  
  .fa-file-download::before {
    content: "\f56d"; }
  
  .fa-caravan::before {
    content: "\f8ff"; }
  
  .fa-shield-cat::before {
    content: "\e572"; }
  
  .fa-bolt::before {
    content: "\f0e7"; }
  
  .fa-zap::before {
    content: "\f0e7"; }
  
  .fa-glass-water::before {
    content: "\e4f4"; }
  
  .fa-oil-well::before {
    content: "\e532"; }
  
  .fa-vault::before {
    content: "\e2c5"; }
  
  .fa-mars::before {
    content: "\f222"; }
  
  .fa-toilet::before {
    content: "\f7d8"; }
  
  .fa-plane-circle-xmark::before {
    content: "\e557"; }
  
  .fa-yen-sign::before {
    content: "\f157"; }
  
  .fa-cny::before {
    content: "\f157"; }
  
  .fa-jpy::before {
    content: "\f157"; }
  
  .fa-rmb::before {
    content: "\f157"; }
  
  .fa-yen::before {
    content: "\f157"; }
  
  .fa-ruble-sign::before {
    content: "\f158"; }
  
  .fa-rouble::before {
    content: "\f158"; }
  
  .fa-rub::before {
    content: "\f158"; }
  
  .fa-ruble::before {
    content: "\f158"; }
  
  .fa-sun::before {
    content: "\f185"; }
  
  .fa-guitar::before {
    content: "\f7a6"; }
  
  .fa-face-laugh-wink::before {
    content: "\f59c"; }
  
  .fa-laugh-wink::before {
    content: "\f59c"; }
  
  .fa-horse-head::before {
    content: "\f7ab"; }
  
  .fa-bore-hole::before {
    content: "\e4c3"; }
  
  .fa-industry::before {
    content: "\f275"; }
  
  .fa-circle-down::before {
    content: "\f358"; }
  
  .fa-arrow-alt-circle-down::before {
    content: "\f358"; }
  
  .fa-arrows-turn-to-dots::before {
    content: "\e4c1"; }
  
  .fa-florin-sign::before {
    content: "\e184"; }
  
  .fa-arrow-down-short-wide::before {
    content: "\f884"; }
  
  .fa-sort-amount-desc::before {
    content: "\f884"; }
  
  .fa-sort-amount-down-alt::before {
    content: "\f884"; }
  
  .fa-less-than::before {
    content: "\3c"; }
  
  .fa-angle-down::before {
    content: "\f107"; }
  
  .fa-car-tunnel::before {
    content: "\e4de"; }
  
  .fa-head-side-cough::before {
    content: "\e061"; }
  
  .fa-grip-lines::before {
    content: "\f7a4"; }
  
  .fa-thumbs-down::before {
    content: "\f165"; }
  
  .fa-user-lock::before {
    content: "\f502"; }
  
  .fa-arrow-right-long::before {
    content: "\f178"; }
  
  .fa-long-arrow-right::before {
    content: "\f178"; }
  
  .fa-anchor-circle-xmark::before {
    content: "\e4ac"; }
  
  .fa-ellipsis::before {
    content: "\f141"; }
  
  .fa-ellipsis-h::before {
    content: "\f141"; }
  
  .fa-chess-pawn::before {
    content: "\f443"; }
  
  .fa-kit-medical::before {
    content: "\f479"; }
  
  .fa-first-aid::before {
    content: "\f479"; }
  
  .fa-person-through-window::before {
    content: "\e5a9"; }
  
  .fa-toolbox::before {
    content: "\f552"; }
  
  .fa-hands-holding-circle::before {
    content: "\e4fb"; }
  
  .fa-bug::before {
    content: "\f188"; }
  
  .fa-credit-card::before {
    content: "\f09d"; }
  
  .fa-credit-card-alt::before {
    content: "\f09d"; }
  
  .fa-car::before {
    content: "\f1b9"; }
  
  .fa-automobile::before {
    content: "\f1b9"; }
  
  .fa-hand-holding-hand::before {
    content: "\e4f7"; }
  
  .fa-book-open-reader::before {
    content: "\f5da"; }
  
  .fa-book-reader::before {
    content: "\f5da"; }
  
  .fa-mountain-sun::before {
    content: "\e52f"; }
  
  .fa-arrows-left-right-to-line::before {
    content: "\e4ba"; }
  
  .fa-dice-d20::before {
    content: "\f6cf"; }
  
  .fa-truck-droplet::before {
    content: "\e58c"; }
  
  .fa-file-circle-xmark::before {
    content: "\e5a1"; }
  
  .fa-temperature-arrow-up::before {
    content: "\e040"; }
  
  .fa-temperature-up::before {
    content: "\e040"; }
  
  .fa-medal::before {
    content: "\f5a2"; }
  
  .fa-bed::before {
    content: "\f236"; }
  
  .fa-square-h::before {
    content: "\f0fd"; }
  
  .fa-h-square::before {
    content: "\f0fd"; }
  
  .fa-podcast::before {
    content: "\f2ce"; }
  
  .fa-temperature-full::before {
    content: "\f2c7"; }
  
  .fa-temperature-4::before {
    content: "\f2c7"; }
  
  .fa-thermometer-4::before {
    content: "\f2c7"; }
  
  .fa-thermometer-full::before {
    content: "\f2c7"; }
  
  .fa-bell::before {
    content: "\f0f3"; }
  
  .fa-superscript::before {
    content: "\f12b"; }
  
  .fa-plug-circle-xmark::before {
    content: "\e560"; }
  
  .fa-star-of-life::before {
    content: "\f621"; }
  
  .fa-phone-slash::before {
    content: "\f3dd"; }
  
  .fa-paint-roller::before {
    content: "\f5aa"; }
  
  .fa-handshake-angle::before {
    content: "\f4c4"; }
  
  .fa-hands-helping::before {
    content: "\f4c4"; }
  
  .fa-location-dot::before {
    content: "\f3c5"; }
  
  .fa-map-marker-alt::before {
    content: "\f3c5"; }
  
  .fa-file::before {
    content: "\f15b"; }
  
  .fa-greater-than::before {
    content: "\3e"; }
  
  .fa-person-swimming::before {
    content: "\f5c4"; }
  
  .fa-swimmer::before {
    content: "\f5c4"; }
  
  .fa-arrow-down::before {
    content: "\f063"; }
  
  .fa-droplet::before {
    content: "\f043"; }
  
  .fa-tint::before {
    content: "\f043"; }
  
  .fa-eraser::before {
    content: "\f12d"; }
  
  .fa-earth-americas::before {
    content: "\f57d"; }
  
  .fa-earth::before {
    content: "\f57d"; }
  
  .fa-earth-america::before {
    content: "\f57d"; }
  
  .fa-globe-americas::before {
    content: "\f57d"; }
  
  .fa-person-burst::before {
    content: "\e53b"; }
  
  .fa-dove::before {
    content: "\f4ba"; }
  
  .fa-battery-empty::before {
    content: "\f244"; }
  
  .fa-battery-0::before {
    content: "\f244"; }
  
  .fa-socks::before {
    content: "\f696"; }
  
  .fa-inbox::before {
    content: "\f01c"; }
  
  .fa-section::before {
    content: "\e447"; }
  
  .fa-gauge-high::before {
    content: "\f625"; }
  
  .fa-tachometer-alt::before {
    content: "\f625"; }
  
  .fa-tachometer-alt-fast::before {
    content: "\f625"; }
  
  .fa-envelope-open-text::before {
    content: "\f658"; }
  
  .fa-hospital::before {
    content: "\f0f8"; }
  
  .fa-hospital-alt::before {
    content: "\f0f8"; }
  
  .fa-hospital-wide::before {
    content: "\f0f8"; }
  
  .fa-wine-bottle::before {
    content: "\f72f"; }
  
  .fa-chess-rook::before {
    content: "\f447"; }
  
  .fa-bars-staggered::before {
    content: "\f550"; }
  
  .fa-reorder::before {
    content: "\f550"; }
  
  .fa-stream::before {
    content: "\f550"; }
  
  .fa-dharmachakra::before {
    content: "\f655"; }
  
  .fa-hotdog::before {
    content: "\f80f"; }
  
  .fa-person-walking-with-cane::before {
    content: "\f29d"; }
  
  .fa-blind::before {
    content: "\f29d"; }
  
  .fa-drum::before {
    content: "\f569"; }
  
  .fa-ice-cream::before {
    content: "\f810"; }
  
  .fa-heart-circle-bolt::before {
    content: "\e4fc"; }
  
  .fa-fax::before {
    content: "\f1ac"; }
  
  .fa-paragraph::before {
    content: "\f1dd"; }
  
  .fa-check-to-slot::before {
    content: "\f772"; }
  
  .fa-vote-yea::before {
    content: "\f772"; }
  
  .fa-star-half::before {
    content: "\f089"; }
  
  .fa-boxes-stacked::before {
    content: "\f468"; }
  
  .fa-boxes::before {
    content: "\f468"; }
  
  .fa-boxes-alt::before {
    content: "\f468"; }
  
  .fa-link::before {
    content: "\f0c1"; }
  
  .fa-chain::before {
    content: "\f0c1"; }
  
  .fa-ear-listen::before {
    content: "\f2a2"; }
  
  .fa-assistive-listening-systems::before {
    content: "\f2a2"; }
  
  .fa-tree-city::before {
    content: "\e587"; }
  
  .fa-play::before {
    content: "\f04b"; }
  
  .fa-font::before {
    content: "\f031"; }
  
  .fa-rupiah-sign::before {
    content: "\e23d"; }
  
  .fa-magnifying-glass::before {
    content: "\f002"; }
  
  .fa-search::before {
    content: "\f002"; }
  
  .fa-table-tennis-paddle-ball::before {
    content: "\f45d"; }
  
  .fa-ping-pong-paddle-ball::before {
    content: "\f45d"; }
  
  .fa-table-tennis::before {
    content: "\f45d"; }
  
  .fa-person-dots-from-line::before {
    content: "\f470"; }
  
  .fa-diagnoses::before {
    content: "\f470"; }
  
  .fa-trash-can-arrow-up::before {
    content: "\f82a"; }
  
  .fa-trash-restore-alt::before {
    content: "\f82a"; }
  
  .fa-naira-sign::before {
    content: "\e1f6"; }
  
  .fa-cart-arrow-down::before {
    content: "\f218"; }
  
  .fa-walkie-talkie::before {
    content: "\f8ef"; }
  
  .fa-file-pen::before {
    content: "\f31c"; }
  
  .fa-file-edit::before {
    content: "\f31c"; }
  
  .fa-receipt::before {
    content: "\f543"; }
  
  .fa-square-pen::before {
    content: "\f14b"; }
  
  .fa-pen-square::before {
    content: "\f14b"; }
  
  .fa-pencil-square::before {
    content: "\f14b"; }
  
  .fa-suitcase-rolling::before {
    content: "\f5c1"; }
  
  .fa-person-circle-exclamation::before {
    content: "\e53f"; }
  
  .fa-chevron-down::before {
    content: "\f078"; }
  
  .fa-battery-full::before {
    content: "\f240"; }
  
  .fa-battery::before {
    content: "\f240"; }
  
  .fa-battery-5::before {
    content: "\f240"; }
  
  .fa-skull-crossbones::before {
    content: "\f714"; }
  
  .fa-code-compare::before {
    content: "\e13a"; }
  
  .fa-list-ul::before {
    content: "\f0ca"; }
  
  .fa-list-dots::before {
    content: "\f0ca"; }
  
  .fa-school-lock::before {
    content: "\e56f"; }
  
  .fa-tower-cell::before {
    content: "\e585"; }
  
  .fa-down-long::before {
    content: "\f309"; }
  
  .fa-long-arrow-alt-down::before {
    content: "\f309"; }
  
  .fa-ranking-star::before {
    content: "\e561"; }
  
  .fa-chess-king::before {
    content: "\f43f"; }
  
  .fa-person-harassing::before {
    content: "\e549"; }
  
  .fa-brazilian-real-sign::before {
    content: "\e46c"; }
  
  .fa-landmark-dome::before {
    content: "\f752"; }
  
  .fa-landmark-alt::before {
    content: "\f752"; }
  
  .fa-arrow-up::before {
    content: "\f062"; }
  
  .fa-tv::before {
    content: "\f26c"; }
  
  .fa-television::before {
    content: "\f26c"; }
  
  .fa-tv-alt::before {
    content: "\f26c"; }
  
  .fa-shrimp::before {
    content: "\e448"; }
  
  .fa-list-check::before {
    content: "\f0ae"; }
  
  .fa-tasks::before {
    content: "\f0ae"; }
  
  .fa-jug-detergent::before {
    content: "\e519"; }
  
  .fa-circle-user::before {
    content: "\f2bd"; }
  
  .fa-user-circle::before {
    content: "\f2bd"; }
  
  .fa-user-shield::before {
    content: "\f505"; }
  
  .fa-wind::before {
    content: "\f72e"; }
  
  .fa-car-burst::before {
    content: "\f5e1"; }
  
  .fa-car-crash::before {
    content: "\f5e1"; }
  
  .fa-y::before {
    content: "\59"; }
  
  .fa-person-snowboarding::before {
    content: "\f7ce"; }
  
  .fa-snowboarding::before {
    content: "\f7ce"; }
  
  .fa-truck-fast::before {
    content: "\f48b"; }
  
  .fa-shipping-fast::before {
    content: "\f48b"; }
  
  .fa-fish::before {
    content: "\f578"; }
  
  .fa-user-graduate::before {
    content: "\f501"; }
  
  .fa-circle-half-stroke::before {
    content: "\f042"; }
  
  .fa-adjust::before {
    content: "\f042"; }
  
  .fa-clapperboard::before {
    content: "\e131"; }
  
  .fa-circle-radiation::before {
    content: "\f7ba"; }
  
  .fa-radiation-alt::before {
    content: "\f7ba"; }
  
  .fa-baseball::before {
    content: "\f433"; }
  
  .fa-baseball-ball::before {
    content: "\f433"; }
  
  .fa-jet-fighter-up::before {
    content: "\e518"; }
  
  .fa-diagram-project::before {
    content: "\f542"; }
  
  .fa-project-diagram::before {
    content: "\f542"; }
  
  .fa-copy::before {
    content: "\f0c5"; }
  
  .fa-volume-xmark::before {
    content: "\f6a9"; }
  
  .fa-volume-mute::before {
    content: "\f6a9"; }
  
  .fa-volume-times::before {
    content: "\f6a9"; }
  
  .fa-hand-sparkles::before {
    content: "\e05d"; }
  
  .fa-grip::before {
    content: "\f58d"; }
  
  .fa-grip-horizontal::before {
    content: "\f58d"; }
  
  .fa-share-from-square::before {
    content: "\f14d"; }
  
  .fa-share-square::before {
    content: "\f14d"; }
  
  .fa-child-combatant::before {
    content: "\e4e0"; }
  
  .fa-child-rifle::before {
    content: "\e4e0"; }
  
  .fa-gun::before {
    content: "\e19b"; }
  
  .fa-square-phone::before {
    content: "\f098"; }
  
  .fa-phone-square::before {
    content: "\f098"; }
  
  .fa-plus::before {
    content: "\2b"; }
  
  .fa-add::before {
    content: "\2b"; }
  
  .fa-expand::before {
    content: "\f065"; }
  
  .fa-computer::before {
    content: "\e4e5"; }
  
  .fa-xmark::before {
    content: "\f00d"; }
  
  .fa-close::before {
    content: "\f00d"; }
  
  .fa-multiply::before {
    content: "\f00d"; }
  
  .fa-remove::before {
    content: "\f00d"; }
  
  .fa-times::before {
    content: "\f00d"; }
  
  .fa-arrows-up-down-left-right::before {
    content: "\f047"; }
  
  .fa-arrows::before {
    content: "\f047"; }
  
  .fa-chalkboard-user::before {
    content: "\f51c"; }
  
  .fa-chalkboard-teacher::before {
    content: "\f51c"; }
  
  .fa-peso-sign::before {
    content: "\e222"; }
  
  .fa-building-shield::before {
    content: "\e4d8"; }
  
  .fa-baby::before {
    content: "\f77c"; }
  
  .fa-users-line::before {
    content: "\e592"; }
  
  .fa-quote-left::before {
    content: "\f10d"; }
  
  .fa-quote-left-alt::before {
    content: "\f10d"; }
  
  .fa-tractor::before {
    content: "\f722"; }
  
  .fa-trash-arrow-up::before {
    content: "\f829"; }
  
  .fa-trash-restore::before {
    content: "\f829"; }
  
  .fa-arrow-down-up-lock::before {
    content: "\e4b0"; }
  
  .fa-lines-leaning::before {
    content: "\e51e"; }
  
  .fa-ruler-combined::before {
    content: "\f546"; }
  
  .fa-copyright::before {
    content: "\f1f9"; }
  
  .fa-equals::before {
    content: "\3d"; }
  
  .fa-blender::before {
    content: "\f517"; }
  
  .fa-teeth::before {
    content: "\f62e"; }
  
  .fa-shekel-sign::before {
    content: "\f20b"; }
  
  .fa-ils::before {
    content: "\f20b"; }
  
  .fa-shekel::before {
    content: "\f20b"; }
  
  .fa-sheqel::before {
    content: "\f20b"; }
  
  .fa-sheqel-sign::before {
    content: "\f20b"; }
  
  .fa-map::before {
    content: "\f279"; }
  
  .fa-rocket::before {
    content: "\f135"; }
  
  .fa-photo-film::before {
    content: "\f87c"; }
  
  .fa-photo-video::before {
    content: "\f87c"; }
  
  .fa-folder-minus::before {
    content: "\f65d"; }
  
  .fa-store::before {
    content: "\f54e"; }
  
  .fa-arrow-trend-up::before {
    content: "\e098"; }
  
  .fa-plug-circle-minus::before {
    content: "\e55e"; }
  
  .fa-sign-hanging::before {
    content: "\f4d9"; }
  
  .fa-sign::before {
    content: "\f4d9"; }
  
  .fa-bezier-curve::before {
    content: "\f55b"; }
  
  .fa-bell-slash::before {
    content: "\f1f6"; }
  
  .fa-tablet::before {
    content: "\f3fb"; }
  
  .fa-tablet-android::before {
    content: "\f3fb"; }
  
  .fa-school-flag::before {
    content: "\e56e"; }
  
  .fa-fill::before {
    content: "\f575"; }
  
  .fa-angle-up::before {
    content: "\f106"; }
  
  .fa-drumstick-bite::before {
    content: "\f6d7"; }
  
  .fa-holly-berry::before {
    content: "\f7aa"; }
  
  .fa-chevron-left::before {
    content: "\f053"; }
  
  .fa-bacteria::before {
    content: "\e059"; }
  
  .fa-hand-lizard::before {
    content: "\f258"; }
  
  .fa-notdef::before {
    content: "\e1fe"; }
  
  .fa-disease::before {
    content: "\f7fa"; }
  
  .fa-briefcase-medical::before {
    content: "\f469"; }
  
  .fa-genderless::before {
    content: "\f22d"; }
  
  .fa-chevron-right::before {
    content: "\f054"; }
  
  .fa-retweet::before {
    content: "\f079"; }
  
  .fa-car-rear::before {
    content: "\f5de"; }
  
  .fa-car-alt::before {
    content: "\f5de"; }
  
  .fa-pump-soap::before {
    content: "\e06b"; }
  
  .fa-video-slash::before {
    content: "\f4e2"; }
  
  .fa-battery-quarter::before {
    content: "\f243"; }
  
  .fa-battery-2::before {
    content: "\f243"; }
  
  .fa-radio::before {
    content: "\f8d7"; }
  
  .fa-baby-carriage::before {
    content: "\f77d"; }
  
  .fa-carriage-baby::before {
    content: "\f77d"; }
  
  .fa-traffic-light::before {
    content: "\f637"; }
  
  .fa-thermometer::before {
    content: "\f491"; }
  
  .fa-vr-cardboard::before {
    content: "\f729"; }
  
  .fa-hand-middle-finger::before {
    content: "\f806"; }
  
  .fa-percent::before {
    content: "\25"; }
  
  .fa-percentage::before {
    content: "\25"; }
  
  .fa-truck-moving::before {
    content: "\f4df"; }
  
  .fa-glass-water-droplet::before {
    content: "\e4f5"; }
  
  .fa-display::before {
    content: "\e163"; }
  
  .fa-face-smile::before {
    content: "\f118"; }
  
  .fa-smile::before {
    content: "\f118"; }
  
  .fa-thumbtack::before {
    content: "\f08d"; }
  
  .fa-thumb-tack::before {
    content: "\f08d"; }
  
  .fa-trophy::before {
    content: "\f091"; }
  
  .fa-person-praying::before {
    content: "\f683"; }
  
  .fa-pray::before {
    content: "\f683"; }
  
  .fa-hammer::before {
    content: "\f6e3"; }
  
  .fa-hand-peace::before {
    content: "\f25b"; }
  
  .fa-rotate::before {
    content: "\f2f1"; }
  
  .fa-sync-alt::before {
    content: "\f2f1"; }
  
  .fa-spinner::before {
    content: "\f110"; }
  
  .fa-robot::before {
    content: "\f544"; }
  
  .fa-peace::before {
    content: "\f67c"; }
  
  .fa-gears::before {
    content: "\f085"; }
  
  .fa-cogs::before {
    content: "\f085"; }
  
  .fa-warehouse::before {
    content: "\f494"; }
  
  .fa-arrow-up-right-dots::before {
    content: "\e4b7"; }
  
  .fa-splotch::before {
    content: "\f5bc"; }
  
  .fa-face-grin-hearts::before {
    content: "\f584"; }
  
  .fa-grin-hearts::before {
    content: "\f584"; }
  
  .fa-dice-four::before {
    content: "\f524"; }
  
  .fa-sim-card::before {
    content: "\f7c4"; }
  
  .fa-transgender::before {
    content: "\f225"; }
  
  .fa-transgender-alt::before {
    content: "\f225"; }
  
  .fa-mercury::before {
    content: "\f223"; }
  
  .fa-arrow-turn-down::before {
    content: "\f149"; }
  
  .fa-level-down::before {
    content: "\f149"; }
  
  .fa-person-falling-burst::before {
    content: "\e547"; }
  
  .fa-award::before {
    content: "\f559"; }
  
  .fa-ticket-simple::before {
    content: "\f3ff"; }
  
  .fa-ticket-alt::before {
    content: "\f3ff"; }
  
  .fa-building::before {
    content: "\f1ad"; }
  
  .fa-angles-left::before {
    content: "\f100"; }
  
  .fa-angle-double-left::before {
    content: "\f100"; }
  
  .fa-qrcode::before {
    content: "\f029"; }
  
  .fa-clock-rotate-left::before {
    content: "\f1da"; }
  
  .fa-history::before {
    content: "\f1da"; }
  
  .fa-face-grin-beam-sweat::before {
    content: "\f583"; }
  
  .fa-grin-beam-sweat::before {
    content: "\f583"; }
  
  .fa-file-export::before {
    content: "\f56e"; }
  
  .fa-arrow-right-from-file::before {
    content: "\f56e"; }
  
  .fa-shield::before {
    content: "\f132"; }
  
  .fa-shield-blank::before {
    content: "\f132"; }
  
  .fa-arrow-up-short-wide::before {
    content: "\f885"; }
  
  .fa-sort-amount-up-alt::before {
    content: "\f885"; }
  
  .fa-house-medical::before {
    content: "\e3b2"; }
  
  .fa-golf-ball-tee::before {
    content: "\f450"; }
  
  .fa-golf-ball::before {
    content: "\f450"; }
  
  .fa-circle-chevron-left::before {
    content: "\f137"; }
  
  .fa-chevron-circle-left::before {
    content: "\f137"; }
  
  .fa-house-chimney-window::before {
    content: "\e00d"; }
  
  .fa-pen-nib::before {
    content: "\f5ad"; }
  
  .fa-tent-arrow-turn-left::before {
    content: "\e580"; }
  
  .fa-tents::before {
    content: "\e582"; }
  
  .fa-wand-magic::before {
    content: "\f0d0"; }
  
  .fa-magic::before {
    content: "\f0d0"; }
  
  .fa-dog::before {
    content: "\f6d3"; }
  
  .fa-carrot::before {
    content: "\f787"; }
  
  .fa-moon::before {
    content: "\f186"; }
  
  .fa-wine-glass-empty::before {
    content: "\f5ce"; }
  
  .fa-wine-glass-alt::before {
    content: "\f5ce"; }
  
  .fa-cheese::before {
    content: "\f7ef"; }
  
  .fa-yin-yang::before {
    content: "\f6ad"; }
  
  .fa-music::before {
    content: "\f001"; }
  
  .fa-code-commit::before {
    content: "\f386"; }
  
  .fa-temperature-low::before {
    content: "\f76b"; }
  
  .fa-person-biking::before {
    content: "\f84a"; }
  
  .fa-biking::before {
    content: "\f84a"; }
  
  .fa-broom::before {
    content: "\f51a"; }
  
  .fa-shield-heart::before {
    content: "\e574"; }
  
  .fa-gopuram::before {
    content: "\f664"; }
  
  .fa-earth-oceania::before {
    content: "\e47b"; }
  
  .fa-globe-oceania::before {
    content: "\e47b"; }
  
  .fa-square-xmark::before {
    content: "\f2d3"; }
  
  .fa-times-square::before {
    content: "\f2d3"; }
  
  .fa-xmark-square::before {
    content: "\f2d3"; }
  
  .fa-hashtag::before {
    content: "\23"; }
  
  .fa-up-right-and-down-left-from-center::before {
    content: "\f424"; }
  
  .fa-expand-alt::before {
    content: "\f424"; }
  
  .fa-oil-can::before {
    content: "\f613"; }
  
  .fa-t::before {
    content: "\54"; }
  
  .fa-hippo::before {
    content: "\f6ed"; }
  
  .fa-chart-column::before {
    content: "\e0e3"; }
  
  .fa-infinity::before {
    content: "\f534"; }
  
  .fa-vial-circle-check::before {
    content: "\e596"; }
  
  .fa-person-arrow-down-to-line::before {
    content: "\e538"; }
  
  .fa-voicemail::before {
    content: "\f897"; }
  
  .fa-fan::before {
    content: "\f863"; }
  
  .fa-person-walking-luggage::before {
    content: "\e554"; }
  
  .fa-up-down::before {
    content: "\f338"; }
  
  .fa-arrows-alt-v::before {
    content: "\f338"; }
  
  .fa-cloud-moon-rain::before {
    content: "\f73c"; }
  
  .fa-calendar::before {
    content: "\f133"; }
  
  .fa-trailer::before {
    content: "\e041"; }
  
  .fa-bahai::before {
    content: "\f666"; }
  
  .fa-haykal::before {
    content: "\f666"; }
  
  .fa-sd-card::before {
    content: "\f7c2"; }
  
  .fa-dragon::before {
    content: "\f6d5"; }
  
  .fa-shoe-prints::before {
    content: "\f54b"; }
  
  .fa-circle-plus::before {
    content: "\f055"; }
  
  .fa-plus-circle::before {
    content: "\f055"; }
  
  .fa-face-grin-tongue-wink::before {
    content: "\f58b"; }
  
  .fa-grin-tongue-wink::before {
    content: "\f58b"; }
  
  .fa-hand-holding::before {
    content: "\f4bd"; }
  
  .fa-plug-circle-exclamation::before {
    content: "\e55d"; }
  
  .fa-link-slash::before {
    content: "\f127"; }
  
  .fa-chain-broken::before {
    content: "\f127"; }
  
  .fa-chain-slash::before {
    content: "\f127"; }
  
  .fa-unlink::before {
    content: "\f127"; }
  
  .fa-clone::before {
    content: "\f24d"; }
  
  .fa-person-walking-arrow-loop-left::before {
    content: "\e551"; }
  
  .fa-arrow-up-z-a::before {
    content: "\f882"; }
  
  .fa-sort-alpha-up-alt::before {
    content: "\f882"; }
  
  .fa-fire-flame-curved::before {
    content: "\f7e4"; }
  
  .fa-fire-alt::before {
    content: "\f7e4"; }
  
  .fa-tornado::before {
    content: "\f76f"; }
  
  .fa-file-circle-plus::before {
    content: "\e494"; }
  
  .fa-book-quran::before {
    content: "\f687"; }
  
  .fa-quran::before {
    content: "\f687"; }
  
  .fa-anchor::before {
    content: "\f13d"; }
  
  .fa-border-all::before {
    content: "\f84c"; }
  
  .fa-face-angry::before {
    content: "\f556"; }
  
  .fa-angry::before {
    content: "\f556"; }
  
  .fa-cookie-bite::before {
    content: "\f564"; }
  
  .fa-arrow-trend-down::before {
    content: "\e097"; }
  
  .fa-rss::before {
    content: "\f09e"; }
  
  .fa-feed::before {
    content: "\f09e"; }
  
  .fa-draw-polygon::before {
    content: "\f5ee"; }
  
  .fa-scale-balanced::before {
    content: "\f24e"; }
  
  .fa-balance-scale::before {
    content: "\f24e"; }
  
  .fa-gauge-simple-high::before {
    content: "\f62a"; }
  
  .fa-tachometer::before {
    content: "\f62a"; }
  
  .fa-tachometer-fast::before {
    content: "\f62a"; }
  
  .fa-shower::before {
    content: "\f2cc"; }
  
  .fa-desktop::before {
    content: "\f390"; }
  
  .fa-desktop-alt::before {
    content: "\f390"; }
  
  .fa-m::before {
    content: "\4d"; }
  
  .fa-table-list::before {
    content: "\f00b"; }
  
  .fa-th-list::before {
    content: "\f00b"; }
  
  .fa-comment-sms::before {
    content: "\f7cd"; }
  
  .fa-sms::before {
    content: "\f7cd"; }
  
  .fa-book::before {
    content: "\f02d"; }
  
  .fa-user-plus::before {
    content: "\f234"; }
  
  .fa-check::before {
    content: "\f00c"; }
  
  .fa-battery-three-quarters::before {
    content: "\f241"; }
  
  .fa-battery-4::before {
    content: "\f241"; }
  
  .fa-house-circle-check::before {
    content: "\e509"; }
  
  .fa-angle-left::before {
    content: "\f104"; }
  
  .fa-diagram-successor::before {
    content: "\e47a"; }
  
  .fa-truck-arrow-right::before {
    content: "\e58b"; }
  
  .fa-arrows-split-up-and-left::before {
    content: "\e4bc"; }
  
  .fa-hand-fist::before {
    content: "\f6de"; }
  
  .fa-fist-raised::before {
    content: "\f6de"; }
  
  .fa-cloud-moon::before {
    content: "\f6c3"; }
  
  .fa-briefcase::before {
    content: "\f0b1"; }
  
  .fa-person-falling::before {
    content: "\e546"; }
  
  .fa-image-portrait::before {
    content: "\f3e0"; }
  
  .fa-portrait::before {
    content: "\f3e0"; }
  
  .fa-user-tag::before {
    content: "\f507"; }
  
  .fa-rug::before {
    content: "\e569"; }
  
  .fa-earth-europe::before {
    content: "\f7a2"; }
  
  .fa-globe-europe::before {
    content: "\f7a2"; }
  
  .fa-cart-flatbed-suitcase::before {
    content: "\f59d"; }
  
  .fa-luggage-cart::before {
    content: "\f59d"; }
  
  .fa-rectangle-xmark::before {
    content: "\f410"; }
  
  .fa-rectangle-times::before {
    content: "\f410"; }
  
  .fa-times-rectangle::before {
    content: "\f410"; }
  
  .fa-window-close::before {
    content: "\f410"; }
  
  .fa-baht-sign::before {
    content: "\e0ac"; }
  
  .fa-book-open::before {
    content: "\f518"; }
  
  .fa-book-journal-whills::before {
    content: "\f66a"; }
  
  .fa-journal-whills::before {
    content: "\f66a"; }
  
  .fa-handcuffs::before {
    content: "\e4f8"; }
  
  .fa-triangle-exclamation::before {
    content: "\f071"; }
  
  .fa-exclamation-triangle::before {
    content: "\f071"; }
  
  .fa-warning::before {
    content: "\f071"; }
  
  .fa-database::before {
    content: "\f1c0"; }
  
  .fa-share::before {
    content: "\f064"; }
  
  .fa-arrow-turn-right::before {
    content: "\f064"; }
  
  .fa-mail-forward::before {
    content: "\f064"; }
  
  .fa-bottle-droplet::before {
    content: "\e4c4"; }
  
  .fa-mask-face::before {
    content: "\e1d7"; }
  
  .fa-hill-rockslide::before {
    content: "\e508"; }
  
  .fa-right-left::before {
    content: "\f362"; }
  
  .fa-exchange-alt::before {
    content: "\f362"; }
  
  .fa-paper-plane::before {
    content: "\f1d8"; }
  
  .fa-road-circle-exclamation::before {
    content: "\e565"; }
  
  .fa-dungeon::before {
    content: "\f6d9"; }
  
  .fa-align-right::before {
    content: "\f038"; }
  
  .fa-money-bill-1-wave::before {
    content: "\f53b"; }
  
  .fa-money-bill-wave-alt::before {
    content: "\f53b"; }
  
  .fa-life-ring::before {
    content: "\f1cd"; }
  
  .fa-hands::before {
    content: "\f2a7"; }
  
  .fa-sign-language::before {
    content: "\f2a7"; }
  
  .fa-signing::before {
    content: "\f2a7"; }
  
  .fa-calendar-day::before {
    content: "\f783"; }
  
  .fa-water-ladder::before {
    content: "\f5c5"; }
  
  .fa-ladder-water::before {
    content: "\f5c5"; }
  
  .fa-swimming-pool::before {
    content: "\f5c5"; }
  
  .fa-arrows-up-down::before {
    content: "\f07d"; }
  
  .fa-arrows-v::before {
    content: "\f07d"; }
  
  .fa-face-grimace::before {
    content: "\f57f"; }
  
  .fa-grimace::before {
    content: "\f57f"; }
  
  .fa-wheelchair-move::before {
    content: "\e2ce"; }
  
  .fa-wheelchair-alt::before {
    content: "\e2ce"; }
  
  .fa-turn-down::before {
    content: "\f3be"; }
  
  .fa-level-down-alt::before {
    content: "\f3be"; }
  
  .fa-person-walking-arrow-right::before {
    content: "\e552"; }
  
  .fa-square-envelope::before {
    content: "\f199"; }
  
  .fa-envelope-square::before {
    content: "\f199"; }
  
  .fa-dice::before {
    content: "\f522"; }
  
  .fa-bowling-ball::before {
    content: "\f436"; }
  
  .fa-brain::before {
    content: "\f5dc"; }
  
  .fa-bandage::before {
    content: "\f462"; }
  
  .fa-band-aid::before {
    content: "\f462"; }
  
  .fa-calendar-minus::before {
    content: "\f272"; }
  
  .fa-circle-xmark::before {
    content: "\f057"; }
  
  .fa-times-circle::before {
    content: "\f057"; }
  
  .fa-xmark-circle::before {
    content: "\f057"; }
  
  .fa-gifts::before {
    content: "\f79c"; }
  
  .fa-hotel::before {
    content: "\f594"; }
  
  .fa-earth-asia::before {
    content: "\f57e"; }
  
  .fa-globe-asia::before {
    content: "\f57e"; }
  
  .fa-id-card-clip::before {
    content: "\f47f"; }
  
  .fa-id-card-alt::before {
    content: "\f47f"; }
  
  .fa-magnifying-glass-plus::before {
    content: "\f00e"; }
  
  .fa-search-plus::before {
    content: "\f00e"; }
  
  .fa-thumbs-up::before {
    content: "\f164"; }
  
  .fa-user-clock::before {
    content: "\f4fd"; }
  
  .fa-hand-dots::before {
    content: "\f461"; }
  
  .fa-allergies::before {
    content: "\f461"; }
  
  .fa-file-invoice::before {
    content: "\f570"; }
  
  .fa-window-minimize::before {
    content: "\f2d1"; }
  
  .fa-mug-saucer::before {
    content: "\f0f4"; }
  
  .fa-coffee::before {
    content: "\f0f4"; }
  
  .fa-brush::before {
    content: "\f55d"; }
  
  .fa-mask::before {
    content: "\f6fa"; }
  
  .fa-magnifying-glass-minus::before {
    content: "\f010"; }
  
  .fa-search-minus::before {
    content: "\f010"; }
  
  .fa-ruler-vertical::before {
    content: "\f548"; }
  
  .fa-user-large::before {
    content: "\f406"; }
  
  .fa-user-alt::before {
    content: "\f406"; }
  
  .fa-train-tram::before {
    content: "\e5b4"; }
  
  .fa-user-nurse::before {
    content: "\f82f"; }
  
  .fa-syringe::before {
    content: "\f48e"; }
  
  .fa-cloud-sun::before {
    content: "\f6c4"; }
  
  .fa-stopwatch-20::before {
    content: "\e06f"; }
  
  .fa-square-full::before {
    content: "\f45c"; }
  
  .fa-magnet::before {
    content: "\f076"; }
  
  .fa-jar::before {
    content: "\e516"; }
  
  .fa-note-sticky::before {
    content: "\f249"; }
  
  .fa-sticky-note::before {
    content: "\f249"; }
  
  .fa-bug-slash::before {
    content: "\e490"; }
  
  .fa-arrow-up-from-water-pump::before {
    content: "\e4b6"; }
  
  .fa-bone::before {
    content: "\f5d7"; }
  
  .fa-user-injured::before {
    content: "\f728"; }
  
  .fa-face-sad-tear::before {
    content: "\f5b4"; }
  
  .fa-sad-tear::before {
    content: "\f5b4"; }
  
  .fa-plane::before {
    content: "\f072"; }
  
  .fa-tent-arrows-down::before {
    content: "\e581"; }
  
  .fa-exclamation::before {
    content: "\21"; }
  
  .fa-arrows-spin::before {
    content: "\e4bb"; }
  
  .fa-print::before {
    content: "\f02f"; }
  
  .fa-turkish-lira-sign::before {
    content: "\e2bb"; }
  
  .fa-try::before {
    content: "\e2bb"; }
  
  .fa-turkish-lira::before {
    content: "\e2bb"; }
  
  .fa-dollar-sign::before {
    content: "\24"; }
  
  .fa-dollar::before {
    content: "\24"; }
  
  .fa-usd::before {
    content: "\24"; }
  
  .fa-x::before {
    content: "\58"; }
  
  .fa-magnifying-glass-dollar::before {
    content: "\f688"; }
  
  .fa-search-dollar::before {
    content: "\f688"; }
  
  .fa-users-gear::before {
    content: "\f509"; }
  
  .fa-users-cog::before {
    content: "\f509"; }
  
  .fa-person-military-pointing::before {
    content: "\e54a"; }
  
  .fa-building-columns::before {
    content: "\f19c"; }
  
  .fa-bank::before {
    content: "\f19c"; }
  
  .fa-institution::before {
    content: "\f19c"; }
  
  .fa-museum::before {
    content: "\f19c"; }
  
  .fa-university::before {
    content: "\f19c"; }
  
  .fa-umbrella::before {
    content: "\f0e9"; }
  
  .fa-trowel::before {
    content: "\e589"; }
  
  .fa-d::before {
    content: "\44"; }
  
  .fa-stapler::before {
    content: "\e5af"; }
  
  .fa-masks-theater::before {
    content: "\f630"; }
  
  .fa-theater-masks::before {
    content: "\f630"; }
  
  .fa-kip-sign::before {
    content: "\e1c4"; }
  
  .fa-hand-point-left::before {
    content: "\f0a5"; }
  
  .fa-handshake-simple::before {
    content: "\f4c6"; }
  
  .fa-handshake-alt::before {
    content: "\f4c6"; }
  
  .fa-jet-fighter::before {
    content: "\f0fb"; }
  
  .fa-fighter-jet::before {
    content: "\f0fb"; }
  
  .fa-square-share-nodes::before {
    content: "\f1e1"; }
  
  .fa-share-alt-square::before {
    content: "\f1e1"; }
  
  .fa-barcode::before {
    content: "\f02a"; }
  
  .fa-plus-minus::before {
    content: "\e43c"; }
  
  .fa-video::before {
    content: "\f03d"; }
  
  .fa-video-camera::before {
    content: "\f03d"; }
  
  .fa-graduation-cap::before {
    content: "\f19d"; }
  
  .fa-mortar-board::before {
    content: "\f19d"; }
  
  .fa-hand-holding-medical::before {
    content: "\e05c"; }
  
  .fa-person-circle-check::before {
    content: "\e53e"; }
  
  .fa-turn-up::before {
    content: "\f3bf"; }
  
  .fa-level-up-alt::before {
    content: "\f3bf"; }
  
  .sr-only,
  .fa-sr-only {
    position: absolute;
    width: 1px;
    height: 1px;
    padding: 0;
    margin: -1px;
    overflow: hidden;
    clip: rect(0, 0, 0, 0);
    white-space: nowrap;
    border-width: 0; }
  
  .sr-only-focusable:not(:focus),
  .fa-sr-only-focusable:not(:focus) {
    position: absolute;
    width: 1px;
    height: 1px;
    padding: 0;
    margin: -1px;
    overflow: hidden;
    clip: rect(0, 0, 0, 0);
    white-space: nowrap;
    border-width: 0; }
  :root, :host {
    --fa-style-family-brands: 'Font Awesome 6 Brands';
    --fa-font-brands: normal 400 1em/1 'Font Awesome 6 Brands'; }
  
  @font-face {
    font-family: 'Font Awesome 6 Brands';
    font-style: normal;
    font-weight: 400;
    font-display: block;
    src: url("../public/fonts/fa-brands-400.woff2") format("woff2"), url("../public/fonts/fa-brands-400.ttf") format("truetype"); }
  
  .fab,
  .fa-brands {
    font-weight: 400; }
  
  .fa-monero:before {
    content: "\f3d0"; }
  
  .fa-hooli:before {
    content: "\f427"; }
  
  .fa-yelp:before {
    content: "\f1e9"; }
  
  .fa-cc-visa:before {
    content: "\f1f0"; }
  
  .fa-lastfm:before {
    content: "\f202"; }
  
  .fa-shopware:before {
    content: "\f5b5"; }
  
  .fa-creative-commons-nc:before {
    content: "\f4e8"; }
  
  .fa-aws:before {
    content: "\f375"; }
  
  .fa-redhat:before {
    content: "\f7bc"; }
  
  .fa-yoast:before {
    content: "\f2b1"; }
  
  .fa-cloudflare:before {
    content: "\e07d"; }
  
  .fa-ups:before {
    content: "\f7e0"; }
  
  .fa-wpexplorer:before {
    content: "\f2de"; }
  
  .fa-dyalog:before {
    content: "\f399"; }
  
  .fa-bity:before {
    content: "\f37a"; }
  
  .fa-stackpath:before {
    content: "\f842"; }
  
  .fa-buysellads:before {
    content: "\f20d"; }
  
  .fa-first-order:before {
    content: "\f2b0"; }
  
  .fa-modx:before {
    content: "\f285"; }
  
  .fa-guilded:before {
    content: "\e07e"; }
  
  .fa-vnv:before {
    content: "\f40b"; }
  
  .fa-square-js:before {
    content: "\f3b9"; }
  
  .fa-js-square:before {
    content: "\f3b9"; }
  
  .fa-microsoft:before {
    content: "\f3ca"; }
  
  .fa-qq:before {
    content: "\f1d6"; }
  
  .fa-orcid:before {
    content: "\f8d2"; }
  
  .fa-java:before {
    content: "\f4e4"; }
  
  .fa-invision:before {
    content: "\f7b0"; }
  
  .fa-creative-commons-pd-alt:before {
    content: "\f4ed"; }
  
  .fa-centercode:before {
    content: "\f380"; }
  
  .fa-glide-g:before {
    content: "\f2a6"; }
  
  .fa-drupal:before {
    content: "\f1a9"; }
  
  .fa-hire-a-helper:before {
    content: "\f3b0"; }
  
  .fa-creative-commons-by:before {
    content: "\f4e7"; }
  
  .fa-unity:before {
    content: "\e049"; }
  
  .fa-whmcs:before {
    content: "\f40d"; }
  
  .fa-rocketchat:before {
    content: "\f3e8"; }
  
  .fa-vk:before {
    content: "\f189"; }
  
  .fa-untappd:before {
    content: "\f405"; }
  
  .fa-mailchimp:before {
    content: "\f59e"; }
  
  .fa-css3-alt:before {
    content: "\f38b"; }
  
  .fa-square-reddit:before {
    content: "\f1a2"; }
  
  .fa-reddit-square:before {
    content: "\f1a2"; }
  
  .fa-vimeo-v:before {
    content: "\f27d"; }
  
  .fa-contao:before {
    content: "\f26d"; }
  
  .fa-square-font-awesome:before {
    content: "\e5ad"; }
  
  .fa-deskpro:before {
    content: "\f38f"; }
  
  .fa-sistrix:before {
    content: "\f3ee"; }
  
  .fa-square-instagram:before {
    content: "\e055"; }
  
  .fa-instagram-square:before {
    content: "\e055"; }
  
  .fa-battle-net:before {
    content: "\f835"; }
  
  .fa-the-red-yeti:before {
    content: "\f69d"; }
  
  .fa-square-hacker-news:before {
    content: "\f3af"; }
  
  .fa-hacker-news-square:before {
    content: "\f3af"; }
  
  .fa-edge:before {
    content: "\f282"; }
  
  .fa-napster:before {
    content: "\f3d2"; }
  
  .fa-square-snapchat:before {
    content: "\f2ad"; }
  
  .fa-snapchat-square:before {
    content: "\f2ad"; }
  
  .fa-google-plus-g:before {
    content: "\f0d5"; }
  
  .fa-artstation:before {
    content: "\f77a"; }
  
  .fa-markdown:before {
    content: "\f60f"; }
  
  .fa-sourcetree:before {
    content: "\f7d3"; }
  
  .fa-google-plus:before {
    content: "\f2b3"; }
  
  .fa-diaspora:before {
    content: "\f791"; }
  
  .fa-foursquare:before {
    content: "\f180"; }
  
  .fa-stack-overflow:before {
    content: "\f16c"; }
  
  .fa-github-alt:before {
    content: "\f113"; }
  
  .fa-phoenix-squadron:before {
    content: "\f511"; }
  
  .fa-pagelines:before {
    content: "\f18c"; }
  
  .fa-algolia:before {
    content: "\f36c"; }
  
  .fa-red-river:before {
    content: "\f3e3"; }
  
  .fa-creative-commons-sa:before {
    content: "\f4ef"; }
  
  .fa-safari:before {
    content: "\f267"; }
  
  .fa-google:before {
    content: "\f1a0"; }
  
  .fa-square-font-awesome-stroke:before {
    content: "\f35c"; }
  
  .fa-font-awesome-alt:before {
    content: "\f35c"; }
  
  .fa-atlassian:before {
    content: "\f77b"; }
  
  .fa-linkedin-in:before {
    content: "\f0e1"; }
  
  .fa-digital-ocean:before {
    content: "\f391"; }
  
  .fa-nimblr:before {
    content: "\f5a8"; }
  
  .fa-chromecast:before {
    content: "\f838"; }
  
  .fa-evernote:before {
    content: "\f839"; }
  
  .fa-hacker-news:before {
    content: "\f1d4"; }
  
  .fa-creative-commons-sampling:before {
    content: "\f4f0"; }
  
  .fa-adversal:before {
    content: "\f36a"; }
  
  .fa-creative-commons:before {
    content: "\f25e"; }
  
  .fa-watchman-monitoring:before {
    content: "\e087"; }
  
  .fa-fonticons:before {
    content: "\f280"; }
  
  .fa-weixin:before {
    content: "\f1d7"; }
  
  .fa-shirtsinbulk:before {
    content: "\f214"; }
  
  .fa-codepen:before {
    content: "\f1cb"; }
  
  .fa-git-alt:before {
    content: "\f841"; }
  
  .fa-lyft:before {
    content: "\f3c3"; }
  
  .fa-rev:before {
    content: "\f5b2"; }
  
  .fa-windows:before {
    content: "\f17a"; }
  
  .fa-wizards-of-the-coast:before {
    content: "\f730"; }
  
  .fa-square-viadeo:before {
    content: "\f2aa"; }
  
  .fa-viadeo-square:before {
    content: "\f2aa"; }
  
  .fa-meetup:before {
    content: "\f2e0"; }
  
  .fa-centos:before {
    content: "\f789"; }
  
  .fa-adn:before {
    content: "\f170"; }
  
  .fa-cloudsmith:before {
    content: "\f384"; }
  
  .fa-pied-piper-alt:before {
    content: "\f1a8"; }
  
  .fa-square-dribbble:before {
    content: "\f397"; }
  
  .fa-dribbble-square:before {
    content: "\f397"; }
  
  .fa-codiepie:before {
    content: "\f284"; }
  
  .fa-node:before {
    content: "\f419"; }
  
  .fa-mix:before {
    content: "\f3cb"; }
  
  .fa-steam:before {
    content: "\f1b6"; }
  
  .fa-cc-apple-pay:before {
    content: "\f416"; }
  
  .fa-scribd:before {
    content: "\f28a"; }
  
  .fa-openid:before {
    content: "\f19b"; }
  
  .fa-instalod:before {
    content: "\e081"; }
  
  .fa-expeditedssl:before {
    content: "\f23e"; }
  
  .fa-sellcast:before {
    content: "\f2da"; }
  
  .fa-square-twitter:before {
    content: "\f081"; }
  
  .fa-twitter-square:before {
    content: "\f081"; }
  
  .fa-r-project:before {
    content: "\f4f7"; }
  
  .fa-delicious:before {
    content: "\f1a5"; }
  
  .fa-freebsd:before {
    content: "\f3a4"; }
  
  .fa-vuejs:before {
    content: "\f41f"; }
  
  .fa-accusoft:before {
    content: "\f369"; }
  
  .fa-ioxhost:before {
    content: "\f208"; }
  
  .fa-fonticons-fi:before {
    content: "\f3a2"; }
  
  .fa-app-store:before {
    content: "\f36f"; }
  
  .fa-cc-mastercard:before {
    content: "\f1f1"; }
  
  .fa-itunes-note:before {
    content: "\f3b5"; }
  
  .fa-golang:before {
    content: "\e40f"; }
  
  .fa-kickstarter:before {
    content: "\f3bb"; }
  
  .fa-grav:before {
    content: "\f2d6"; }
  
  .fa-weibo:before {
    content: "\f18a"; }
  
  .fa-uncharted:before {
    content: "\e084"; }
  
  .fa-firstdraft:before {
    content: "\f3a1"; }
  
  .fa-square-youtube:before {
    content: "\f431"; }
  
  .fa-youtube-square:before {
    content: "\f431"; }
  
  .fa-wikipedia-w:before {
    content: "\f266"; }
  
  .fa-wpressr:before {
    content: "\f3e4"; }
  
  .fa-rendact:before {
    content: "\f3e4"; }
  
  .fa-angellist:before {
    content: "\f209"; }
  
  .fa-galactic-republic:before {
    content: "\f50c"; }
  
  .fa-nfc-directional:before {
    content: "\e530"; }
  
  .fa-skype:before {
    content: "\f17e"; }
  
  .fa-joget:before {
    content: "\f3b7"; }
  
  .fa-fedora:before {
    content: "\f798"; }
  
  .fa-stripe-s:before {
    content: "\f42a"; }
  
  .fa-meta:before {
    content: "\e49b"; }
  
  .fa-laravel:before {
    content: "\f3bd"; }
  
  .fa-hotjar:before {
    content: "\f3b1"; }
  
  .fa-bluetooth-b:before {
    content: "\f294"; }
  
  .fa-sticker-mule:before {
    content: "\f3f7"; }
  
  .fa-creative-commons-zero:before {
    content: "\f4f3"; }
  
  .fa-hips:before {
    content: "\f452"; }
  
  .fa-behance:before {
    content: "\f1b4"; }
  
  .fa-reddit:before {
    content: "\f1a1"; }
  
  .fa-discord:before {
    content: "\f392"; }
  
  .fa-chrome:before {
    content: "\f268"; }
  
  .fa-app-store-ios:before {
    content: "\f370"; }
  
  .fa-cc-discover:before {
    content: "\f1f2"; }
  
  .fa-wpbeginner:before {
    content: "\f297"; }
  
  .fa-confluence:before {
    content: "\f78d"; }
  
  .fa-mdb:before {
    content: "\f8ca"; }
  
  .fa-dochub:before {
    content: "\f394"; }
  
  .fa-accessible-icon:before {
    content: "\f368"; }
  
  .fa-ebay:before {
    content: "\f4f4"; }
  
  .fa-amazon:before {
    content: "\f270"; }
  
  .fa-unsplash:before {
    content: "\e07c"; }
  
  .fa-yarn:before {
    content: "\f7e3"; }
  
  .fa-square-steam:before {
    content: "\f1b7"; }
  
  .fa-steam-square:before {
    content: "\f1b7"; }
  
  .fa-500px:before {
    content: "\f26e"; }
  
  .fa-square-vimeo:before {
    content: "\f194"; }
  
  .fa-vimeo-square:before {
    content: "\f194"; }
  
  .fa-asymmetrik:before {
    content: "\f372"; }
  
  .fa-font-awesome:before {
    content: "\f2b4"; }
  
  .fa-font-awesome-flag:before {
    content: "\f2b4"; }
  
  .fa-font-awesome-logo-full:before {
    content: "\f2b4"; }
  
  .fa-gratipay:before {
    content: "\f184"; }
  
  .fa-apple:before {
    content: "\f179"; }
  
  .fa-hive:before {
    content: "\e07f"; }
  
  .fa-gitkraken:before {
    content: "\f3a6"; }
  
  .fa-keybase:before {
    content: "\f4f5"; }
  
  .fa-apple-pay:before {
    content: "\f415"; }
  
  .fa-padlet:before {
    content: "\e4a0"; }
  
  .fa-amazon-pay:before {
    content: "\f42c"; }
  
  .fa-square-github:before {
    content: "\f092"; }
  
  .fa-github-square:before {
    content: "\f092"; }
  
  .fa-stumbleupon:before {
    content: "\f1a4"; }
  
  .fa-fedex:before {
    content: "\f797"; }
  
  .fa-phoenix-framework:before {
    content: "\f3dc"; }
  
  .fa-shopify:before {
    content: "\e057"; }
  
  .fa-neos:before {
    content: "\f612"; }
  
  .fa-hackerrank:before {
    content: "\f5f7"; }
  
  .fa-researchgate:before {
    content: "\f4f8"; }
  
  .fa-swift:before {
    content: "\f8e1"; }
  
  .fa-angular:before {
    content: "\f420"; }
  
  .fa-speakap:before {
    content: "\f3f3"; }
  
  .fa-angrycreative:before {
    content: "\f36e"; }
  
  .fa-y-combinator:before {
    content: "\f23b"; }
  
  .fa-empire:before {
    content: "\f1d1"; }
  
  .fa-envira:before {
    content: "\f299"; }
  
  .fa-square-gitlab:before {
    content: "\e5ae"; }
  
  .fa-gitlab-square:before {
    content: "\e5ae"; }
  
  .fa-studiovinari:before {
    content: "\f3f8"; }
  
  .fa-pied-piper:before {
    content: "\f2ae"; }
  
  .fa-wordpress:before {
    content: "\f19a"; }
  
  .fa-product-hunt:before {
    content: "\f288"; }
  
  .fa-firefox:before {
    content: "\f269"; }
  
  .fa-linode:before {
    content: "\f2b8"; }
  
  .fa-goodreads:before {
    content: "\f3a8"; }
  
  .fa-square-odnoklassniki:before {
    content: "\f264"; }
  
  .fa-odnoklassniki-square:before {
    content: "\f264"; }
  
  .fa-jsfiddle:before {
    content: "\f1cc"; }
  
  .fa-sith:before {
    content: "\f512"; }
  
  .fa-themeisle:before {
    content: "\f2b2"; }
  
  .fa-page4:before {
    content: "\f3d7"; }
  
  .fa-hashnode:before {
    content: "\e499"; }
  
  .fa-react:before {
    content: "\f41b"; }
  
  .fa-cc-paypal:before {
    content: "\f1f4"; }
  
  .fa-squarespace:before {
    content: "\f5be"; }
  
  .fa-cc-stripe:before {
    content: "\f1f5"; }
  
  .fa-creative-commons-share:before {
    content: "\f4f2"; }
  
  .fa-bitcoin:before {
    content: "\f379"; }
  
  .fa-keycdn:before {
    content: "\f3ba"; }
  
  .fa-opera:before {
    content: "\f26a"; }
  
  .fa-itch-io:before {
    content: "\f83a"; }
  
  .fa-umbraco:before {
    content: "\f8e8"; }
  
  .fa-galactic-senate:before {
    content: "\f50d"; }
  
  .fa-ubuntu:before {
    content: "\f7df"; }
  
  .fa-draft2digital:before {
    content: "\f396"; }
  
  .fa-stripe:before {
    content: "\f429"; }
  
  .fa-houzz:before {
    content: "\f27c"; }
  
  .fa-gg:before {
    content: "\f260"; }
  
  .fa-dhl:before {
    content: "\f790"; }
  
  .fa-square-pinterest:before {
    content: "\f0d3"; }
  
  .fa-pinterest-square:before {
    content: "\f0d3"; }
  
  .fa-xing:before {
    content: "\f168"; }
  
  .fa-blackberry:before {
    content: "\f37b"; }
  
  .fa-creative-commons-pd:before {
    content: "\f4ec"; }
  
  .fa-playstation:before {
    content: "\f3df"; }
  
  .fa-quinscape:before {
    content: "\f459"; }
  
  .fa-less:before {
    content: "\f41d"; }
  
  .fa-blogger-b:before {
    content: "\f37d"; }
  
  .fa-opencart:before {
    content: "\f23d"; }
  
  .fa-vine:before {
    content: "\f1ca"; }
  
  .fa-paypal:before {
    content: "\f1ed"; }
  
  .fa-gitlab:before {
    content: "\f296"; }
  
  .fa-typo3:before {
    content: "\f42b"; }
  
  .fa-reddit-alien:before {
    content: "\f281"; }
  
  .fa-yahoo:before {
    content: "\f19e"; }
  
  .fa-dailymotion:before {
    content: "\e052"; }
  
  .fa-affiliatetheme:before {
    content: "\f36b"; }
  
  .fa-pied-piper-pp:before {
    content: "\f1a7"; }
  
  .fa-bootstrap:before {
    content: "\f836"; }
  
  .fa-odnoklassniki:before {
    content: "\f263"; }
  
  .fa-nfc-symbol:before {
    content: "\e531"; }
  
  .fa-ethereum:before {
    content: "\f42e"; }
  
  .fa-speaker-deck:before {
    content: "\f83c"; }
  
  .fa-creative-commons-nc-eu:before {
    content: "\f4e9"; }
  
  .fa-patreon:before {
    content: "\f3d9"; }
  
  .fa-avianex:before {
    content: "\f374"; }
  
  .fa-ello:before {
    content: "\f5f1"; }
  
  .fa-gofore:before {
    content: "\f3a7"; }
  
  .fa-bimobject:before {
    content: "\f378"; }
  
  .fa-facebook-f:before {
    content: "\f39e"; }
  
  .fa-square-google-plus:before {
    content: "\f0d4"; }
  
  .fa-google-plus-square:before {
    content: "\f0d4"; }
  
  .fa-mandalorian:before {
    content: "\f50f"; }
  
  .fa-first-order-alt:before {
    content: "\f50a"; }
  
  .fa-osi:before {
    content: "\f41a"; }
  
  .fa-google-wallet:before {
    content: "\f1ee"; }
  
  .fa-d-and-d-beyond:before {
    content: "\f6ca"; }
  
  .fa-periscope:before {
    content: "\f3da"; }
  
  .fa-fulcrum:before {
    content: "\f50b"; }
  
  .fa-cloudscale:before {
    content: "\f383"; }
  
  .fa-forumbee:before {
    content: "\f211"; }
  
  .fa-mizuni:before {
    content: "\f3cc"; }
  
  .fa-schlix:before {
    content: "\f3ea"; }
  
  .fa-square-xing:before {
    content: "\f169"; }
  
  .fa-xing-square:before {
    content: "\f169"; }
  
  .fa-bandcamp:before {
    content: "\f2d5"; }
  
  .fa-wpforms:before {
    content: "\f298"; }
  
  .fa-cloudversify:before {
    content: "\f385"; }
  
  .fa-usps:before {
    content: "\f7e1"; }
  
  .fa-megaport:before {
    content: "\f5a3"; }
  
  .fa-magento:before {
    content: "\f3c4"; }
  
  .fa-spotify:before {
    content: "\f1bc"; }
  
  .fa-optin-monster:before {
    content: "\f23c"; }
  
  .fa-fly:before {
    content: "\f417"; }
  
  .fa-aviato:before {
    content: "\f421"; }
  
  .fa-itunes:before {
    content: "\f3b4"; }
  
  .fa-cuttlefish:before {
    content: "\f38c"; }
  
  .fa-blogger:before {
    content: "\f37c"; }
  
  .fa-flickr:before {
    content: "\f16e"; }
  
  .fa-viber:before {
    content: "\f409"; }
  
  .fa-soundcloud:before {
    content: "\f1be"; }
  
  .fa-digg:before {
    content: "\f1a6"; }
  
  .fa-tencent-weibo:before {
    content: "\f1d5"; }
  
  .fa-symfony:before {
    content: "\f83d"; }
  
  .fa-maxcdn:before {
    content: "\f136"; }
  
  .fa-etsy:before {
    content: "\f2d7"; }
  
  .fa-facebook-messenger:before {
    content: "\f39f"; }
  
  .fa-audible:before {
    content: "\f373"; }
  
  .fa-think-peaks:before {
    content: "\f731"; }
  
  .fa-bilibili:before {
    content: "\e3d9"; }
  
  .fa-erlang:before {
    content: "\f39d"; }
  
  .fa-cotton-bureau:before {
    content: "\f89e"; }
  
  .fa-dashcube:before {
    content: "\f210"; }
  
  .fa-42-group:before {
    content: "\e080"; }
  
  .fa-innosoft:before {
    content: "\e080"; }
  
  .fa-stack-exchange:before {
    content: "\f18d"; }
  
  .fa-elementor:before {
    content: "\f430"; }
  
  .fa-square-pied-piper:before {
    content: "\e01e"; }
  
  .fa-pied-piper-square:before {
    content: "\e01e"; }
  
  .fa-creative-commons-nd:before {
    content: "\f4eb"; }
  
  .fa-palfed:before {
    content: "\f3d8"; }
  
  .fa-superpowers:before {
    content: "\f2dd"; }
  
  .fa-resolving:before {
    content: "\f3e7"; }
  
  .fa-xbox:before {
    content: "\f412"; }
  
  .fa-searchengin:before {
    content: "\f3eb"; }
  
  .fa-tiktok:before {
    content: "\e07b"; }
  
  .fa-square-facebook:before {
    content: "\f082"; }
  
  .fa-facebook-square:before {
    content: "\f082"; }
  
  .fa-renren:before {
    content: "\f18b"; }
  
  .fa-linux:before {
    content: "\f17c"; }
  
  .fa-glide:before {
    content: "\f2a5"; }
  
  .fa-linkedin:before {
    content: "\f08c"; }
  
  .fa-hubspot:before {
    content: "\f3b2"; }
  
  .fa-deploydog:before {
    content: "\f38e"; }
  
  .fa-twitch:before {
    content: "\f1e8"; }
  
  .fa-ravelry:before {
    content: "\f2d9"; }
  
  .fa-mixer:before {
    content: "\e056"; }
  
  .fa-square-lastfm:before {
    content: "\f203"; }
  
  .fa-lastfm-square:before {
    content: "\f203"; }
  
  .fa-vimeo:before {
    content: "\f40a"; }
  
  .fa-mendeley:before {
    content: "\f7b3"; }
  
  .fa-uniregistry:before {
    content: "\f404"; }
  
  .fa-figma:before {
    content: "\f799"; }
  
  .fa-creative-commons-remix:before {
    content: "\f4ee"; }
  
  .fa-cc-amazon-pay:before {
    content: "\f42d"; }
  
  .fa-dropbox:before {
    content: "\f16b"; }
  
  .fa-instagram:before {
    content: "\f16d"; }
  
  .fa-cmplid:before {
    content: "\e360"; }
  
  .fa-facebook:before {
    content: "\f09a"; }
  
  .fa-gripfire:before {
    content: "\f3ac"; }
  
  .fa-jedi-order:before {
    content: "\f50e"; }
  
  .fa-uikit:before {
    content: "\f403"; }
  
  .fa-fort-awesome-alt:before {
    content: "\f3a3"; }
  
  .fa-phabricator:before {
    content: "\f3db"; }
  
  .fa-ussunnah:before {
    content: "\f407"; }
  
  .fa-earlybirds:before {
    content: "\f39a"; }
  
  .fa-trade-federation:before {
    content: "\f513"; }
  
  .fa-autoprefixer:before {
    content: "\f41c"; }
  
  .fa-whatsapp:before {
    content: "\f232"; }
  
  .fa-slideshare:before {
    content: "\f1e7"; }
  
  .fa-google-play:before {
    content: "\f3ab"; }
  
  .fa-viadeo:before {
    content: "\f2a9"; }
  
  .fa-line:before {
    content: "\f3c0"; }
  
  .fa-google-drive:before {
    content: "\f3aa"; }
  
  .fa-servicestack:before {
    content: "\f3ec"; }
  
  .fa-simplybuilt:before {
    content: "\f215"; }
  
  .fa-bitbucket:before {
    content: "\f171"; }
  
  .fa-imdb:before {
    content: "\f2d8"; }
  
  .fa-deezer:before {
    content: "\e077"; }
  
  .fa-raspberry-pi:before {
    content: "\f7bb"; }
  
  .fa-jira:before {
    content: "\f7b1"; }
  
  .fa-docker:before {
    content: "\f395"; }
  
  .fa-screenpal:before {
    content: "\e570"; }
  
  .fa-bluetooth:before {
    content: "\f293"; }
  
  .fa-gitter:before {
    content: "\f426"; }
  
  .fa-d-and-d:before {
    content: "\f38d"; }
  
  .fa-microblog:before {
    content: "\e01a"; }
  
  .fa-cc-diners-club:before {
    content: "\f24c"; }
  
  .fa-gg-circle:before {
    content: "\f261"; }
  
  .fa-pied-piper-hat:before {
    content: "\f4e5"; }
  
  .fa-kickstarter-k:before {
    content: "\f3bc"; }
  
  .fa-yandex:before {
    content: "\f413"; }
  
  .fa-readme:before {
    content: "\f4d5"; }
  
  .fa-html5:before {
    content: "\f13b"; }
  
  .fa-sellsy:before {
    content: "\f213"; }
  
  .fa-sass:before {
    content: "\f41e"; }
  
  .fa-wirsindhandwerk:before {
    content: "\e2d0"; }
  
  .fa-wsh:before {
    content: "\e2d0"; }
  
  .fa-buromobelexperte:before {
    content: "\f37f"; }
  
  .fa-salesforce:before {
    content: "\f83b"; }
  
  .fa-octopus-deploy:before {
    content: "\e082"; }
  
  .fa-medapps:before {
    content: "\f3c6"; }
  
  .fa-ns8:before {
    content: "\f3d5"; }
  
  .fa-pinterest-p:before {
    content: "\f231"; }
  
  .fa-apper:before {
    content: "\f371"; }
  
  .fa-fort-awesome:before {
    content: "\f286"; }
  
  .fa-waze:before {
    content: "\f83f"; }
  
  .fa-cc-jcb:before {
    content: "\f24b"; }
  
  .fa-snapchat:before {
    content: "\f2ab"; }
  
  .fa-snapchat-ghost:before {
    content: "\f2ab"; }
  
  .fa-fantasy-flight-games:before {
    content: "\f6dc"; }
  
  .fa-rust:before {
    content: "\e07a"; }
  
  .fa-wix:before {
    content: "\f5cf"; }
  
  .fa-square-behance:before {
    content: "\f1b5"; }
  
  .fa-behance-square:before {
    content: "\f1b5"; }
  
  .fa-supple:before {
    content: "\f3f9"; }
  
  .fa-rebel:before {
    content: "\f1d0"; }
  
  .fa-css3:before {
    content: "\f13c"; }
  
  .fa-staylinked:before {
    content: "\f3f5"; }
  
  .fa-kaggle:before {
    content: "\f5fa"; }
  
  .fa-space-awesome:before {
    content: "\e5ac"; }
  
  .fa-deviantart:before {
    content: "\f1bd"; }
  
  .fa-cpanel:before {
    content: "\f388"; }
  
  .fa-goodreads-g:before {
    content: "\f3a9"; }
  
  .fa-square-git:before {
    content: "\f1d2"; }
  
  .fa-git-square:before {
    content: "\f1d2"; }
  
  .fa-square-tumblr:before {
    content: "\f174"; }
  
  .fa-tumblr-square:before {
    content: "\f174"; }
  
  .fa-trello:before {
    content: "\f181"; }
  
  .fa-creative-commons-nc-jp:before {
    content: "\f4ea"; }
  
  .fa-get-pocket:before {
    content: "\f265"; }
  
  .fa-perbyte:before {
    content: "\e083"; }
  
  .fa-grunt:before {
    content: "\f3ad"; }
  
  .fa-weebly:before {
    content: "\f5cc"; }
  
  .fa-connectdevelop:before {
    content: "\f20e"; }
  
  .fa-leanpub:before {
    content: "\f212"; }
  
  .fa-black-tie:before {
    content: "\f27e"; }
  
  .fa-themeco:before {
    content: "\f5c6"; }
  
  .fa-python:before {
    content: "\f3e2"; }
  
  .fa-android:before {
    content: "\f17b"; }
  
  .fa-bots:before {
    content: "\e340"; }
  
  .fa-free-code-camp:before {
    content: "\f2c5"; }
  
  .fa-hornbill:before {
    content: "\f592"; }
  
  .fa-js:before {
    content: "\f3b8"; }
  
  .fa-ideal:before {
    content: "\e013"; }
  
  .fa-git:before {
    content: "\f1d3"; }
  
  .fa-dev:before {
    content: "\f6cc"; }
  
  .fa-sketch:before {
    content: "\f7c6"; }
  
  .fa-yandex-international:before {
    content: "\f414"; }
  
  .fa-cc-amex:before {
    content: "\f1f3"; }
  
  .fa-uber:before {
    content: "\f402"; }
  
  .fa-github:before {
    content: "\f09b"; }
  
  .fa-php:before {
    content: "\f457"; }
  
  .fa-alipay:before {
    content: "\f642"; }
  
  .fa-youtube:before {
    content: "\f167"; }
  
  .fa-skyatlas:before {
    content: "\f216"; }
  
  .fa-firefox-browser:before {
    content: "\e007"; }
  
  .fa-replyd:before {
    content: "\f3e6"; }
  
  .fa-suse:before {
    content: "\f7d6"; }
  
  .fa-jenkins:before {
    content: "\f3b6"; }
  
  .fa-twitter:before {
    content: "\f099"; }
  
  .fa-rockrms:before {
    content: "\f3e9"; }
  
  .fa-pinterest:before {
    content: "\f0d2"; }
  
  .fa-buffer:before {
    content: "\f837"; }
  
  .fa-npm:before {
    content: "\f3d4"; }
  
  .fa-yammer:before {
    content: "\f840"; }
  
  .fa-btc:before {
    content: "\f15a"; }
  
  .fa-dribbble:before {
    content: "\f17d"; }
  
  .fa-stumbleupon-circle:before {
    content: "\f1a3"; }
  
  .fa-internet-explorer:before {
    content: "\f26b"; }
  
  .fa-telegram:before {
    content: "\f2c6"; }
  
  .fa-telegram-plane:before {
    content: "\f2c6"; }
  
  .fa-old-republic:before {
    content: "\f510"; }
  
  .fa-square-whatsapp:before {
    content: "\f40c"; }
  
  .fa-whatsapp-square:before {
    content: "\f40c"; }
  
  .fa-node-js:before {
    content: "\f3d3"; }
  
  .fa-edge-legacy:before {
    content: "\e078"; }
  
  .fa-slack:before {
    content: "\f198"; }
  
  .fa-slack-hash:before {
    content: "\f198"; }
  
  .fa-medrt:before {
    content: "\f3c8"; }
  
  .fa-usb:before {
    content: "\f287"; }
  
  .fa-tumblr:before {
    content: "\f173"; }
  
  .fa-vaadin:before {
    content: "\f408"; }
  
  .fa-quora:before {
    content: "\f2c4"; }
  
  .fa-reacteurope:before {
    content: "\f75d"; }
  
  .fa-medium:before {
    content: "\f23a"; }
  
  .fa-medium-m:before {
    content: "\f23a"; }
  
  .fa-amilia:before {
    content: "\f36d"; }
  
  .fa-mixcloud:before {
    content: "\f289"; }
  
  .fa-flipboard:before {
    content: "\f44d"; }
  
  .fa-viacoin:before {
    content: "\f237"; }
  
  .fa-critical-role:before {
    content: "\f6c9"; }
  
  .fa-sitrox:before {
    content: "\e44a"; }
  
  .fa-discourse:before {
    content: "\f393"; }
  
  .fa-joomla:before {
    content: "\f1aa"; }
  
  .fa-mastodon:before {
    content: "\f4f6"; }
  
  .fa-airbnb:before {
    content: "\f834"; }
  
  .fa-wolf-pack-battalion:before {
    content: "\f514"; }
  
  .fa-buy-n-large:before {
    content: "\f8a6"; }
  
  .fa-gulp:before {
    content: "\f3ae"; }
  
  .fa-creative-commons-sampling-plus:before {
    content: "\f4f1"; }
  
  .fa-strava:before {
    content: "\f428"; }
  
  .fa-ember:before {
    content: "\f423"; }
  
  .fa-canadian-maple-leaf:before {
    content: "\f785"; }
  
  .fa-teamspeak:before {
    content: "\f4f9"; }
  
  .fa-pushed:before {
    content: "\f3e1"; }
  
  .fa-wordpress-simple:before {
    content: "\f411"; }
  
  .fa-nutritionix:before {
    content: "\f3d6"; }
  
  .fa-wodu:before {
    content: "\e088"; }
  
  .fa-google-pay:before {
    content: "\e079"; }
  
  .fa-intercom:before {
    content: "\f7af"; }
  
  .fa-zhihu:before {
    content: "\f63f"; }
  
  .fa-korvue:before {
    content: "\f42f"; }
  
  .fa-pix:before {
    content: "\e43a"; }
  
  .fa-steam-symbol:before {
    content: "\f3f6"; }
  :root, :host {
    --fa-style-family-classic: 'Font Awesome 6 Free';
    --fa-font-regular: normal 400 1em/1 'Font Awesome 6 Free'; }
  
  @font-face {
    font-family: 'Font Awesome 6 Free';
    font-style: normal;
    font-weight: 400;
    font-display: block;
    src: url("../public/fonts/fa-regular-400.woff2") format("woff2"), url("../public/fonts/fa-regular-400.ttf") format("truetype"); }
  
  .far,
  .fa-regular {
    font-weight: 400; }
  :root, :host {
    --fa-style-family-classic: 'Font Awesome 6 Free';
    --fa-font-solid: normal 900 1em/1 'Font Awesome 6 Free'; }
  
  @font-face {
    font-family: 'Font Awesome 6 Free';
    font-style: normal;
    font-weight: 900;
    font-display: block;
    src: url("../public/fonts/fa-solid-900.woff2") format("woff2"), url("../public/fonts/fa-solid-900.ttf") format("truetype"); }
  
  .fas,
  .fa-solid {
    font-weight: 900; }
  @font-face {
    font-family: 'Font Awesome 5 Brands';
    font-display: block;
    font-weight: 400;
    src: url("../public/fonts/fa-brands-400.woff2") format("woff2"), url("../public/fonts/fa-brands-400.ttf") format("truetype"); }
  
  @font-face {
    font-family: 'Font Awesome 5 Free';
    font-display: block;
    font-weight: 900;
    src: url("../public/fonts/fa-solid-900.woff2") format("woff2"), url("../public/fonts/fa-solid-900.ttf") format("truetype"); }
  
  @font-face {
    font-family: 'Font Awesome 5 Free';
    font-display: block;
    font-weight: 400;
    src: url("../public/fonts/fa-regular-400.woff2") format("woff2"), url("../public/fonts/fa-regular-400.ttf") format("truetype"); }
  @font-face {
    font-family: 'FontAwesome';
    font-display: block;
    src: url("../public/fonts/fa-solid-900.woff2") format("woff2"), url("../public/fonts/fa-solid-900.ttf") format("truetype"); }
  
  @font-face {
    font-family: 'FontAwesome';
    font-display: block;
    src: url("../public/fonts/fa-brands-400.woff2") format("woff2"), url("../public/fonts/fa-brands-400.ttf") format("truetype"); }
  
  @font-face {
    font-family: 'FontAwesome';
    font-display: block;
    src: url("../public/fonts/fa-regular-400.woff2") format("woff2"), url("../public/fonts/fa-regular-400.ttf") format("truetype");
    unicode-range: U+F003,U+F006,U+F014,U+F016-F017,U+F01A-F01B,U+F01D,U+F022,U+F03E,U+F044,U+F046,U+F05C-F05D,U+F06E,U+F070,U+F087-F088,U+F08A,U+F094,U+F096-F097,U+F09D,U+F0A0,U+F0A2,U+F0A4-F0A7,U+F0C5,U+F0C7,U+F0E5-F0E6,U+F0EB,U+F0F6-F0F8,U+F10C,U+F114-F115,U+F118-F11A,U+F11C-F11D,U+F133,U+F147,U+F14E,U+F150-F152,U+F185-F186,U+F18E,U+F190-F192,U+F196,U+F1C1-F1C9,U+F1D9,U+F1DB,U+F1E3,U+F1EA,U+F1F7,U+F1F9,U+F20A,U+F247-F248,U+F24A,U+F24D,U+F255-F25B,U+F25D,U+F271-F274,U+F278,U+F27B,U+F28C,U+F28E,U+F29C,U+F2B5,U+F2B7,U+F2BA,U+F2BC,U+F2BE,U+F2C0-F2C1,U+F2C3,U+F2D0,U+F2D2,U+F2D4,U+F2DC; }
  
  @font-face {
    font-family: 'FontAwesome';
    font-display: block;
    src: url("../public/fonts/fa-v4compatibility.woff2") format("woff2"), url("../public/fonts/fa-v4compatibility.ttf") format("truetype");
    unicode-range: U+F041,U+F047,U+F065-F066,U+F07D-F07E,U+F080,U+F08B,U+F08E,U+F090,U+F09A,U+F0AC,U+F0AE,U+F0B2,U+F0D0,U+F0D6,U+F0E4,U+F0EC,U+F10A-F10B,U+F123,U+F13E,U+F148-F149,U+F14C,U+F156,U+F15E,U+F160-F161,U+F163,U+F175-F178,U+F195,U+F1F8,U+F219,U+F27A; }
  
/* ============ =========== =========== =========== =========== ===========
Elusive Icons 2.0.0 by @ReduxFramework - http://elusiveicons.com - @reduxframework
License - http://elusiveicons.com/license (Font: SIL OFL 1.1, CSS: MIT License)
 ============ =========== =========== =========== =========== */
 @font-face {
    font-family: 'Elusive-Icons';
    src: url('../public/fonts/elusiveicons-webfont28b5.eot?v=2.0.0');
    src: url('../public/fonts/elusiveicons-webfontd41d.eot?#iefix&v=2.0.0') format('embedded-opentype'), url('../public/fonts/elusiveicons-webfont28b5.woff?v=2.0.0') format('woff'), url('../public/fonts/elusiveicons-webfont28b5.ttf?v=2.0.0') format('truetype'), url('../public/fonts/elusiveicons-webfont28b5.svg?v=2.0.0#elusiveiconsregular') format('svg');
    font-weight: normal;
    font-style: normal;
}
.el {
    display: inline-block;
    font: normal normal normal 14px/1 'Elusive-Icons';
    font-size: inherit;
    text-rendering: auto;
    -webkit-font-smoothing: antialiased;
    -moz-osx-font-smoothing: grayscale;
    transform: translate(0, 0);
}
/* makes the font 33% larger relative to the icon container */.el-lg {
    font-size: 1.33333em;
    line-height: 0.75em;
    vertical-align: -15%;
}
.el-2x {
    font-size: 2em;
}
.el-3x {
    font-size: 3em;
}
.el-4x {
    font-size: 4em;
}
.el-5x {
    font-size: 5em;
}
.el-fw {
    width: 1.28571em;
    text-align: center;
}
.el-ul {
    padding-left: 0;
    margin-left: 2.14286em;
    list-style-type: none;
}
.el-ul > li {
    position: relative;
}
.el-li {
    position: absolute;
    left: -2.14286em;
    width: 2.14286em;
    top: 0.14286em;
    text-align: center;
}
.el-li.el-lg {
    left: -1.85714em;
}
.el-border {
    padding: 0.2em 0.25em 0.15em;
    border: solid 0.08em #eee;
    border-radius: 0.1em;
}
.pull-right {
    float: right;
}
.pull-left {
    float: left;
}
.el.pull-left {
    margin-right: 0.3em;
}
.el.pull-right {
    margin-left: 0.3em;
}
.el-spin {
    -webkit-animation: el-spin 2s infinite linear;
    animation: el-spin 2s infinite linear;
}
.el-pulse {
    -webkit-animation: el-spin 1s infinite steps(8);
    animation: el-spin 1s infinite steps(8);
}
@-webkit-keyframes el-spin {
    0% {
        -webkit-transform: rotate(0deg);
        transform: rotate(0deg);
    }
    100% {
        -webkit-transform: rotate(359deg);
        transform: rotate(359deg);
    }
}
@keyframes el-spin {
    0% {
        -webkit-transform: rotate(0deg);
        transform: rotate(0deg);
    }
    100% {
        -webkit-transform: rotate(359deg);
        transform: rotate(359deg);
    }
}
.el-rotate-90 {
    filter: progid:DXImageTransform.Microsoft.BasicImage(rotation=1);
    -webkit-transform: rotate(90deg);
    -ms-transform: rotate(90deg);
    transform: rotate(90deg);
}
.el-rotate-180 {
    filter: progid:DXImageTransform.Microsoft.BasicImage(rotation=2);
    -webkit-transform: rotate(180deg);
    -ms-transform: rotate(180deg);
    transform: rotate(180deg);
}
.el-rotate-270 {
    filter: progid:DXImageTransform.Microsoft.BasicImage(rotation=3);
    -webkit-transform: rotate(270deg);
    -ms-transform: rotate(270deg);
    transform: rotate(270deg);
}
.el-flip-horizontal {
    filter: progid:DXImageTransform.Microsoft.BasicImage(rotation=0);
    -webkit-transform: scale(-1, 1);
    -ms-transform: scale(-1, 1);
    transform: scale(-1, 1);
}
.el-flip-vertical {
    filter: progid:DXImageTransform.Microsoft.BasicImage(rotation=2);
    -webkit-transform: scale(1, -1);
    -ms-transform: scale(1, -1);
    transform: scale(1, -1);
}
:root .el-rotate-90, :root .el-rotate-180, :root .el-rotate-270, :root .el-flip-horizontal, :root .el-flip-vertical {
    filter: none;
}
.el-stack {
    position: relative;
    display: inline-block;
    width: 2em;
    height: 2em;
    line-height: 2em;
    vertical-align: middle;
}
.el-stack-1x, .el-stack-2x {
    position: absolute;
    left: 0;
    width: 100%;
    text-align: center;
}
.el-stack-1x {
    line-height: inherit;
}
.el-stack-2x {
    font-size: 2em;
}
.el-inverse {
    color: #fff;
}
/* Elusive Icons uses the Unicode Private Use Area (PUA) to ensure screen
 readers do not read off random characters that represent icons */.el-address-book-alt:before {
    content: "\f101";
}
.el-address-book:before {
    content: "\f102";
}
.el-adjust-alt:before {
    content: "\f103";
}
.el-adjust:before {
    content: "\f104";
}
.el-adult:before {
    content: "\f105";
}
.el-align-center:before {
    content: "\f106";
}
.el-align-justify:before {
    content: "\f107";
}
.el-align-left:before {
    content: "\f108";
}
.el-align-right:before {
    content: "\f109";
}
.el-arrow-down:before {
    content: "\f10a";
}
.el-arrow-left:before {
    content: "\f10b";
}
.el-arrow-right:before {
    content: "\f10c";
}
.el-arrow-up:before {
    content: "\f10d";
}
.el-asl:before {
    content: "\f10e";
}
.el-asterisk:before {
    content: "\f10f";
}
.el-backward:before {
    content: "\f110";
}
.el-ban-circle:before {
    content: "\f111";
}
.el-barcode:before {
    content: "\f112";
}
.el-behance:before {
    content: "\f113";
}
.el-bell:before {
    content: "\f114";
}
.el-blind:before {
    content: "\f115";
}
.el-blogger:before {
    content: "\f116";
}
.el-bold:before {
    content: "\f117";
}
.el-book:before {
    content: "\f118";
}
.el-bookmark-empty:before {
    content: "\f119";
}
.el-bookmark:before {
    content: "\f11a";
}
.el-braille:before {
    content: "\f11b";
}
.el-briefcase:before {
    content: "\f11c";
}
.el-broom:before {
    content: "\f11d";
}
.el-brush:before {
    content: "\f11e";
}
.el-bulb:before {
    content: "\f11f";
}
.el-bullhorn:before {
    content: "\f120";
}
.el-calendar-sign:before {
    content: "\f121";
}
.el-calendar:before {
    content: "\f122";
}
.el-camera:before {
    content: "\f123";
}
.el-car:before {
    content: "\f124";
}
.el-caret-down:before {
    content: "\f125";
}
.el-caret-left:before {
    content: "\f126";
}
.el-caret-right:before {
    content: "\f127";
}
.el-caret-up:before {
    content: "\f128";
}
.el-cc:before {
    content: "\f129";
}
.el-certificate:before {
    content: "\f12a";
}
.el-check-empty:before {
    content: "\f12b";
}
.el-check:before {
    content: "\f12c";
}
.el-chevron-down:before {
    content: "\f12d";
}
.el-chevron-left:before {
    content: "\f12e";
}
.el-chevron-right:before {
    content: "\f12f";
}
.el-chevron-up:before {
    content: "\f130";
}
.el-child:before {
    content: "\f131";
}
.el-circle-arrow-down:before {
    content: "\f132";
}
.el-circle-arrow-left:before {
    content: "\f133";
}
.el-circle-arrow-right:before {
    content: "\f134";
}
.el-circle-arrow-up:before {
    content: "\f135";
}
.el-cloud-alt:before {
    content: "\f136";
}
.el-cloud:before {
    content: "\f137";
}
.el-cog-alt:before {
    content: "\f138";
}
.el-cog:before {
    content: "\f139";
}
.el-cogs:before {
    content: "\f13a";
}
.el-comment-alt:before {
    content: "\f13b";
}
.el-comment:before {
    content: "\f13c";
}
.el-compass-alt:before {
    content: "\f13d";
}
.el-compass:before {
    content: "\f13e";
}
.el-credit-card:before {
    content: "\f13f";
}
.el-css:before {
    content: "\f140";
}
.el-dashboard:before {
    content: "\f141";
}
.el-delicious:before {
    content: "\f142";
}
.el-deviantart:before {
    content: "\f143";
}
.el-digg:before {
    content: "\f144";
}
.el-download-alt:before {
    content: "\f145";
}
.el-download:before {
    content: "\f146";
}
.el-dribbble:before {
    content: "\f147";
}
.el-edit:before {
    content: "\f148";
}
.el-eject:before {
    content: "\f149";
}
.el-envelope-alt:before {
    content: "\f14a";
}
.el-envelope:before {
    content: "\f14b";
}
.el-error-alt:before {
    content: "\f14c";
}
.el-error:before {
    content: "\f14d";
}
.el-eur:before {
    content: "\f14e";
}
.el-exclamation-sign:before {
    content: "\f14f";
}
.el-eye-close:before {
    content: "\f150";
}
.el-eye-open:before {
    content: "\f151";
}
.el-facebook:before {
    content: "\f152";
}
.el-facetime-video:before {
    content: "\f153";
}
.el-fast-backward:before {
    content: "\f154";
}
.el-fast-forward:before {
    content: "\f155";
}
.el-female:before {
    content: "\f156";
}
.el-file-alt:before {
    content: "\f157";
}
.el-file-edit-alt:before {
    content: "\f158";
}
.el-file-edit:before {
    content: "\f159";
}
.el-file-new-alt:before {
    content: "\f15a";
}
.el-file-new:before {
    content: "\f15b";
}
.el-file:before {
    content: "\f15c";
}
.el-film:before {
    content: "\f15d";
}
.el-filter:before {
    content: "\f15e";
}
.el-fire:before {
    content: "\f15f";
}
.el-flag-alt:before {
    content: "\f160";
}
.el-flag:before {
    content: "\f161";
}
.el-flickr:before {
    content: "\f162";
}
.el-folder-close:before {
    content: "\f163";
}
.el-folder-open:before {
    content: "\f164";
}
.el-folder-sign:before {
    content: "\f165";
}
.el-folder:before {
    content: "\f166";
}
.el-font:before {
    content: "\f167";
}
.el-fontsize:before {
    content: "\f168";
}
.el-fork:before {
    content: "\f169";
}
.el-forward-alt:before {
    content: "\f16a";
}
.el-forward:before {
    content: "\f16b";
}
.el-foursquare:before {
    content: "\f16c";
}
.el-friendfeed-rect:before {
    content: "\f16d";
}
.el-friendfeed:before {
    content: "\f16e";
}
.el-fullscreen:before {
    content: "\f16f";
}
.el-gbp:before {
    content: "\f170";
}
.el-gift:before {
    content: "\f171";
}
.el-github-text:before {
    content: "\f172";
}
.el-github:before {
    content: "\f173";
}
.el-glass:before {
    content: "\f174";
}
.el-glasses:before {
    content: "\f175";
}
.el-globe-alt:before {
    content: "\f176";
}
.el-globe:before {
    content: "\f177";
}
.el-googleplus:before {
    content: "\f178";
}
.el-graph-alt:before {
    content: "\f179";
}
.el-graph:before {
    content: "\f17a";
}
.el-group-alt:before {
    content: "\f17b";
}
.el-group:before {
    content: "\f17c";
}
.el-guidedog:before {
    content: "\f17d";
}
.el-hand-down:before {
    content: "\f17e";
}
.el-hand-left:before {
    content: "\f17f";
}
.el-hand-right:before {
    content: "\f180";
}
.el-hand-up:before {
    content: "\f181";
}
.el-hdd:before {
    content: "\f182";
}
.el-headphones:before {
    content: "\f183";
}
.el-hearing-impaired:before {
    content: "\f184";
}
.el-heart-alt:before {
    content: "\f185";
}
.el-heart-empty:before {
    content: "\f186";
}
.el-heart:before {
    content: "\f187";
}
.el-home-alt:before {
    content: "\f188";
}
.el-home:before {
    content: "\f189";
}
.el-hourglass:before {
    content: "\f18a";
}
.el-idea-alt:before {
    content: "\f18b";
}
.el-idea:before {
    content: "\f18c";
}
.el-inbox-alt:before {
    content: "\f18d";
}
.el-inbox-box:before {
    content: "\f18e";
}
.el-inbox:before {
    content: "\f18f";
}
.el-indent-left:before {
    content: "\f190";
}
.el-indent-right:before {
    content: "\f191";
}
.el-info-circle:before {
    content: "\f192";
}
.el-instagram:before {
    content: "\f193";
}
.el-iphone-home:before {
    content: "\f194";
}
.el-italic:before {
    content: "\f195";
}
.el-key:before {
    content: "\f196";
}
.el-laptop-alt:before {
    content: "\f197";
}
.el-laptop:before {
    content: "\f198";
}
.el-lastfm:before {
    content: "\f199";
}
.el-leaf:before {
    content: "\f19a";
}
.el-lines:before {
    content: "\f19b";
}
.el-link:before {
    content: "\f19c";
}
.el-linkedin:before {
    content: "\f19d";
}
.el-list-alt:before {
    content: "\f19e";
}
.el-list:before {
    content: "\f19f";
}
.el-livejournal:before {
    content: "\f1a0";
}
.el-lock-alt:before {
    content: "\f1a1";
}
.el-lock:before {
    content: "\f1a2";
}
.el-magic:before {
    content: "\f1a3";
}
.el-magnet:before {
    content: "\f1a4";
}
.el-male:before {
    content: "\f1a5";
}
.el-map-marker-alt:before {
    content: "\f1a6";
}
.el-map-marker:before {
    content: "\f1a7";
}
.el-mic-alt:before {
    content: "\f1a8";
}
.el-mic:before {
    content: "\f1a9";
}
.el-minus-sign:before {
    content: "\f1aa";
}
.el-minus:before {
    content: "\f1ab";
}
.el-move:before {
    content: "\f1ac";
}
.el-music:before {
    content: "\f1ad";
}
.el-myspace:before {
    content: "\f1ae";
}
.el-network:before {
    content: "\f1af";
}
.el-off:before {
    content: "\f1b0";
}
.el-ok-circle:before {
    content: "\f1b1";
}
.el-ok-sign:before {
    content: "\f1b2";
}
.el-ok:before {
    content: "\f1b3";
}
.el-opensource:before {
    content: "\f1b4";
}
.el-paper-clip-alt:before {
    content: "\f1b5";
}
.el-paper-clip:before {
    content: "\f1b6";
}
.el-path:before {
    content: "\f1b7";
}
.el-pause-alt:before {
    content: "\f1b8";
}
.el-pause:before {
    content: "\f1b9";
}
.el-pencil-alt:before {
    content: "\f1ba";
}
.el-pencil:before {
    content: "\f1bb";
}
.el-person:before {
    content: "\f1bc";
}
.el-phone-alt:before {
    content: "\f1bd";
}
.el-phone:before {
    content: "\f1be";
}
.el-photo-alt:before {
    content: "\f1bf";
}
.el-photo:before {
    content: "\f1c0";
}
.el-picasa:before {
    content: "\f1c1";
}
.el-picture:before {
    content: "\f1c2";
}
.el-pinterest:before {
    content: "\f1c3";
}
.el-plane:before {
    content: "\f1c4";
}
.el-play-alt:before {
    content: "\f1c5";
}
.el-play-circle:before {
    content: "\f1c6";
}
.el-play:before {
    content: "\f1c7";
}
.el-plurk-alt:before {
    content: "\f1c8";
}
.el-plurk:before {
    content: "\f1c9";
}
.el-plus-sign:before {
    content: "\f1ca";
}
.el-plus:before {
    content: "\f1cb";
}
.el-podcast:before {
    content: "\f1cc";
}
.el-print:before {
    content: "\f1cd";
}
.el-puzzle:before {
    content: "\f1ce";
}
.el-qrcode:before {
    content: "\f1cf";
}
.el-question-sign:before {
    content: "\f1d0";
}
.el-question:before {
    content: "\f1d1";
}
.el-quote-alt:before {
    content: "\f1d2";
}
.el-quote-right-alt:before {
    content: "\f1d3";
}
.el-quote-right:before {
    content: "\f1d4";
}
.el-quotes:before {
    content: "\f1d5";
}
.el-random:before {
    content: "\f1d6";
}
.el-record:before {
    content: "\f1d7";
}
.el-reddit:before {
    content: "\f1d8";
}
.el-redux:before {
    content: "\f1d9";
}
.el-refresh:before {
    content: "\f1da";
}
.el-remove-circle:before {
    content: "\f1db";
}
.el-remove-sign:before {
    content: "\f1dc";
}
.el-remove:before {
    content: "\f1dd";
}
.el-repeat-alt:before {
    content: "\f1de";
}
.el-repeat:before {
    content: "\f1df";
}
.el-resize-full:before {
    content: "\f1e0";
}
.el-resize-horizontal:before {
    content: "\f1e1";
}
.el-resize-small:before {
    content: "\f1e2";
}
.el-resize-vertical:before {
    content: "\f1e3";
}
.el-return-key:before {
    content: "\f1e4";
}
.el-retweet:before {
    content: "\f1e5";
}
.el-reverse-alt:before {
    content: "\f1e6";
}
.el-road:before {
    content: "\f1e7";
}
.el-rss:before {
    content: "\f1e8";
}
.el-scissors:before {
    content: "\f1e9";
}
.el-screen-alt:before {
    content: "\f1ea";
}
.el-screen:before {
    content: "\f1eb";
}
.el-screenshot:before {
    content: "\f1ec";
}
.el-search-alt:before {
    content: "\f1ed";
}
.el-search:before {
    content: "\f1ee";
}
.el-share-alt:before {
    content: "\f1ef";
}
.el-share:before {
    content: "\f1f0";
}
.el-shopping-cart-sign:before {
    content: "\f1f1";
}
.el-shopping-cart:before {
    content: "\f1f2";
}
.el-signal:before {
    content: "\f1f3";
}
.el-skype:before {
    content: "\f1f4";
}
.el-slideshare:before {
    content: "\f1f5";
}
.el-smiley-alt:before {
    content: "\f1f6";
}
.el-smiley:before {
    content: "\f1f7";
}
.el-soundcloud:before {
    content: "\f1f8";
}
.el-speaker:before {
    content: "\f1f9";
}
.el-spotify:before {
    content: "\f1fa";
}
.el-stackoverflow:before {
    content: "\f1fb";
}
.el-star-alt:before {
    content: "\f1fc";
}
.el-star-empty:before {
    content: "\f1fd";
}
.el-star:before {
    content: "\f1fe";
}
.el-step-backward:before {
    content: "\f1ff";
}
.el-step-forward:before {
    content: "\f200";
}
.el-stop-alt:before {
    content: "\f201";
}
.el-stop:before {
    content: "\f202";
}
.el-stumbleupon:before {
    content: "\f203";
}
.el-tag:before {
    content: "\f204";
}
.el-tags:before {
    content: "\f205";
}
.el-tasks:before {
    content: "\f206";
}
.el-text-height:before {
    content: "\f207";
}
.el-text-width:before {
    content: "\f208";
}
.el-th-large:before {
    content: "\f209";
}
.el-th-list:before {
    content: "\f20a";
}
.el-th:before {
    content: "\f20b";
}
.el-thumbs-down:before {
    content: "\f20c";
}
.el-thumbs-up:before {
    content: "\f20d";
}
.el-time-alt:before {
    content: "\f20e";
}
.el-time:before {
    content: "\f20f";
}
.el-tint:before {
    content: "\f210";
}
.el-torso:before {
    content: "\f211";
}
.el-trash-alt:before {
    content: "\f212";
}
.el-trash:before {
    content: "\f213";
}
.el-tumblr:before {
    content: "\f214";
}
.el-twitter:before {
    content: "\f215";
}
.el-universal-access:before {
    content: "\f216";
}
.el-unlock-alt:before {
    content: "\f217";
}
.el-unlock:before {
    content: "\f218";
}
.el-upload:before {
    content: "\f219";
}
.el-usd:before {
    content: "\f21a";
}
.el-user:before {
    content: "\f21b";
}
.el-viadeo:before {
    content: "\f21c";
}
.el-video-alt:before {
    content: "\f21d";
}
.el-video-chat:before {
    content: "\f21e";
}
.el-video:before {
    content: "\f21f";
}
.el-view-mode:before {
    content: "\f220";
}
.el-vimeo:before {
    content: "\f221";
}
.el-vkontakte:before {
    content: "\f222";
}
.el-volume-down:before {
    content: "\f223";
}
.el-volume-off:before {
    content: "\f224";
}
.el-volume-up:before {
    content: "\f225";
}
.el-w3c:before {
    content: "\f226";
}
.el-warning-sign:before {
    content: "\f227";
}
.el-website-alt:before {
    content: "\f228";
}
.el-website:before {
    content: "\f229";
}
.el-wheelchair:before {
    content: "\f22a";
}
.el-wordpress:before {
    content: "\f22b";
}
.el-wrench-alt:before {
    content: "\f22c";
}
.el-wrench:before {
    content: "\f22d";
}
.el-youtube:before {
    content: "\f22e";
}
.el-zoom-in:before {
    content: "\f22f";
}
.el-zoom-out:before {
    content: "\f230";
}


body {
	font-family: 'Open Sans', sans-serif;
	font-weight: 400;
	color: #666;
	font-size: 12px;
	line-height: 20px;
	width: 100%;
}
h1, h2, h3, h4, h5, h6 {
	color: #444;
}
/* default font size */
.fa {
	font-size: 14px;
}
/* Override the bootstrap defaults */
h1 {
	font-size: 33px;
}
h2 {
	font-size: 27px;
}
h3 {
	font-size: 21px;
}
h4 {
	font-size: 15px;
}
h5 {
	font-size: 12px;
}
h6 {
	font-size: 10.2px;
}
a {
	color: #23a1d1;
}
a:hover {
	text-decoration: none;
}
legend {
	font-size: 18px;
	padding: 7px 0px
}
label {
	font-size: 12px;
	font-weight: normal;
}
select.form-control, textarea.form-control, input[type="text"].form-control, input[type="password"].form-control, input[type="datetime"].form-control, input[type="datetime-local"].form-control, input[type="date"].form-control, input[type="month"].form-control, input[type="time"].form-control, input[type="week"].form-control, input[type="number"].form-control, input[type="email"].form-control, input[type="url"].form-control, input[type="search"].form-control, input[type="tel"].form-control, input[type="color"].form-control {
	font-size: 12px;
}
.input-group input, .input-group select, .input-group .dropdown-menu, .input-group .popover {
	font-size: 12px;
}
.input-group .input-group-addon {
	font-size: 12px;
	height: 30px;
}
/* Fix some bootstrap issues */
span.hidden-xs, span.hidden-sm, span.hidden-md, span.hidden-lg {
	display: inline;
}

.nav-tabs {
	margin-bottom: 15px;
}
div.required .control-label:before {
	content: '* ';
	color: #F00;
	font-weight: bold;
}
/* Gradent to all drop down menus */
.dropdown-menu li > a:hover {
	text-decoration: none;
	color: #ffffff;

}

#top .container {
	padding: 0 20px;
}
#top #form-currency .currency-select,
#top #form-language .language-select {
	text-align: left;
}
#top #form-currency .currency-select:hover,
#top #form-language .language-select:hover {
	text-shadow: none;
	color: #ffffff;
	background-color: #229ac8;
	background-image: linear-gradient(to bottom, #23a1d1, #1f90bb);
	background-repeat: repeat-x;
}
#top .btn-link, #top-links li, #top-links a {
	color: #888;
	text-shadow: 0 1px 0 #FFF;
	text-decoration: none;
}
#top .btn-link:hover, #top-links a:hover {
	color: #444;
}
#top-links .dropdown-menu a {
	text-shadow: none;
}
#top-links .dropdown-menu a:hover {
	color: #FFF;
}
#top .btn-link strong {
	font-size: 14px;
        line-height: 14px;
}
#top-links {
	padding-top: 6px;
}
#top-links a + a {
	margin-left: 15px;
}
/* logo */
#logo {
	margin: 0 0 10px 0;
}
/* search */
#search {
	margin-bottom: 10px;
}
#search .input-lg {
	height: 40px;
	line-height: 20px;
	padding: 0 10px;
}
#search .btn-lg {
	font-size: 15px;
	line-height: 18px;
	padding: 10px 35px;
	text-shadow: 0 1px 0 #FFF;
}
/* cart */
#cart {
	margin-bottom: 10px;
}
#cart > .btn {
	font-size: 12px;
	line-height: 18px;
	color: #FFF;
}
#cart.open > .btn {
	background-image: none;
	background-color: #FFFFFF;
	border: 1px solid #E6E6E6;
	color: #666;
	box-shadow: none;
	text-shadow: none;
}
#cart.open > .btn:hover {
	color: #444;
}
#cart .dropdown-menu {
	background: #eee;
	z-index: 1001;
}
#cart .dropdown-menu {
	min-width: 100%;
}
@media (max-width: 478px) {
	#cart .dropdown-menu {
		width: 100%;
	}
}
#cart .dropdown-menu table {
	margin-bottom: 10px;
}
#cart .dropdown-menu li > div {
	min-width: 427px;
	padding: 0 10px;
}
@media (max-width: 478px) {
	#cart .dropdown-menu li > div {
		min-width: 100%;
	}
}
#cart .dropdown-menu li p {
	margin: 20px 0;
}
/* menu */
#menu {
	background-color: #229ac8;
	background-image: linear-gradient(to bottom, #23a1d1, #1f90bb);
	background-repeat: repeat-x;
	border-color: #1f90bb #1f90bb #145e7a;
	min-height: 40px;
}
#menu .nav > li > a {
	color: #fff;
	text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
	padding: 10px 15px 10px 15px;
	min-height: 15px;
	background-color: transparent;
}
#menu .nav > li > a:hover, #menu .nav > li.open > a {
	background-color: rgba(0, 0, 0, 0.1);
}
#menu .dropdown-menu {
	padding-bottom: 0;
}
#menu .dropdown-inner {
	display: table;
}
#menu .dropdown-inner ul {
	display: table-cell;
}
#menu .dropdown-inner a {
	min-width: 160px;
	display: block;
	padding: 3px 20px;
	clear: both;
	line-height: 20px;
	color: #333333;
	font-size: 12px;
}
#menu .dropdown-inner li a:hover {
	color: #FFFFFF;
}
#menu .see-all {
	display: block;
	margin-top: 0.5em;
	border-top: 1px solid #DDD;
	padding: 3px 20px;
	-webkit-border-radius: 0 0 4px 4px;
	-moz-border-radius: 0 0 4px 4px;
	border-radius: 0 0 3px 3px;
	font-size: 12px;
}
#menu .see-all:hover, #menu .see-all:focus {
	text-decoration: none;
	color: #ffffff;
	background-color: #229ac8;
	background-image: linear-gradient(to bottom, #23a1d1, #1f90bb);
	background-repeat: repeat-x;
}
#menu #category {
	float: left;
	padding-left: 15px;
	font-size: 16px;
	font-weight: 700;
	line-height: 40px;
	color: #fff;
	text-shadow: 0 1px 0 rgba(0, 0, 0, 0.2);
}
#menu .btn-navbar {
	font-size: 15px;
	font-stretch: expanded;
	color: #FFF;
	padding: 2px 18px;
	float: right;
	background-color: #229ac8;
	background-image: linear-gradient(to bottom, #23a1d1, #1f90bb);
	background-repeat: repeat-x;
	border-color: #1f90bb #1f90bb #145e7a;
}
#menu .btn-navbar:hover, #menu .btn-navbar:focus, #menu .btn-navbar:active, #menu .btn-navbar.disabled, #menu .btn-navbar[disabled] {
	color: #ffffff;
	background-color: #229ac8;
}
@media (min-width: 768px) {
	#menu .dropdown:hover .dropdown-menu {
		display: block;
	}
}
@media (max-width: 767px) {
	#menu {
		border-radius: 4px;
	}
	#menu div.dropdown-inner > ul.list-unstyled {
		display: block;
	}
	#menu div.dropdown-menu {
		margin-left: 0 !important;
		padding-bottom: 10px;
		background-color: rgba(0, 0, 0, 0.1);
	}
	#menu .dropdown-inner {
		display: block;
	}
	#menu .dropdown-inner a {
		width: 100%;
		color: #fff;
	}
	#menu .dropdown-menu a:hover,
	#menu .dropdown-menu ul li a:hover {
		background: rgba(0, 0, 0, 0.1);
	}
	#menu .see-all {
		margin-top: 0;
		border: none;
		border-radius: 0;
		color: #fff;
	}
}
/* content */
#content {
	min-height: 600px;
}
/* footer */
footer {
/*	margin-top: 30px; */
	padding-top: 30px;
	background-color: #303030;
	border-top: 1px solid #ddd;
	color: #e2e2e2;
}
footer hr {
	border-top: none;
	border-bottom: 1px solid #666;
}
footer a {
	color: #ccc;
}
footer a:hover {
	color: #fff;
}
footer h5 {
	font-family: 'Open Sans', sans-serif;
	font-size: 13px;
	font-weight: bold;
	color: #fff;
}
/* alert */
.alert {
	padding: 8px 14px 8px 14px;
}

.pagination {
	margin: 0;
}
/* buttons */
.buttons {
	margin: 1em 0;
}
.btn {
	padding: 7.5px 12px;
	font-size: 12px;
	border: 1px solid #cccccc;
	border-radius: 4px;
	box-shadow: inset 0 1px 0 rgba(255,255,255,.2), 0 1px 2px rgba(0,0,0,.05);
}
.btn-xs {
	font-size: 9px;
}
.btn-sm {
	font-size: 10.2px;
}
.btn-lg {
	padding: 10px 16px;
	font-size: 15px;
}
.btn-group > .btn, .btn-group > .dropdown-menu, .btn-group > .popover {
	font-size: 12px;
}
.btn-group > .btn-xs {
	font-size: 9px;
}
.btn-group > .btn-sm {
	font-size: 10.2px;
}
.btn-group > .btn-lg {
	font-size: 15px;
}
.btn-default {
	color: #777;
	text-shadow: 0 1px 0 rgba(255, 255, 255, 0.5);
	background-color: #e7e7e7;
	background-image: linear-gradient(to bottom, #eeeeee, #dddddd);
	background-repeat: repeat-x;
	border-color: #dddddd #dddddd #b3b3b3 #b7b7b7;
}
.btn-primary {
	color: #ffffff;
	text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
	background-color: #229ac8;
	background-image: linear-gradient(to bottom, #23a1d1, #1f90bb);
	background-repeat: repeat-x;
	border-color: #1f90bb #1f90bb #145e7a;
}
.btn-primary:hover, .btn-primary:active, .btn-primary.active, .btn-primary.disabled, .btn-primary[disabled] {
	background-color: #1f90bb;
	background-position: 0 -15px;
}
.btn-warning {
	color: #ffffff;
	text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
	background-color: #faa732;
	background-image: linear-gradient(to bottom, #fbb450, #f89406);
	background-repeat: repeat-x;
	border-color: #f89406 #f89406 #ad6704;
}
.btn-warning:hover, .btn-warning:active, .btn-warning.active, .btn-warning.disabled, .btn-warning[disabled] {
	box-shadow: inset 0 1000px 0 rgba(0, 0, 0, 0.1);
}
.btn-danger {
	color: #ffffff;
	text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
	background-color: #da4f49;
	background-image: linear-gradient(to bottom, #ee5f5b, #bd362f);
	background-repeat: repeat-x;
	border-color: #bd362f #bd362f #802420;
}
.btn-danger:hover, .btn-danger:active, .btn-danger.active, .btn-danger.disabled, .btn-danger[disabled] {
	box-shadow: inset 0 1000px 0 rgba(0, 0, 0, 0.1);
}
.btn-success {
	color: #ffffff;
	text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
	background-color: #5bb75b;
	background-image: linear-gradient(to bottom, #62c462, #51a351);
	background-repeat: repeat-x;
	border-color: #51a351 #51a351 #387038;
}
.btn-success:hover, .btn-success:active, .btn-success.active, .btn-success.disabled, .btn-success[disabled] {
	box-shadow: inset 0 1000px 0 rgba(0, 0, 0, 0.1);
}
.btn-info {
	color: #ffffff;
	text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
	background-color: #df5c39;
	background-image: linear-gradient(to bottom, #e06342, #dc512c);
	background-repeat: repeat-x;
	border-color: #dc512c #dc512c #a2371a;
}
.btn-info:hover, .btn-info:active, .btn-info.active, .btn-info.disabled, .btn-info[disabled] {
	background-image: none;
	background-color: #df5c39;
}
.btn-link {
	border-color: rgba(0, 0, 0, 0);
	cursor: pointer;
	color: #23A1D1;
	border-radius: 0;
}
.btn-link, .btn-link:active, .btn-link[disabled] {
	background-color: rgba(0, 0, 0, 0);
	background-image: none;
	box-shadow: none;
}
.btn-inverse {
	color: #ffffff;
	text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25);
	background-color: #363636;
	background-image: linear-gradient(to bottom, #444444, #222222);
	background-repeat: repeat-x;
	border-color: #222222 #222222 #000000;
}
.btn-inverse:hover, .btn-inverse:active, .btn-inverse.active, .btn-inverse.disabled, .btn-inverse[disabled] {
	background-color: #222222;
	background-image: linear-gradient(to bottom, #333333, #111111);
}
/* list group */
.list-group a {
	border: 1px solid #DDDDDD;
	color: #888888;
	padding: 8px 12px;
}
.list-group a.active, .list-group a.active:hover, .list-group a:hover {
	color: #444444;
	background: #eeeeee;
	border: 1px solid #DDDDDD;
	text-shadow: 0 1px 0 #FFF;
}
/* carousel */
.carousel-caption {
	color: #FFFFFF;
	text-shadow: 0 1px 0 #000000;
}
.carousel-control .icon-prev:before {
	content: '\f053';
	font-family: FontAwesome;
}
.carousel-control .icon-next:before {
	content: '\f054';
	font-family: FontAwesome;
}
/* product list */
.product-thumb {
	border: 1px solid #ddd;
	margin-bottom: 20px;
	overflow: auto;
}
.product-thumb .image {
	text-align: center;
}
.product-thumb .image a {
	display: block;
}
.product-thumb .image a:hover {
	opacity: 0.8;
}
.product-thumb .image img {
	margin-left: auto;
	margin-right: auto;
}
.product-grid .product-thumb .image {
	float: none;
}
@media (min-width: 767px) {
.product-list .product-thumb .image {
	float: left;
	padding: 0 15px;
}
}
.product-thumb h4 {
	font-weight: bold;
}
.product-thumb .caption {
	padding: 0 20px;
	min-height: 180px;
}
.product-list .product-thumb .caption {
	margin-left: 230px;
}
@media (max-width: 1200px) {
.product-grid .product-thumb .caption {
	min-height: 210px;
	padding: 0 10px;
}
}
@media (max-width: 767px) {
.product-list .product-thumb .caption {
	min-height: 0;
	margin-left: 0;
	padding: 0 10px;
}
.product-grid .product-thumb .caption {
	min-height: 0;
}
}
.product-thumb .rating {
	padding-bottom: 10px;
}
.rating .fa-stack {
	font-size: 8px;
}
.rating .fa-star-o {
	color: #999;
	font-size: 15px;
}
.rating .fa-star {
	color: #FC0;
	font-size: 15px;
}
.rating .fa-star + .fa-star-o {
	color: #E69500;
}
h2.price {
	margin: 0;
}
.product-thumb .price {
	color: #444;
}
.product-thumb .price-new {
	font-weight: 600;
}
.product-thumb .price-old {
	color: #999;
	text-decoration: line-through;
	margin-left: 10px;
}
.product-thumb .price-tax {
	color: #999;
	font-size: 12px;
	display: block;
}
.product-thumb .button-group {
	border-top: 1px solid #ddd;
	background-color: #eee;
	overflow: auto;
}
.product-list .product-thumb .button-group {
	border-left: 1px solid #ddd;
}
@media (max-width: 768px) {
	.product-list .product-thumb .button-group {
		border-left: none;
	}
}
.product-thumb .button-group button {
	width: 60%;
	border: none;
	display: inline-block;
	float: left;
	background-color: #eee;
	color: #888;
	line-height: 38px;
	font-weight: bold;
	text-align: center;
	text-transform: uppercase;
}
.product-thumb .button-group button + button {
	width: 20%;
	border-left: 1px solid #ddd;
}
.product-thumb .button-group button:hover {
	color: #444;
	background-color: #ddd;
	text-decoration: none;
	cursor: pointer;
}
@media (max-width: 1200px) {
	.product-thumb .button-group button, .product-thumb .button-group button + button {
		width: 33.33%;
	}
}
@media (max-width: 767px) {
	.product-thumb .button-group button, .product-thumb .button-group button + button {
		width: 33.33%;
	}
}
.thumbnails {
	overflow: auto;
	clear: both;
	list-style: none;
	padding: 0;
	margin: 0;
}
.thumbnails > li {
	margin-left: 20px;
}
.thumbnails {
	margin-left: -20px;
}
.thumbnails > img {
	width: 100%;
}
.image-additional a {
	margin-bottom: 20px;
	padding: 5px;
	display: block;
	border: 1px solid #ddd;
}
.image-additional {
	max-width: 78px;
}
.thumbnails .image-additional {
	float: left;
	margin-left: 20px;
}

@media (min-width: 1200px) {
	#content .col-lg-2:nth-child(6n+1),
	#content .col-lg-2:nth-child(6n+1),
	#content .col-lg-3:nth-child(4n+1),
	#content .col-lg-4:nth-child(3n+1),
	#content .col-lg-6:nth-child(2n+1) {
		clear:left;
	}
}
@media (min-width: 992px) and (max-width: 1199px) {
	#content .col-md-2:nth-child(6n+1),
	#content .col-md-2:nth-child(6n+1),
	#content .col-md-3:nth-child(4n+1),
	#content .col-md-4:nth-child(3n+1),
	#content .col-md-6:nth-child(2n+1) {
		clear:left;
	}
}
@media (min-width: 768px) and (max-width: 991px) {
	#content .col-sm-2:nth-child(6n+1),
	#content .col-sm-2:nth-child(6n+1),
	#content .col-sm-3:nth-child(4n+1),
	#content .col-sm-4:nth-child(3n+1),
	#content .col-sm-6:nth-child(2n+1) {
		clear:left;
	}
}

/* fixed colum left + content + right*/
@media (min-width: 768px) {
    #column-left  .product-layout .col-md-3 {
       width: 100%;
    }

	#column-left + #content .product-layout .col-md-3 {
       width: 50%;
    }

	#column-left + #content + #column-right .product-layout .col-md-3 {
       width: 100%;
    }

    #content + #column-right .product-layout .col-md-3 {
       width: 100%;
    }
}

/* fixed product layouts used in left and right columns */
#column-left .product-layout, #column-right .product-layout {
	width: 100%;
}

/* fixed mobile cart quantity input */
.input-group .form-control[name^=quantity] {
	min-width: 50px;
}

/* Missing focus and border color to overwrite bootstrap */
.btn-info:hover, .btn-info:active, .btn-info.active, .btn-info.disabled, .btn-info[disabled] {
    background-image: none;
    background-color: #df5c39;
}

.align-right {
	text-align: right !important;
}

.product-info .thumbnails-carousel img,
.studio-info .thumbnails-carousel img {
    border: 1px solid #ddd;
    display: block;
    border-radius: 6px;
    -moz-border-radius: 6px;
    -webkit-border-radius: 6px;
    margin: 0px auto;
    padding: 2px;
    background: #fff;
}

/*!
 * Bootstrap v3.3.5 (http://getbootstrap.com)
 * Copyright 2011-2015 Twitter, Inc.
 * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
 */
/* $headings-font-weight:    700 !default; */
/*! normalize.css v3.0.3 | MIT License | github.com/necolas/normalize.css */
html {
  font-family: sans-serif;
  -ms-text-size-adjust: 100%;
  -webkit-text-size-adjust: 100%; }

body {
  margin: 0; }


.embed-responsive {
  position: relative;
  display: block;
  height: 0;
  padding: 0;
  overflow: hidden; }
  .embed-responsive .embed-responsive-item,
  .embed-responsive iframe,
  .embed-responsive embed,
  .embed-responsive object,
  .embed-responsive video {
    position: absolute;
    top: 0;
    left: 0;
    bottom: 0;
    height: 100%;
    width: 100%;
    border: 0; }

.embed-responsive-16by9 {
  padding-bottom: 56.25%; }

.embed-responsive-4by3 {
  padding-bottom: 75%; }

.well {
  min-height: 20px;
  padding: 19px;
  margin-bottom: 20px; }
  .well blockquote {
    border-color: #ddd;
    border-color: rgba(0, 0, 0, 0.15); }

.well-lg {
  padding: 24px;
  border-radius: 0px; }

.well-sm {
  padding: 9px;
  border-radius: 0px; }

.close {
  float: right;
  font-size: 21px;
  font-weight: bold;
  line-height: 1;
  color: #000;
  text-shadow: 0 1px 0 #fff;
  opacity: 0.2;
  filter: alpha(opacity=20); }
  .close:hover, .close:focus {
    color: #000;
    text-decoration: none;
    cursor: pointer;
    opacity: 0.5;
    filter: alpha(opacity=50); }

button.close {
  padding: 0;
  cursor: pointer;
  background: transparent;
  border: 0;
  -webkit-appearance: none; }

.modal-open {
  overflow: hidden; }

.modal {
  display: none;
  overflow: hidden;
  position: fixed;
  top: 0;
  right: 0;
  bottom: 0;
  left: 0;
  z-index: 1050;
  -webkit-overflow-scrolling: touch;
  outline: 0; }
  .modal.fade .modal-dialog {
    -webkit-transform: translate(0, -25%);
    -ms-transform: translate(0, -25%);
    -o-transform: translate(0, -25%);
    transform: translate(0, -25%);
    -webkit-transition: -webkit-transform 0.3s ease-out;
    -moz-transition: -moz-transform 0.3s ease-out;
    -o-transition: -o-transform 0.3s ease-out;
    transition: transform 0.3s ease-out; }
  .modal.in .modal-dialog {
    -webkit-transform: translate(0, 0);
    -ms-transform: translate(0, 0);
    -o-transform: translate(0, 0);
    transform: translate(0, 0); }

.modal-open .modal {
  overflow-x: hidden;
  overflow-y: auto; }

.modal-dialog {
  position: relative;
  width: auto;
  margin: 10px; }

.modal-content {
  position: relative;
  background-color: #fff;
  border: 1px solid #999;
  border: 1px solid rgba(0, 0, 0, 0.2);
  border-radius: 0px;
  -webkit-box-shadow: 0 3px 9px rgba(0, 0, 0, 0.5);
  box-shadow: 0 3px 9px rgba(0, 0, 0, 0.5);
  background-clip: padding-box;
  outline: 0; }

.modal-backdrop {
  position: fixed;
  top: 0;
  right: 0;
  bottom: 0;
  left: 0;
  z-index: 1040;
  background-color: #000; }
  .modal-backdrop.fade {
    opacity: 0;
    filter: alpha(opacity=0); }
  .modal-backdrop.in {
    opacity: 0.5;
    filter: alpha(opacity=50); }

.modal-header {
  padding: 15px;
  border-bottom: 1px solid #e5e5e5;
  min-height: 16.42857px; }

.modal-header .close {
  margin-top: -2px; }

.modal-title {
  margin: 0;
  line-height: 1.42857; }

.modal-body {
  position: relative;
  padding: 15px; }

.modal-footer {
  padding: 15px;
  text-align: right;
  border-top: 1px solid #e5e5e5; }
  .modal-footer:before, .modal-footer:after {
    content: " ";
    display: table; }
  .modal-footer:after {
    clear: both; }
  .modal-footer .btn + .btn {
    margin-left: 5px;
    margin-bottom: 0; }
  .modal-footer .btn-group .btn + .btn {
    margin-left: -1px; }
  .modal-footer .btn-block + .btn-block {
    margin-left: 0; }

.modal-scrollbar-measure {
  position: absolute;
  top: -9999px;
  width: 50px;
  height: 50px;
  overflow: scroll; }

@media (min-width: 768px) {
  .modal-dialog {
    width: 600px;
    margin: 30px auto; }

  .modal-content {
    -webkit-box-shadow: 0 5px 15px rgba(0, 0, 0, 0.5);
    box-shadow: 0 5px 15px rgba(0, 0, 0, 0.5); }

  .modal-sm {
    width: 300px; } }
@media (min-width: 992px) {
  .modal-lg {
    width: 900px; } }
.tooltip {
  position: absolute;
  z-index: 1070;
  display: block;
  font-family: "Lato", sans-serif;
  font-style: normal;
  font-weight: normal;
  letter-spacing: normal;
  line-break: auto;
  line-height: 1.42857;
  text-align: left;
  text-align: start;
  text-decoration: none;
  text-shadow: none;
  text-transform: none;
  white-space: normal;
  word-break: normal;
  word-spacing: normal;
  word-wrap: normal;
  font-size: 12px;
  opacity: 0;
  filter: alpha(opacity=0); }
  .tooltip.in {
    opacity: 0.9;
    filter: alpha(opacity=90); }
  .tooltip.top {
    margin-top: -3px;
    padding: 5px 0; }
  .tooltip.right {
    margin-left: 3px;
    padding: 0 5px; }
  .tooltip.bottom {
    margin-top: 3px;
    padding: 5px 0; }
  .tooltip.left {
    margin-left: -3px;
    padding: 0 5px; }

.tooltip-inner {
  max-width: 200px;
  padding: 3px 8px;
  color: #fff;
  text-align: center;
  background-color: #000;
  border-radius: 0px; }

.tooltip-arrow {
  position: absolute;
  width: 0;
  height: 0;
  border-color: transparent;
  border-style: solid; }

.tooltip.top .tooltip-arrow {
  bottom: 0;
  left: 50%;
  margin-left: -5px;
  border-width: 5px 5px 0;
  border-top-color: #000; }
.tooltip.top-left .tooltip-arrow {
  bottom: 0;
  right: 5px;
  margin-bottom: -5px;
  border-width: 5px 5px 0;
  border-top-color: #000; }
.tooltip.top-right .tooltip-arrow {
  bottom: 0;
  left: 5px;
  margin-bottom: -5px;
  border-width: 5px 5px 0;
  border-top-color: #000; }
.tooltip.right .tooltip-arrow {
  top: 50%;
  left: 0;
  margin-top: -5px;
  border-width: 5px 5px 5px 0;
  border-right-color: #000; }
.tooltip.left .tooltip-arrow {
  top: 50%;
  right: 0;
  margin-top: -5px;
  border-width: 5px 0 5px 5px;
  border-left-color: #000; }
.tooltip.bottom .tooltip-arrow {
  top: 0;
  left: 50%;
  margin-left: -5px;
  border-width: 0 5px 5px;
  border-bottom-color: #000; }
.tooltip.bottom-left .tooltip-arrow {
  top: 0;
  right: 5px;
  margin-top: -5px;
  border-width: 0 5px 5px;
  border-bottom-color: #000; }
.tooltip.bottom-right .tooltip-arrow {
  top: 0;
  left: 5px;
  margin-top: -5px;
  border-width: 0 5px 5px;
  border-bottom-color: #000; }

.popover {
  position: absolute;
  top: 0;
  left: 0;
  z-index: 1060;
  display: none;
  max-width: 276px;
  padding: 1px;
  font-family: "Lato", sans-serif;
  font-style: normal;
  font-weight: normal;
  letter-spacing: normal;
  line-break: auto;
  line-height: 1.42857;
  text-align: left;
  text-align: start;
  text-decoration: none;
  text-shadow: none;
  text-transform: none;
  white-space: normal;
  word-break: normal;
  word-spacing: normal;
  word-wrap: normal;
  font-size: 14px;
  background-color: #fff;
  background-clip: padding-box;
  border: 1px solid #ccc;
  border: 1px solid rgba(0, 0, 0, 0.2);
  border-radius: 0px;
  -webkit-box-shadow: 0 5px 10px rgba(0, 0, 0, 0.2);
  box-shadow: 0 5px 10px rgba(0, 0, 0, 0.2); }
  .popover.top {
    margin-top: -10px; }
  .popover.right {
    margin-left: 10px; }
  .popover.bottom {
    margin-top: 10px; }
  .popover.left {
    margin-left: -10px; }

.popover-title {
  margin: 0;
  padding: 8px 14px;
  font-size: 14px;
  background-color: #f7f7f7;
  border-bottom: 1px solid #ebebeb;
  border-radius: -1px -1px 0 0; }

.popover-content {
  padding: 9px 14px; }

.popover > .arrow, .popover > .arrow:after {
  position: absolute;
  display: block;
  width: 0;
  height: 0;
  border-color: transparent;
  border-style: solid; }

.popover > .arrow {
  border-width: 11px; }

.popover > .arrow:after {
  border-width: 10px;
  content: ""; }

.popover.top > .arrow {
  left: 50%;
  margin-left: -11px;
  border-bottom-width: 0;
  border-top-color: #999999;
  border-top-color: rgba(0, 0, 0, 0.25);
  bottom: -11px; }
  .popover.top > .arrow:after {
    content: " ";
    bottom: 1px;
    margin-left: -10px;
    border-bottom-width: 0;
    border-top-color: #fff; }
.popover.right > .arrow {
  top: 50%;
  left: -11px;
  margin-top: -11px;
  border-left-width: 0;
  border-right-color: #999999;
  border-right-color: rgba(0, 0, 0, 0.25); }
  .popover.right > .arrow:after {
    content: " ";
    left: 1px;
    bottom: -10px;
    border-left-width: 0;
    border-right-color: #fff; }
.popover.bottom > .arrow {
  left: 50%;
  margin-left: -11px;
  border-top-width: 0;
  border-bottom-color: #999999;
  border-bottom-color: rgba(0, 0, 0, 0.25);
  top: -11px; }
  .popover.bottom > .arrow:after {
    content: " ";
    top: 1px;
    margin-left: -10px;
    border-top-width: 0;
    border-bottom-color: #fff; }
.popover.left > .arrow {
  top: 50%;
  right: -11px;
  margin-top: -11px;
  border-right-width: 0;
  border-left-color: #999999;
  border-left-color: rgba(0, 0, 0, 0.25); }
  .popover.left > .arrow:after {
    content: " ";
    right: 1px;
    border-right-width: 0;
    border-left-color: #fff;
    bottom: -10px; }

.carousel {
  position: relative; }

.carousel-inner {
  position: relative;
  overflow: hidden;
  width: 100%; }
  .carousel-inner > .item {
    display: none;
    position: relative;
    -webkit-transition: 0.6s ease-in-out left;
    -o-transition: 0.6s ease-in-out left;
    transition: 0.6s ease-in-out left; }
    .carousel-inner > .item > img,
    .carousel-inner > .item > a > img {
      display: block;
      max-width: 100%;
      height: auto;
      line-height: 1; }
    @media all and (transform-3d), (-webkit-transform-3d) {
      .carousel-inner > .item {
        -webkit-transition: -webkit-transform 0.6s ease-in-out;
        -moz-transition: -moz-transform 0.6s ease-in-out;
        -o-transition: -o-transform 0.6s ease-in-out;
        transition: transform 0.6s ease-in-out;
        -webkit-backface-visibility: hidden;
        -moz-backface-visibility: hidden;
        backface-visibility: hidden;
        -webkit-perspective: 1000px;
        -moz-perspective: 1000px;
        perspective: 1000px; }
        .carousel-inner > .item.next, .carousel-inner > .item.active.right {
          -webkit-transform: translate3d(100%, 0, 0);
          transform: translate3d(100%, 0, 0);
          left: 0; }
        .carousel-inner > .item.prev, .carousel-inner > .item.active.left {
          -webkit-transform: translate3d(-100%, 0, 0);
          transform: translate3d(-100%, 0, 0);
          left: 0; }
        .carousel-inner > .item.next.left, .carousel-inner > .item.prev.right, .carousel-inner > .item.active {
          -webkit-transform: translate3d(0, 0, 0);
          transform: translate3d(0, 0, 0);
          left: 0; } }
  .carousel-inner > .active,
  .carousel-inner > .next,
  .carousel-inner > .prev {
    display: block; }
  .carousel-inner > .active {
    left: 0; }
  .carousel-inner > .next,
  .carousel-inner > .prev {
    position: absolute;
    top: 0;
    width: 100%; }
  .carousel-inner > .next {
    left: 100%; }
  .carousel-inner > .prev {
    left: -100%; }
  .carousel-inner > .next.left,
  .carousel-inner > .prev.right {
    left: 0; }
  .carousel-inner > .active.left {
    left: -100%; }
  .carousel-inner > .active.right {
    left: 100%; }

.carousel-control {
  position: absolute;
  top: 0;
  left: 0;
  bottom: 0;
  width: 15%;
  font-size: 20px;
  color: #fff;
  text-align: center; }
  .carousel-control.right {
    left: auto;
    right: 0; }
  .carousel-control:hover, .carousel-control:focus {
    outline: 0;
    color: #fff;
    text-decoration: none; }
  .carousel-control .icon-prev,
  .carousel-control .icon-next,
  .carousel-control .glyphicon-chevron-left,
  .carousel-control .glyphicon-chevron-right {
    position: absolute;
    top: 50%;
    margin-top: -10px;
    z-index: 5;
    display: inline-block; }
  .carousel-control .icon-prev,
  .carousel-control .glyphicon-chevron-left {
    left: 50%;
    margin-left: -10px; }
  .carousel-control .icon-next,
  .carousel-control .glyphicon-chevron-right {
    right: 50%;
    margin-right: -10px; }
  .carousel-control .icon-prev,
  .carousel-control .icon-next {
    width: 20px;
    height: 20px;
    line-height: 1;
    font-family: serif; }
  .carousel-control .icon-prev:before {
    content: '\2039'; }
  .carousel-control .icon-next:before {
    content: '\203a'; }

.carousel-indicators {
  position: absolute;
  bottom: 10px;
  left: 50%;
  z-index: 15;
  width: 60%;
  margin-left: -30%;
  padding-left: 0;
  list-style: none;
  text-align: center; }
  .carousel-indicators li {
    display: inline-block;
    width: 10px;
    height: 10px;
    margin: 1px;
    text-indent: -999px;
    border: 1px solid #fff;
    border-radius: 10px;
    cursor: pointer;
    background-color: #000 \9;
    background-color: transparent; }
  .carousel-indicators .active {
    margin: 0;
    width: 12px;
    height: 12px;
    background-color: #fff; }

.carousel-caption {
  position: absolute;
  left: 15%;
  right: 15%;
  bottom: 20px;
  z-index: 10;
  padding-top: 20px;
  padding-bottom: 20px;
  color: #fff;
  text-align: center;
  text-shadow: 0 1px 2px rgba(0, 0, 0, 0.6); }
  .carousel-caption .btn {
    text-shadow: none; }

@media screen and (min-width: 768px) {
  .carousel-control .glyphicon-chevron-left,
  .carousel-control .glyphicon-chevron-right,
  .carousel-control .icon-prev,
  .carousel-control .icon-next {
    width: 30px;
    height: 30px;
    margin-top: -15px;
    font-size: 30px; }
  .carousel-control .glyphicon-chevron-left,
  .carousel-control .icon-prev {
    margin-left: -15px; }
  .carousel-control .glyphicon-chevron-right,
  .carousel-control .icon-next {
    margin-right: -15px; }

  .carousel-caption {
    left: 20%;
    right: 20%;
    padding-bottom: 30px; }

  .carousel-indicators {
    bottom: 20px; } }
.clearfix:before, .clearfix:after {
  content: " ";
  display: table; }
.clearfix:after {
  clear: both; }

.center-block {
  display: block;
  margin-left: auto;
  margin-right: auto; }

.pull-right {
  float: right !important; }

.pull-left {
  float: left !important; }

.hide {
  display: none !important; }

.show {
  display: block !important; }

.invisible {
  visibility: hidden; }

.text-hide {
  font: 0/0 a;
  color: transparent;
  text-shadow: none;
  background-color: transparent;
  border: 0; }

.hidden {
  display: none !important; }

.affix {
  position: fixed; }

@-ms-viewport {
  width: device-width; }
.visible-xs {
  display: none !important; }

.visible-sm {
  display: none !important; }

.visible-md {
  display: none !important; }

.visible-lg {
  display: none !important; }

.visible-xs-block,
.visible-xs-inline,
.visible-xs-inline-block,
.visible-sm-block,
.visible-sm-inline,
.visible-sm-inline-block,
.visible-md-block,
.visible-md-inline,
.visible-md-inline-block,
.visible-lg-block,
.visible-lg-inline,
.visible-lg-inline-block {
  display: none !important; }

@media (max-width: 767px) {
  .visible-xs {
    display: block !important; }

  table.visible-xs {
    display: table !important; }

  tr.visible-xs {
    display: table-row !important; }

  th.visible-xs,
  td.visible-xs {
    display: table-cell !important; } }
@media (max-width: 767px) {
  .visible-xs-block {
    display: block !important; } }

@media (max-width: 767px) {
  .visible-xs-inline {
    display: inline !important; } }

@media (max-width: 767px) {
  .visible-xs-inline-block {
    display: inline-block !important; } }

@media (min-width: 768px) and (max-width: 991px) {
  .visible-sm {
    display: block !important; }

  table.visible-sm {
    display: table !important; }

  tr.visible-sm {
    display: table-row !important; }

  th.visible-sm,
  td.visible-sm {
    display: table-cell !important; } }
@media (min-width: 768px) and (max-width: 991px) {
  .visible-sm-block {
    display: block !important; } }

@media (min-width: 768px) and (max-width: 991px) {
  .visible-sm-inline {
    display: inline !important; } }

@media (min-width: 768px) and (max-width: 991px) {
  .visible-sm-inline-block {
    display: inline-block !important; } }

@media (min-width: 992px) and (max-width: 1199px) {
  .visible-md {
    display: block !important; }

  table.visible-md {
    display: table !important; }

  tr.visible-md {
    display: table-row !important; }

  th.visible-md,
  td.visible-md {
    display: table-cell !important; } }
@media (min-width: 992px) and (max-width: 1199px) {
  .visible-md-block {
    display: block !important; } }

@media (min-width: 992px) and (max-width: 1199px) {
  .visible-md-inline {
    display: inline !important; } }

@media (min-width: 992px) and (max-width: 1199px) {
  .visible-md-inline-block {
    display: inline-block !important; } }

@media (min-width: 1200px) {
  .visible-lg {
    display: block !important; }

  table.visible-lg {
    display: table !important; }

  tr.visible-lg {
    display: table-row !important; }

  th.visible-lg,
  td.visible-lg {
    display: table-cell !important; } }
@media (min-width: 1200px) {
  .visible-lg-block {
    display: block !important; } }

@media (min-width: 1200px) {
  .visible-lg-inline {
    display: inline !important; } }

@media (min-width: 1200px) {
  .visible-lg-inline-block {
    display: inline-block !important; } }

@media (max-width: 767px) {
  .hidden-xs {
    display: none !important; } }
@media (min-width: 768px) and (max-width: 991px) {
  .hidden-sm {
    display: none !important; } }
@media (min-width: 992px) and (max-width: 1199px) {
  .hidden-md {
    display: none !important; } }
@media (min-width: 1200px) {
  .hidden-lg {
    display: none !important; } }
.visible-print {
  display: none !important; }

@media print {
  .visible-print {
    display: block !important; }

  table.visible-print {
    display: table !important; }

  tr.visible-print {
    display: table-row !important; }

  th.visible-print,
  td.visible-print {
    display: table-cell !important; } }
.visible-print-block {
  display: none !important; }
  @media print {
    .visible-print-block {
      display: block !important; } }

.visible-print-inline {
  display: none !important; }
  @media print {
    .visible-print-inline {
      display: inline !important; } }

.visible-print-inline-block {
  display: none !important; }
  @media print {
    .visible-print-inline-block {
      display: inline-block !important; } }

@media print {
  .hidden-print {
    display: none !important; } }
/****/
/** elements mixins **/
/**
* Transition-timing-function property@mixin
*/
/*background RGBA
============================================*/
/*inline-block
============================================*/
/****/
/****/
/*
 * Global variables
 */
/* main color which will be used for all main block styles... */
/**
 * Import component variables
 */
/* --- SCSS For Accordion --- */
/* --- SCSS For Breadcrumb --- */
/* --- SCSS For Buttons --- */
/* --- SCSS For Call-to-action --- */
/* --- SCSS For Content-slider --- */
/*  */
/* carousel-controls-v1 */
/* carousel-controls-v2 */
/* carousel-controls-v3 */
/* Navigation Styles */
/* carousel-indicators-v1 */
/* carousel-indicators-v2 */
/* carousel-indicators-v3 */
/* carousel-indicators-v4 */
/* carousel-indicators-v5 */
/* carousel-indicators-v6 */
/* --- SCSS For Counters --- */
/* --- SCSS For Heading --- */
/* --- SCSS For Icon-box --- */
/* --- SCSS For Interactive-banner --- */
/* --- SCSS For Latest-posts --- */
/* latest posts */
/* --- SCSS For List --- */
/* variables for list */
/* variables for list light */
/* --- SCSS For Message --- */
/* --- SCSS For Newsletter --- */
/* --- SCSS For Piechart --- */
/* --- SCSS For Pricing --- */
/* --- SCSS For Process-steps --- */
/* process-steps */
/* --- SCSS For Service --- */
/* variables for tab style1 using as base of tab */
/* --- SCSS For Style-icon --- */
/* Variables icons default */
/* Variables icons bodered */
/* Variables icons darker */
/* Variables icons light */
/* Variables icons plain */
/* Variables icons for light style */
/* Variables icons outline */
/* Variables icons inverse */
/* --- SCSS For Table --- */
/* --- SCSS For Tabs --- */
/* --- SCSS For Table --- */
/* --- SCSS For Tabs --- */
/* variables for tab style1 using as base of tab */
/* tab style version 4 */
/* tab style version 5 */
/* tab style version 6 */
/* --- SCSS For Testimonials --- */
/* testimonials default */
/* testimonials-v1 */
/* testimonials light */
/* --- SCSS For Typography --- */
/**
 *
 */
/* $vertical-widget-title-font-family:     $font-menu-family !default; */
/* top */
html {
  overflow-x: hidden; }

body {
  overflow-x: hidden; }
  body[class*="account-"] #content h1, body[class*="account-"] #content h2 {
    font-size: 20px;
    text-transform: uppercase; }
  body.layout-boxed-lg {
    background-color: #FFFFFF;
    margin: 0 auto;
    max-width: 1200px; }

header, .container {
  position: relative; }

#top {
  line-height: 39px;
  font-size: 12px;
  border-bottom: 1px solid #f1f1f1;
  color: #bbb; }
  #top .phone {
    color: #ef5d5d; }
  #top .fa-user, #top .fa-cog, #top .fa-phone {
    padding-right: 3px; }
    .rtl #top .fa-user, .rtl #top .fa-cog, .rtl #top .fa-phone {
      padding-left: 3px;
      padding-right: inherit; }
  #top .fa-caret-down {
    padding-left: 3px;
    font-size: 10px; }
    .rtl #top .fa-caret-down {
      padding-right: 3px;
      padding-left: inherit; }
  #top .setting-box {
    color: #bbb; }
    #top .setting-box .dropdown-menu {
      font-size: 12px;
      line-height: 20px;
      margin-right: 23px; }
      #top .setting-box .dropdown-menu a {
        color: #bbb; }
        #top .setting-box .dropdown-menu a:hover {
          color: #2f2f2f; }
      #top .setting-box .dropdown-menu .box-language button {
        background: transparent;
        border: none;
        color: #bbb; }
        #top .setting-box .dropdown-menu .box-language button:hover {
          color: #2f2f2f; }

/* top links */
#top-links ul {
  margin-bottom: 0; }
  #top-links ul li {
    padding-right: 20px; }
    .rtl #top-links ul li {
      padding-left: 20px;
      padding-right: inherit; }
    #top-links ul li:last-child {
      padding-right: 0; }
      .rtl #top-links ul li:last-child {
        padding-left: 0;
        padding-right: inherit; }
#top-links li, #top-links a {
  text-decoration: none; }
#top-links a + a {
  margin-left: 15px; }
#top-links .btn-link strong {
  font-size: 14px;
  line-height: 14px; }
#top-links .dropdown-menu li a {
  line-height: 25px; }
#top-links .dropdown-menu .btn-link {
  padding: 0 20px;
  text-align: left; }
  .rtl #top-links .dropdown-menu .btn-link {
    text-align: right; }

/* header */
.style-header .dropdown-toggle {
  cursor: pointer; }
.style-header .dropdown-menu {
  padding: 20px; }
  .style-header .dropdown-menu .box-currency button {
    background-color: transparent;
    border: 1px solid #ebebeb;
    padding: 0 10px; }
    .style-header .dropdown-menu .box-currency button:hover {
      color: #2f2f2f; }
  .style-header .dropdown-menu > li {
    line-height: 25px; }
    .style-header .dropdown-menu > li > a i {
      padding-right: 5px; }
      .rtl .style-header .dropdown-menu > li > a i {
        padding-left: 5px;
        padding-right: inherit; }

/* logo */
.logo-store {
  position: relative; }
  .logo-store a {
    vertical-align: middle; }
    .logo-store a img {
      width: 100%;
      height: 100%; }

#logo-theme a {
  background: url(../image/logo.png) no-repeat;
  display: inline-block;
  width: 217px;
  height: 69px; }
  #logo-theme a span {
    display: none; }

.toggle-overlay-container {
  background-color: #f1f1f1;
  display: block;
  position: absolute;
  top: 0;
  transform: rotateX(-90deg);
  transform-origin: 0 0 0;
  visibility: hidden;
  width: 100%;
  -webkit-transition: all 0.3s ease-in-out 0s;
  -o-transition: all 0.3s ease-in-out 0s;
  transition: all 0.3s ease-in-out 0s;
  padding: 20px 0; }
  .toggle-overlay-container.active {
    transform: rotateX(0deg);
    visibility: visible;
    z-index: 99999; }
  .toggle-overlay-container .search-box {
    width: calc(100% - 86px);
    float: left;
    height: 100%; }
    .rtl .toggle-overlay-container .search-box {
      float: right; }
    .toggle-overlay-container .search-box .form-control::-moz-placeholder {
      color: #FFFFFF; }
    .toggle-overlay-container .search-box .input-group {
      width: 100%;
      margin: 0px auto; }
      .toggle-overlay-container .search-box .input-group .form-control {
        border: 1px solid #ebebeb;
        margin-left: 20px;
        padding-left: 20px; }
        .rtl .toggle-overlay-container .search-box .input-group .form-control {
          margin-right: 20px;
          margin-left: inherit; }
        .rtl .toggle-overlay-container .search-box .input-group .form-control {
          padding-right: 20px;
          padding-left: inherit; }
        .toggle-overlay-container .search-box .input-group .form-control:focus {
          -webkit-box-shadow: none;
          box-shadow: none; }
    .toggle-overlay-container .search-box button {
      border: none; }
      .toggle-overlay-container .search-box button i {
        font-size: 18px;
        color: #000000;
        line-height: 40px; }
  .toggle-overlay-container .dropdown-toggle-button {
    text-align: center;
    cursor: hand;
    cursor: pointer;
    -webkit-transition: all 0.5s ease 0s;
    -o-transition: all 0.5s ease 0s;
    transition: all 0.5s ease 0s; }

/
/* menu */
.menu {
  background: #f1f1f1;
  margin-bottom: 30px;
  line-height: 60px; }

@media (max-width: 768px) {
.menu {
  background: #f1f1f1;
  margin-bottom: 60px;
  line-height: 60px; }
 }

.maincols {
  margin-bottom: 30px; }

/* content */
#content {
  min-height: 600px; }


/*------------------------------------*\
    Copyright
\*------------------------------------*/
.copyright {
  background: #222222;
  line-height: 50px;
  font-size: 12px;
  text-align: center;
  color: #777777;
  font-family: Georgia, "Times New Roman", Times, serif;
  font-style: italic; }
  .copyright .input-group {
    border: 0px; }
    .copyright .input-group .fa {
      color: #2f2f2f; }
  .copyright a {
    color: #fff; }
    .copyright a:hover, .copyright a:focus, .copyright a:active {
      color: #fff; }

.scrollup {
  background: #f1f1f1;
  bottom: 62px;
  position: fixed;
  right: 100px;
  z-index: 9999;
  color: #2f2f2f; }
  .rtl .scrollup {
    left: 100px;
    right: auto; }

#input-captcha {
  margin-bottom: 10px; }


/**
 * Simple Styles
 */
.navbar-mega-simple {
  text-align: center; }
  .navbar-mega-simple .pbr-megamenu {
    display: inline-block; }

/*** Vertical Megamenu ***/
.pbr-vertical-menu .navbar-vertical-mega {
  display: block;
  position: relative;
  width: 100%; }
  .pbr-vertical-menu .navbar-vertical-mega > li {
    display: block;
    float: none;
    clear: both;
    width: 100%;
    border-bottom: solid 1px #ebebeb; }
    .pbr-vertical-menu .navbar-vertical-mega > li > a {
      text-transform: uppercase;
      padding-top: 10px;
      padding-bottom: 10px;
      font-size: 13px; }
    .pbr-vertical-menu .navbar-vertical-mega > li .dropdown-menu {
      top: 0;
      left: 100%; }
    .pbr-vertical-menu .navbar-vertical-mega > li:hover > .dropdown-menu {
      display: block; }
    .pbr-vertical-menu .navbar-vertical-mega > li .caret {
      float: right; }
.pbr-vertical-menu.menu-right > li .dropdown-menu {
  top: 0;
  right: 100%; }

.panel {
  -webkit-box-shadow: 0 0px 0px transparent;
  box-shadow: 0 0px 0px transparent; }

.panel-body .list-group-item {
  /*border: none;
  padding-left: 0; */}
  .rtl .panel-body .list-group-item {
    padding-right: 0;
    padding-left: inherit; }
  .panel-body .list-group-item i {
    cursor: pointer;
    width: 20px;
    height: 20px;
    text-align: center;
    font-size: 12px !important;
    color: #f1f1f1; }
  .panel-body .list-group-item ul li {
   /* border: none; */}

.nav-tabs {
  margin-bottom: 20px; }

.widget-products.product-tabs.panel .nav-tabs {
 margin-bottom: 0px; }

.list-unstyled span {
  padding-right: 5px; }
  .rtl .list-unstyled span {
    padding-left: 5px;
    padding-right: inherit; }

.price {
  color: #2f2f2f;
  font-weight: 700; }
  .price .price-new {
    color: #cc0000;
    font-size: 16px; }
  .price .price-old {
    color: #cccccc;
    text-decoration: line-through; }
  .price.detail .price-new {
    font-size: 22px; }

/* product style */
.cart {
  text-align: left;
  display: inline-block; }
  .rtl .cart {
    text-align: right; }
  .cart button {
    padding: 7px 7px !important;
    color: #FFFFFF;
    font-size: 12px;
    text-transform: capitalize;
    border: none;
    letter-spacing: 1px; }
    .cart button:hover {
      -webkit-box-shadow: none;
      box-shadow: none;
      background-color: #2f2f2f; }
  .cart i {
    font-size: 10px;
    font-weight: 900;
    padding-right: 5px; }
    .rtl .cart i {
      padding-left: 5px;
      padding-right: inherit; }

.product-block {
  position: relative;
  width: 100%;
  margin-bottom: 30px; }
  .product-block .description {
    line-height: 20px;
    height: 40px;
    overflow: hidden;
    margin-bottom: 20px;
    color: #2f2f2f;
    display: none; }
  .product-block .name {
    margin: 0;
    overflow: hidden;
    font-size: 14px;
    text-color: #474747;
    letter-spacing: 0;
    font-weight: normal; }
    .product-block .name a {
      color: #555555;
       }
  .product-block .image {
    position: relative;
    overflow: hidden;
    text-align: center;
    background-color: #fff;
    border: 1px solid #ccc; }
    .product-block .image .img-responsive {
      display: inline-block; }
  .product-block .product-meta {
    overflow: hidden;
    padding-top: 12px; }

.pav-hover-image {
  opacity: 0.3;
  width: 100%; }
  .pav-hover-image:hover {
    opacity: 1; }

.product-label {
  color: #FFFFFF;
  font-size: 10px;
  font-weight: 900;
  text-align: center;
  position: absolute;
  text-transform: uppercase;
  z-index: 9; }
  .product-label.ribbon {
    position: absolute;
    right: 0;
    top: 0;
    width: 40px;
    height: 40px; }
    .rtl .product-label.ribbon {
      left: 0;
      right: auto; }
    .product-label.ribbon:before {
      content: "";
      position: absolute;
      top: 0;
      right: 0;
      width: 0;
      height: 0;
      border-top: 40px solid #474747;
      border-left: 40px solid transparent; }
      .rtl .product-label.ribbon:before {
        left: 0;
        right: auto; }
      .rtl .product-label.ribbon:before {
        border-right: 40px solid transparent;
        border-left: inherit; }
    .product-label.ribbon .product-label-special {
      display: block;
      text-align: center;
      height: 100%;
      padding-top: 2px;
      -webkit-transform: rotate(45deg);
      -ms-transform: rotate(45deg);
      -o-transform: rotate(45deg);
      transform: rotate(45deg); }
  .product-label.ribbon2 {
    width: 85px;
    height: 88px;
    overflow: hidden;
    position: absolute;
    top: 0px;
    right: 0px;
    z-index: 99;
    display: block;
    font-family: "Lato", sans-serif;
    font-size: 10px; }
    .rtl .product-label.ribbon2 {
      left: 0px;
      right: auto; }
    .product-label.ribbon2 .product-label-special {
      display: block;
      text-transform: uppercase;
      text-align: center;
      -webkit-transform: rotate(45deg);
      -ms-transform: rotate(45deg);
      -o-transform: rotate(45deg);
      transform: rotate(45deg);
      position: relative;
      padding: 6px 0;
      left: -2px;
      top: 12px;
      width: 120px;
      background-color: #ef5d5d;
      color: #000000;
      -webkit-box-shadow: 0px 0px 3px rgba(255, 255, 255, 0.3);
      box-shadow: 0px 0px 3px rgba(255, 255, 255, 0.3); }
  .product-label.ribbon1 {
    width: 85px;
    height: 88px;
    overflow: hidden;
    position: absolute;
    top: 0px;
    left: 0px;
    z-index: 99;
    display: block;
    font-family: "Lato", sans-serif;
    font-size: 10px; }
    .rtl .product-label.ribbon1 {
      right: 0px;
      left: auto; }
    .product-label.ribbon1 .product-label-special {
      display: block;
      text-transform: uppercase;
      text-align: center;
      -webkit-transform: rotate(-45deg);
      -ms-transform: rotate(-45deg);
      -o-transform: rotate(-45deg);
      transform: rotate(-45deg);
      position: relative;
      padding: 6px 0;
      left: -32px;
      top: 15px;
      width: 120px;
      background-color: #f0c73b;
      color: #000000;
      -webkit-box-shadow: 0px 0px 3px rgba(255, 255, 255, 0.3);
      box-shadow: 0px 0px 3px rgba(255, 255, 255, 0.3); }
      .rtl .product-label.ribbon1 .product-label-special {
        right: -32px;
        left: auto; }
  .product-label.bts {
    text-align: center;
    display: block;
    text-transform: uppercase;
    height: 17px;
    line-height: 17px;
    padding: 0 10px;
    position: absolute;
    top: 20px;
    background-color: #ef5d5d;
    left: 20px; }
    .rtl .product-label.bts {
      right: 20px;
      left: auto; }
    .product-label.bts .product-label-special {
      display: block;
      width: 100%;
      height: 100%;
      position: relative; }
  .product-label.sale {
    top: 10px;
    background-color: #FFFFFF;
    border: 1px solid #f1f1f1;
    left: 10px;
    padding: 5px 10px; }
    .rtl .product-label.sale {
      right: 10px;
      left: auto; }
  .product-label.sale-border {
    text-align: center;
    display: block;
    text-transform: uppercase;
    width: 40px;
    height: 20px;
    position: absolute;
    top: 15px;
    border: 2px solid #d95e41;
    right: 10px;
    color: #474747; }
    .rtl .product-label.sale-border {
      left: 10px;
      right: auto; }
  .product-label.flag {
    text-align: center;
    display: block;
    text-transform: uppercase;
    width: 60px;
    height: 30px;
    position: absolute;
    top: 15px;
    background-color: #70ba28;
    left: 0;
    line-height: 30px; }
    .rtl .product-label.flag {
      right: 0;
      left: auto; }
    .product-label.flag:before {
      content: "";
      width: 0;
      height: 0;
      position: absolute;
      right: -15px;
      top: 0;
      border-top: 15px solid #70ba28;
      border-right: 15px solid transparent; }
      .rtl .product-label.flag:before {
        left: -15px;
        right: auto; }
      .rtl .product-label.flag:before {
        border-left: 15px solid transparent;
        border-right: inherit; }
    .product-label.flag:after {
      content: "";
      width: 0;
      height: 0;
      position: absolute;
      right: -15px;
      bottom: 0;
      border-bottom: 15px solid #70ba28;
      border-right: 15px solid transparent; }
      .rtl .product-label.flag:after {
        left: -15px;
        right: auto; }
      .rtl .product-label.flag:after {
        border-left: 15px solid transparent;
        border-right: inherit; }

.product-block .action {
  -webkit-transition: all 0.4s ease-in-out 0s;
  -o-transition: all 0.4s ease-in-out 0s;
  transition: all 0.4s ease-in-out 0s;
  margin: 20px 0;
  display: inline-block; }
  .product-block .action button {
    background-color: #FFFFFF;
    padding: 0;
    color: #2f2f2f; }
    .product-block .action button:hover {
      color: #FFFFFF;
      background-color: #ef5d5d;
      border: none; }
  .product-block .action .quickview .btn-outline-light, .product-block .action .zoom .btn-outline-light {
    background-color: #FFFFFF;
    padding: 0;
    color: #2f2f2f; }
    .product-block .action .quickview .btn-outline-light:hover, .product-block .action .zoom .btn-outline-light:hover {
      color: #FFFFFF;
      background-color: #ef5d5d;
      border: none; }
.product-block:hover .action > div {
  opacity: 1; }
.product-block .product-meta .rating {
  position: relative; }
  .product-block .product-meta .rating:before {
    position: absolute;
    content: "";
    height: 1px;
    width: 100px;
    top: 29px;
    left: 0px;
    background: #ddd; }

.rating {
  font-weight: 300;
  padding-bottom: 10px; }
  .rating .fa-stack {
    width: 1em;
    font-size: 12px;
    width: 12px;
    height: 16px; }
  .rating .fa-star {
    color: #f7bc3d;
    height: 11px;
    line-height: 11px; }
  .rating .fa-star-o {
    color: #d5d5d5;
    height: 11px;
    line-height: 11px; }
  .rating a {
    font-weight: 400; }

.zmdi {
  /* color: $black;
  font-size: 18px !important; */ }

.panel {
  position: relative; }

/*
 * 	Core Owl Carousel CSS File
 *	v1.3.3
 */
.no-space-row .row {
  margin: 0; }

.no-space-row [class^="col-"],
.no-space-row [class*="col-"] {
  padding: 0; }

.col-nopadding .row {
  margin-left: 0;
  margin-right: 0; }
  .col-nopadding .row [class*="col-"] {
    padding-left: 0;
    padding-right: 0; }

.bg-white {
  background: #FFF; }

.background-img-v1 {
  background: url(../image/bg-v2.jpg) no-repeat center; }

.parallax {
  background-size: cover;
  background-attachment: fixed;
  background-position: center center;
  position: relative;
  -webkit-transition: all 0.3s ease 0s;
  -o-transition: all 0.3s ease 0s;
  transition: all 0.3s ease 0s; }
  .parallax:after {
    left: 0;
    bottom: 0;
    width: 100%;
    z-index: -1;
    content: " ";
    height: 100%;
    text-align: center;
    position: absolute;
    background: rgba(0, 0, 0, 0.2);
    -webkit-transition: all 0.3s ease 0s;
    -o-transition: all 0.3s ease 0s;
    transition: all 0.3s ease 0s; }

.btn-outline-light {
  color: #2f2f2f;
  background-color: transparent;
  border-color: #f1f1f1;
  -webkit-transition: all 0.4s ease-out 0s;
  -o-transition: all 0.4s ease-out 0s;
  transition: all 0.4s ease-out 0s; }
  .btn-outline-light:hover, .btn-outline-light:focus, .btn-outline-light:active, .btn-outline-light.active {
    color: #474747;
    background-color: #f1f1f1;
    border-color: #f1f1f1; }
  .open .btn-outline-light.dropdown-toggle {
    color: #474747;
    background-color: #f1f1f1;
    border-color: #f1f1f1; }
  .btn-outline-light:active, .btn-outline-light.active {
    background-image: none; }
  .open .btn-outline-light.dropdown-toggle {
    background-image: none; }
  .btn-outline-light.disabled, .btn-outline-light.disabled:hover, .btn-outline-light.disabled:focus, .btn-outline-light.disabled:active, .btn-outline-light.disabled.active, .btn-outline-light[disabled], .btn-outline-light[disabled]:hover, .btn-outline-light[disabled]:focus, .btn-outline-light[disabled]:active, .btn-outline-light[disabled].active, fieldset[disabled] .btn-outline-light, fieldset[disabled] .btn-outline-light:hover, fieldset[disabled] .btn-outline-light:focus, fieldset[disabled] .btn-outline-light:active, fieldset[disabled] .btn-outline-light.active {
    background-color: transparent;
    border-color: #f1f1f1; }
  .btn-outline-light .badge {
    color: transparent;
    background-color: #2f2f2f; }

.btn-outline-dark {
  color: #000;
  background-color: transparent;
  border-color: #000; }
  .btn-outline-dark:hover, .btn-outline-dark:focus, .btn-outline-dark:active, .btn-outline-dark.active {
    color: #FFFFFF;
    background-color: #f1f1f1;
    border-color: #f1f1f1; }
  .open .btn-outline-dark.dropdown-toggle {
    color: #FFFFFF;
    background-color: #f1f1f1;
    border-color: #f1f1f1; }
  .btn-outline-dark:active, .btn-outline-dark.active {
    background-image: none; }
  .open .btn-outline-dark.dropdown-toggle {
    background-image: none; }
  .btn-outline-dark.disabled, .btn-outline-dark.disabled:hover, .btn-outline-dark.disabled:focus, .btn-outline-dark.disabled:active, .btn-outline-dark.disabled.active, .btn-outline-dark[disabled], .btn-outline-dark[disabled]:hover, .btn-outline-dark[disabled]:focus, .btn-outline-dark[disabled]:active, .btn-outline-dark[disabled].active, fieldset[disabled] .btn-outline-dark, fieldset[disabled] .btn-outline-dark:hover, fieldset[disabled] .btn-outline-dark:focus, fieldset[disabled] .btn-outline-dark:active, fieldset[disabled] .btn-outline-dark.active {
    background-color: transparent;
    border-color: #000; }
  .btn-outline-dark .badge {
    color: transparent;
    background-color: #000; }

.btn-inverse-light {
  color: #f1f1f1;
  background-color: transparent;
  border-color: #f1f1f1; }
  .btn-inverse-light:hover, .btn-inverse-light:focus, .btn-inverse-light:active, .btn-inverse-light.active {
    color: #FFFFFF;
    background-color: #f1f1f1;
    border-color: #f1f1f1; }
  .open .btn-inverse-light.dropdown-toggle {
    color: #FFFFFF;
    background-color: #f1f1f1;
    border-color: #f1f1f1; }
  .btn-inverse-light:active, .btn-inverse-light.active {
    background-image: none; }
  .open .btn-inverse-light.dropdown-toggle {
    background-image: none; }
  .btn-inverse-light.disabled, .btn-inverse-light.disabled:hover, .btn-inverse-light.disabled:focus, .btn-inverse-light.disabled:active, .btn-inverse-light.disabled.active, .btn-inverse-light[disabled], .btn-inverse-light[disabled]:hover, .btn-inverse-light[disabled]:focus, .btn-inverse-light[disabled]:active, .btn-inverse-light[disabled].active, fieldset[disabled] .btn-inverse-light, fieldset[disabled] .btn-inverse-light:hover, fieldset[disabled] .btn-inverse-light:focus, fieldset[disabled] .btn-inverse-light:active, fieldset[disabled] .btn-inverse-light.active {
    background-color: transparent;
    border-color: #f1f1f1; }
  .btn-inverse-light .badge {
    color: transparent;
    background-color: #f1f1f1; }

.btn-outline {
  background: transparent;
  background: transparent;
  background: transparent;
  background: transparent;
  background: transparent;
  background: transparent; }
  .btn-outline.btn-default {
    color: #000; }
    .btn-outline.btn-default:hover {
      color: #FFFFFF; }
  .btn-outline.btn-primary {
    color: #2f2f2f; }
    .btn-outline.btn-primary:hover {
      color: #FFFFFF; }
  .btn-outline.btn-success {
    color: #f1f1f1; }
    .btn-outline.btn-success:hover {
      color: #FFFFFF; }
  .btn-outline.btn-info {
    color: #80b2a7; }
    .btn-outline.btn-info:hover {
      color: #FFFFFF; }
  .btn-outline.btn-danger {
    color: #f40000; }
    .btn-outline.btn-danger:hover {
      color: #FFFFFF; }
  .btn-outline.btn-warning {
    color: #f0c73b; }
    .btn-outline.btn-warning:hover {
      color: #FFFFFF; }

.btn-inverse.btn-primary:hover {
  color: #2f2f2f;
  background: transparent; }
.btn-inverse.btn-success:hover {
  color: #f1f1f1;
  background: transparent; }
.btn-inverse.btn-info:hover {
  color: #80b2a7;
  background: transparent; }
.btn-inverse.btn-danger:hover {
  color: #f40000;
  background: transparent; }
.btn-inverse.btn-warning:hover {
  color: #f0c73b;
  background: transparent; }

/* clearfix */
.owl-carousel .owl-wrapper:after {
  content: ".";
  display: block;
  clear: both;
  visibility: hidden;
  line-height: 0;
  height: 0; }

/* display none until init */
.owl-carousel {
  display: none;
  position: relative;
  width: 100%;
  -ms-touch-action: pan-y;
  background: transparent;
  -webkit-box-shadow: none;
  box-shadow: none;
  margin: 0 !important;
  background: transparent !important;
   }

 .tab-content .owl-carousel {
      background: #fff !important;
      border:solid 1px #999;
      padding: 30px;

   }

.owl-carousel .owl-wrapper {
  display: none;
  position: relative;
  -webkit-transform: translate3d(0px, 0px, 0px); }

.owl-carousel .owl-wrapper-outer {
  overflow: hidden;
  position: relative;
  width: 100%;
  border: none;
  -webkit-box-shadow: none;
  box-shadow: none;
  -webkit-border-radius: 0;
  -moz-border-radius: 0;
  -ms-border-radius: 0;
  -o-border-radius: 0;
  border-radius: 0; }

.owl-carousel .owl-wrapper-outer.autoHeight {
  -webkit-transition: height 500ms ease-in-out;
  -moz-transition: height 500ms ease-in-out;
  -ms-transition: height 500ms ease-in-out;
  -o-transition: height 500ms ease-in-out;
  transition: height 500ms ease-in-out; }

.owl-carousel .owl-item {
  float: left;
  /* .item {
  	padding: 0 10px;
  } */ }

.products-owl-carousel {
  position: relative; }

.owl-controls .owl-page,
.owl-controls .owl-buttons div {
  cursor: pointer; }

.owl-controls .owl-buttons div {
  position: absolute; }

.owl-controls .owl-buttons .owl-prev {
  left: 10px;
  top: 50%; }

.owl-controls .owl-buttons .owl-next {
  right: 10px;
  top: 50%; }

.owl-controls {
  -webkit-user-select: none;
  -khtml-user-select: none;
  -moz-user-select: none;
  -ms-user-select: none;
  user-select: none;
  -webkit-tap-highlight-color: transparent;
  display: none !important; }

/* mouse grab icon */
/* fix */
.owl-carousel .owl-wrapper,
.owl-carousel .owl-item {
  -webkit-backface-visibility: hidden;
  -moz-backface-visibility: hidden;
  -ms-backface-visibility: hidden; }

/* OpenCart Code */
.owl-carousel {
  margin: 0 0px;
  direction: ltr !important;
  overflow: hidden; }

.owl-carousel .owl-buttons div {
  opacity: 0;
  color: rgba(0, 0, 0, 0.8);
  text-shadow: 1px 1px 0 rgba(255, 255, 255, 0.3);
  transition: all .3s ease; }

.owl-carousel:hover .owl-buttons div {
  opacity: 0.7; }

.owl-carousel .owl-buttons div i {
  font-size: 40px;
  margin: -20px 0 0; }

.owl-carousel .owl-buttons .owl-prev {
  left: -50px; }

.owl-carousel .owl-buttons .owl-next {
  right: -50px; }

.owl-carousel:hover .owl-buttons .owl-prev {
  left: 10px; }

.owl-carousel:hover .owl-buttons .owl-next {
  right: 10px; }

.owl-pagination {
  text-align: center;
  top: 0px;
  position: relative; }

.owl-controls .owl-page {
  display: inline-block;
  margin: 0px 6px; }

.owl-controls .owl-page span {
  display: block;
  width: 11px;
  height: 11px;
  background: rgba(0, 0, 0, 0.5);
  border-radius: 20px;
  box-shadow: inset 0 0 3px rgba(0, 0, 0, 0.3); }

.owl-controls .owl-page.active span {
  background: rgba(0, 0, 0, 0.9); }

.owl-carousel-play {
  position: relative; }
  .owl-carousel-play .owl-item:last-child .product-wrapper {
    border: none; }

.owl-carousel-play .carousel-control {
  z-index: 5;
  top: 38%;
  /* display: none; */ }
.owl-carousel-play:hover .carousel-control {
  /* display: block; */ }

.carousel-md {
  width: 44px;
  height: 44px;
  line-height: 44px; }

.carousel-sm {
  width: 36px;
  height: 36px;
  line-height: 36px;
  font-size: 22px; }

.carousel-xs {
  width: 28px;
  height: 28px;
  line-height: 28px;
  font-size: 14px; }

.carousel-controls {
  height: 30px;
  width: 52px;
  left: auto;
  right: 8px;
  position: absolute;
  top: 0;
  margin-top: -80px;
  display: inline-block; }
  .rtl .carousel-controls {
    right: auto;
    left: auto; }
  .rtl .carousel-controls {
    left: 8px;
    right: auto; }
  .carousel-controls.carousel-center {
    left: -30px;
    margin: 0 auto;
    right: 0;
    text-align: center;
    top: -25px; }
  .carousel-controls .carousel-control {
    background: none;
    border: none;
    color: #d4d4d4;
    z-index: 99;
    height: 25px;
    left: auto;
    font-size: 18px; }
    .rtl .carousel-controls .carousel-control {
      right: auto;
      left: auto; }
    .carousel-controls .carousel-control:hover, .carousel-controls .carousel-control:active, .carousel-controls .carousel-control:focus {
      color: #f1f1f1; }
    .carousel-controls .carousel-control.left {
      left: 0; }
    .carousel-controls .carousel-control.right {
      right: 0; }

/*Font Weight*/
.text-purple {
  color: #6c58bd !important; }

.text-red {
  color: #c32322 !important; }

.text-red-1 {
  color: #ff0000 !important; }

.text-orange {
  color: #f66000 !important; }

.text-yellow {
  color: #e2d951 !important; }

.text-black {
  color: #000 !important; }

.text-white, .text-light {
  color: #FFFFFF !important; }

.text-darker {
  color: #333 !important; }

.text-uppercase, .initialism {
  text-transform: uppercase; }

/*Radius
------------------------------------*/
.radius-0 {
  border-radius: 0 !important; }

.radius-x {
  border-radius: 50% !important; }

.radius-1x {
  border-radius: 10px !important; }

.radius-2x {
  border-radius: 20px !important; }

.radius-3x {
  border-radius: 30px !important; }

.radius-4x {
  border-radius: 40px !important; }

.radius-5x {
  border-radius: 5px !important; }

.radius-6x {
  border-radius: 3px !important; }

/**
 * Menu
 */
ul.menu {
  padding: 0;
  margin: 0; }
  ul.menu li {
    list-style: none; }

/****/
.testimonials {
  color: #000; }
  .testimonials .testimonials-avatar {
    width: 60px;
    height: 60px;
    overflow: hidden;
    margin-right: 15px; }
    .rtl .testimonials .testimonials-avatar {
      margin-left: 15px;
      margin-right: inherit; }
  .testimonials .testimonials-quote {
    background-color: #f3f3f3;
    margin-bottom: 20px;
    padding: 15px;
    position: relative; }
    .testimonials .testimonials-quote:after {
      bottom: -28px;
      color: #f3f3f3;
      content: "\f0d7";
      font-family: "FontAwesome";
      font-size: 30px;
      margin-left: -15px;
      position: absolute;
      text-align: center; }
      .rtl .testimonials .testimonials-quote:after {
        margin-right: -15px;
        margin-left: inherit; }
  .testimonials h3, .testimonials h4, .testimonials h5 {
    text-transform: uppercase;
    font-size: 13px;
    color: #000; }
  .testimonials .testimonials-body {
    padding: 15px 10px;
    display: table;
    margin-top: 20px;
    margin-bottom: 20px;
    position: relative;
    display: block;
    overflow: hidden; }
  .testimonials .testimonials-left .testimonials-avatar {
    float: left; }
    .rtl .testimonials .testimonials-left .testimonials-avatar {
      float: right; }
  .testimonials.testimonials-v2 .testimonials-avatar {
    float: left; }
    .rtl .testimonials.testimonials-v2 .testimonials-avatar {
      float: right; }
  .testimonials.testimonials-v4 .testimonials-body {
    margin: 20px 25px; }
  .testimonials.testimonials-v4 .testimonials-avatar {
    position: absolute;
    top: 15px;
    left: -30px; }
  .testimonials.testimonials-v4 .testimonials-description, .testimonials.testimonials-v4 .testimonials-meta {
    margin-left: 30px; }

/** SOCIAL ICONS ***/
.bo-social-icons [class^="bo-social-"] {
  display: inline-block;
  margin: 10px 5px;
  overflow: hidden;
  text-decoration: none;
  text-align: center;
  vertical-align: top;
  line-height: 36px;
  width: 36px;
  height: 36px;
  transition: all 0.2s ease-out 0s; }
  .bo-social-icons [class^="bo-social-"]:hover {
    background: #000000;
    color: #FFFFFF; }
.bo-social-icons .bo-social-white {
  background: #FFFFFF;
  color: #9f9f9f;
  border: 1px solid #9f9f9f; }
.bo-social-icons .bo-social-outline {
  background: transparent;
  color: #000;
  border: 1px solid #000; }
.bo-social-icons .bo-social-outline-light {
  background: transparent;
  color: #FFF;
  border: 1px solid #FFFFFF; }
  .bo-social-icons .bo-social-outline-light:hover {
    background: #FFF;
    color: #000;
    border-color: #000; }
.bo-social-icons:first-child [class*="bo-social-"] {
  margin-top: 0; }
.bo-social-icons:last-child [class*="bo-social-"] {
  margin-bottom: 0; }
.bo-social-icons.bo-sicolor [class*="bo-social-"] {
  color: #FFFFFF; }

.bo-sicolor .bo-social-twitter {
  background: #00bdec; }
.bo-sicolor .bo-social-twitter:hover {
  background: #000000; }
.bo-sicolor .bo-social-dribbble {
  background: #ef5b92; }
.bo-sicolor .bo-social-dribbble:hover {
  background: #000000; }
.bo-sicolor .bo-social-facebook {
  background: #3b5998; }
.bo-sicolor .bo-social-facebook:hover {
  background: #000000; }
.bo-sicolor .bo-social-duckduckgo {
  background: #de3100; }
.bo-sicolor .bo-social-duckduckgo:hover {
  background: #000000; }
.bo-sicolor .bo-social-aim {
  background: #158799; }
.bo-sicolor .bo-social-aim:hover {
  background: #000000; }
.bo-sicolor .bo-social-delicious {
  background: #183864; }
.bo-sicolor .bo-social-delicious:hover {
  background: #000000; }
.bo-sicolor .bo-social-paypal {
  background: #32689a; }
.bo-sicolor .bo-social-paypal:hover {
  background: #000000; }
.bo-sicolor .bo-social-android {
  background: #8ab733; }
.bo-sicolor .bo-social-android:hover {
  background: #000000; }
.bo-sicolor .bo-social-gplus {
  background: #d94a39; }
.bo-sicolor .bo-social-gplus:hover {
  background: #000000; }
.bo-sicolor .bo-social-lanyrd {
  background: #3879ba; }
.bo-sicolor .bo-social-lanyrd:hover {
  background: #000000; }
.bo-sicolor .bo-social-stumbleupon {
  background: #ea4b24; }
.bo-sicolor .bo-social-stumbleupon:hover {
  background: #000000; }
.bo-sicolor .bo-social-fivehundredpx {
  background: #00a6e1; }
.bo-sicolor .bo-social-fivehundredpx:hover {
  background: #000000; }
.bo-sicolor .bo-social-pinterest {
  background: #b8242a; }
.bo-sicolor .bo-social-pinterest:hover {
  background: #000000; }
.bo-sicolor .bo-social-bitcoin {
  background: #f7931a; }
.bo-sicolor .bo-social-bitcoin:hover {
  background: #000000; }
.bo-sicolor .bo-social-w3c {
  background: #005a9c; }
.bo-sicolor .bo-social-w3c:hover {
  background: #000000; }
.bo-sicolor .bo-social-foursquare {
  background: #3bb7e8; }
.bo-sicolor .bo-social-foursquare:hover {
  background: #000000; }
.bo-sicolor .bo-social-html5 {
  background: #e44e26; }
.bo-sicolor .bo-social-html5:hover {
  background: #000000; }
.bo-sicolor .bo-social-ie {
  background: #00ccff; }
.bo-sicolor .bo-social-ie:hover {
  background: #000000; }
.bo-sicolor .bo-social-grooveshark {
  background: #f66f00; }
.bo-sicolor .bo-social-grooveshark:hover {
  background: #000000; }
.bo-sicolor .bo-social-ninetyninedesigns {
  background: #ff5501; }
.bo-sicolor .bo-social-ninetyninedesigns:hover {
  background: #000000; }
.bo-sicolor .bo-social-forrst {
  background: #223f17; }
.bo-sicolor .bo-social-forrst:hover {
  background: #000000; }
.bo-sicolor .bo-social-spotify {
  background: #8fbd05; }
.bo-sicolor .bo-social-spotify:hover {
  background: #000000; }
.bo-sicolor .bo-social-reddit {
  background: #ff4500; }
.bo-sicolor .bo-social-reddit:hover {
  background: #000000; }
.bo-sicolor .bo-social-gowalla {
  background: #f6911d; }
.bo-sicolor .bo-social-gowalla:hover {
  background: #000000; }
.bo-sicolor .bo-social-apple {
  background: #5f5f5f; }
.bo-sicolor .bo-social-apple:hover {
  background: #000000; }
.bo-sicolor .bo-social-blogger {
  background: #fb9241; }
.bo-sicolor .bo-social-blogger:hover {
  background: #000000; }
.bo-sicolor .bo-social-cc {
  background: #5e7c00; }
.bo-sicolor .bo-social-cc:hover {
  background: #000000; }
.bo-sicolor .bo-social-evernote {
  background: #61b239; }
.bo-sicolor .bo-social-evernote:hover {
  background: #000000; }
.bo-sicolor .bo-social-flickr {
  background: #ff0084; }
.bo-sicolor .bo-social-flickr:hover {
  background: #000000; }
.bo-sicolor .bo-social-google {
  background: #d94a39; }
.bo-sicolor .bo-social-google:hover {
  background: #000000; }
.bo-sicolor .bo-social-viadeo {
  background: #f5a433; }
.bo-sicolor .bo-social-viadeo:hover {
  background: #000000; }
.bo-sicolor .bo-social-instapaper {
  background: #eaec08; }
.bo-sicolor .bo-social-instapaper:hover {
  background: #000000; }
.bo-sicolor .bo-social-klout {
  background: #e34600; }
.bo-sicolor .bo-social-klout:hover {
  background: #000000; }
.bo-sicolor .bo-social-linkedin {
  background: #1b92bd; }
.bo-sicolor .bo-social-linkedin:hover {
  background: #000000; }
.bo-sicolor .bo-social-meetup {
  background: #e51938; }
.bo-sicolor .bo-social-meetup:hover {
  background: #000000; }
.bo-sicolor .bo-social-vk {
  background: #587da4; }
.bo-sicolor .bo-social-vk:hover {
  background: #000000; }
.bo-sicolor .bo-social-disqus {
  background: #2e9fff; }
.bo-sicolor .bo-social-disqus:hover {
  background: #000000; }
.bo-sicolor .bo-social-rss {
  background: #ff7f00; }
.bo-sicolor .bo-social-rss:hover {
  background: #000000; }
.bo-sicolor .bo-social-skype {
  background: #18b7f1; }
.bo-sicolor .bo-social-skype:hover {
  background: #000000; }
.bo-sicolor .bo-social-youtube {
  background: #c4302b; }
.bo-sicolor .bo-social-youtube:hover {
  background: #000000; }
.bo-sicolor .bo-social-vimeo {
  background: #01557a; }
.bo-sicolor .bo-social-vimeo:hover {
  background: #000000; }
.bo-sicolor .bo-social-windows {
  background: #00ccff; }
.bo-sicolor .bo-social-windows:hover {
  background: #000000; }
.bo-sicolor .bo-social-xing {
  background: #036567; }
.bo-sicolor .bo-social-xing:hover {
  background: #000000; }
.bo-sicolor .bo-social-yahoo {
  background: #61399d; }
.bo-sicolor .bo-social-yahoo:hover {
  background: #000000; }
.bo-sicolor .bo-social-chrome {
  background: #58b947; }
.bo-sicolor .bo-social-chrome:hover {
  background: #000000; }
.bo-sicolor .bo-social-macstore {
  background: #6e6e6e; }
.bo-sicolor .bo-social-macstore:hover {
  background: #000000; }
.bo-sicolor .bo-social-amazon {
  background: #ff9900; }
.bo-sicolor .bo-social-amazon:hover {
  background: #000000; }
.bo-sicolor .bo-social-steam {
  background: #a5a4a1; }
.bo-sicolor .bo-social-steam:hover {
  background: #000000; }
.bo-sicolor .bo-social-dropbox {
  background: #7ab6ec; }
.bo-sicolor .bo-social-dropbox:hover {
  background: #000000; }
.bo-sicolor .bo-social-cloudapp {
  background: #489dde; }
.bo-sicolor .bo-social-cloudapp:hover {
  background: #000000; }
.bo-sicolor .bo-social-ebay {
  background: #86b817; }
.bo-sicolor .bo-social-ebay:hover {
  background: #000000; }
.bo-sicolor .bo-social-github {
  background: #667F8E; }
.bo-sicolor .bo-social-github:hover {
  background: #000000; }
.bo-sicolor .bo-social-googleplay {
  background: #5befd0; }
.bo-sicolor .bo-social-googleplay:hover {
  background: #000000; }
.bo-sicolor .bo-social-itunes {
  background: #177ac8; }
.bo-sicolor .bo-social-itunes:hover {
  background: #000000; }
.bo-sicolor .bo-social-plurk {
  background: #a73d07; }
.bo-sicolor .bo-social-plurk:hover {
  background: #000000; }
.bo-sicolor .bo-social-songkick {
  background: #f80046; }
.bo-sicolor .bo-social-songkick:hover {
  background: #000000; }
.bo-sicolor .bo-social-lastfm {
  background: #c60e16; }
.bo-sicolor .bo-social-lastfm:hover {
  background: #000000; }
.bo-sicolor .bo-social-gmail {
  background: #e04a3f; }
.bo-sicolor .bo-social-gmail:hover {
  background: #000000; }
.bo-sicolor .bo-social-pinboard {
  background: #224cf4; }
.bo-sicolor .bo-social-pinboard:hover {
  background: #000000; }
.bo-sicolor .bo-social-openid {
  background: #be661b; }
.bo-sicolor .bo-social-openid:hover {
  background: #000000; }
.bo-sicolor .bo-social-quora {
  background: #c41a00; }
.bo-sicolor .bo-social-quora:hover {
  background: #000000; }
.bo-sicolor .bo-social-soundcloud {
  background: #ff5c00; }
.bo-sicolor .bo-social-soundcloud:hover {
  background: #000000; }
.bo-sicolor .bo-social-tumblr {
  background: #395874; }
.bo-sicolor .bo-social-tumblr:hover {
  background: #000000; }
.bo-sicolor .bo-social-eventasaurus {
  background: #b9f15e; }
.bo-sicolor .bo-social-eventasaurus:hover {
  background: #000000; }
.bo-sicolor .bo-social-wordpress {
  background: #464646; }
.bo-sicolor .bo-social-wordpress:hover {
  background: #000000; }
.bo-sicolor .bo-social-yelp {
  background: #c41200; }
.bo-sicolor .bo-social-yelp:hover {
  background: #000000; }
.bo-sicolor .bo-social-intensedebate {
  background: #00aeef; }
.bo-sicolor .bo-social-intensedebate:hover {
  background: #000000; }
.bo-sicolor .bo-social-eventbrite {
  background: #ff6c00; }
.bo-sicolor .bo-social-eventbrite:hover {
  background: #000000; }
.bo-sicolor .bo-social-scribd {
  background: #002939; }
.bo-sicolor .bo-social-scribd:hover {
  background: #000000; }
.bo-sicolor .bo-social-posterous {
  background: #f8d667; }
.bo-sicolor .bo-social-posterous:hover {
  background: #000000; }
.bo-sicolor .bo-social-stripe {
  background: #617ee8; }
.bo-sicolor .bo-social-stripe:hover {
  background: #000000; }
.bo-sicolor .bo-social-opentable {
  background: #990000; }
.bo-sicolor .bo-social-opentable:hover {
  background: #000000; }
.bo-sicolor .bo-social-instagram {
  background: #4c799f; }
.bo-sicolor .bo-social-instagram:hover {
  background: #000000; }
.bo-sicolor .bo-social-dwolla {
  background: #ff7404; }
.bo-sicolor .bo-social-dwolla:hover {
  background: #000000; }
.bo-sicolor .bo-social-appnet {
  background: #1e0c29; }
.bo-sicolor .bo-social-appnet:hover {
  background: #000000; }
.bo-sicolor .bo-social-statusnet {
  background: #fb6104; }
.bo-sicolor .bo-social-statusnet:hover {
  background: #000000; }
.bo-sicolor .bo-social-acrobat {
  background: #ff0000; }
.bo-sicolor .bo-social-acrobat:hover {
  background: #000000; }
.bo-sicolor .bo-social-drupal {
  background: #007dc3; }
.bo-sicolor .bo-social-drupal:hover {
  background: #000000; }
.bo-sicolor .bo-social-pocket {
  background: #ee4056; }
.bo-sicolor .bo-social-pocket:hover {
  background: #000000; }
.bo-sicolor .bo-social-bitbucket {
  background: #205081; }
.bo-sicolor .bo-social-bitbucket:hover {
  background: #000000; }
.bo-sicolor .bo-social-flattr {
  background: #fbbc23; }
.bo-sicolor .bo-social-flattr:hover {
  background: #000000; }
.bo-sicolor .bo-social-eventful {
  background: #0066cc; }
.bo-sicolor .bo-social-eventful:hover {
  background: #000000; }
.bo-sicolor .bo-social-smashmag {
  background: #d6231c; }
.bo-sicolor .bo-social-smashmag:hover {
  background: #000000; }
.bo-sicolor .bo-social-wordpress {
  background: #1e8cbe; }
.bo-sicolor .bo-social-wordpress:hover {
  background: #000000; }
.bo-sicolor .bo-social-calendar {
  background: #ff0000; }
.bo-sicolor .bo-social-calendar:hover {
  background: #000000; }
.bo-sicolor .bo-social-call {
  background: #04be3d; }
.bo-sicolor .bo-social-call:hover {
  background: #000000; }
.bo-sicolor .bo-social-guest {
  background: #03a9d2; }
.bo-sicolor .bo-social-guest:hover {
  background: #000000; }
.bo-sicolor .bo-social-weibo {
  background: #fd0000; }
.bo-sicolor .bo-social-weibo:hover {
  background: #000000; }
.bo-sicolor .bo-social-plancast {
  background: #e4b82c; }
.bo-sicolor .bo-social-plancast:hover {
  background: #000000; }
.bo-sicolor .bo-social-email {
  background: blue; }
.bo-sicolor .bo-social-email:hover {
  background: #000000; }
.bo-sicolor .bo-social-myspace {
  background: #2068b0; }
.bo-sicolor .bo-social-myspace:hover {
  background: #000000; }
.bo-sicolor .bo-social-podcast {
  background: #f38b36; }
.bo-sicolor .bo-social-podcast:hover {
  background: #000000; }
.bo-sicolor .bo-social-cart {
  background: #00a204; }
.bo-sicolor .bo-social-cart:hover {
  background: #000000; }

/* --- SCSS For Counters --- */
.counters {
  text-align: center; }
  .counters .counter-wrap {
    font-size: 36px;
    color: #70ba28;
    font-weight: 800; }
    .counters .counter-wrap .fa {
      font-size: 46px; }
    .counters .counter-wrap .counter {
      position: relative;
      display: inline-block;
      padding-bottom: 5px;
      margin-bottom: 10px; }
      .counters .counter-wrap .counter:after {
        content: "";
        position: absolute;
        width: 30px;
        height: 2px;
        background: #70ba28;
        bottom: 0;
        left: 50%;
        margin-left: -15px; }
  .counters h5 {
    font-weight: 700;
    margin: 5px 0 30px;
    text-transform: uppercase;
    position: relative;
    font-size: 14px; }

/* --- SCSS For Pricing --- */
.pricing {
  text-align: center; }
  .pricing ul {
    padding-left: 0;
    padding-right: 0; }
    .pricing ul li {
      list-style: none; }
  .pricing.pricing-v1 {
    background: #FFFFFF;
    border: 3px solid #313131; }
    .pricing.pricing-v1 .pricing-header > * {
      font-family: "Lato", sans-serif; }
    .pricing.pricing-v1 .plan-title {
      font-size: 24px;
      text-transform: uppercase;
      font-weight: 300;
      margin: 0;
      padding: 30px 0;
      background: #313131;
      color: #FFFFFF; }
    .pricing.pricing-v1 .plan-figure {
      font-size: 48px;
      font-weight: 700;
      color: #000; }
    .pricing.pricing-v1 .plan-price {
      font-size: 16px;
      border-bottom: 2px solid #ebebeb;
      line-height: 1;
      padding: 25px 0; }
      .pricing.pricing-v1 .plan-price p {
        margin: 0; }
    .pricing.pricing-v1 .plan-currency {
      font-size: 30px;
      font-weight: 700;
      color: #000000;
      position: relative;
      top: -15px; }
    .pricing.pricing-v1 .plain-info {
      padding: 20px; }
      .pricing.pricing-v1 .plain-info li {
        font-size: 16px;
        color: #555555;
        font-weight: 400;
        padding: 15px 0; }
    .pricing.pricing-v1 .pricing-footer {
      padding: 0px 20px 40px 20px; }
    .pricing.pricing-v1.pricing-highlight {
      border-color: #f1f1f1 !important; }
  .pricing.pricing-v2 {
    background: #FFFFFF; }
    .pricing.pricing-v2 .plan-title {
      color: #000;
      font-size: 24px;
      text-transform: uppercase;
      font-weight: 300;
      margin: 0;
      padding: 30px 0; }
    .pricing.pricing-v2 .plan-price {
      background: #2f2f2f;
      margin: 0 -10px;
      position: relative;
      height: 100px; }
      .pricing.pricing-v2 .plan-price .plan-price-body {
        background: #2f2f2f;
        margin: 0 auto;
        border-radius: 50%;
        position: absolute;
        left: 0;
        top: -15px;
        right: 0;
        color: #FFF;
        width: 130px;
        height: 130px; }
      .pricing.pricing-v2 .plan-price .plan-figure {
        font-size: 48px;
        font-weight: 300; }
      .pricing.pricing-v2 .plan-price .plan-currency {
        font-size: 30px;
        font-weight: 300; }
    .pricing.pricing-v2 .plain-info {
      padding: 20px; }
      .pricing.pricing-v2 .plain-info li {
        color: #000;
        line-height: 62px;
        border-bottom: 1px dashed #C8C8C8; }
    .pricing.pricing-v2 .pricing-footer {
      padding: 0 20px 40px 20px; }
    .pricing.pricing-v2.pricing-highlight .plan-title {
      background: #FFFFFF;
      color: #000000; }
    .pricing.pricing-v2.pricing-highlight .plan-price-body {
      background: #f1f1f1;
      color: #FFFFFF; }
    .pricing.pricing-v2.pricing-highlight .btn-block {
      background: #f1f1f1;
      border-color: #f1f1f1; }
      .pricing.pricing-v2.pricing-highlight .btn-block:hover, .pricing.pricing-v2.pricing-highlight .btn-block:focus, .pricing.pricing-v2.pricing-highlight .btn-block:active {
        background: none;
        color: #f1f1f1; }
  .pricing.pricing-v3 {
    background: #FFFFFF;
    border: 1px solid #DEDEDE; }
    .pricing.pricing-v3 .plan-title {
      background: #261F2F;
      font-size: 24px;
      text-transform: uppercase;
      font-weight: 300;
      margin: 0;
      padding: 30px 0;
      border: none; }
      .pricing.pricing-v3 .plan-title span {
        color: #FFFFFF; }
    .pricing.pricing-v3 .plan-figure {
      font-size: 48px;
      font-weight: 300;
      color: #000; }
    .pricing.pricing-v3 .plan-price {
      font-size: 16px;
      background: #332C3E;
      padding: 15px 0; }
      .pricing.pricing-v3 .plan-price > * {
        color: #FFFFFF;
        line-height: 1; }
    .pricing.pricing-v3 .plan-currency {
      font-size: 30px;
      font-weight: 300; }
    .pricing.pricing-v3 .plain-info li {
      font-size: 16px;
      color: #000;
      font-weight: 300;
      background: #F8F8F8;
      padding: 14px 0; }
      .pricing.pricing-v3 .plain-info li:nth-child(2n+1) {
        background: #FFFFFF; }
    .pricing.pricing-v3 .pricing-footer {
      padding: 0px 20px 40px 20px; }
    .pricing.pricing-v3.pricing-highlight .plan-title {
      background: #f1f1f1;
      color: #FFFFFF; }
    .pricing.pricing-v3.pricing-highlight .plan-price {
      background: #f1f1f1;
      color: #FFFFFF; }
    .pricing.pricing-v3.pricing-highlight .btn-block {
      background: #f1f1f1;
      border-color: #f1f1f1; }
      .pricing.pricing-v3.pricing-highlight .btn-block:hover, .pricing.pricing-v3.pricing-highlight .btn-block:focus, .pricing.pricing-v3.pricing-highlight .btn-block:active {
        background: none;
        color: #f1f1f1; }
  .pricing.pricing-highlight .plan-title {
    background: #f1f1f1;
    color: #FFFFFF; }

/* our team */
[class*="team-v"] {
  text-align: center; }
  [class*="team-v"] [class^="bo-social-"] {
    margin: 0; }
  [class*="team-v"] .team-name {
    text-transform: uppercase;
    font-size: 14px;
    margin: 0 0 10px 0; }

.team-list {
  margin-bottom: 50px; }
  .team-list .team-name {
    font-size: 18px;
    margin: 0 0 20px 0;
    text-transform: uppercase;
    padding: 0 0 20px 0;
    position: relative; }
    .team-list .team-name:after {
      bottom: 0;
      left: 0;
      content: "";
      background: #f1f1f1;
      width: 30px;
      height: 2px;
      position: absolute; }
  .team-list .team-position {
    text-transform: uppercase;
    color: #f1f1f1;
    font-weight: 800;
    margin-bottom: 25px; }
  .team-list .team-info {
    margin-bottom: 15px; }
  .team-list .bo-social-icons {
    text-align: left; }
    .team-list .bo-social-icons [class*="bo-social-"] {
      margin: 0; }

.team-gallery {
  background: #FFF; }
  .team-gallery .team-header {
    position: relative;
    text-align: center; }
    .team-gallery .team-header:before {
      top: 0;
      left: 0;
      content: "";
      position: absolute;
      visibility: hidden;
      width: 100%;
      height: 100%;
      opacity: 0;
      filter: alpha(opacity=0);
      -webkit-transition: all 0.5s ease 0s;
      -o-transition: all 0.5s ease 0s;
      transition: all 0.5s ease 0s;
      background: rgba(241, 241, 241, 0.5); }
  .team-gallery .team-name {
    font-size: 14px;
    margin-top: 0;
    text-transform: uppercase; }
  .team-gallery .team-gallery-box {
    top: 0;
    left: 0;
    width: 80%;
    right: 0;
    height: 50%;
    bottom: 0;
    margin: auto;
    position: absolute;
    visibility: hidden;
    opacity: 0;
    filter: alpha(opacity=0);
    -webkit-transition: all 0.5s ease 0s;
    -o-transition: all 0.5s ease 0s;
    transition: all 0.5s ease 0s; }
  .team-gallery .team-info {
    color: #FFFFFF; }
  .team-gallery .team-position {
    color: #999999;
    margin-bottom: 0; }
  .team-gallery .team-body-content {
    padding: 30px;
    position: relative; }
    .team-gallery .team-body-content:before {
      content: "";
      right: 0;
      width: 1px;
      height: 50px;
      position: absolute;
      background: #f1f1f1; }
  .team-gallery .bo-social-white {
    border-color: #FFFFFF;
    color: #FFFFFF;
    background: none; }
  .team-gallery:hover .team-header:before {
    visibility: visible;
    opacity: 1;
    filter: alpha(opacity=100); }
  .team-gallery:hover .team-gallery-box {
    visibility: visible;
    opacity: 1;
    filter: alpha(opacity=100); }

.team-hover {
  background: #FFF;
  border: none; }
  .team-hover .team-header {
    position: relative;
    text-align: center; }
    .team-hover .team-header:before {
      top: 0;
      left: 0;
      content: "";
      position: absolute;
      visibility: hidden;
      width: 100%;
      height: 100%;
      opacity: 0;
      filter: alpha(opacity=0);
      -webkit-transition: all 0.5s ease 0s;
      -o-transition: all 0.5s ease 0s;
      transition: all 0.5s ease 0s;
      background: rgba(241, 241, 241, 0.5); }
  .team-hover .team-name {
    font-size: 14px;
    margin-top: 0;
    text-transform: uppercase; }
  .team-hover .team-gallery-box {
    width: 100%;
    height: 45px;
    top: 50%;
    margin-top: -22.5px; }
  .team-hover .team-info {
    color: #FFFFFF; }
  .team-hover .team-position {
    color: #999999;
    margin-bottom: 0; }
  .team-hover .team-body-content {
    padding: 20px;
    position: relative;
    text-align: center; }
    .team-hover .team-body-content:before {
      content: none; }
    .team-hover .team-body-content > * {
      text-align: center; }
    .team-hover .team-body-content .team-name {
      margin-bottom: 5px; }
  .team-hover .bo-social-white {
    border-color: #FFFFFF;
    color: #FFFFFF;
    background: none; }
  .team-hover:hover .team-header:before {
    visibility: visible;
    opacity: 1;
    filter: alpha(opacity=100); }
  .team-hover:hover .team-gallery-box {
    visibility: visible;
    opacity: 1;
    filter: alpha(opacity=100); }

.team-small {
  border: none !important; }
  .team-small .team-body {
    background: none !important; }
  .team-small .team-info {
    display: none !important; }
  .team-small:hover .team-body {
    -webkit-transform: translateY(0) !important;
    -ms-transform: translateY(0) !important;
    -o-transform: translateY(0) !important;
    transform: translateY(0) !important; }

/* heading */
.heading-left {
  text-align: left;
  padding-bottom: 20px;
  margin-bottom: 20px; }
  .rtl .heading-left {
    text-align: right; }
.heading-center {
  text-align: center;
  padding-bottom: 20px;
  margin-bottom: 20px; }

.panel-center > .panel-heading {
  text-align: left;
  margin-bottom: 20px; }
.panel-left > .panel-heading {
  text-align: left;
  margin-bottom: 20px;
  overflow: hidden; }
  .rtl .panel-left > .panel-heading {
    text-align: right; }

/* carousel */
.carousel-sm {
  width: 36px;
  height: 36px;
  line-height: 36px;
  font-size: 19px; }

.carousel-controls-v1 .carousel-control {
  box-shadow: 0 0 0 2px #f1f1f1 inset;
  background-color: #FFFFFF;
  color: #2f2f2f;
  -webkit-transition: all 0.35s ease 0s;
  -o-transition: all 0.35s ease 0s;
  transition: all 0.35s ease 0s;
  top: 50%;
  margin-top: -70px; }
  .carousel-controls-v1 .carousel-control:hover {
    box-shadow: 0 0 0 30px #2f2f2f inset;
    color: #FFFFFF; }
  .carousel-controls-v1 .carousel-control.left {
    left: -50px; }
  .carousel-controls-v1 .carousel-control.right {
    right: -50px; }

.carousel-controls-v2 {
  position: absolute;
  left: -80px;
  margin-top: -18px;
  top: 50%; }
  .rtl .carousel-controls-v2 {
    right: -80px;
    left: auto; }
  .carousel-controls-v2 .carousel-control {
    box-shadow: 0 0 0 1px #FFFFFF inset;
    background-color: #FFFFFF;
    color: #f1f1f1;
    -webkit-transition: all 0.35s ease 0s;
    -o-transition: all 0.35s ease 0s;
    transition: all 0.35s ease 0s; }
    .carousel-controls-v2 .carousel-control:hover {
      box-shadow: 0 0 0 30px #d8d8d8 inset;
      color: #FFFFFF; }
    .carousel-controls-v2 .carousel-control.left {
      left: -45px; }
    .carousel-controls-v2 .carousel-control.right {
      right: -47px; }

.carousel-controls-v3 .carousel-control {
  box-shadow: 0 0 0 1px #f1f1f1 inset;
  background-color: #FFFFFF;
  color: #f1f1f1;
  margin-top: -5px; }
  .carousel-controls-v3 .carousel-control:hover {
    box-shadow: 0 0 0 30px #f1f1f1 inset;
    color: #FFFFFF; }
  .carousel-controls-v3 .carousel-control.left {
    left: 0; }
  .carousel-controls-v3 .carousel-control.right {
    right: 0; }

/**
 * Tab Style
 */
/* tabs style 1 */
.tab-v1 .tab-heading {
  text-align: center;
  padding-bottom: 20px;
  border-bottom: 5px #D40000 solid;
  }
  .tab-v1 .tab-heading .nav-tabs {
    border: none;
   display: inline-block;  }
    .tab-v1 .tab-heading .nav-tabs > li {
      margin-right: 48px;
      border: 0px solid #f1f1f1; }
      .rtl .tab-v1 .tab-heading .nav-tabs > li {
        margin-left: 48px;
        margin-right: inherit; }
      .tab-v1 .tab-heading .nav-tabs > li > a {
        /*padding: 25px 50px;*/
        margin-top:30px;
        font-weight: 700;
        font-size: 2vh; }

.tab-v1 .nav-tabs > li > a {
  color: #aaa;
    border: 3px solid #ccc;
   }
  .tab-v1 .nav-tabs > li > a:hover {
    color: #222;
      border: 3px solid #888;}
.tab-v1 .nav-tabs > li.active > a {
  color: #f2f2f2;
 background-color: #222;
 }
     .fotolist   {

      border-top: 3px solid #D40000;}

.tab-center .nav-tabs {
  border-bottom: none;
  margin-bottom: 0;
  text-align: center; }
  .tab-center .nav-tabs > li {
    border: none;
    display: inline-block;
    float: none; }
    .tab-center .nav-tabs > li.active {
      text-align: center;
      padding-bottom: 20px;
      margin-bottom: 20px;
      margin-right: 40px;
      margin-left: 40px; }
    .tab-center .nav-tabs > li > a {
      color: #cccccc;
      padding: 0;
      text-transform: uppercase;
      font-size: 15px;
      font-weight: 900; }
      .tab-center .nav-tabs > li > a:hover {
        color: #2f2f2f;
         border: 3px solid #888 }
    .tab-center .nav-tabs > li.active > a {
      color: #474747; }
.tab-center .tab-content {
  padding: 15px 20px;
  border: 1px solid #ebebeb; }

/* border */
.border-bottom {
  border-bottom: 1px solid #ebebeb; }

.border-top {
  border-top: 1px solid #ebebeb; }

.border {
  border: 1px solid #ebebeb; }

.none-border {
  border: none !important; }

/* space */
/*Space Padding

/*Font size
---------------------------------------*/
.font-size-7 {
  font-size: 7px; }

.font-size-10 {
  font-size: 10px; }

.font-size-12 {
  font-size: 12px; }

.font-size-14 {
  font-size: 14px; }

.font-size-16 {
  font-size: 16px; }

.font-size-18 {
  font-size: 18px !important; }

.font-size-20 {
  font-size: 20px; }

.font-size-22 {
  font-size: 22px; }

.font-size-24 {
  font-size: 24px; }

.font-size-26 {
  font-size: 26px; }

.font-size-28 {
  font-size: 28px; }

.font-size-30 {
  font-size: 30px; }

/* color */
.white {
  color: #FFFFFF; }

/* --- SCSS For Newsletter --- */
[class*="newsletter-v"].light-style {
  color: #fff; }
  [class*="newsletter-v"].light-style .form-control {
    color: #fff;
    background: transparent; }
  [class*="newsletter-v"].light-style .newsletter-label {
    color: #FFF; }
[class*="newsletter-v"].newsletter-border {
  border: 1px solid #ebebeb; }
[class*="newsletter-v"].newsletter-center {
  text-align: center; }
  [class*="newsletter-v"].newsletter-center .newsletter-heading {
    margin-bottom: 20px; }
  [class*="newsletter-v"].newsletter-center h2 {
    margin-top: 0; }

.newsletter-label {
  font-size: 14px;
  margin: 0;
  text-transform: uppercase; }

.newsletter-v1 .form-control {
  height: 40px;
  font-size: 14px; }
.newsletter-v1 button.icon-mail {
  display: block;
  padding: 10px 10px; }
  .newsletter-v1 button.icon-mail span {
    font-size: 12px;
    font-weight: 700; }

/* --- SCSS For Icon-box --- */
@-webkit-keyframes hover-imagecategory {
  0% {
    transform: perspective(200px) rotate3d(0, 1, 0, -90deg) translateX(-100%); }
  100% {
    transform: perspective(200px) rotate3d(0, 1, 0, 0deg) translateX(0px); } }
@-moz-keyframes hover-imagecategory {
  0% {
    transform: perspective(200px) rotate3d(0, 1, 0, -90deg) translateX(-100%); }
  100% {
    transform: perspective(200px) rotate3d(0, 1, 0, 0deg) translateX(0px); } }
@-o-keyframes hover-imagecategory {
  0% {
    transform: perspective(200px) rotate3d(0, 1, 0, -90deg) translateX(-100%); }
  100% {
    transform: perspective(200px) rotate3d(0, 1, 0, 0deg) translateX(0px); } }
@keyframes hover-imagecategory {
  0% {
    transform: perspective(200px) rotate3d(0, 1, 0, -90deg) translateX(-100%); }
  100% {
    transform: perspective(200px) rotate3d(0, 1, 0, 0deg) translateX(0px); } }
.feature-box .fbox-icon {
  float: left;
  margin: 10px 20px 0 0;
  -webkit-transition: all 0.4s ease 0s;
  -o-transition: all 0.4s ease 0s;
  transition: all 0.4s ease 0s; }
  .rtl .feature-box .fbox-icon {
    float: right; }
.feature-box .fbox-body {
  overflow: hidden; }
  .feature-box .fbox-body .fbox-icon {
    margin-top: 0; }
.feature-box small {
  font-size: 13px;
  margin-bottom: 15px;
  display: inline-block; }
.feature-box h4 {
  margin: 0; }
.feature-box .fbox-title {
  margin: 10px 0;
  font-weight: 600;
  text-transform: none; }
.feature-box.light-style {
  color: #dfdfdf; }
  .feature-box.light-style a {
    color: #fff; }
    .feature-box.light-style a:hover {
      color: #000; }
  .feature-box.light-style .fbox-title,
  .feature-box.light-style h4 {
    color: #fff; }
.feature-box.feature-box-right {
  text-align: right; }
  .rtl .feature-box.feature-box-right {
    text-align: left; }
  .feature-box.feature-box-right .fbox-icon {
    float: right;
    margin: 10px 0 0 20px; }
    .rtl .feature-box.feature-box-right .fbox-icon {
      float: left; }
    .rtl .feature-box.feature-box-right .fbox-icon {
      margin: 10px 20px 0 0; }
.feature-box.feature-box-center {
  text-align: center;
  padding: 0 16px; }
  .feature-box.feature-box-center .fbox-icon {
    float: none; }
.feature-box:hover .fbox-icon {
  -webkit-animation: hover-imagecategory 0.6s cubic-bezier(0.25, 0.46, 0.45, 0.94) 1;
  -o-animation: hover-imagecategory 0.6s cubic-bezier(0.25, 0.46, 0.45, 0.94) 1;
  animation: hover-imagecategory 0.6s cubic-bezier(0.25, 0.46, 0.45, 0.94) 1; }

[class*="feature-box-"] .fbox-icon {
  float: none;
  margin: 0; }
[class*="feature-box-"] h4 {
  padding: 5px 0;
  position: relative; }

.feature-box-v1 .fbox-icon {
  float: left;
  margin-right: 15px;
  margin-top: 10px; }
  .rtl .feature-box-v1 .fbox-icon {
    float: right; }
  .rtl .feature-box-v1 .fbox-icon {
    margin-left: 15px;
    margin-right: inherit; }
.feature-box-v1 .fbox-body {
  line-height: 20px; }
  .feature-box-v1 .fbox-body h4 {
    font-size: 22px;
    color: #000000;
    margin-bottom: 5px;
    text-transform: capitalize; }
  .feature-box-v1 .fbox-body p {
    margin: 0;
    padding: 0; }

.feature-box-v2 .fbox-icon {
  float: left;
  margin-right: 15px;
  margin-top: 10px; }
  .rtl .feature-box-v2 .fbox-icon {
    float: right; }
  .rtl .feature-box-v2 .fbox-icon {
    margin-left: 15px;
    margin-right: inherit; }
.feature-box-v2 .fbox-body {
  line-height: 20px;
  color: #c0b7af; }
  .feature-box-v2 .fbox-body h4 {
    font-size: 22px;
    color: #FFFFFF;
    margin-bottom: 5px;
    text-transform: capitalize; }
  .feature-box-v2 .fbox-body p {
    margin: 0;
    padding: 0; }

/* space */
/*Space Padding
------------------------------------*/
/*Padding Around the Block*/
.space-padding-tb-10 {
  padding-top: 10px !important;
  padding-bottom: 10px !important; }

.space-padding-tb-20 {
  padding-top: 20px !important;
  padding-bottom: 20px !important; }

.space-padding-tb-25 {
  padding-top: 25px !important;
  padding-bottom: 25px !important; }

.space-padding-tb-30 {
  padding-top: 30px !important;
  padding-bottom: 30px !important; }

.space-padding-tb-40 {
  padding-top: 40px !important;
  padding-bottom: 40px !important; }

.space-padding-tb-60 {
  padding-top: 60px !important;
  padding-bottom: 60px !important; }

/*Margin Bottom*/
.space-15 {
  margin-bottom: 15px !important; }

.space-20 {
  margin-bottom: 20px !important; }

.space-30 {
  margin-bottom: 30px !important; }

.space-40 {
  margin-bottom: 40px !important; }

.space-60 {
  margin-bottom: 60px !important; }

.space-top-20 {
  margin-top: 20px !important; }

.space-top-15 {
  margin-top: 15px !important; }

.space-top-60 {
  margin-top: 60px !important; }

/*Margin right*/
.space-right-5 {
  margin-right: 5px !important; }

.space-right-25 {
  margin-right: 25px; }
  .rtl .space-right-25 {
    margin-left: 25px;
    margin-right: inherit; }

.space-margin-lr-40 {
  margin-left: 40px !important;
  margin-right: 40px !important; }

.space-margin-l-40 {
  margin-left: 40px !important; }

.space-margin-r-40 {
  margin-right: 40px !important; }

.space-margin-lr-20 {
  margin-left: 20px !important;
  margin-right: 20px !important; }

.space-margin-tb-20 {
  margin-top: 20px !important;
  margin-bottom: 20px !important; }

.space-margin-tb-60 {
  margin-top: 60px !important;
  margin-bottom: 60px !important; }

.space-margin-r-10 {
  margin-right: 10px; }

/* latest posts */
.latest-posts {
  font-size: 14px;
  color: #2f2f2f; }
  .latest-posts .latest-posts-title {
    margin-top: 0;
    font-size: 14px; }
  .latest-posts .latest-posts-profile {
    font-size: 13px;
    color: #696969;
    padding-bottom: 10px; }
    .latest-posts .latest-posts-profile a {
      color: #696969; }
      .latest-posts .latest-posts-profile a:hover {
        color: red; }
    .latest-posts .latest-posts-profile i {
      margin-right: 2px;
      font-size: 14px; }
      .rtl .latest-posts .latest-posts-profile i {
        margin-left: 2px;
        margin-right: inherit; }
  .latest-posts.latest-posts-special .latest-posts-body > div {
    width: 50%;
    overflow: hidden; }

/* latest posts v1*/
.latest-posts-v1 .latest-posts-image {
  padding-right: 30px; }
  .rtl .latest-posts-v1 .latest-posts-image {
    padding-left: 30px;
    padding-right: inherit; }
.latest-posts-v1 .media-body {
  padding-top: 15px; }
  .latest-posts-v1 .media-body .latest-posts-title a {
    color: #2f2f2f;
    text-transform: none;
    letter-spacing: 0;
    font-size: 15px;
    font-weight: 400; }
    .latest-posts-v1 .media-body .latest-posts-title a:hover {
      color: #ef5d5d; }
  .latest-posts-v1 .media-body .latest-posts-profile {
    line-height: 1px;
    margin-top: -5px;
    padding-bottom: 25px; }
    .latest-posts-v1 .media-body .latest-posts-profile > span {
      color: #bbb;
      font-size: 12px;
      padding: 0 5px;
      text-transform: none;
      position: relative; }
      .latest-posts-v1 .media-body .latest-posts-profile > span:before {
        position: absolute;
        content: "";
        width: 100px;
        height: 1px;
        background: #dddddd;
        top: 27px;
        left: 0px; }
    .latest-posts-v1 .media-body .latest-posts-profile .created {
      position: relative;
      padding-left: 0; }
      .rtl .latest-posts-v1 .media-body .latest-posts-profile .created {
        padding-right: 0;
        padding-left: inherit; }
  .latest-posts-v1 .media-body .shortinfo {
    line-height: 20px;
    color: #747474;
    font-size: 13px; }
    .latest-posts-v1 .media-body .shortinfo a {
      color: #ef5d5d; }
      .latest-posts-v1 .media-body .shortinfo a:hover {
        color: #2f2f2f; }
.latest-posts-v1.none-readmore .blog-readmore {
  display: none; }

/* accordion */
.accordion {
     -webkit-box-shadow: 0 0 5px rgba(0, 0, 0, 0.4);
    -moz-box-shadow: 0 0 5px rgba(0, 0, 0, 0.4);
    box-shadow: 0 0 5px rgba(0, 0, 0, 0.4);
  padding: 0 60px;
  background-color:#fff;}
  .accordion .panel {
    margin: 0; }
  .accordion .first .panel-heading {
    border-top: none; }
  .accordion .panel-heading {
    padding: 20px 0;
    border-top: 1px solid #ebebeb;
    position: relative; }
    .accordion .panel-heading .panel-title {
      text-transform: uppercase;
      color: #D40000;
      font-size: 14px;
      letter-spacing: 1px; }
    .accordion .panel-heading a:before {
      content: "\f2f9";
      font-family: 'Material-Design-Iconic-Font';
      font-size: 12px;
      font-weight: 600;
      width: 20px;
      height: 20px;
      text-align: center;
      line-height: 16px;
      display: inline-block;
      color: #f1f1f1; }
    .accordion .panel-heading a.collapsed:before {
      content: "\f2fc"; }
  .accordion .panel-body {
    padding: 0 0 20px; }
  .accordion.collapse-right .panel-heading a:before {
    position: absolute;
    right: 20px; }
    .rtl .accordion.collapse-right .panel-heading a:before {
      left: 20px;
      right: auto; }
  .accordion.collapse-color .panel-heading a:before {
    color: #fff;
    background: #70ba28; }
  .accordion.noborder .panel-heading {
    padding-left: 0;
    padding-right: 0; }
  .accordion.noborder .panel, .accordion.noborder .panel-heading, .accordion.noborder .panel-body {
    background-color: transparent;
    border: none; }
  .accordion.nobackground .panel, .accordion.nobackground .panel-heading, .accordion.nobackground .panel-body {
    background-color: transparent; }

.interactive-banner {
  color: #fff;
  position: relative;
  overflow: hidden; }
  .interactive-banner .interactive-banner-profile {
    position: absolute;
    z-index: 2;
    margin: 0 auto;
    text-align: center;
    content: "";
    margin-top: -60px;
    top: 50%; }
    .interactive-banner .interactive-banner-profile h2 {
      text-transform: uppercase;
      margin: 10px 0 15px; }
    .interactive-banner .interactive-banner-profile small {
      text-transform: uppercase; }
    .interactive-banner .interactive-banner-profile h1, .interactive-banner .interactive-banner-profile h2, .interactive-banner .interactive-banner-profile h3, .interactive-banner .interactive-banner-profile h4, .interactive-banner .interactive-banner-profile h5, .interactive-banner .interactive-banner-profile h6 {
      font-size: 24px;
      margin: 0;
      text-transform: capitalize;
      height: 30px;
      overflow: hidden; }
  .interactive-banner .mask-link {
    position: absolute;
    content: "";
    width: 100%;
    height: 100%;
    top: 0;
    left: 0;
    right: 0;
    bottom: 0;
    margin: auto;
    z-index: 1; }
  .interactive-banner .description {
    font-size: 16px;
    font-weight: 900;
    left: -1000%;
    margin-top: 15px;
    max-height: 80px;
    opacity: 0;
    overflow: hidden;
    padding: 10px 60px;
    position: absolute;
    top: 50%;
    visibility: hidden;
    -webkit-transition: all 0.4s ease 0s;
    -o-transition: all 0.4s ease 0s;
    transition: all 0.4s ease 0s; }
    .rtl .interactive-banner .description {
      right: -1000%;
      left: auto; }
    .interactive-banner .description h4 {
      font-weight: 900;
      font-size: 30px; }
  .interactive-banner .sub-title {
    display: none; }
  .interactive-banner .btn-links {
    color: #c7b299;
    font-size: 10px;
    padding: 0 10px;
    margin-top: 10px;
    left: 0;
    right: 0;
    letter-spacing: 2px;
    text-transform: uppercase;
    font-weight: 900;
    top: 40px;
    -webkit-transition: all 0.4s ease 0s;
    -o-transition: all 0.4s ease 0s;
    transition: all 0.4s ease 0s;
    position: absolute; }
  .interactive-banner:hover h1, .interactive-banner:hover h2, .interactive-banner:hover h3, .interactive-banner:hover h4, .interactive-banner:hover h5, .interactive-banner:hover h6 {
    color: #FFFFFF; }
  .interactive-banner:hover .btn-links {
    top: 120px; }
  .interactive-banner:hover .description {
    left: 0;
    opacity: 1;
    filter: alpha(opacity=100);
    visibility: visible; }
    .rtl .interactive-banner:hover .description {
      right: 0;
      left: auto; }
  .interactive-banner .action .icons:hover {
    background-color: #70ba28 !important;
    border: #70ba28 !important; }
  .interactive-banner.left .interactive-banner-profile {
    left: 30px; }
    .rtl .interactive-banner.left .interactive-banner-profile {
      right: 30px;
      left: auto; }
  .interactive-banner.right .interactive-banner-profile {
    right: 30px; }
    .rtl .interactive-banner.right .interactive-banner-profile {
      left: 30px;
      right: auto; }
  .interactive-banner.center .interactive-banner-profile {
    right: 0;
    left: 0; }

.interactive-banner-v2 h1, .interactive-banner-v2 h2, .interactive-banner-v2 h3, .interactive-banner-v2 h4, .interactive-banner-v2 h5, .interactive-banner-v2 h6 {
  color: #FFFFFF; }
.interactive-banner-v2 .btn-links {
  color: #000000; }
.interactive-banner-v2:hover .btn-links {
  color: #c7b299; }

.interactive-banner-v3 .btn-links {
  background-color: rgba(255, 255, 255, 0.6);
  color: #000000;
  display: inline-block;
  font-size: 10px;
  font-weight: bold;
  padding: 5px 40px;
  position: relative; }
  .interactive-banner-v3 .btn-links:before {
    background-color: #644800;
    display: block;
    width: 0;
    height: 100%;
    left: 0;
    opacity: 0;
    filter: alpha(opacity=0);
    position: absolute;
    top: 0;
    -webkit-transition: all 0.4s ease 0s;
    -o-transition: all 0.4s ease 0s;
    transition: all 0.4s ease 0s;
    content: "";
    z-index: -1; }
    .rtl .interactive-banner-v3 .btn-links:before {
      right: 0;
      left: auto; }
.interactive-banner-v3 .interactive-banner-profile {
  margin-top: -15px;
  top: 50%; }
.interactive-banner-v3:hover .btn-links {
  color: #FFFFFF;
  top: 40px; }
  .interactive-banner-v3:hover .btn-links:before {
    width: 100%;
    opacity: 1;
    filter: alpha(opacity=100); }

.interactive-banner-v4 h1, .interactive-banner-v4 h2, .interactive-banner-v4 h3, .interactive-banner-v4 h4, .interactive-banner-v4 h5, .interactive-banner-v4 h6 {
  color: #FFFFFF; }
.interactive-banner-v4 .btn-links {
  color: #FFFFFF; }
.interactive-banner-v4:hover .btn-links {
  color: #c7b299; }

.interactive-banner-v5 h1, .interactive-banner-v5 h2, .interactive-banner-v5 h3, .interactive-banner-v5 h4, .interactive-banner-v5 h5, .interactive-banner-v5 h6 {
  color: #000000; }
.interactive-banner-v5 .btn-links {
  color: #000000; }
.interactive-banner-v5:hover .btn-links {
  color: #c7b299; }

/**
 * Category Products Page
 */
.page-product-category .breadcrumb li:last-child {
  display: block;
  text-align: left;
  padding: 20px 0;
  font-size: 40px; }
  .page-product-category .breadcrumb li:last-child:before {
    display: none; }
.page-product-category #content > h1 {
  display: none; }

.product-buttons-wrap .btn-inverse-light {
  height: 39px;
  width: 39px;
  line-height: 39px;
  background: #FFFFFF;
  color: #2f2f2f; }
  .product-buttons-wrap .btn-inverse-light:hover {
    background: #ef5d5d;
    color: #FFFFFF;
    border: none; }

/* filter by brands */
.product-filter span {
  margin-right: 5px; }
  .rtl .product-filter span {
    margin-left: 5px;
    margin-right: inherit; }
.product-filter .filter-left > div {
  padding-right: 15px; }
  .rtl .product-filter .filter-left > div {
    padding-left: 15px;
    padding-right: inherit; }
.product-filter .display {
  float: right; }
  .rtl .product-filter .display {
    float: left; }
.product-filter .form-control {
  display: inline-block;
  padding: 0 5px;
  width: auto;
  text-transform: capitalize;
  background-color: #f7f7f7; }
.product-filter .btn-switch {
  display: inline-block;
  margin-left: 10px;
  color: #d4d4d4;
  background: transparent;
  padding: 0;
  line-height: 42px;
  width: 40px;
  height: 40px; }
  .rtl .product-filter .btn-switch {
    margin-right: 10px;
    margin-left: inherit; }
  .product-filter .btn-switch i {
    font-size: 18px;
    color: #000000; }
  .product-filter .btn-switch:hover, .product-filter .btn-switch.active {
    -webkit-box-shadow: none;
    box-shadow: none; }
    .product-filter .btn-switch:hover i, .product-filter .btn-switch.active i {
      color: #ccc; }

/* product tab */
.product-tabs {
  margin-top: 60px; }
  .product-tabs .rating {
    display: none; }
  .product-tabs .widget-heading .panel-title:after {
    display: none; }
  .product-tabs .widget-heading .panel-title:before {
    display: none; }

/* product list */
.product-list .description {
  display: block; }
.product-list .bottom-last {
  margin-top: 20px; }
.product-list .product-meta {
  padding-top: 20px;
  padding-left: 0; }
  .rtl .product-list .product-meta {
    padding-right: 0;
    padding-left: inherit; }
.product-list .product-col {
  width: 100% !important; }
  .product-list .product-col .image {
    float: left;
    width: 30%;
    margin-right: 20px; }
    .rtl .product-list .product-col .image {
      float: right; }
    .rtl .product-list .product-col .image {
      margin-left: 20px;
      margin-right: inherit; }
  .product-list .product-col:first-child .product-block {
    padding: 0;
    border-top: none; }
  .product-list .product-col .product-block {
    border-top: 1px solid #ebebeb;
    padding-top: 30px; }
    .product-list .product-col .product-block .name {
      font-size: 18px;
      font-weight: 900; }
    .product-list .product-col .product-block .price {
      padding: 10px 0; }

/* product grid */
.product-grid .product-block .name-price {
  overflow: hidden; }
  .product-grid .product-block .name-price .name {
    line-height: 21px; }

#products .product-block .product-meta .rating:before {
  left: 0; }
  .rtl #products .product-block .product-meta .rating:before {
    right: 0;
    left: auto; }

.widget-carousel .widget-heading .panel-title {
  padding-bottom: 70px; }

.sidebar .carousel-controls-v1 {
  position: relative;
  top: 0;
  width: 50px;
  left: 80%; }
  .rtl .sidebar .carousel-controls-v1 {
    right: 80%;
    left: auto; }
  .sidebar .carousel-controls-v1 .carousel-control {
    position: absolute;
    top: 0;
    background-color: transparent;
    box-shadow: none;
    width: 25px;
    height: 25px;
    line-height: 25px; }
    .sidebar .carousel-controls-v1 .carousel-control:hover {
      background-color: #2f2f2f; }
    .sidebar .carousel-controls-v1 .carousel-control.left {
      left: 0; }
    .sidebar .carousel-controls-v1 .carousel-control.right {
      right: 0; }
.sidebar .widget-heading {
  text-align: left; }
  .sidebar .widget-heading .panel-title {
    font-size: 20px; }
    .sidebar .widget-heading .panel-title:before {
      display: none; }
.sidebar .product-label, .sidebar .cart {
  display: none; }
.sidebar .product-col {
  width: 100%;
  clear: both;
  position: relative; }
.sidebar .panel-body {
  padding-left: 0;
  padding-right: 0; }
.sidebar .products-block {
  overflow: hidden; }
.sidebar.border-yellow .products-block {
  position: relative;
  border: none; }
  .sidebar.border-yellow .products-block:before {
    border: 3px solid #f2ddb5;
    content: "";
    left: 0;
    position: absolute;
    top: 0;
    width: 100%;
    height: 100%; }
    .rtl .sidebar.border-yellow .products-block:before {
      right: 0;
      left: auto; }
.sidebar .product-block .rating-price .rating {
  float: right; }
  .rtl .sidebar .product-block .rating-price .rating {
    float: left; }
.sidebar .product-block .rating-price .price {
  float: left; }
  .rtl .sidebar .product-block .rating-price .price {
    float: right; }
.sidebar .product-block .image {
  float: left;
  margin-right: 15px;
  /*border-bottom: none;*/ }
  .rtl .sidebar .product-block .image {
    float: right; }
  .rtl .sidebar .product-block .image {
    margin-left: 15px;
    margin-right: inherit; }
.sidebar .product-block .product-meta {
  text-align: left;
  padding-top: 0px; }
  .rtl .sidebar .product-block .product-meta {
    text-align: right; }
  .sidebar .product-block .product-meta .rating {
    line-height: 20px; }
    .sidebar .product-block .product-meta .rating:before {
      width: 50px;
      top: 25px;
      left: 0; }
      .rtl .sidebar .product-block .product-meta .rating:before {
        right: 0;
        left: auto; }
.sidebar .product-block .name {
  margin-bottom: 5px; }
.sidebar .product-block .bottom {
  display: none; }
.sidebar .product-block .product-img:before {
  content: none; }
.sidebar.product-grid .product-block {
  border-bottom: none; }
  .sidebar.product-grid .product-block .name-price .name {
    float: none;
    max-width: 100%; }
  .sidebar.product-grid .product-block .name-price .price {
    float: none;
    max-width: 100%; }

.quantity-title {
  margin-right: 20px;
  line-height: 40px; }
  .rtl .quantity-title {
    margin-left: 20px;
    margin-right: inherit; }

.quantity-adder .add-action {
  width: 38px;
  height: 20px;
  display: block;
  position: relative;
  cursor: pointer;
  font-size: 7px;
  line-height: 20px;
  text-align: center;
  background-color: #2f2f2f;
  color: #FFFFFF; }
.quantity-adder .add-up {
  margin-bottom: 1px; }
.quantity-adder .quantity-number input {
  width: 65px;
  height: 41px;
  display: inline-block;
  *display: inline;
  zoom: 1;
  color: #474747;
  padding-left: 20px; }
  .rtl .quantity-adder .quantity-number input {
    padding-right: 20px;
    padding-left: inherit; }
.quantity-adder .minimum {
  line-height: 38px;
  font-size: 11px;
  margin-left: 10px; }
  .rtl .quantity-adder .minimum {
    margin-right: 10px;
    margin-left: inherit; }

/* product detail */
.product-info h1 {
  font-size: 24px;
  margin-top: 0; }
.product-info .image {
  position: relative; }
.product-info .image-additional .owl-carousel {
  margin-bottom: 0 !important; }
.product-info .image-additional .item {
  text-align: center;
  margin: 0 2px; }
.product-info .addthis_toolbox a {
  margin: 0; }

.review-form-width {
  background-color: #fff;
  margin: 10% auto;
  padding: 20px 15px;
  max-width: 700px;
  position: relative;
  z-index: 999999;
  background-color: #fff; }
  .review-form-width .panel-body {
    padding: 0; }

.product-related .owl-wrapper {
  margin-left: -5px;
  margin-right: -5px; }
  .product-related .owl-wrapper .owl-item {
    padding-right: 5px;
    padding-left: 5px; }

/* */
div.required .control-label:before {
  color: #f00;
  content: "* ";
  font-weight: bold; }

@font-face {
  font-family: 'proxima_regular';
  src: url("../fonts/mark_simonson_-_proxima_nova_regular-webfont.eot");
  src: url("../fonts/mark_simonson_-_proxima_nova_regular-webfont.eot?#iefix") format("embedded-opentype"), url("../fonts/mark_simonson_-_proxima_nova_regular-webfont.woff") format("woff"), url("../fonts/mark_simonson_-_proxima_nova_regular-webfont.ttf") format("truetype"), url("../fonts/mark_simonson_-_proxima_nova_regular-webfont.svg#proxima_regular") format("svg");
  font-weight: 100;
  font-style: normal; }
@font-face {
  font-family: 'proxima_regular';
  src: url("../fonts/mark_simonson_-_proxima_nova_thin-webfont.eot");
  src: url("../fonts/mark_simonson_-_proxima_nova_thin-webfont.eot?#iefix") format("embedded-opentype"), url("../fonts/mark_simonson_-_proxima_nova_thin-webfont.woff") format("woff"), url("../fonts/mark_simonson_-_proxima_nova_thin-webfont.woff2") format("woff"), url("../fonts/mark_simonson_-_proxima_nova_thin-webfont.ttf") format("truetype"), url("../fonts/mark_simonson_-_proxima_nova_thin-webfont.svg#proxima_regular") format("svg");
  font-weight: 200;
  font-style: normal; }
@font-face {
  font-family: 'proxima_regular';
  src: url("../fonts/mark_simonson_-_proxima_nova_semibold-webfont.eot");
  src: url("../fonts/mark_simonson_-_proxima_nova_semibold-webfont.eot?#iefix") format("embedded-opentype"), url("../fonts/mark_simonson_-_proxima_nova_semibold-webfont.woff") format("woff"), url("../fonts/mark_simonson_-_proxima_nova_semibold-webfont.ttf") format("truetype"), url("../fonts/mark_simonson_-_proxima_nova_semibold-webfont.svg#proxima_regular") format("svg");
  font-weight: 600;
  font-style: normal; }
@font-face {
  font-family: 'proxima_regular';
  src: url("../fonts/mark_simonson_-_proxima_nova_extrabold-webfont.eot");
  src: url("../fonts/mark_simonson_-_proxima_nova_extrabold-webfont.eot?#iefix") format("embedded-opentype"), url("../fonts/mark_simonson_-_proxima_nova_extrabold-webfont.woff") format("woff"), url("../fonts/mark_simonson_-_proxima_nova_extrabold-webfont.woff2") format("woff"), url("../fonts/mark_simonson_-_proxima_nova_extrabold-webfont.svg#proxima_regular") format("svg");
  font-weight: 700;
  font-style: normal; }
@font-face {
  font-family: 'proxima_regular';
  src: url("../fonts/mark_simonson_-_proxima_nova_black-webfont.eot");
  src: url("../fonts/mark_simonson_-_proxima_nova_black-webfont.eot?#iefix") format("embedded-opentype"), url("../fonts/mark_simonson_-_proxima_nova_black-webfont.woff") format("woff"), url("../fonts/mark_simonson_-_proxima_nova_black-webfont.woff2") format("woff"), url("../fonts/mark_simonson_-_proxima_nova_black-webfont.ttf") format("truetype"), url("../fonts/mark_simonson_-_proxima_nova_black-webfont.svg#proxima_regular") format("svg");
  font-weight: 800;
  font-style: normal; }
@font-face {
  font-family: 'proxima_regular';
  src: url("../fonts/mark_simonson_-_proxima_nova_bold-webfont.eot");
  src: url("../fonts/mark_simonson_-_proxima_nova_bold-webfont.eot?#iefix") format("embedded-opentype"), url("../fonts/mark_simonson_-_proxima_nova_bold-webfont.woff") format("woff"), url("../fonts/mark_simonson_-_proxima_nova_bold-webfont.ttf") format("truetype"), url("../fonts/mark_simonson_-_proxima_nova_bold-webfont.svg#proxima_regular") format("svg");
  font-weight: 900;
  font-style: normal; }
/*
 * Off Canvas
 * --------------------------------------------------
 */
@media screen and (max-width: 992px) {
  .row-offcanvas {
    -webkit-transition: all 0.25s ease-out;
    -o-transition: all 0.25s ease-out;
    transition: all 0.25s ease-out; }

  .row-offcanvas-right {
    right: 0; }
    .rtl .row-offcanvas-right {
      left: 0;
      right: auto; }

  .row-offcanvas-left {
    left: 0; }
    .rtl .row-offcanvas-left {
      right: 0;
      left: auto; }

  .row-offcanvas-right
  .sidebar-offcanvas {
    right: -70%; }
    .rtl .row-offcanvas-right
    .sidebar-offcanvas {
      left: -70%;
      right: auto; }

  .row-offcanvas-left
  .sidebar-offcanvas {
    left: -70%; }
    .rtl .row-offcanvas-left
    .sidebar-offcanvas {
      right: -70%;
      left: auto; }

  .row-offcanvas-right.active {
    right: 70%; }
    .rtl .row-offcanvas-right.active {
      left: 70%;
      right: auto; }

  .row-offcanvas-left.active {
    left: 70%; }
    .rtl .row-offcanvas-left.active {
      right: 70%;
      left: auto; }

  .sidebar-offcanvas {
    position: absolute;
    top: 0;
    width: 70%;
    background: #FFFFFF; }
    .sidebar-offcanvas ul, .sidebar-offcanvas ol {
      padding: 0;
      margin: 0; }
      .sidebar-offcanvas ul li, .sidebar-offcanvas ol li {
        list-style: none;
        position: relative; }
    .sidebar-offcanvas .offcanvas-body .panel .panel-heading {
      margin-top: 10px;
      margin-bottom: 0; }

  .bottom-offcanvas {
    border-top: 1px solid #ebebeb;
    padding: 10px 0; } }
.row-offcanvas {
  position: relative; }

.canvas-menu {
  padding: 5px 10px;
  font-size: 18px; }

.header-v3 .canvas-menu {
  margin: 10px 0; }

/*offcanvas-menu*/
#offcanvasmenu .badges.new, #offcanvasmenu .badges.hot {
  right: auto;
  left: 50px; }
#offcanvasmenu .navbar-nav {
  float: none; }
  #offcanvasmenu .navbar-nav > li {
    float: none;
    border-top: 1px solid #ebebeb; }
    #offcanvasmenu .navbar-nav > li .caret {
      display: none; }
    #offcanvasmenu .navbar-nav > li.home .menu-icon {
      background: none !important; }
    #offcanvasmenu .navbar-nav > li .click-canavs-menu {
      cursor: pointer;
      display: inline-block;
      padding: 19px;
      position: absolute;
      right: 0;
      top: 0;
      z-index: 1; }
      .rtl #offcanvasmenu .navbar-nav > li .click-canavs-menu {
        left: 0;
        right: auto; }
    #offcanvasmenu .navbar-nav > li li.dropdown-submenu .click-canavs-menu {
      padding: 10px; }
    #offcanvasmenu .navbar-nav > li > a {
      padding: 15px 25px;
      background-color: transparent !important;
      -webkit-transition: all 350ms ease-out;
      -o-transition: all 350ms ease-out;
      transition: all 350ms ease-out;
      text-transform: uppercase;
      font-weight: 900;
      line-height: 22px; }
#offcanvasmenu .dropdown-menu {
  background: none repeat scroll 0 0 transparent;
  border: 0 none;
  border-radius: 0;
  box-shadow: none;
  display: none;
  float: none;
  margin: 0;
  padding: 0 8px;
  position: static;
  visibility: visible;
  width: auto !important;
  opacity: 1;
  filter: alpha(opacity=100); }
  #offcanvasmenu .dropdown-menu .dropdown-menu-inner {
    line-height: 30px;
    padding-bottom: 20px;
    padding-left: 20px; }
  #offcanvasmenu .dropdown-menu .pavo-widget .sidebar {
    border: none; }
    #offcanvasmenu .dropdown-menu .pavo-widget .sidebar .product-block {
      padding-left: 0; }
      .rtl #offcanvasmenu .dropdown-menu .pavo-widget .sidebar .product-block {
        padding-right: 0;
        padding-left: inherit; }
  #offcanvasmenu .dropdown-menu a {
    font-size: 13px;
    padding: 5px 10px;
    background: none; }
  #offcanvasmenu .dropdown-menu .widget-video {
    display: none; }
  #offcanvasmenu .dropdown-menu .box-heading {
    color: #262a2e; }
#offcanvasmenu .w-product {
  padding: 0; }
#offcanvasmenu .product-block {
  border: none; }
  #offcanvasmenu .product-block .zoom, #offcanvasmenu .product-block .product-label {
    display: none; }

.badges.new, .badges.hot {
  color: #FFFFFF;
  font-size: 8px;
  line-height: 17px;
  padding: 0 7px;
  position: absolute;
  right: 17px;
  text-align: center;
  text-transform: uppercase;
  top: -15px;
  transform: translateZ(0px);
  font-weight: 900; }
  .rtl .badges.new, .rtl .badges.hot {
    left: 17px;
    right: auto; }
  .badges.new:before, .badges.hot:before {
    border-style: solid;
    border-width: 2px;
    bottom: -4px;
    content: "";
    left: 7px;
    position: absolute; }
.badges.new {
  background-color: #ef5d5d; }
  .badges.new:before {
    border-color: #ef5d5d transparent transparent #ef5d5d; }
.badges.hot {
  background-color: #80b2a7; }
  .badges.hot:before {
    border-color: #80b2a7 transparent transparent #80b2a7; }

.widget-heading {
  color: #2f2f2f;
  margin-top: 0;
  margin-bottom: 15px;
  font-size: 14px;
  text-align: center; }
  .widget-heading .panel-title {
    position: relative;
    display: inline-block;
    font-weight: bold;
    letter-spacing: normal;
    text-transform: none;
    font-size: 30px;
    letter-spacing: 0; }
    .widget-heading .panel-title:before {
      position: absolute;
      content: "";
      width: 100px;
      height: 1px;
      background: #ddd;
      left: -113px;
      top: 17px; }
      .rtl .widget-heading .panel-title:before {
        right: -113px;
        left: auto; }
    .widget-heading .panel-title:after {
      position: absolute;
      content: "";
      width: 100px;
      height: 1px;
      background: #ddd;
      right: -113px;
      top: 17px; }
      .rtl .widget-heading .panel-title:after {
        left: -113px;
        right: auto; }

.pav-megamenu {
  /* level 2 */
  /* level > 3 */ }
  .pav-megamenu > .click-canavs-menu.fa {
    position: absolute;
    padding: 18px;
    position: absolute;
    right: 0;
    top: 0;
    display: inline-block;
    cursor: pointer; }
  .pav-megamenu .navbar {
    margin: 0;
    border: 0; }
  .pav-megamenu .navbar-collapse {
    padding: 0; }
  .pav-megamenu .navbar-nav > li:hover, .pav-megamenu .navbar-nav > li:focus, .pav-megamenu .navbar-nav > li:active {
    background: #e5e5e5; }
  .pav-megamenu .navbar-nav > li.aligned-fullwidth {
    position: static; }
    .pav-megamenu .navbar-nav > li.aligned-fullwidth > .dropdown-menu {
      left: 0; }
      .rtl .pav-megamenu .navbar-nav > li.aligned-fullwidth > .dropdown-menu {
        right: 0;
        left: auto; }
    .pav-megamenu .navbar-nav > li.aligned-fullwidth .dropdown-submenu .dropdown-menu {
      margin-left: 0; }
      .rtl .pav-megamenu .navbar-nav > li.aligned-fullwidth .dropdown-submenu .dropdown-menu {
        margin-right: 0;
        margin-left: inherit; }
  .pav-megamenu .navbar-nav > li.aligned-right .dropdown-menu {
    left: auto;
    right: 0; }
    .rtl .pav-megamenu .navbar-nav > li.aligned-right .dropdown-menu {
      right: auto;
      left: auto; }
    .rtl .pav-megamenu .navbar-nav > li.aligned-right .dropdown-menu {
      left: 0;
      right: auto; }
  .pav-megamenu .navbar-nav > li.aligned-right .dropdown-submenu .dropdown-menu {
    margin-right: 100%; }
    .rtl .pav-megamenu .navbar-nav > li.aligned-right .dropdown-submenu .dropdown-menu {
      margin-left: 100%;
      margin-right: inherit; }
  .pav-megamenu .navbar-nav > li.aligned-left .dropdown-menu {
    left: 0;
    right: auto; }
    .rtl .pav-megamenu .navbar-nav > li.aligned-left .dropdown-menu {
      right: 0;
      left: auto; }
    .rtl .pav-megamenu .navbar-nav > li.aligned-left .dropdown-menu {
      left: auto;
      right: auto; }
  .pav-megamenu .navbar-nav > li.aligned-left .dropdown-submenu .dropdown-menu {
    margin-left: 100%; }
    .rtl .pav-megamenu .navbar-nav > li.aligned-left .dropdown-submenu .dropdown-menu {
      margin-right: 100%;
      margin-left: inherit; }
  .pav-megamenu .navbar-nav > li.aligned-center .dropdown-menu {
    left: 50%;
    transform: translate(-50%); }
    .rtl .pav-megamenu .navbar-nav > li.aligned-center .dropdown-menu {
      right: 50%;
      left: auto; }
  .pav-megamenu .navbar-nav > li.aligned-center .dropdown-submenu .dropdown-menu {
    margin-left: 100%; }
    .rtl .pav-megamenu .navbar-nav > li.aligned-center .dropdown-submenu .dropdown-menu {
      margin-right: 100%;
      margin-left: inherit; }
  .pav-megamenu .navbar-nav > li > .dropdown-menu {
    top: 120%;
    opacity: 0;
    filter: alpha(opacity=0);
    -webkit-transition: all 0.3s cubic-bezier(0.25, 0.46, 0.45, 0.94) 0s;
    -o-transition: all 0.3s cubic-bezier(0.25, 0.46, 0.45, 0.94) 0s;
    transition: all 0.3s cubic-bezier(0.25, 0.46, 0.45, 0.94) 0s;
    display: block;
    position: absolute;
    visibility: hidden;
    padding: 40px 30px;
    -webkit-box-shadow: 0px 5px 15px 0px rgba(0, 0, 0, 0.15);
    box-shadow: 0px 5px 15px 0px rgba(0, 0, 0, 0.15);
    left: 0; }
    .rtl .pav-megamenu .navbar-nav > li > .dropdown-menu {
      right: 0;
      left: auto; }
    .pav-megamenu .navbar-nav > li > .dropdown-menu .widget-heading {
      text-align: left; }
  .pav-megamenu .navbar-nav > li:hover > .dropdown-menu, .pav-megamenu .navbar-nav > li:focus > .dropdown-menu {
    opacity: 1;
    filter: alpha(opacity=100);
    visibility: visible;
    display: block;
    top: 100%; }
  .pav-megamenu .navbar-nav > li > a {
    padding: 10px 20px;
    text-transform: uppercase;
    color: #474747;
    background-color: transparent !important;
    -webkit-transition: all 350ms ease-out;
    -o-transition: all 350ms ease-out;
    transition: all 350ms ease-out;
    font-weight: 900;
    line-height: 40px;
    font-size: 13px; }
    .pav-megamenu .navbar-nav > li > a:hover .caret:before, .pav-megamenu .navbar-nav > li > a:focus .caret:before, .pav-megamenu .navbar-nav > li > a:active .caret:before {
      color: #474747 !important; }
    .pav-megamenu .navbar-nav > li > a .caret {
      border: 0;
      position: relative; }
      .pav-megamenu .navbar-nav > li > a .caret:before {
        content: '\f2f9';
        font-family: "Material-Design-Iconic-Font";
        position: absolute;
        right: -10px;
        top: -20px;
        font-size: 13px;
        font-weight: 100; }
        .rtl .pav-megamenu .navbar-nav > li > a .caret:before {
          left: -10px;
          right: auto; }
  .pav-megamenu .navbar-nav > li.full-width {
    position: static; }
  .pav-megamenu .dropdown-menu {
    top: 100%;
    left: -9999px;
    height: auto;
    line-height: 25px;
    color: #2f2f2f;
    /*         border-top:1px solid $border-color; */
    min-width: 200px;
    padding: 25px;
    background-color: #FFFFFF;
    -webkit-transition: opacity 0.3s linear 0s;
    -o-transition: opacity 0.3s linear 0s;
    transition: opacity 0.3s linear 0s;
    z-index: 9999; }
    .rtl .pav-megamenu .dropdown-menu {
      right: -9999px;
      left: auto; }
    .pav-megamenu .dropdown-menu ul, .pav-megamenu .dropdown-menu ol {
      padding: 0; }
    .pav-megamenu .dropdown-menu li {
      list-style: none;
      color: #f1f1f1; }
      .pav-megamenu .dropdown-menu li a:hover {
        background-color: transparent;
        color: #bbb; }
        .pav-megamenu .dropdown-menu li a:hover .fa {
          color: #0a2432; }
  .pav-megamenu .dropdown:hover > .dropdown-menu {
    display: block;
    left: 0px; }
    .rtl .pav-megamenu .dropdown:hover > .dropdown-menu {
      right: 0px;
      left: auto; }
  .pav-megamenu .dropdown:hover > a .fa {
    color: #2f2f2f; }
  .pav-megamenu .dropdown-submenu {
    position: relative; }
    .pav-megamenu .dropdown-submenu .dropdown-menu {
      top: 0;
      right: -100%;
      left: auto;
      position: absolute; }
      .rtl .pav-megamenu .dropdown-submenu .dropdown-menu {
        left: -100%;
        right: auto; }
      .rtl .pav-megamenu .dropdown-submenu .dropdown-menu {
        right: auto;
        left: auto; }
    .pav-megamenu .dropdown-submenu:hover > .dropdown-menu {
      left: 100%;
      display: block;
      top: 0; }
      .rtl .pav-megamenu .dropdown-submenu:hover > .dropdown-menu {
        right: 100%;
        left: auto; }
  .pav-megamenu .megamenu .cols1 {
    min-width: 200px; }
  .pav-megamenu .megamenu .cols2 {
    min-width: 500px; }
  .pav-megamenu .megamenu .cols3 {
    min-width: 740px; }
  .pav-megamenu .sidebar .product-block {
    border-top: none; }

.box-heading .panel-title {
  color: #FFFFFF; }

iframe {
  border: none; }

/* slideshow */
.tp-bullets {
  background: #fff; }
  .tp-bullets:before {
    border-color: transparent transparent #fff;
    border-style: solid;
    border-width: 36px;
    content: "";
    position: absolute;
    right: -36px;
    top: -36px; }

/* fillter */
.fillter a {
  font-weight: 900;
  text-transform: uppercase;
  padding-bottom: 0;
  color: #2f2f2f;
  letter-spacing: 1px; }
.fillter label {
  margin-left: 20px;
  font-weight: 100; }
  .rtl .fillter label {
    margin-right: 20px;
    margin-left: inherit; }
.fillter .list-group-item {
  border-bottom: 1px solid #ebebeb;
  margin-bottom: 20px; }

/* category */
.category .list-group {
  margin-bottom: 0; }
.category ul.level1 {
  padding-left: 0; }
  .rtl .category ul.level1 {
    padding-right: 0;
    padding-left: inherit; }
.category ul > li {
  padding-left: 0;
  display: block;
  padding-bottom: 8px;
  padding-top: 8px; }
  .rtl .category ul > li {
    padding-right: 0;
    padding-left: inherit; }
  .category ul > li > a {
    font-weight: 900;
    color: #2f2f2f;
    letter-spacing: 1px; }
.category ul ul {
  padding-left: 20px; }
  .rtl .category ul ul {
    padding-right: 20px;
    padding-left: inherit; }
  .category ul ul > li {
    position: relative;
    padding: 0; }
    .category ul ul > li a {
      color: #2f2f2f;
      font-weight: 400;
      letter-spacing: 0;
       }
      .category ul ul > li a:hover, .category ul ul > li a:active, .category ul ul > li a:focus {
        color: #f40000;
         }
       .category ul > li a:hover, .category ul > li a:active, .category ul > li a:focus {
        color: #f40000;
         }

.refine-search ul {
  margin-bottom: 0; }
  .refine-search ul li {
    padding: 0 15px;
    position: relative;
    white-space: nowrap; }
    .refine-search ul li:before {
      content: ".";
      color: #f1f1f1;
      position: absolute;
      left: 0;
      top: -8px;
      font-size: 30px; }
      .rtl .refine-search ul li:before {
        right: 0;
        left: auto; }
 .refine-search .panel-body {
    padding: 15px;
    background-color: #ccc;
}
 .category .panel-body{
    background-color: #ccc;
}

/* slidelayer */
.layerslider-wrapper {
  overflow: hidden; }
  .layerslider-wrapper:hover .tp-rightarrow {
    right: 20px !important; }
  .layerslider-wrapper:hover .tp-leftarrow {
    left: 20px !important; }

.tparrows {
  position: absolute;
  top: 50% !important;
  z-index: 9999;
  cursor: pointer;
  display: block;
  width: 45px;
  height: 45px;
  -webkit-transition: all 0.3s ease-in-out 0s;
  -o-transition: all 0.3s ease-in-out 0s;
  transition: all 0.3s ease-in-out 0s;
  font-size: 0; }
  .tparrows:before {
    color: #2f2f2f;
    content: "\f105";
    display: inline-block;
    font-size: 22px;
    font-family: FontAwesome;
    position: absolute;
    right: 0;
    text-align: center;
    top: 0;
    width: 36px;
    height: 36px;
    z-index: 12;
    background-color: #FFFFFF;
    line-height: 35px; }
  .tparrows.tp-leftarrow:before {
    content: "\f104"; }
  .tparrows:hover:before {
    background-color: #2f2f2f;
    color: #FFFFFF; }

.tp-leftarrow {
  left: -50px !important; }

.tp-rightarrow {
  right: -50px !important; }

/* custom */
.custom-v1 {
  padding: 30px; }
  .custom-v1 .custom-heading {
    color: #f1f1f1;
    font-size: 22px;
    text-transform: capitalize; }
  .custom-v1 .description {
    color: #999999;
    line-height: 20px; }

/* banner home4 */
.style1 {
  text-align: center;
  padding: 80px 0 50px; }
  .style1 img {
    display: inline-block; }

.product-block .block-img {
  position: relative;
  overflow: hidden; }
.product-block .action > div {
  display: inline-block;
  position: relative; }

.grayscale-gray {
  filter: grayscale(100%);
  -webkit-filter: grayscale(1);
  /* For Webkit browsers */
  -moz-filter: grayscale(100%);
  -ms-filter: grayscale(100%);
  -o-filter: grayscale(100%);
  filter: gray;
  /* For IE 6 - 9 */
  filter: url("data:image/svg+xml;utf8,<svg xmlns='http://www.w3.org/2000/svg'><filter id='grayscale'><feColorMatrix type='matrix' values='0.3333 0.3333 0.3333 0 0 0.3333 0.3333 0.3333 0 0 0.3333 0.3333 0.3333 0 0 0 0 0 1 0'/></filter></svg>#grayscale");
  /* Firefox 10+, Firefox on Android */ }

.grayscale-color {
  filter: grayscale(0%);
  -webkit-filter: grayscale(0%);
  -moz-filter: grayscale(0%);
  -ms-filter: grayscale(0%);
  -o-filter: grayscale(0%);
  filter: url("data:image/svg+xml;utf8,<svg xmlns='http://www.w3.org/2000/svg'><filter id='grayscale'><feColorMatrix type='matrix' values='1 0 0 0 0, 0 1 0 0 0, 0 0 1 0 0, 0 0 0 1 0'/></filter></svg>#grayscale"); }

/* effect-v1 */
.effect-v1 {
  background-color: #000;
  overflow: hidden;
  position: relative;
  /* style for hover */ }
  .effect-v1:before {
    bottom: 20px;
    content: "";
    left: 20px;
    position: absolute;
    right: 20px;
    top: 20px;
    -webkit-transform: scale(1.1);
    -ms-transform: scale(1.1);
    -o-transform: scale(1.1);
    transform: scale(1.1);
    opacity: 0;
    filter: alpha(opacity=0);
    -webkit-transition: opacity 0.35s ease 0s, transform 0.35s ease 0s;
    -o-transition: opacity 0.35s ease 0s, transform 0.35s ease 0s;
    transition: opacity 0.35s ease 0s, transform 0.35s ease 0s;
    z-index: 1; }
  .effect-v1 img {
    -webkit-transform: scale(1.12);
    -ms-transform: scale(1.12);
    -o-transform: scale(1.12);
    transform: scale(1.12);
    -webkit-transition: opacity 0.35s ease 0s, transform 0.35s ease 0s;
    -o-transition: opacity 0.35s ease 0s, transform 0.35s ease 0s;
    transition: opacity 0.35s ease 0s, transform 0.35s ease 0s; }
  .effect-v1 .action {
    -webkit-transform: scale(1.12);
    -ms-transform: scale(1.12);
    -o-transform: scale(1.12);
    transform: scale(1.12);
    opacity: 0;
    filter: alpha(opacity=0);
    -webkit-transition: opacity 0.35s ease 0s, transform 0.35s ease 0s;
    -o-transition: opacity 0.35s ease 0s, transform 0.35s ease 0s;
    transition: opacity 0.35s ease 0s, transform 0.35s ease 0s; }
  .effect-v1:hover:before {
    opacity: 1;
    filter: alpha(opacity=100);
    -webkit-transform: scale(1);
    -ms-transform: scale(1);
    -o-transform: scale(1);
    transform: scale(1); }
  .effect-v1:hover img {
    opacity: 0.5;
    filter: alpha(opacity=50);
    -webkit-transform: scale(1);
    -ms-transform: scale(1);
    -o-transform: scale(1);
    transform: scale(1); }
  .effect-v1:hover .action {
    -webkit-transform: scale(1);
    -ms-transform: scale(1);
    -o-transform: scale(1);
    transform: scale(1);
    opacity: 1;
    filter: alpha(opacity=100); }

/* effect-v2*/
.effect-v2 {
  background-color: #000;
  overflow: hidden;
  position: relative;
  /* style for hover */ }
  .effect-v2:before {
    border: 1px solid #ffffff;
    bottom: 20px;
    content: "";
    left: 20px;
    position: absolute;
    right: 20px;
    top: 20px;
    -webkit-transform: translate3d(-20px, 0px, 0px);
    transform: translate3d(-20px, 0px, 0px);
    opacity: 0;
    filter: alpha(opacity=0);
    -webkit-transition: opacity 0.35s ease 0s, transform 0.35s ease 0s;
    -o-transition: opacity 0.35s ease 0s, transform 0.35s ease 0s;
    transition: opacity 0.35s ease 0s, transform 0.35s ease 0s;
    z-index: 1; }
  .effect-v2 img {
    -webkit-transform: scale(1, 1);
    -ms-transform: scale(1, 1);
    -o-transform: scale(1, 1);
    transform: scale(1, 1);
    -webkit-transition: opacity 0.35s ease 0s, transform 0.35s ease 0s;
    -o-transition: opacity 0.35s ease 0s, transform 0.35s ease 0s;
    transition: opacity 0.35s ease 0s, transform 0.35s ease 0s; }
  .effect-v2 .action {
    -webkit-transform: translate3d(-10px, 0px, 0px);
    transform: translate3d(-10px, 0px, 0px);
    opacity: 0;
    filter: alpha(opacity=0);
    -webkit-transition: opacity 0.35s ease 0s, transform 0.35s ease 0s;
    -o-transition: opacity 0.35s ease 0s, transform 0.35s ease 0s;
    transition: opacity 0.35s ease 0s, transform 0.35s ease 0s; }
  .effect-v2:hover:before {
    opacity: 1;
    filter: alpha(opacity=100);
    -webkit-transform: translate3d(0px, 0px, 0px);
    transform: translate3d(0px, 0px, 0px); }
  .effect-v2:hover img {
    opacity: 0.7;
    filter: alpha(opacity=70);
    -webkit-transform: scale(1.2, 1);
    -ms-transform: scale(1.2, 1);
    -o-transform: scale(1.2, 1);
    transform: scale(1.2, 1); }
  .effect-v2:hover .action {
    -webkit-transform: translate3d(0px, 0px, 0px);
    transform: translate3d(0px, 0px, 0px);
    opacity: 1;
    filter: alpha(opacity=100); }

/* effect-v3*/
.effect-v3 {
  background-color: #000;
  overflow: hidden;
  position: relative;
  /* style for hover */ }
  .effect-v3:before, .effect-v3:after {
    bottom: 20px;
    content: "";
    left: 20px;
    opacity: 0;
    position: absolute;
    right: 20px;
    top: 20px;
    -webkit-transition: opacity 0.35s ease 0s, transform 0.35s ease 0s;
    -o-transition: opacity 0.35s ease 0s, transform 0.35s ease 0s;
    transition: opacity 0.35s ease 0s, transform 0.35s ease 0s;
    z-index: 1; }
  .effect-v3:before {
    border-bottom: 1px solid #ffffff;
    border-top: 1px solid #ffffff;
    -webkit-transform: scale(0, 1);
    -ms-transform: scale(0, 1);
    -o-transform: scale(0, 1);
    transform: scale(0, 1); }
  .effect-v3:after {
    border-left: 1px solid #ffffff;
    border-right: 1px solid #ffffff;
    -webkit-transform: scale(1, 0);
    -ms-transform: scale(1, 0);
    -o-transform: scale(1, 0);
    transform: scale(1, 0); }
  .effect-v3 img {
    opacity: 1;
    filter: alpha(opacity=100);
    -webkit-transition: opacity 0.35s ease 0s;
    -o-transition: opacity 0.35s ease 0s;
    transition: opacity 0.35s ease 0s; }
  .effect-v3 .banner-title {
    -webkit-transform: translate3d(0px, -20px, 0px);
    transform: translate3d(0px, -20px, 0px);
    -webkit-transition: transform 0.35s ease 0s;
    -o-transition: transform 0.35s ease 0s;
    transition: transform 0.35s ease 0s; }
  .effect-v3 .action {
    opacity: 0;
    filter: alpha(opacity=0);
    -webkit-transform: translate3d(0px, 40px, 0px);
    transform: translate3d(0px, 40px, 0px);
    -webkit-transition: opacity 0.35s ease 0s, transform 0.35s ease 0s;
    -o-transition: opacity 0.35s ease 0s, transform 0.35s ease 0s;
    transition: opacity 0.35s ease 0s, transform 0.35s ease 0s; }
  .effect-v3:hover:before, .effect-v3:hover:after {
    opacity: 1;
    filter: alpha(opacity=100);
    -webkit-transform: scale(1);
    -ms-transform: scale(1);
    -o-transform: scale(1);
    transform: scale(1); }
  .effect-v3:hover img {
    opacity: 0.5;
    filter: alpha(opacity=50); }
  .effect-v3:hover .banner-title, .effect-v3:hover .action {
    opacity: 1;
    filter: alpha(opacity=100);
    -webkit-transform: translate3d(0px, 0px, 0px);
    transform: translate3d(0px, 0px, 0px); }

/* effect-v4*/
.effect-v4 {
  overflow: hidden;
  position: relative;
  /* style for hover */ }
  .effect-v4:before {
    bottom: 20px;
    -webkit-box-shadow: 0 0 0 30px rgba(255, 255, 255, 0.4);
    box-shadow: 0 0 0 30px rgba(255, 255, 255, 0.4);
    content: "";
    left: 20px;
    opacity: 0;
    position: absolute;
    right: 20px;
    top: 20px;
    -webkit-transform: scale(1.4);
    -ms-transform: scale(1.4);
    -o-transform: scale(1.4);
    transform: scale(1.4);
    -webkit-transition: opacity 0.35s ease 0s, transform 0.35s ease 0s;
    -o-transition: opacity 0.35s ease 0s, transform 0.35s ease 0s;
    transition: opacity 0.35s ease 0s, transform 0.35s ease 0s;
    z-index: 1; }
  .effect-v4 img {
    opacity: 1;
    filter: alpha(opacity=100);
    -webkit-transition: opacity 0.35s ease 0s;
    -o-transition: opacity 0.35s ease 0s;
    transition: opacity 0.35s ease 0s; }
  .effect-v4 .banner-title {
    -webkit-transform: scale(1);
    -ms-transform: scale(1);
    -o-transform: scale(1);
    transform: scale(1);
    -webkit-transition: transform 0.35s ease 0s;
    -o-transition: transform 0.35s ease 0s;
    transition: transform 0.35s ease 0s; }
  .effect-v4 .action {
    opacity: 0;
    filter: alpha(opacity=0);
    -webkit-transform: scale(1.2);
    -ms-transform: scale(1.2);
    -o-transform: scale(1.2);
    transform: scale(1.2);
    -webkit-transition: opacity 0.35s ease 0s, transform 0.35s ease 0s;
    -o-transition: opacity 0.35s ease 0s, transform 0.35s ease 0s;
    transition: opacity 0.35s ease 0s, transform 0.35s ease 0s; }
  .effect-v4:hover:before {
    opacity: 1;
    filter: alpha(opacity=100);
    -webkit-transform: scale(1);
    -ms-transform: scale(1);
    -o-transform: scale(1);
    transform: scale(1); }
  .effect-v4:hover .banner-title {
    -webkit-transform: scale(0.95);
    -ms-transform: scale(0.95);
    -o-transform: scale(0.95);
    transform: scale(0.95); }
  .effect-v4:hover .action {
    opacity: 1;
    filter: alpha(opacity=100);
    -webkit-transform: scale(1);
    -ms-transform: scale(1);
    -o-transform: scale(1);
    transform: scale(1); }

/* effect-v5*/
.effect-v5 {
  overflow: hidden;
  position: relative;
  /* style for hover */ }
  .effect-v5 img {
    backface-visibility: hidden;
    opacity: 1;
    filter: alpha(opacity=100);
    -webkit-transition: opacity 1s ease 0s, transform 1s ease 0s;
    -o-transition: opacity 1s ease 0s, transform 1s ease 0s;
    transition: opacity 1s ease 0s, transform 1s ease 0s; }
  .effect-v5 .action {
    transform: translate3d(-150%, 0px, 0px);
    -webkit-transition: opacity 0.35s ease 0s, transform 0.35s ease 0s;
    -o-transition: opacity 0.35s ease 0s, transform 0.35s ease 0s;
    transition: opacity 0.35s ease 0s, transform 0.35s ease 0s; }
    .effect-v5 .action:first-child {
      -webkit-transition-delay: 0.15s;
      transition-delay: 0.15s; }
    .effect-v5 .action:nth-of-type(2) {
      -webkit-transition-delay: 0.1s;
      transition-delay: 0.1s; }
    .effect-v5 .action:nth-of-type(3) {
      -webkit-transition-delay: 0.05s;
      transition-delay: 0.05s; }
  .effect-v5:hover img {
    opacity: 0.8;
    filter: alpha(opacity=80);
    transform: scale3d(1.1, 1.1, 1); }
  .effect-v5:hover .action {
    opacity: 1;
    filter: alpha(opacity=100);
    transform: scale3d(1.1, 1.1, 1);
    transform: translate3d(0px, 0px, 0px); }
    .effect-v5:hover .action:first-child {
      -webkit-transition-delay: 0s;
      transition-delay: 0s; }
    .effect-v5:hover .action:nth-of-type(2) {
      -webkit-transition-delay: 0.05s;
      transition-delay: 0.05s; }
    .effect-v5:hover .action:nth-of-type(3) {
      -webkit-transition-delay: 0.1s;
      transition-delay: 0.1s; }

/* effect-v6*/
.effect-v6 {
  background-color: #000;
  overflow: hidden;
  position: relative;
  /* style for hover */ }
  .effect-v6 img {
    opacity: 1;
    filter: alpha(opacity=100);
    -webkit-transition: opacity 0.35s ease 0s;
    -o-transition: opacity 0.35s ease 0s;
    transition: opacity 0.35s ease 0s; }
  .effect-v6 .action {
    transform: translate3d(0px, -100px, 0px);
    transition: opacity 0.35s ease 0s, transform 0.35s ease 0s;
    opacity: 0;
    margin-top: 20px; }
  .effect-v6:hover img {
    opacity: 0.5;
    filter: alpha(opacity=50); }
  .effect-v6:hover .action {
    opacity: 1;
    transform: translate3d(0px, 0px, 0px); }

/* effect-v7*/
.effect-v7 {
  overflow: hidden;
  position: relative;
  /* style for hover */ }
  .effect-v7:before {
    bottom: 0;
    content: "";
    left: 0;
    position: absolute;
    right: 0;
    top: 0;
    -webkit-transition: all 0.4s cubic-bezier(0.94, 0.85, 0.1, 0.62) 0s;
    -o-transition: all 0.4s cubic-bezier(0.94, 0.85, 0.1, 0.62) 0s;
    transition: all 0.4s cubic-bezier(0.94, 0.85, 0.1, 0.62) 0s;
    z-index: 1;
    border: 200px double transparent;
    opacity: 1;
    filter: alpha(opacity=100);
    visibility: visible; }
  .effect-v7:hover:before {
    opacity: 0;
    filter: alpha(opacity=0);
    border: 0 double rgba(255, 255, 255, 0.7);
    visibility: hidden; }

/* effect-v8*/
.effect-v8 {
  overflow: hidden;
  position: relative;
  /* style for hover */ }
  .effect-v8:before {
    border-bottom: 50px solid rgba(255, 255, 255, 0.4);
    border-top: 50px solid rgba(255, 255, 255, 0.4);
    content: "";
    height: 100%;
    left: 0;
    opacity: 0;
    filter: alpha(opacity=0);
    position: absolute;
    top: 0;
    transform: rotate3d(0, 0, 1, 45deg) scale3d(1, 0, 1);
    -o-transform: rotate3d(0, 0, 1, 45deg) scale3d(1, 0, 1);
    -webkit-transform: rotate3d(0, 0, 1, 45deg) scale3d(1, 0, 1);
    -moz-transform: rotate3d(0, 0, 1, 45deg) scale3d(1, 0, 1);
    -ms-transform: rotate3d(0, 0, 1, 45deg) scale3d(1, 0, 1);
    -webkit-transition: opacity 0.35s ease 0s, transform 0.35s ease 0s;
    -o-transition: opacity 0.35s ease 0s, transform 0.35s ease 0s;
    transition: opacity 0.35s ease 0s, transform 0.35s ease 0s;
    transform-origin: 50% 50% 0;
    width: 100%; }
  .effect-v8:hover:before {
    opacity: 1;
    filter: alpha(opacity=100);
    transform: rotate3d(0, 0, 1, 45deg) scale3d(1, 4, 1);
    -o-transform: rotate3d(0, 0, 1, 45deg) scale3d(1, 4, 1);
    -webkit-transform: rotate3d(0, 0, 1, 45deg) scale3d(1, 4, 1);
    -moz-transform: rotate3d(0, 0, 1, 45deg) scale3d(1, 4, 1);
    -ms-transform: rotate3d(0, 0, 1, 45deg) scale3d(1, 4, 1); }

/* effect-v9*/
.effect-v9 {
  overflow: hidden;
  position: relative;
  /* style for hover */ }
  .effect-v9:before {
    border: 50px solid transparent;
    border-top-right-radius: 50px;
    border-top-left-radius: 50px;
    border-bottom-right-radius: 50px;
    border-bottom-left-radius: 50px;
    box-sizing: border-box;
    cursor: pointer;
    display: inline-block;
    left: 0;
    right: 0;
    bottom: 0;
    margin: auto;
    position: absolute;
    top: 0;
    content: "";
    opacity: 1;
    filter: alpha(opacity=100);
    width: 100px;
    height: 100px;
    -webkit-transform: scale(7);
    -ms-transform: scale(7);
    -o-transform: scale(7);
    transform: scale(7);
    -webkit-transition: all 0.3s ease-in-out 0s;
    -o-transition: all 0.3s ease-in-out 0s;
    transition: all 0.3s ease-in-out 0s;
    visibility: visible;
    z-index: 1; }
  .effect-v9:hover:before {
    border: 0 solid rgba(0, 0, 0, 0.7);
    opacity: 0;
    filter: alpha(opacity=0);
    visibility: hidden; }

/* effect-v10*/
.effect-v10 {
  overflow: hidden;
  position: relative;
  /* style for hover */ }
  .effect-v10:before {
    background-color: rgba(255, 255, 255, 0.2);
    display: block;
    width: 100%;
    height: 100%;
    left: -100%;
    opacity: 0;
    filter: alpha(opacity=0);
    position: absolute;
    top: 0;
    -webkit-transition: all 0.3s ease 0s;
    -o-transition: all 0.3s ease 0s;
    transition: all 0.3s ease 0s;
    content: "";
    z-index: 1; }
  .effect-v10:hover:before {
    left: 0;
    opacity: 1;
    filter: alpha(opacity=100); }

.effect-v11 {
  overflow: hidden;
  position: relative;
  /* style for hover */ }
  .effect-v11 img {
    opacity: 1;
    filter: alpha(opacity=100);
    -webkit-transition: opacity 0.35s ease 0s;
    -o-transition: opacity 0.35s ease 0s;
    transition: opacity 0.35s ease 0s; }
  .effect-v11 .action {
    transform: translate3d(0px, -100px, 0px);
    transition: opacity 0.35s ease 0s, transform 0.35s ease 0s;
    opacity: 0; }
  .effect-v11 li:hover img {
    opacity: 0.8;
    filter: alpha(opacity=80); }
  .effect-v11 li:hover .action {
    opacity: 1;
    transform: translate3d(0px, 0px, 0px); }

.icon-effect-v1 img {
  transform: scale(1);
  transition: transform 0.2s ease 0s; }
.icon-effect-v1 li:hover img {
  transform: scale(0.8); }

@media (min-width: 992px) {
  .btn-outline-light {
    color: #FFFFFF;
    background-color: transparent;
    border-color: #FFFFFF;
    -webkit-transition: all 0.4s ease-out 0s;
    -o-transition: all 0.4s ease-out 0s;
    transition: all 0.4s ease-out 0s; }
    .btn-outline-light:hover, .btn-outline-light:focus, .btn-outline-light:active, .btn-outline-light.active {
      color: #474747;
      background-color: #FFFFFF;
      border-color: #FFFFFF; }
    .open .btn-outline-light.dropdown-toggle {
      color: #474747;
      background-color: #FFFFFF;
      border-color: #FFFFFF; }
    .btn-outline-light:active, .btn-outline-light.active {
      background-image: none; }
    .open .btn-outline-light.dropdown-toggle {
      background-image: none; }
    .btn-outline-light.disabled, .btn-outline-light.disabled:hover, .btn-outline-light.disabled:focus, .btn-outline-light.disabled:active, .btn-outline-light.disabled.active, .btn-outline-light[disabled], .btn-outline-light[disabled]:hover, .btn-outline-light[disabled]:focus, .btn-outline-light[disabled]:active, .btn-outline-light[disabled].active, fieldset[disabled] .btn-outline-light, fieldset[disabled] .btn-outline-light:hover, fieldset[disabled] .btn-outline-light:focus, fieldset[disabled] .btn-outline-light:active, fieldset[disabled] .btn-outline-light.active {
      background-color: transparent;
      border-color: #FFFFFF; }
    .btn-outline-light .badge {
      color: transparent;
      background-color: #FFFFFF; }

  .effect-carousel-v1 {
    overflow: hidden; }
    .effect-carousel-v1 .carousel-controls-v3 .carousel-control {
      opacity: 0;
      filter: alpha(opacity=0);
      -webkit-transition: all 0.5s ease-in-out 0s;
      -o-transition: all 0.5s ease-in-out 0s;
      transition: all 0.5s ease-in-out 0s; }
      .effect-carousel-v1 .carousel-controls-v3 .carousel-control.left {
        left: -30px; }
      .effect-carousel-v1 .carousel-controls-v3 .carousel-control.right {
        right: -30px; }
    .effect-carousel-v1:hover .carousel-control {
      opacity: 1;
      filter: alpha(opacity=100); }
      .effect-carousel-v1:hover .carousel-control.left {
        left: 0; }
      .effect-carousel-v1:hover .carousel-control.right {
        right: 0; }

  .col {
    width: 10% !important; } }
@media (max-width: 1199px) {
  .pav-megamenu .navbar-nav > li > a {
    padding: 10px 13px !important; }

  .product-filter .filter-left > div {
    padding-top: 5px;
    padding-right: 5px; } }
@media (min-width: 768px) {
  .product-block .bottom {
    bottom: 0;
    left: 0;
    margin: 0 auto;
    opacity: 0;
    position: absolute;
    right: 0;
    text-align: center;
    transform: scale(0);
    transition: all 0.3s ease-out 0s;
    visibility: hidden;
    z-index: 11; }
    .product-block .bottom button {
      display: inline-block;
      padding: 0px 0px;
      text-align: center;
      vertical-align: middle; }
  .product-block:hover .bottom {
    bottom: 5%;
    opacity: 1;
    transform: scale(1);
    transition: all 0.3s ease-out 0s;
    visibility: visible; } }
@media (min-width: 768px) and (max-width: 991px) {
  .product-tabs {
    margin-top: 40px; } }
@media (max-width: 768px) {
  .productdeals .product-block .bottom {
    margin: 10px; }

  .custom-v1 {
    padding: 0px; }
    .custom-v1 .custom-heading {
      margin-top: 0; }

  .scrollup {
    right: 15px; }
    .rtl .scrollup {
      left: 15px;
      right: auto; }

  .zoomContainer {
    display: none; } }
@media (min-width: 767px) and (max-width: 768px) {
  .bg-carousel .panel-title {
    text-transform: capitalize;
    font-size: 20px; }

  footer .footer-center .column {
    clear: both; }
    footer .footer-center .column .panel-heading {
      margin-top: 10px; } }
@media (max-width: 767px) {
  .tab-center .nav-tabs > li.active {
    padding-bottom: 0;
    margin-bottom: 0; }

  .breadcrumb {
    margin-bottom: 0px; }

  .product-tabs {
    margin-top: 0px; }
    .product-tabs .tab-v1 {
      padding: 0; }
      .product-tabs .tab-v1 .tab-heading {
        margin-bottom: 20px;
        text-align: center; }
        .product-tabs .tab-v1 .tab-heading .nav-tabs {
          margin-bottom: 0px; }
          .product-tabs .tab-v1 .tab-heading .nav-tabs > li {
            border: none;
            margin-right: 0px; }
            .product-tabs .tab-v1 .tab-heading .nav-tabs > li a {
              padding: 0 10px 0 0; }

  .widget-blogs {
    margin-top: -20px;
    margin-bottom: -20px; }
    .widget-blogs .panel-heading {
      padding: 0; }

  .product-list .product-col .image {
    float: none;
    width: 100%; }
  .product-list .product-meta {
    padding: 20px; }

  .product-filter .filter-left > div {
    margin-bottom: 10px;
    padding-right: 0; }
    .rtl .product-filter .filter-left > div {
      padding-left: 0;
      padding-right: inherit; }

  .product-list .product-block .product-img {
    margin-bottom: 10px; }

  .pav-comment .form-group > div {
    margin-bottom: 10px; }

  .blog-item .image {
    margin-bottom: 20px; }

  .checkout-cart .input-group .form-control {
    width: auto; }

  .latest-posts-body .latest-posts-image {
    text-align: center;
    padding-top: 20px;
    float: none !important; }
    .latest-posts-body .latest-posts-image .img-responsive {
      display: inline-block; }
  .latest-posts-body .media-body {
    float: left;
    width: 100%; }
    .rtl .latest-posts-body .media-body {
      float: right; }

  .pavpopulartag .box-heading {
    padding-top: 15px; } }
@media (max-width: 480px) {
  .pav-megamenu {
    position: absolute; }

  .space-right-15 {
    margin-right: 5px; }
    .rtl .space-right-15 {
      margin-left: 5px;
      margin-right: inherit; }

  .product-info h1 {
    margin-top: 10px;
    font-size: 18px; }

  .accordion {
    padding: 0 20px; }

  .tab-v1 {
    padding: 30px 20px 60px; }

  .feature-box {
    margin-bottom: 20px; }

  .header-v2 {
    border-bottom: #ebebeb; }
    .header-v2 .border-bottom {
      border: none; }
    .header-v2 .part-2 .inner {
      padding: 0 !important; }
    .header-v2 .canvas-menu {
      left: 30px;
      position: absolute;
      top: -60px; }
      .rtl .header-v2 .canvas-menu {
        right: 30px;
        left: auto; }
    .header-v2 .logo-store {
      margin-bottom: 20px; }
    .header-v2 #cart .dropdown-menu {
      left: -138px; }
      .rtl .header-v2 #cart .dropdown-menu {
        right: -138px;
        left: auto; }

  .breadcrumb {
    padding: 10px 0; }

  #cart .dropdown-menu {
    min-width: 320px; }

  .header-v3 {
    margin-bottom: 5px; }
    .header-v3 .canvas-menu {
      position: absolute;
      top: -60px;
      display: block;
      margin: 0; }
    .header-v3 .logo-store {
      text-align: center;
      margin-bottom: 10px; }

  .space-margin-lr-40 {
    margin-left: 10px !important;
    margin-right: 10px !important; }

  .box-support {
    display: none; }

  #offcanvasmenu .widget-images {
    display: none; }

  .widget-images {
    text-align: center; }
    .widget-images img {
      display: inline-block; }

  #button-cart {
    padding: 10px; }

  #search {
    width: 250px; }

  .tab-v1.space-margin-tb-60 {
    margin-top: 0px !important;
    margin-bottom: 0px !important; }

  .btn.btn-default {
    padding: 10px 5px; }

  .table-responsive .btn.btn-default {
    padding: 0; }

  #offcanvas-search .form-control {
    padding: 10px 5px; }
  #offcanvas-search .btn {
    padding: 10px 15px; } }
.heading-vetical .panel-heading {
  padding: 20px 25px; }

.arrow {
  width: 20px;
  height: 20px;
  line-height: 20px !important;
  color: #343434;
  font-size: 17px;
  text-align: center;
  background: #FFFFFF;
  -webkit-border-radius: 100%;
  -moz-border-radius: 100%;
  -ms-border-radius: 100%;
  -o-border-radius: 100%;
  border-radius: 100%; }

.pav-verticalmenu {
  left: 0;
  position: absolute;
  width: 100%; }
  .rtl .pav-verticalmenu {
    right: 0;
    left: auto; }
  .pav-verticalmenu .vertical-icon {
    width: 50px;
    height: 40px;
    background: #f1f1f1;
    color: #FFFFFF;
    text-align: center;
    line-height: 40px;
    font-size: 18px;
    cursor: pointer; }
  .pav-verticalmenu .navbar-default {
    background: #FFFFFF;
    border: none;
    margin: 0;
    top: 120%;
    opacity: 0;
    filter: alpha(opacity=0);
    -webkit-transition: all 0.3s cubic-bezier(0.25, 0.46, 0.45, 0.94) 0s;
    -o-transition: all 0.3s cubic-bezier(0.25, 0.46, 0.45, 0.94) 0s;
    transition: all 0.3s cubic-bezier(0.25, 0.46, 0.45, 0.94) 0s;
    display: block;
    position: absolute;
    visibility: hidden;
    z-index: 999; }
  .pav-verticalmenu:hover .navbar-default, .pav-verticalmenu:focus .navbar-default {
    opacity: 1;
    filter: alpha(opacity=100);
    visibility: visible;
    display: block;
    top: 100%; }

.verticalmenu .navbar-collapse {
  margin: 0;
  padding: 20px 0;
  border: 1px solid #f1f1f1; }
.verticalmenu .widget-heading {
  /* text-transform: uppercase;
  border-bottom:1px solid $border-color;
  padding-bottom:20px; */ }
.verticalmenu .navbar-nav {
  position: static;
  float: none;
  width: 100%;
  padding: 0; }
  .verticalmenu .navbar-nav > li {
    width: 100%;
    height: auto;
    position: static;
    float: left;
    padding: 0 30px; }
    .rtl .verticalmenu .navbar-nav > li {
      float: right; }
    .verticalmenu .navbar-nav > li:last-child a {
      border-bottom: none; }
    .verticalmenu .navbar-nav > li > a {
      display: block;
      color: #f1f1f1;
      text-transform: uppercase;
      font-weight: 900;
      padding: 10px 0;
      font-size: 14px;
      background: transparent !important;
      position: relative;
      border-bottom: 1px solid #ebebeb; }
      .verticalmenu .navbar-nav > li > a:hover, .verticalmenu .navbar-nav > li > a:focus, .verticalmenu .navbar-nav > li > a:active {
        color: #0a2432; }
      .verticalmenu .navbar-nav > li > a .menu-icon {
        display: block; }
      .verticalmenu .navbar-nav > li > a .fa {
        margin-right: 5px;
        width: 20px; }
        .rtl .verticalmenu .navbar-nav > li > a .fa {
          margin-left: 5px;
          margin-right: inherit; }
      .verticalmenu .navbar-nav > li > a .caret {
        float: right;
        -webkit-transform: rotate(-90deg);
        -ms-transform: rotate(-90deg);
        -o-transform: rotate(-90deg);
        transform: rotate(-90deg);
        margin-top: 8px; }
        .rtl .verticalmenu .navbar-nav > li > a .caret {
          float: left; }
        .rtl .verticalmenu .navbar-nav > li > a .caret {
          -webkit-transform: rotate(90deg);
          -ms-transform: rotate(90deg);
          -o-transform: rotate(90deg);
          transform: rotate(90deg); }
    .verticalmenu .navbar-nav > li.topdropdow:hover {
      position: static; }
    .verticalmenu .navbar-nav > li:hover {
      background: #FFFFFF;
      -webkit-transition: all 300ms ease-in-out 0s;
      -o-transition: all 300ms ease-in-out 0s;
      transition: all 300ms ease-in-out 0s; }
      .verticalmenu .navbar-nav > li:hover > .dropdown-menu {
        top: 0px;
        opacity: 1;
        filter: alpha(opacity=100);
        visibility: visible;
        display: block;
        left: 100%;
        margin-left: -1px; }
        .rtl .verticalmenu .navbar-nav > li:hover > .dropdown-menu {
          right: 100%;
          left: auto; }
        .rtl .verticalmenu .navbar-nav > li:hover > .dropdown-menu {
          margin-right: -1px;
          margin-left: inherit; }
    .verticalmenu .navbar-nav > li .parent {
      position: relative; }
      .verticalmenu .navbar-nav > li .parent:hover > .dropdown-menu {
        right: 100%;
        top: 0px;
        opacity: 1;
        filter: alpha(opacity=100); }
        .rtl .verticalmenu .navbar-nav > li .parent:hover > .dropdown-menu {
          left: 100%;
          right: auto; }
      .verticalmenu .navbar-nav > li .parent.dropdown-submenu:hover .dropdown-menu {
        right: 115%;
        display: block;
        top: 0;
        visibility: visible; }
.verticalmenu .dropdown-menu {
  right: auto;
  left: 110%;
  opacity: 0;
  filter: alpha(opacity=0);
  -webkit-box-shadow: 0 5px 15px 0 rgba(0, 0, 0, 0.15);
  box-shadow: 0 5px 15px 0 rgba(0, 0, 0, 0.15);
  -webkit-transition: all 0.4s cubic-bezier(0.25, 0.46, 0.45, 0.94) 0s;
  -o-transition: all 0.4s cubic-bezier(0.25, 0.46, 0.45, 0.94) 0s;
  transition: all 0.4s cubic-bezier(0.25, 0.46, 0.45, 0.94) 0s;
  top: 0;
  position: absolute;
  visibility: hidden;
  z-index: 999;
  display: block;
  min-width: 215px;
  padding: 25px; }
  .rtl .verticalmenu .dropdown-menu {
    left: auto;
    right: auto; }
  .rtl .verticalmenu .dropdown-menu {
    right: 110%;
    left: auto; }
  .verticalmenu .dropdown-menu ul.content {
    padding-left: 15px; }
    .rtl .verticalmenu .dropdown-menu ul.content {
      padding-right: 15px;
      padding-left: inherit; }
  .verticalmenu .dropdown-menu .column {
    position: relative; }
    .verticalmenu .dropdown-menu .column:before {
      content: "";
      width: 1px;
      height: 100%;
      background-color: #ebebeb;
      right: 30px;
      top: 0;
      position: absolute; }
      .rtl .verticalmenu .dropdown-menu .column:before {
        left: 30px;
        right: auto; }
    .verticalmenu .dropdown-menu .column.last:before {
      content: none; }
  .verticalmenu .dropdown-menu.level1 {
    margin-top: -1px; }
    .verticalmenu .dropdown-menu.level1 .fa {
      display: none; }
  .verticalmenu .dropdown-menu.level2 .fa {
    display: none; }
  .verticalmenu .dropdown-menu.level3 .fa {
    display: none; }
  .verticalmenu .dropdown-menu ul {
    list-style-type: none;
    padding-left: 0; }
    .rtl .verticalmenu .dropdown-menu ul {
      padding-right: 0;
      padding-left: inherit; }
    .verticalmenu .dropdown-menu ul > li > a:hover {
      color: #000000; }
  .verticalmenu .dropdown-menu .sidebar {
    box-shadow: none;
    padding: 0; }
.verticalmenu .w-product .product-block {
  text-align: center; }
  .verticalmenu .w-product .product-block .image {
    border: 1px solid #ebebeb; }
  .verticalmenu .w-product .product-block .name {
    min-height: auto;
    margin-bottom: 0; }
.verticalmenu .w-product .media-body {
  display: inline-block;
  text-align: center; }

.deals .product-filter {
  background: transparent;
  color: #2f2f2f; }

.productdeals .carousel-inner:hover {
  overflow: inherit !important; }
.productdeals .product-grid .products-row .product-block .action > div {
  padding-right: 1px; }
.productdeals .product-grid .products-row .item-countdown ul {
  text-align: center; }
.productdeals.product-list .footer-deals {
  margin-bottom: 0 !important; }
.productdeals .product-block .bottom {
  bottom: 20%; }
  .productdeals .product-block .bottom:hover {
    bottom: 20%; }
  .productdeals .product-block .bottom .cart button {
    background: #ef5d5d; }
    .productdeals .product-block .bottom .cart button:hover {
      background: #2f2f2f; }
.productdeals .item-countdown ul, .footer-deals .item-countdown ul, .lof-labelexpired{
  margin: 0 auto;
  width: 100%;
  background: #ef9a9a;
  text-align: center; }

  .lof-labelexpired{
  margin: 0 auto;
  width: 100%;
  background: #999A9A;
  text-align: center;
  color:#fff;}


.productdeals .item-countdown li, .footer-deals .item-countdown li {
  margin: 0;
  padding: 10px 0;
  position: relative;
  width: 40px;
  display: inline-block;
  font-weight: 900;
  cursor: pointer; }
  .productdeals .item-countdown li span, .footer-deals .item-countdown li span {
    display: none;
    font-size: 12px;
    position: absolute;
    text-transform: uppercase;
    color: #fff; }
  .productdeals .item-countdown li:hover span, .footer-deals .item-countdown li:hover span{
    display: block;
    bottom: 27px; }
  .productdeals .item-countdown li .countdown_num span, .footer-deals .item-countdown li .countdown_num span{
    display: inline-block;
    position: inherit;
    font-size: 18px;
    color: #FFFFFF; }
  .productdeals .item-countdown li .countdown_num:before {
    position: absolute;
    left: 0;
    font-size: 18px;
    top: 10px;
    content: ":";
    color: #FFFFFF;
    font-weight: 200; }
    .rtl .productdeals .item-countdown li .countdown_num:before {
      right: 0;
      left: auto; }
  .productdeals .item-countdown li:first-child .countdown_num:before {
    content: none; }

.valid {
  position: absolute;
  width: 100%; }

.page-pavblog h1 {
  margin: 0; }

.comment-warning {
  color: #c12e2a; }

.pav-blogs .image {
  text-align: center; }
  .pav-blogs .image .img-responsive {
    display: inline-block;
    float: none; }
.pav-blogs .blog-date {
  background: #000000;
  color: #FFFFFF;
  display: block;
  float: left;
  font-size: 18px;
  height: 70px;
  line-height: normal;
  margin-right: 20px;
  overflow: hidden;
  padding: 12px; }
  .rtl .pav-blogs .blog-date {
    float: right; }
  .rtl .pav-blogs .blog-date {
    margin-left: 20px;
    margin-right: inherit; }
  .pav-blogs .blog-date .day {
    padding: 0;
    display: block;
    text-align: center; }
.pav-blogs .blog-body {
  overflow: hidden; }
  .pav-blogs .blog-body .text-link {
    color: #000000;
    font-weight: 600; }
    .pav-blogs .blog-body .text-link .fa {
      padding-left: 5px; }
      .rtl .pav-blogs .blog-body .text-link .fa {
        padding-right: 5px;
        padding-left: inherit; }
    .pav-blogs .blog-body .text-link:hover, .pav-blogs .blog-body .text-link:active, .pav-blogs .blog-body .text-link:focus {
      color: #2f2f2f; }
.pav-blogs .blog-title a {
  color: #000000; }
.pav-blogs .blog-meta ul {
  margin: 0; }
  .pav-blogs .blog-meta ul li {
    display: inline-block;
    padding-right: 13px;
    position: relative; }
    .rtl .pav-blogs .blog-meta ul li {
      padding-left: 13px;
      padding-right: inherit; }
    .pav-blogs .blog-meta ul li b {
      color: #2f2f2f; }
    .pav-blogs .blog-meta ul li:before {
      width: 1px;
      height: 15px;
      background: #ccc;
      content: "";
      position: absolute;
      left: -8px;
      top: 5px; }
      .rtl .pav-blogs .blog-meta ul li:before {
        right: -8px;
        left: auto; }
    .pav-blogs .blog-meta ul li:first-child:before {
      content: none; }
    .pav-blogs .blog-meta ul li:last-child {
      border-right: none; }
      .rtl .pav-blogs .blog-meta ul li:last-child {
        border-left: none;
        border-right: inherit; }

.search-auto {
  padding-top: 15px; }

.rtl .header-v3 .autosearch-wrapper .dropdown-menu {
  right: 168px;
  left: auto; }

.autosearch-wrapper .input-group-btn {
  position: relative; }
  .autosearch-wrapper .input-group-btn:after {
    background: #ebebeb;
    line-height: 40px;
    position: absolute;
    right: 0;
    text-align: center;
    top: 0;
    font-family: 'FontAwesome';
    content: "\f107";
    font-size: 16px;
    width: 35px;
    height: 40px;
    color: #343434; }
    .rtl .autosearch-wrapper .input-group-btn:after {
      left: 0;
      right: auto; }
.autosearch-wrapper .category_filter {
  border: none;
  display: inline-block;
  font-size: 13px;
  color: #474747;
  height: 40px;
  line-height: 30px;
  -webkit-box-shadow: inherit;
  box-shadow: inherit;
  background-color: #ebebeb;
  padding-left: 10px;
  text-transform: capitalize; }
  .rtl .autosearch-wrapper .category_filter {
    padding-right: 10px;
    padding-left: inherit; }
  @media (max-width: 480px) {
    .autosearch-wrapper .category_filter {
      max-width: 130px; } }
.autosearch-wrapper .search_query {
  background-color: transparent;
  height: 40px; }
  .autosearch-wrapper .search_query:focus {
    -webkit-box-shadow: inherit;
    box-shadow: inherit; }
.autosearch-wrapper .input-group {
  width: 100%;
  padding-right: 35px; }
  .rtl .autosearch-wrapper .input-group {
    padding-left: 35px;
    padding-right: inherit; }
.autosearch-wrapper .button-search {
  position: absolute;
  right: 0;
  line-height: 40px;
  top: 0;
  z-index: 10;
  border: 0;
  width: 40px;
  height: 40px;
  color: #FFFFFF;
  padding: 0;
  font-size: 18px;
  background-color: #f1f1f1; }
  .rtl .autosearch-wrapper .button-search {
    left: 0;
    right: auto; }
.autosearch-wrapper .dropdown-menu {
  z-index: 999;
  padding: 20px; }
  .autosearch-wrapper .dropdown-menu > li.clearfix {
    border-bottom: 1px dashed #ebebeb;
    margin-right: 10px; }
  .autosearch-wrapper .dropdown-menu > li:last-child {
    border-bottom: none; }
  .autosearch-wrapper .dropdown-menu > li > a {
    padding: 0; }
  .autosearch-wrapper .dropdown-menu > li .media-body {
    padding-left: 10px; }
    .rtl .autosearch-wrapper .dropdown-menu > li .media-body {
      padding-right: 10px;
      padding-left: inherit; }

.pavcarousel {
  margin-left: 200px; }
  .rtl .pavcarousel {
    margin-right: 200px;
    margin-left: inherit; }
  .pavcarousel .effect-carousel a img {
    margin: 0 auto;
    text-align: center;
    -webkit-transform: rotateY(0deg);
    -ms-transform: rotateY(0deg);
    -o-transform: rotateY(0deg);
    transform: rotateY(0deg);
    -webkit-transform-style: preserve-3d;
    -moz-transform-style: preserve-3d;
    -ms-transform-style: preserve-3d;
    -o-transform-style: preserve-3d;
    transform-style: preserve-3d;
    -webkit-transition: all 600ms ease-in-out 0s;
    -o-transition: all 600ms ease-in-out 0s;
    transition: all 600ms ease-in-out 0s; }
  .pavcarousel .effect-carousel a:hover img {
    -webkit-transform: rotateY(-180deg);
    -ms-transform: rotateY(-180deg);
    -o-transform: rotateY(-180deg);
    transform: rotateY(-180deg); }

.skin1 .home-banner-group .banner {

    background: #b70505;

    position: relative;

    overflow: hidden;



  }

  .skin1 .home-banner-group .banner:hover {

    background: #000;

    position: relative;

    overflow: hidden;



  }





.skin1 .home-banner-group .banner .footer-deals {

  color: white;

  text-align: center;



}



.skin1 .home-banner-group .banner .list-inline {

  padding: 0 0 0 0 !important;

  height: 1.5em;

}



/* podpurne*/

.white

{

  background: #fff;





}



.pattern {

  background: url('/image/catalog/protetovani/bg.jpg') top no-repeat;



}

.rounded{

  border-radius: 7px;



}



/*labelly*/

 .product-image .onhot, .product-image .onsale1,  .product-image .onsale2, .product-image .ondiscount {

  border-radius: 0;

  -webkit-border-radius: 0;

  -moz-border-radius: 0;

}



  .product-image .onsale1,   .product-image .onsale2, .product-image .onsale3, .product-image .onhot{

  line-height: 1;

  color: #fff;

  font-weight: 600;

  text-transform: uppercase;

  position: absolute;

  z-index: 1;

  border-radius: 4px;

  font-size: 0.7em;

  padding: 0.5833em 0.6333em;

}



  .product-image .ondiscount{

    line-height: 1;

    color: #000;

    font-weight: 600;

    text-transform: uppercase;

    position: absolute;

    z-index: 1;

    height: 40px;

    width: 40px;

    border-radius: 50%;

    font-size: 0.8571em;

    padding: 0.5833em 0.6333em;

    font-weight: bold;

  }

  .product-image .onhot {

    background: #62b959;

    left: 0.8em;

    top: 3em;

  }



  .product-icons ul.icons-list {

    display: flex;

    flex-direction: column;

}



  .product-icons li.onsale1.text  {

    position:relative;

    margin-bottom: 5px;

}





.product-icons li.onsale1.image {

  position:relative;

  padding: unset;



}



.product-image .ondiscount {

  background: #b9f005;

  right: 0.8em;

  bottom:0.8em;

  padding-top: 1.1em;

}





/* slideshow content top homepage */

div[id^="slideshow"] .owl-nav {

  width: 100%;

  top: 50%;

}



div[id^="slideshow"] .item div {

  background-position: center center;

  background-size: cover;

  display: block;

    border-radius: 0.5em;

    text-wrap: pretty;

    word-wrap: break-word;



}



div[id^="slideshow"] .owl-stage-outer {

  margin-right: 10px;

  margin-left: 10px;

}





div[id^="slideshow"] .owl-next, div[id^="slideshow"] .owl-prev {

  position: absolute;

}



div[id^="slideshow"] .owl-prev {

  margin-left: 15px;

  display:none;

}



div[id^="slideshow"] .owl-next {

  margin-right: 15px;

  display:none;

}







div[id^="slideshow"] .owl-prev, .owl-next {

  opacity: 1 !important;

}

.owl-carousel:active .owl-controls .owl-buttons .owl-prev {opacity: 1 !important;}

.owl-carousel:active .owl-controls .owl-buttons .owl-next {opacity: 1 !important;}







#banner-separator {

  background: transparent;

}



#banner-separator .item {

  text-align: center;

}



#banner-separator .item h2 {

  line-height: 1.2;

  font-size: 4.2857em;

  font-weight: 600;

  letter-spacing: -1px;

  margin: 0;

  text-transform: uppercase;

  color: white;

    top: 50%;

    position: absolute;

    left: 25%;

}



#banner-separator img.img-responsive{

    display: block;

    width: 100%;

    height: auto;

}

div#banner-separator.owl-loaded {

    display:block;

}





#banner-separator .item h4 {

  font-size: 1.5714em;

  font-weight: 300;

  margin: 0 0 14px 0;

  color: white;

    top: 60%;

    position: absolute;

    left: 25%;

}



/* Partners Carousel */

.brands-carousel-container {

	padding:0 20px;

}



.brands-carousel-container.no-padding {

	padding:0;

}



.brand a {

	display:block;

	transition: all 0.4s ease;

	-webkit-transition: all 0.4s ease;

	position: relative;

	text-align: center;

}



.owl-item .brand img {

	display:inline-block;

	max-width:none;

	width:100%;

	height: auto;

}



.brands-carousel-container .owl-carousel .owl-item .brand img {

	display:inline-block;

	max-width:100%;

	width:auto;

	height: auto;

}



.product-filter {

	padding: 0px;

	margin: 0px 0px 14px 0px;

}



	.product-filter .sort {

		padding: 0px 0px 0px 0px;

		float: left;

		width: auto;

		font-size: 13px;

	}



		.product-filter .sort select {

			margin: 0px 0px 0px 5px;

			width: auto;

			padding: 0px;

			position: relative;

			height: 26px;

			border: 1px solid #ccc;

			background: #fff;

		}



	.product-filter .pagination {

		float: right;

		clear: none;

		margin: 0px 0px -5px 0px;

		max-width: 350px;

	}



	.product-filter .limit {

		padding: 0px 0px 0px 15px;

		float: right;

		width: auto;

		font-size: 13px;

	}



		.product-filter .limit select {

			margin: 0px 4px 0px 5px;

			width: auto;

			padding: 0px;

			position: relative;

			height: 26px;

			border: 1px solid #ccc;

			background: #fff;

		}



	.product-filter .product-compare {

		float: left;

		width: auto;

		font-size: 13px;

		padding: 2px 0px 0px 15px;

	}



	.product-filter .options {

		float: left;

		width: auto;

		padding: 0px 0px 0px 12px;

	}



		.product-filter .options .button-group {

			float: left;

			width: auto;

		}



			.product-filter .options .button-group button {

				border: 1px solid #ccc;

				border-radius: 3px;

				color: #ccc;

				display: inline-block;

				font-family: "Elusive-Icons";

				width: 26px;

				height: 26px;

				line-height: 24px;

				margin-left: 3px;

				text-decoration: none;

				text-align: center;

				-webkit-transition: all 0.25s ease 0s;

				-moz-transition: all 0.25s ease 0s;

				transition: all 0.25s ease 0s;

				background: transparent;

				vertical-align: top;

				padding: 0px;

			}



				.product-filter .options .button-group button:hover,

				.product-filter .options .button-group .active {

					background:#b70505;

					color: #fff;

					border-color: #b70505;

				}



				#grid:before {

				    content: "\f20b";

				    font-size: 14px;

				}



				#list:before {

				    content: "\f20a";

				    font-size: 14px;

				}



	@media (max-width: 1024px) {



		.product-filter .product-compare {

			display: none;

		}



		.product-filter .limit {

			float: left;

		}

	}



  @media (max-width: 1200px) {

    .product-filter .pagination {

			clear: both;

			float: none;

			display: block;

			padding-top: 10px;

			margin-left: -5px;

			max-width: none;

		}

    .vertical ul.megamenu > li.click > a:before, .vertical ul.megamenu > li.hover > a:before {

      display: none;

    }



  }









  /* kategorie filtr submenu*/



.catlist {

 overflow-x:hidden;

 margin:0 0 50px;

}





.catlist .subC  {

 width:20%;

 float:left;

 display:block;

 text-decoration:none;

 -webkit-box-sizing:border-box;

 box-sizing:border-box;

 position:relative;

 padding:2px;

font-size: 1.2rem;

}



  @media (max-width: 992px) {

    .catlist .subC  {

     width:33.3%;

    }





  }





.catlist .subC .container {

 background:#f8f8f8;

 border:1px solid #efefef;

 border-bottom:2px solid #efefef;

 border-radius:5px;

 -webkit-border-radius:5px;

 -moz-border-radius:5px;

 width: 100%;

 display: block;

 padding: 0 5px 0 8px;

}



 .catlist .subC .container:hover

  {

 background:#e6e4e4;

}







.catlist .subCategories .container {

 -webkit-transition:all .2s ease-in-out;

 -moz-transition:all .2s ease-in-out;

 -o-transition:all .2s ease-in-out;

 transition:all .2s ease-in-out

}











/*.catlist .subC .img  {

 float:left;

 margin:7px 5px 6px 4px;

 height:32px;

 width:32px;

 display:block

}*/



.catlist .subC .name  {

 display:table-cell;

 vertical-align:middle;

 text-decoration:none;

 padding:0 15px 0 3px;

 font-weight:700;

 height:47px;

 line-height:1em;

 /*overflow:hidden;*/

 color:#6b6a6a;

 font-size: 1em;

}



/*sipky*/





@media (min-width: 767px) {

 .catlist .subC .container:before {

   color:#6b6a6a;

   text-decoration:none;

   display:inline-block;

   font:normal normal normal 14px/1 FontAwesome;

   font-size:inherit;

   text-rendering:auto;

   -webkit-font-smoothing:antialiased;

   -moz-osx-font-smoothing:grayscale;

   content:"\f0da";

   float: right;

   line-height:47px;

   margin-right:5px

  }

}



.alert {

  border: unset;

  margin: unset;

  border-radius: unset;

}



#mini-cart .dropdown-cart-content .table {

  border: unset;

}



#mini-cart .dropdown-cart-content .table tbody>tr>td {

  border: unset;

  vertical-align: middle;

}



#mini-cart .dropdown-cart-content .table .btn {

  background-color: #da4f49;

}



/* Studia */

#input-kraj, #search-studia input, #search-studia select {

  display: inline-block;

    padding: 0 5px;

    width: auto;

    text-transform: capitalize;

    background-color: #f7f7f7;

}



.product-block .image {

    position: relative;

    overflow: hidden;

    text-align: center;

    background-color: #fff;

    border: 1px solid #ccc;

  }



  #studios .product-block .bottom {

    position: absolute;

    top: 0;

    bottom: 0;

    left: 0;

    right: 0;

    width: 100%;

    height: 100%;

    background: #fffffff5;

    color: #fff;

    visibility: hidden;

    opacity: 0;

    display: flex;

    align-items: center;

    justify-content: center;



    /* transition effect. not necessary */

    transition: opacity .2s, visibility .2s;

  }



  #studios .product-block .kontakt {

    color: white;

    font-size: 20px;

    position: absolute;

    top: 50%;

    left: 50%;

    transform: translate(-50%, -50%);

    -ms-transform: translate(-50%, -50%);



  }



  #studios .product-block .image:hover .bottom {

    visibility: visible;

    opacity: 1;

  }



  .notification .gift {



	font-size: 15px



}



/* popup windows buy */



#notification {

  max-width: 500px;

  padding: 0;

  margin: auto;

  border-radius: .3em;

  box-shadow: 0 0.1em 0.4em rgba(0,0,0,.3);

  overflow: unset !important;

  background: white;

}



/*

.fancybox-opened .fancybox-skin {

    -webkit-box-shadow: 0 0 0 !important;

       -moz-box-shadow: 0 0 0 !important;

            box-shadow: 0 0 0 !important;

}



.fancybox-skin {background: transparent !important}





#notification {

    background-color: white;

    margin: auto;

    -webkit-border-radius: 4px;

    -moz-border-radius: 4px;

    border-radius: 4px;

    -webkit-box-shadow: 0 10px 25px rgba(0,0,0,.5);

    -moz-box-shadow: 0 10px 25px rgba(0,0,0,.5);

    box-shadow: 0 10px 25px rgba(0,0,0,.5);

    width: 476px;



}*/



#related{

  width: 50%;

  padding: 0px;

  margin: auto;

  overflow: unset !important;

  top: 20px;

  position: relative;

}



.padding-top {

    padding-top: 20px;

}



.related-container {

    padding: 15px;

    border-radius: .3em;

    /* box-shadow: 0 0.1em 0.4em rgba(0,0,0,.3); */

    background-color: white;

}



.notification-container {

  text-align: center;

}



#popup {

    background: transparent;

    overflow: unset;

}

.opened {display: block !important;}

.closed {display: none !important;}



.popup-close {

    right: unset !important;

    top: unset !important;

    position: unset !important;

    float: right;

    position: relative !important;

}



/* laptop */

@media screen and (min-width: 1024px) and (max-width: 1440) {

  .fb_iframe_widget iframe {

      position: relative;

      width: 100%;

      height: 100%;

  }

}



@media screen and (min-width: 320px) and (max-width: 1024px) {

  a.quickview-icon {

    display: hide !important;

  }



  h2.slider-title {

      text-align: center;

  }



  .auction .product {

    margin-bottom: 20px;

  }



  .widget .widget-title {

    text-align: center;

  }

  .post-item .post-excerpt {

    max-width: 100%;

  }



  .post-item{

    text-align: center;

  }

}



.live-search {

  min-width: 100%;

  position:absolute;

  z-index:1000;

  padding:5px 0px;

  background-color:#FFF;

  border: 1px solid #DDD;

  border-bottom-left-radius: 10px;

  border-bottom-right-radius: 10px;

  box-shadow: 0 2px 2px #DDDDDD;

  left: auto;

  right: 0;

  top: 100%;

  display:none;

}

.live-search .loading{

  display:block;

  margin-left:auto;

  margin-right:auto;

}

.live-search ul {

  list-style-type: none;

  margin:0px;

  padding:0px;

}

.live-search ul li {

  cursor:pointer;

  padding:5px;

  margin:0px 5px;

  background-color:#FFF;

  min-height:40px;

  clear:both;

}

.live-search ul li:nth-child(even) {

  background-color: #FFF;

}

.live-search ul li:hover {

  background-color:#F0F7FA;

}

.live-search ul li a{

  text-decoration: none;

  display:block;

}

.live-search ul li .product-image{

  float:left;

  margin-right:5px;

}



.live-search ul li .product-text{

  width: 85%;

  /* height: auto; */

  /* display: block; */

  float: right;

  margin: auto;

  /* position: relative; */

  }





.live-search ul li .product-name p{

  font-weight: normal;

  font-style: italic;

  font-size: 10px;

  color:#555555;

  margin:0px;

  padding:0px;

}

.live-search ul li .product-name{

  font-weight: bold;

  float: left;

  max-width:100%;

  margin-left: 15px;

  font-size: 12px;

}

.live-search ul li .product-price {

  text-align: right;

  font-size: 12px;

  font-weight: bold;

  float:right;

  /*width:25%;*/

}



.live-search ul li .product-price .price-special{

  color: #333333;

  display:block;



  font-size: 1.4286em;

  margin: -0.25em 0 0.75em;

  color: #444;

  line-height: 1;

  font-weight: 600;

}



.live-search ul li .product-price span.price{

  color: #333333;

  display:block;

  margin-top: 20px;

}

.live-search ul li .product-price .special{

  color: #FF0000;

  text-decoration: line-through;

  display:block;

}



.live-search .product-price > .special {

  margin-top: -5px;

}



.live-search .result-text{

  font-weight: bold;

  text-align: center;

  font-size: 11px;

  line-height: 20px;

  color:#555555;

  background-color:#e6ffff;

  position: absolute;

  bottom: 0;

  width: 100%;

  border-bottom-left-radius: 10px;

  border-bottom-right-radius: 10px;

}

.live-search .view-all-results:hover {

  color: #23527c;

}

.live-search .view-all-results {

  color: #23a1d1;

}



.category-block.vertical-align {

  display: flex;

  align-items: center;

  justify-content: center;

  flex-direction: row;

}

.quantity-adder .add-action {

    width: 38px;

    height: 17px;

    display: block;

    position: relative;

    cursor: pointer;

    font-size: 7px;

    line-height: 20px;

    text-align: center;

    background-color: #2f2f2f;

    color: #FFFFFF;

}



.quantity-adder .add-up {

  margin-bottom: 1px;

}



.quantity-adder .quantity-number {

  width: 70%;

  display: inline-block;

  float:left;

  border-radius: unset;

}



.quantity-adder .quantity-title {

  margin-right: 20px;

  line-height: 34px;

}

















.quantity  .quantity-number {

    font-size: 14px !important;

    line-height: 1.42857;

    color: rgb(85, 85, 85);

    background-color: rgb(255, 255, 255);

    background-image: none;

    box-shadow: rgba(0, 0, 0, 0.0745098) 0px 1px 1px inset;

    padding: 6px 12px;

    border-width: 1px;

    border-style: solid;

    border-color: rgb(204, 204, 204);

    border-image: initial;

    transition: border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;

    text-align: center;

    width: 2.5em;

    height: 2.7143em;

    padding-left: 0px;

    padding-right: 0px;

    vertical-align: middle;

    display: inline-block;

    border-radius: 3px !important;

}



.quantity .add-up {

    display: block;

    position: absolute;

    top: 1px;

    right: 18px;

    text-align: center;

    display: block;

    padding: 0 0 0 1px;

    border-radius: 3px;

    margin-bottom: 5px;

    border: 1px solid #ccc;

    font-size: 9px;

    font-weight: normal;

    width: 15px;

    height: 16px;

    line-height: 14px;

}



.quantity .add-down {

    display: block;

    position: absolute;

    top: 22px;

    right: 18px;

    text-align: center;

    display: block;

    padding: 0 0 0 1px;

    border-radius: 3px;

    border: 1px solid #ccc;

    font-size: 9px;

    font-weight: normal;

    width: 15px;

    height: 16px;

    line-height: 16px;

}



 .update_post  {



    min-height: 50vh;

}



.product-info #tab-description h1 {



    font-size: 24px;

    margin-top: 0;

    margin: unset;

}



.product-info #tab-description p {



    margin: unset;

}





/* =============================================

-------------------  1.General ---------------

==============================================*/

/* Overwrite bootstrap values */

@media (min-width: 1440px){

	.container {

	    width: 1418px;

	}

}

header {

	position: relative;

	/*background-color: #9ac93d;*/

	color: #888;

}

nav#top {

	position: relative;

	z-index: 1;

	font-size: 0.7857em;

	background-color: #950707;

}





.container-fluid {

	padding:0 30px;

}

.row {

	margin-left:-10px;

	margin-right:-10px;

}



.row.row-lg {

	margin-left:-15px;

	margin-right: -15px;

}



.col-xs-1, .col-sm-1, .col-md-1, .col-lg-1, .col-xs-2, .col-sm-2, .col-sm-25, .col-md-2, .col-lg-2, .col-xs-3, .col-sm-3, .col-md-3, .col-lg-3, .col-xs-4, .col-sm-4, .col-md-4, .col-lg-4, .col-xs-5, .col-sm-5, .col-md-5, .col-lg-5, .col-xs-6, .col-sm-6, .col-md-6, .col-lg-6, .col-xs-7, .col-sm-7, .col-md-7, .col-lg-7, .col-xs-8, .col-sm-8, .col-md-8, .col-lg-8, .col-xs-9, .col-sm-9, .col-md-9, .col-lg-9, .col-xs-10, .col-sm-10, .col-md-10, .col-lg-10, .col-xs-11, .col-sm-11, .col-md-11, .col-lg-11, .col-xs-12, .col-sm-12, .col-md-12, .col-lg-12 {

  padding-right: 10px;

  padding-left: 10px;

}



[class^="col-"].padding-lg {

	padding:0 15px;

}



#wrapper.boxed.boxed-short .row {

	margin-left:-8px;

	margin-right:-8px;

}



#wrapper.boxed.boxed-short [class^="col-"] {

  padding-right: 8px;

  padding-left: 8px;

}





/* fix outlines on focus */

*:focus {

	outline:none;

}



html {

	min-height:100%;

}



body {

	font: 400 14px/22px "Open Sans", Arial, sans-serif;

	color: #333;

	background-color: #fff;

	-webkit-font-smoothing: antialiased;

    -moz-osx-font-smoothing: grayscale;

    overflow-x:hidden;

}



body.index5 {

	background-color: #e6e6e3;

	background-image: url('../images/body_bg.png');

	background-repeat: repeat-x;

	background-size: auto;

	background-position: center top;

}



body.index9 {

	background-color: #f5f5f5;

}



@media (min-width: 1320px) {

	.skin13 .container {

		width:1280px;

	}

}



#wrapper {

	width: 100%;

	position: relative;

}



#wrapper.boxed,

#wrapper.boxed-long {

	width:100%;

	margin:0;

}



@media (min-width: 768px) {



	#wrapper.boxed {

		width: 750px;

		margin: 26px auto;

	}



	#wrapper.boxed-long {

		width:750px;

		margin:0 auto;

	}

}



@media (min-width: 992px) {



	#wrapper.boxed {

		width: 970px;

		margin: 32px auto;

	}



	#wrapper.boxed-long,

	.custom-wrapper.boxed-long,

	.boxed .sticky-menu.fixed .container,

	.boxed-long .sticky-menu.fixed .container {

		width:970px;

		margin:0 auto;

	}



	.custom-wrapper {

		padding-top:22px;

	}



	#wrapper.boxed.boxed-short,

	#wrapper.boxed.boxed-short .container {

		width:940px;

		margin:0 auto;

	}

}



@media (min-width: 1054px) {

	#wrapper.boxed.boxed-short,

	#wrapper.boxed.boxed-short .container {

		width:994px;

		margin:0 auto;

	}

}



@media (min-width: 991px) {

	#wrapper.boxed.boxed-short .main-content .container,

	#wrapper.boxed.boxed-short header .container,

	#wrapper.boxed.boxed-short .page-top .container {

		padding: 0px;

	}

}



@media (min-width: 991px) {

	#wrapper.boxed-long .main-content .container {

		padding: 0px;

	}

}



@media (min-width: 1200px) {



	#wrapper.boxed {

		width:1170px;

	}



	#wrapper.boxed-long,

	.custom-wrapper.boxed-long,

	.boxed .sticky-menu.fixed .container,

	.boxed-long .sticky-menu.fixed .container {

		width:1170px;

	}

}



::selection {

    background-color: #9ac93d;

    color: #fff;

}



::-moz-selection {

	background-color: #9ac93d;

    color: #fff;

}



h1,.h1,

h2,.h2,

h3,.h3,

h4,.h4,

h5,.h5,

h6,.h6 {

    font-weight: 200;

    letter-spacing: normal;

	color:#0e0e0e;

	margin:0 0 14px;

}



h1,

.h1 {

    font-size: 2.4em;

    line-height: 44px;

    margin: 0 0 44px;

    letter-spacing: -1px;

}



h2,

.h2 {

    font-size: 1.7em;

    font-weight: 300;

    line-height: 42px;

    margin: 0 0 20px;

    letter-spacing: -1px;

}



h3,

.h3 {

    font-size: 1.4em;

    font-weight: 400;

    line-height: 24px;

    margin: 0 0 20px;

}



h4,

.h4 {

    font-size: 1.2em;

    font-weight: 400;

    line-height: 27px;

}



h5,

.h5 {

    font-size: 1em;

    font-weight: 600;

    line-height: 18px;

}



h6,

.h6 {

    font-size: 1em;

    font-weight: 400;

    line-height: 18px;

    margin-bottom:14px;

}



h1.big {

    font-size: 4.2em;

    line-height: 54px;

}



@media (max-width: 767px) {

    h1.big {

        font-size: 3.2em;

        line-height: 42px;

    }

}



h1.short {

    margin-bottom: 15px;

}



h2.short {

    margin-bottom: 15px;

}



h3.short, h4.short, h5.short, h6.short {

    margin-bottom: 9px;

}



h1.text-shadow,

h2.text-shadow,

h3.text-shadow,

h4.text-shadow,

h5.text-shadow,

h6.text-shadow {

    text-shadow: 1px 1px 0 rgba(0, 0, 0, 0.2);

}



ul,ol {

	list-style-type:square;

	margin:0 0 25px;

}



p {

	line-height: 24px;

	margin: 0 0 20px;

}



.lead {

	font-size: 16px;

	font-weight: 400;

}



@media (min-width: 768px) {

	.lead {

		font-size: 16px;

	}

}



a,

a:hover,

a:focus {

    color: #777;

    cursor: pointer;

}



a:active,

a:hover,

a:focus {

	text-decoration:none;

	color: #9ac93d;

}



a.thumbnail.active, a.thumbnail:focus, a.thumbnail:hover {

	text-decoration:none;

	color: #9ac93d !important;

}



a:active,

a:focus,

input,

select,

textarea {

	outline:none;

}



iframe {

	border:none;

}



select {

    padding: 6px 0 6px 2px;

}



textarea {

    resize: vertical;

}



form label {

    font-weight: normal;

}



img.pull-right {

	margin: 7px 0 7px 24px;

}



img.pull-left {

	margin: 7px 24px 7px 0;

}



hr {

	background-image: - webkit-linear-gradient(left, transparent, rgba(0, 0, 0, 0.2), transparent);

	background-image: linear-gradient(to right, transparent, rgba(0, 0, 0, 0.2), transparent);

	border: 0;

	height: 1px;

	margin: 22px 0;

}



.widget-block hr {

	margin: 35px 0;

}



blockquote {

	position: relative;

	padding: 10px 20px;

	margin: 0 0 20px;

	font-size: 1em;

	border-left: 5px solid #eee;

}





/* =============================================

----------------- 2.Helper Classes -------------

==============================================*/



.xss-margin,

.xs-margin,

.sm-margin,

.md-margin,

.lg-margin,

.xlg-margin,

.md-margin2x,

.lg-margin2x,

.xlg-margin2x,

.md-margin3x,

.lg-margin3x,

.xlg-margin3x {

	min-height:1px;

}



.xss-margin {

	margin-bottom:5px;

}



.xs-margin {

	margin-bottom:10px;

}



.xs-margin.half {

	margin-bottom:15px;

}



.sm-margin {

	margin-bottom:20px;

}



.sm-margin.half {

	margin-bottom:25px;

}



.md-margin {

	margin-bottom:30px;

}



.md-margin.half {

	margin-bottom:35px;

}



.lg-margin {

	margin-bottom:40px;

}



.lg-margin.half {

	margin-bottom:45px;

}



.xlg-margin {

	margin-bottom:50px;

}



.xlg-margin.half {

	margin-bottom:55px;

}



.md-margin2x {

	margin-bottom:60px;

}



.md-margin2x.quarter {

	margin-bottom:65px;

}



.md-margin2x.half {

	margin-bottom:70px;

}



.lg-margin2x {

	margin-bottom:80px;

}



.xlg-margin2x {

	margin-bottom:100px;

}



.xlg-margin2x.half {

	margin-bottom:110px;

}



.md-margin3x {

	margin-bottom:90px;

}



.lg-margin3x {

	margin-bottom:120px;

}



.xlg-margin3x {

	margin-bottom:150px;

}



.clear-margin {

	margin:0 !important;

}



@media (max-width: 580px) {

	.nav-mini .hidden-xss {

		display:none;

	}

}



@media (max-width: 480px) {

	.hidden-xss {

		display:none !important;

	}

	/* helper grid class*/

	.col-xss-12 {

		float:none !important;

		width:100% !important;

	}



	.col-xss-6 {

		width:50% !important;

	}

}



@media (max-width: 300px) {

	.col-xss-6 {

		float:none !important;

		width:100% !important;

	}

}







/* =============================================

---------  4.Mobile Nav + Header/Menu  ---------

==============================================*/



#mobile-menu {

	position: fixed;

	left:-250px;

	top:0;

	bottom:0;

	background-color: #1e1e1e;

	width:250px;

	z-index:1600;

	color:#fff;

	transition: all 0.3s ease-in-out 0s;

	-webkit-transition: all 0.3s ease-in-out 0s;

	visibility: hidden;

    font-size: 0.9em;

    overflow-x: hidden;

    overflow-y: scroll;

}



body.opened-menu #mobile-menu {

	left:0;

	visibility: visible;

}



 #main-content {

	position: relative;

	left:0;

	right: 0;

	transition: all 0.3s ease-in-out 0s;

	-webkit-transition: all 0.3s ease-in-out 0s;

}

body.opened-menu #main-content {

	position: relative;

	left:250px;

}



#mobile-menu-overlay {

	position: fixed;

	right:0;

	left:0;

	top:0;

	bottom:0;

	background-color: rgba(0,0,0, 0.35);

	z-index:1550;

	cursor:pointer;

	transition: opacity 0.2s ease-in-out 0s;

	-webkit-transition:opacity 0.2s ease-in-out 0s;

	opacity:0;

	visibility: hidden;

}



body.opened-menu #mobile-menu-overlay  {

	opacity:1;

	visibility: visible;

}



#mobile-menu .welcome-msg {

	color:#fff;

    text-align: center;

    display: block;

    margin: 15px 0;

    padding: 0 10px;

}



#mobile-menu .menu-wrap {

    margin: 20px 0;

    padding: 0 10px;

}



#mobile-menu .accordion-menu {

	font-size:0.8571em;

	margin:0;

}



/* Mobile Menu */

#mobile-menu .mobile-menu.accordion-menu {

	font-size:1em;

}



.accordion-menu li {

	line-height: 24px;

}



.accordion-menu > li {

	position: relative;

}



.accordion-menu li a {

    position: relative;

    display: block;

    outline: medium none;

    text-decoration: none;

    margin: 1px 0 0;

    padding: 5px 6px;

    line-height: 25px;

    font-weight: 400;

    -webkit-transition: all 0.25s ease 0s;

    -moz-transition: all 0.25s ease 0s;

    transition: all 0.25s ease 0s;

    color:#fff;

}



.accordion-menu li.open > a,

.accordion-menu li > a:hover {

	background-color: #2b2b2b;

}



.accordion-menu > li > a {

	padding-right: 33px;

}



.accordion-menu li a img {

	display: inline-block;

	margin: 7px 4px 0px 0px;

	vertical-align: top;

}



.accordion-menu .arrow {

    border-radius: 3px;

    position: absolute;

    top: 6px;

    right: 0;

    width: 25px;

    height: 25px;

    cursor: pointer;

    text-align: center;

    font-family: "FontAwesome";

    line-height: 25px;

    vertical-align: top;

    -webkit-transition: all 0.25s ease 0s;

    transition: all 0.25s ease 0s;

    color:#fff;

}



.accordion-menu .arrow:before {

    content: "\f067";

}



.accordion-menu .open > a > .arrow:before {

    content: "\f068";

}



.accordion-menu ul {

	display: none;

	padding-left:10px;

}



@media (max-width: 767px) {

	.container {

		width: 100%;

	}

}





/* Header */

#header {

	position: relative;

/*	background-color: #9ac93d;*/

	color:#777;

}



#header.header-absolute {

	position: absolute;

	top:0;

	left:0;

	right:0;

	background-color: transparent;

	z-index:1030;

	border-bottom:none;

}





#header #header-top .container,

#header #header-inner .container {

    position: relative;

    display: table;

}



.skin17 #header #header-inner .container {

	width:100%;

	padding:12px 30px 12px 45px;

}



#header #header-top .container > div,

#header #header-inner .container > div,

#header #header-inner .container-fluid > div {

    display: table-cell;

    position: relative;

    vertical-align: middle;

}





#header .header-left {

    text-align: left;

}



#header .header-center {

    text-align: left;

}



#header .header-right {

    text-align: right;

}



#header #header-inner .container {

    min-height: 68px;

}





#header #header-inner .container .header-left {

    padding: 30px 0;

}



@media (max-width: 1199px) {

    #header #header-inner .container .header-left {

        padding-top: 25px;

        padding-bottom: 25px;

    }

}



@media (max-width: 767px) {

    #header #header-inner .container .header-left {

        padding-top: 15px;

        padding-bottom: 15px;

        display: inline-block;

    }

}



#header #header-inner .container .header-center {

    padding: 30px 40px;

}



@media (max-width: 1199px) {

    #header #header-inner .container .header-center {

        padding-top: 25px;

        padding-bottom: 25px;

    }

}



@media (max-width: 767px) {

    #header #header-inner .container .header-center {

        padding-top: 15px;

        padding-bottom: 15px;

        display: inline-block;

    }

}



#header #header-inner .container .header-right {

    padding: 30px 0;

}



@media (max-width: 1199px) {

    #header #header-inner .container .header-right {

        padding-top: 25px;

        padding-bottom: 25px;

    }

}

@media (max-width: 767px) {

    #header #header-inner .container .header-right {

        padding-top: 15px;

        padding-bottom: 15px;

    }

}



#header #header-top {

    position: relative;

    z-index: 1;

   /* background-color:#d94f19;*/



}



#header .separator {

	margin:0 8px;

	font-weight: 300;

}



#header .currency-switcher,

#header .view-switcher,

#header .top-links {

    font-size: 0.7857em;

    display: inline-block;

    vertical-align: middle;

    margin: 3px 0;

}



#header #header-top .currency-switcher,

#header #header-top .view-switcher,

#header #header-top .top-links {

	margin:0;

	font-size:1em;

}



#header .currency-switcher li,

#header .view-switcher li {

	position: relative;

	display: inline-block;

	line-height: 24px;

}



#header .currency-switcher > li,

#header .view-switcher > li,

#header .top-links > li {

	float:left;

}



#header .view-switcher img{

	display: inline-block;

	margin: 7px 3px 0 0;

	vertical-align: top;

}



.header_10 .view-switcher ul img {

	margin-top: 3px;

}



#header .currency-switcher a,

#header .view-switcher a,

#header .top-links a {

	color:#333;

}



#header .top-links a:hover {

	color:#eee;

}



#header .currency-switcher li > a > i,

#header .view-switcher li > a > i {

	margin:1px 0 -1px 5px;

}



#header .welcome-msg {

    display: inline-block;

    vertical-align: middle;

}



#header #header-top .welcome-msg {

	line-height: 36px;

}



#header .switcher-wrap {

    display: inline-block;

    white-space: nowrap;

}



#header .switcher-wrap ul:first-child {

    margin-left: 0;

}



#header .currency-switcher,

#header .view-switcher,

#header .top-links {

    font-size: 0.7857em;

    display: inline-block;

    vertical-align: middle;

    margin: 3px 0;

}



#header .currency-switcher li > ul,

#header .view-switcher li > ul {

	display:none;

	position: absolute;

	left:0;

	top:100%;

	z-index: 900;

	padding:5px;

	background-color: #fff;

	min-width: 94px;

	border-radius: 0 0 6px 6px;

    border:1px solid #ccc;

}



#header .currency-switcher li:hover > ul,

#header .view-switcher li:hover > ul {

	display: block;

}





#header .currency-switcher li li,

#header .view-switcher li li {

	display: block;

}



#header .currency-switcher li:hover > a,

#header .view-switcher li:hover > a {

	background-color: #9ac93d;

	color:#fff;



}



#header .currency-switcher li ul a,

#header .view-switcher li ul a {

	display: inline-block;

	font-size: 1em;

    padding: 0 7px;

    line-height: 25px;

    border-bottom-width: 0;

    text-transform: uppercase;



}



#header .currency-switcher li li:hover > a,

#header .view-switcher li li:hover > a {

	background-color: #9ac93d;

	color:#fff;



}





#header .top-links > li:after {

    content: "|";

    font-weight: 300;

    position: relative;

    top: -1px;

    margin: 0 2px 0 4px;

}



#header .top-links > li:last-child:after {

    display: none;

}



#header .currency-switcher > li + li,

#header .view-switcher > li+ li,

#header .top-links > li + li {

    margin-left: 0;

}



#header .currency-switcher > li > a,

#header .view-switcher > li > a,

#header .top-links > li > a {

	display: inline-block;

    font-size: 1em;

    font-weight: normal;

    padding: 0 5px;

    border-radius: 4px;

    line-height: 26px;

    text-transform: uppercase;

}





#header .currency-switcher,

#header .view-switcher {

    margin-left: 11px;

}



#header .top-links {

    white-space: nowrap;

}



@media (max-width: 991px) {

    #header .top-links:not(.visible-top-links) {

        display: none;

    }

}



#header .top-links > li {

    display: inline-block;

    margin-left: -2px;

    float: none;

}



#header .top-links > li.active > a,

#header .top-links > li:hover > a,

#header .top-links > li.active > h5,

#header .top-links > li:hover > h5 {

    background: transparent;

    color:#84ac34;

}





#header #header-top .currency-switcher > li > a,

#header #header-top .view-switcher > li > a,

#header #header-top .top-links > li > a {

    padding-top: 5px !important;

    padding-bottom: 5px !important;

    border-radius: 0 !important;

}



@media (max-width: 1199px) {

    #header #header-top .currency-switcher > li > a,

    #header #header-top .view-switcher > li > a,

    #header #header-top .top-links > li > a {

        padding-top: 3px !important;

        padding-bottom: 3px !important;

    }

}



#header #header-top .welcome-msg {

    line-height: 36px;

}



@media (max-width: 1199px) {

    #header #header-top .welcome-msg {

        line-height: 32px;

    }

}



.logo {

	width: 150px;

	margin:0;

}



@media (max-width: 480px) {

    #header .logo {

        text-align: center;

        margin: -15px 0 0;

    }

}



#header .logo a {

    display: inline-block;

    max-width: 100%;

}



#header .logo img {

    display: inline-block;

    color: transparent;

    max-width: 100%;

    -webkit-transition: all 0.2s ease 0s;

    transition: all 0.2s ease 0s;

    min-width: 110px;

    -webkit-transform-origin: 0 center;

    transform-origin: 0 center;

}



@media (max-width: 480px) {

    #header .logo img {

        max-width: 200px;

    }

}



#header #header-inner .header-minicart {

	position: relative;

	padding-right: 60px;

}



#header #header-inner .header-contact {

	color:#fff;

    margin: 0px 20px 0px 0px;

    display: inline-block;

    vertical-align: middle;

    white-space: nowrap;

}



#header .header-contact i {

	display: inline-block;

	margin:0 5px;

}



#header #header-inner .header-contact .separator {

	margin:0 11px;

}



#header #header-inner .header-contact a {

	color:#fff;

	font-size:0.8571em;

}



#header #header-inner .header-contact a:hover  {

	color:#eee;

}



#mini-cart {

    display: inline-block;

    vertical-align: middle;

    position: absolute;

    top: 50%;

    bottom: 50%;

    right: 0;

    height: 44px;

    margin: -22px auto;

}



#mini-cart .cart-head {

    position: relative;

    cursor: pointer;

    margin-top: 0;

    min-width: 50px;

    text-align: center;

}





#mini-cart .minicart-icon {

    font-size: 60px;

    top:-10px;

    display: inline-block;

    color:  #9ac93d;;

	position: relative;

}



#mini-cart .cart-items {

    position: absolute;

    font-size: 11px;

    font-weight: 600;

    color: #fff;

    bottom: 0px;

    left: 0;

    right: 0;

    top: 10px;

    text-align: center;

    display: inline-block;

    color:#fff;

}

#mini-cart .cart-price {

  position: absolute;

  font-size: 13px;

  font-weight: 600;

  color: #fff;

  bottom: 0px;

  left: 0px;

  right: 0;

  top: 25px;

  text-align: center;

  display: inline-block;

  color:#000;

}



#mini-cart.dropdown .dropdown-menu {

    width: 640px;

    -webkit-backface-visibility: hidden;

    -moz-backface-visibility: hidden;

    left: auto;

    right: 0;

    padding: 0;

    font-size: 1em;

    border-radius: 0px;

    border: none;

    border-top: 1px solid #cacaca;

    box-shadow: 0 2px 3px rgba(0, 0, 0, 0.15);

}



#mini-cart.dropdown:hover .dropdown-menu {

	display: block;

}



#mini-cart.dropdown .dropdown-menu ul {

	margin-bottom: 0;

}



#mini-cart.dropdown .dropdown-menu ul li.empty {

	padding:10px 0;

	text-align: center;

}



@media (max-width: 767px) {

    #mini-cart.dropdown .dropdown-menu {

        width: 490px;

    }

}



@media (max-width: 600px) {

    #mini-cart.dropdown .dropdown-menu {

        width: 290px;

    }

}

#mini-cart.dropdown .dropdown-menu:before {

    content: '';

    position: absolute;

    top: 0px;

    right: 17px;

    border-left: 0px solid transparent !important;

    border-right: 0px solid transparent !important;

    border-bottom: 0px solid #950707;

}



#mini-cart.dropdown .dropdown-menu:after {

    content: '';

    position: absolute;

    top: -17px;

    right: 0;

    left: 0;

    display: block;

    height: 17px;

}



.header-minicart-box #mini-cart.dropdown .dropdown-menu:before {

    right: 25px;

}



#mini-cart .dropdown-cart-content {

    background: #fff;

    color: #777;

    border-radius: 0px;

    margin-top: 0px;

    padding: 15px;

}





#header .searchform {

    border: 1px solid #9ac93d;

    border-radius: 20px;

    position: relative;

    display: inline-block;

    line-height: 40px;

    font-size: 13px;

    padding: 0;

    vertical-align: middle;

    width: 468px;

	background-color: #9ac93d;

}



#header .searchform:before,

#header .searchform:after {

    content: " ";

    display: table;

}



#header .searchform:after {

    clear: both;

}



#header .searchform:before {

    content: "";

    display: none;

    position: absolute;

    left: 27px;

    top: -23px;

    width: 22px;

    height: 22px;

    border: 11px solid transparent;

    border-bottom-color: inherit;

}



#header .searchform fieldset {

    padding:0;

    margin:0 -2px 0 0;

    border:0;

    min-width: 0;

}



@media (max-width: 1199px) {

    #header .searchform {

        width: 368px;

    }

}



@media (max-width: 991px) {

    #header .searchform {

        border-width: 5px;

        border-radius: 25px;

        width: 378px;

        display: none;

        position: absolute;

        left: -30px;

        top: 35px;

        z-index: 111;

        box-shadow: 0 2px 3px rgba(0, 0, 0, 0.15);

    }



    #header .searchform:before {

        display: block;

    }

}



#header .searchform .text,

#header .searchform .cat,

#header .searchform .button-wrap {

	float: left;

	display: inline-block;

}



#header .searchform input,

#header .searchform select,

#header .searchform button {

    background: transparent;

    border-radius: 0;

    float: left;

    color: #fff;

    border: none;

    height: 40px;

    line-height: 40px;

    outline: none;

    box-shadow: none;

    margin-bottom: 0;

}



#header .searchform input {

    padding: 0 15px 0 20px;

    border-radius: 20px 0 0 20px;

    width: 400px;

}



#header .searchform input::-webkit-input-placeholder { /* WebKit, Blink, Edge */

    color:    #fff;

}

#header .searchform input:-moz-placeholder { /* Mozilla Firefox 4 to 18 */

   color:    #fff;

   opacity:  1;

}

#header .searchform input::-moz-placeholder { /* Mozilla Firefox 19+ */

   color:    #fff;

   opacity:  1;

}

#header .searchform input:-ms-input-placeholder { /* Internet Explorer 10-11 */

   color:    #fff;

}



@media (max-width: 1199px) {

    #header .searchform input {

        width: 320px;

    }

}



@media (max-width: 1199px) {

    #header .searchform input {

        /* width: 190px; */

    }

}



#header .searchform button {

    font-size: 14px;

    padding: 0 20px 0 13px;

    border-radius: 0 20px 20px 0;

    text-shadow: none;

    color:#fff;

}



#header .searchform select {

    padding: 0 0 0 10px;

    width: 130px;

    -moz-appearance: none;

    -webkit-appearance: none;

}



#header .searchform select option {

    background: #fff;

    color: #777;

}



#header .searchform input,

#header .searchform select {

    border-right: 1px solid #fff;

}





#header .searchform-popup {

    display: inline-block;

    position: relative;

}



#header .searchform-popup .search-toggle {

    cursor: pointer;

    display: none;

    width: 30px;

    height: 30px;

    line-height: 30px;

    text-align: center;

    position: relative;

    z-index: 112;

    color:#84ac34;

}

@media (max-width: 991px) {

    #header .searchform-popup .search-toggle {

        display: block;

    }

}



#header .searchform.opened {

	display: block !important;

	border-color:#cccccc;

}



#header .show-menu-search .searchform-popup {

    position: absolute;

    left: 0;

    top: 0;

    bottom: 0;

    height: 30px;

    margin: auto;

}



@media (max-width: 991px) {

    #header .show-menu-search .searchform-popup {

        position: relative;

        left: 0;

    }

}



#header .mobile-toggle {

	color:#84ac34;;

    cursor: pointer;

    width: 30px;

    height: 30px;

    line-height: 30px;

    text-align: center;

    display: none;

}



@media (max-width: 991px) {

    #header .mobile-toggle {

        display: inline-block;

    }

}



@media (max-width: 480px) {

    #header .mobile-toggle {

        position: absolute;

        left: 15px;

        top: 6px;

    }

}





@media (max-width: 480px) {

    #header #header-inner .container {

        display: block;

        padding-top: 28px;

        padding-bottom: 15px;

        min-height: 43px;

    }

    #header #header-inner .container > * {

        display: inline !important;

        padding: 0 !important;

        position: static !important;

    }



    #header .searchform-popup {

        position: absolute;

        left: 45px;

        top: 6px;

        bottom: auto;

    }



    #header .searchform {

    	width:288px;

    	border-width: 3px;

    }



    #header .searchform select {

    	width:116px;

    	padding:0 0 0 5px;

    }



	#header .searchform:before {

        width: 14px;

        border-width: 7px;

        left: 34px;

        right: auto;

        top: -23px;

	}



    #header .searchform input {

    	width:120px;

    	padding:0 15px;

    }



    #header #mini-cart {

    	background-color: #930000;

        font-size: 0.8462em;

        width: auto;

        height: auto;

        position: absolute;

        right: 15px;

        top: 9px;

        bottom: auto;

        margin: 0;

        border-radius: 4px;

        border-width: 0;

    }



    #header #mini-cart .minicart-icon {

        font-size: 1.2727em;

        vertical-align: baseline;

				display: none;

    }



    #header #mini-cart .cart-head {

        padding: 0 10px;

        line-height: 26px;

        height: 26px;

        margin: 0;

        white-space: nowrap;

    }



    #header #mini-cart .cart-items {

        font-size: 1em;

        margin-left: 3px;

        position: relative;

        top: -3px;

        vertical-align: middle;

        color:#fff;

    }



    #header #mini-cart.dropdown .dropdown-menu {

        margin-top: 8px;

        font-size:14px;

    }



    #header #mini-cart.dropdown .dropdown-menu:before {

        right: 18px;

    }

}



/* Header2 - index3.html*/

#header.fixed-header{

	position: relative;

	left:0;

	top:0;

	right:0;

	z-index: 999;

}



#header.fixed-header .sub-menu {

	display: block !important;

}



.common-home #header.fixed-header{

	position: fixed;

	left:0;

	top:0;

	right:0;

	z-index: 999;

}





#header.header2 {

	background-color: #1e1e1e;

}



.common-home #header.header2 {

	background: rgba(0,0,0,.5);

}



#header.fixed-header #header-inner .container > div {

	padding-top:15px;

	padding-bottom: 15px;

}



@media (max-width: 767px) {

	#header.fixed-header #header-inner .container > div {

		padding-top:8px;

		padding-bottom: 8px;

	}

}



#header.header2 #header-inner .container .header-center {

	position: static;

}



#header.header2 .menu {

	position: static;

	vertical-align: middle;

}



@media (min-width: 992px) {

	#header.header2 #header-center-wrapper {

		display: inline-block;

		white-space: nowrap;

	}

}



.header2 .menu > li.open > a > i,

.header2 .menu > li.active > a > i{

	color:#fff;

}



.header2 .menu > li.open > a,

.header2 .menu > li.active > a {

	background-color: #000;

	color:#fff;

}



.header2 .menu > li > a {

	padding:9px 12px 8px;

	border-radius: 4px;

}



@media (max-width: 1199px) {

	.header2 .menu > li > a {

		padding:9px 9px 8px;

	}



}



.header2 .menu ul,

.header2 .menu .megamenu {

	border-color: #000;

}



.header2 .menu .megamenu-container .megamenu {

	left:15px;

	right:15px;

	width:auto;

	top:auto;

}



.header2 .menu > li > a > .tip {

	top:-9px;

	right:10px;

}



.block-nowrap {

	display: inline-block;

	white-space: nowrap;

}



#header.header2 .search-toggle {

	display:inline-block;

}



#header.header2 .searchform {

	position: absolute;

	display: none;

	border-color:#cccccc;

	border-width: 5px;

	left:auto;

	right:-27px;

	background-color: #fff;

	z-index: 900;

}



#header.header2 .searchform input,

#header.header2 .searchform select,

#header.header2 .searchform button  {

	color:#999;

	border-color:#ccc;

}



#header.header2 .searchform button:hover {

	color:#3b3b3b;

}



#header.header2 .searchform {

	width:378px;

}



@media (min-width: 1200px) {

	#header.header2 .searchform {

		width:478px;

	}

}



@media (max-width: 767px) {

	#header.header2 .searchform {

		width:380px;

	}

}



#header.header2 .searchform:before {

	display: block;

	left:auto;

	right:27px;

}



@media (max-width: 480px) {



	.header-minicart-inline {

		line-height: 1;height: 0;

	}

	#header.header2 .searchform {

		right:auto;

		left:-27px;

		width:290px;

	}





	#header.header2 .searchform:before {

		right:auto;

		left:27px;

	}

}



#mini-cart.minicart-inline {

	background-color: #000 !important;

    font-size: 0.7857em;

    width: auto;

    height: auto;

    position: relative;

    top: auto;

    bottom: auto;

    margin: 3px 0 3px 7px;

    border-radius: 4px;

}



#mini-cart.minicart-inline .minicart-icon {

    font-size: 1.2727em;

    vertical-align: top;

}



#mini-cart.minicart-inline .cart-items {

    font-size: 1em;

    margin-left: 3px;

    position: relative;

    top: -1px;

}



#mini-cart.minicart-inline .cart-head {

    padding: 0 10px;

    line-height: 26px;

    height: 26px;

    white-space: nowrap;

    margin-top: 1px;

    margin-bottom: -1px;

}



#mini-cart.minicart-inline .dropdown-menu {

	border-color:#000;

	margin-top:8px;

	font-size: 14px;

}



#mini-cart.minicart-inline .cart-items {

	color:#fff;

}



#mini-cart.dropdown.minicart-inline .dropdown-menu:before {

	border-bottom-color:#000;

}



#header.header2 .view-switcher {

	margin-left:8px;

}



#header.header2 .currency-switcher,

#header.header2 .view-switcher {

	text-align: left;

}



#header.header2 .currency-switcher > li > a,

#header.header2 .view-switcher > li > a {

	border-radius: 4px 4px 0 0;

	background-color: #000;

}



#header.header2 .currency-switcher > li:hover > a,

#header.header2 .view-switcher > li:hover > a,

#header.header2 .currency-switcher li > ul,

#header.header2 .view-switcher li > ul,

#header.header2 .view-switcher > li li:hover > a,

#header.header2 .currency-switcher > li li:hover > a {

	background-color: #000;

}



/* Header3 - index4.html*/

#header.header3 {

	background-color: #fff;

	border-top:4px solid #9ac93d;

}



#header.header3 #header-top {

	background-color: #f0f0ed;

}



#header.header3 #menu-container {

	background-color: transparent;

	padding-bottom:15px;

}



#header.header3 .menu {

	background-color: #f0f0ed;

	border-radius: 6px;

}



#header.header3 .menu > li > a {

	padding:11px 13px 9px 13px;

}



#header.header3 .menu > li > a,

#header.header3 .menu > li > a > i {

	color:#9ac93d;

}



#header.header3 .menu > li.open > a,

#header.header3 .menu > li.open > a > i,

#header.header3 .menu > li.active > a,

#header.header3 .menu > li.active > a > i {

	color:#fff;

}



#header.header3 .menu > li.pull-right.open > a,

#header.header3 .menu > li.pull-right.open > a i {

	color:#950707;

	background-color: transparent;

}





#header.header3 .menu > li.open > a,

#header.header3 .menu > li.active > a {

	background-color: #9ac93d;

	border-radius: 4px;

}



#header.header3 .menu > li.open > a {

	border-radius: 4px 4px 0 0;

}



#header.header3 .menu > li > a > .tip {

	right:13px;

	top:-4px;

}



#header.header3 .currency-switcher > li > a,

#header.header3 .view-switcher > li > a,

.header3 #header-top .welcome-msg,

.header3 #header-top .separator,

#header.header3 .top-links {

	color:#777;

}



#header.header3 .currency-switcher > li:hover > a,

#header.header3 .view-switcher > li:hover > a {

	color:#fff;

	background-color: #9ac93d;

}



#header.header3 .currency-switcher > li > ul,

#header.header3 .view-switcher > li ul {

	background-color: #9ac93d;

}



#header.header3 .currency-switcher li li:hover > a,

#header.header3 .view-switcher li li:hover > a {

	background-color: #0099e6;

}



#header.header3 .top-links a,

#header.header3 #header-inner .header-contact a,

#header.header3 #mini-cart .minicart-icon,

#header.header3 .searchform button:hover,

#header.header3 .searchform-popup .search-toggle,

#header.header3 .mobile-toggle {

	color:#9ac93d;

}



#header.header3 .top-links a:hover,

#header.header3 #header-inner .header-contact a:hover,

#header.header3 .searchform-popup .search-toggle:hover,

#header.header3 .mobile-toggle:hover {

	color:#0099e6;

}



#header.header3 #header-inner .header-contact {

	color:#777;

}



#header.header3 #mini-cart .cart-items {

	color:#fff;

}



#header.header3 .searchform {

	background-color: #fff;

	border-color:#ccc;

}



#header.header3 .searchform input,

#header.header3 .searchform select {

	border-color:#ccc;

	color:#777;

}



#header.header3 .searchform button {

	color:#777;

}



#header.header3 #mini-cart.dropdown .dropdown-menu {

	border-color:#9ac93d;

}



#header.header3 #mini-cart.dropdown .dropdown-menu:before {

	border-bottom-color: #9ac93d;

}



@media (max-width: 480px) {

	#header.header3 #mini-cart {

		background-color: transparent;

	}



	#header.header3 #mini-cart .cart-items {

		color:#9ac93d;

	}

}



/* Header4 - index5.html */

.skin5 {

	border-top:4px solid #9ac93d;

}



#header.header4 {

	background-color: transparent;

}



@media (min-width: 768px) {

	#header.header4 .container {

		padding-right:0;

		padding-left:0;

	}

}



#header.header4 #header-top {

	background-color: transparent;

}



#header.header4 #menu-container {

	background-color: #9ac93d;

}





#header.header4 .menu li a {

	border-radius: 0 !important;

}



#header.header4 .menu > li > a {

	padding:11px 20px 9px 20px;

}





#header.header4 .menu > li > a,

#header.header4 .menu > li > a > i {

	color:#fff;

}



#header.header4 .menu > li.open > a,

#header.header4 .menu > li.open > a > i,

#header.header4 .menu > li.active > a,

#header.header4 .menu > li.active > a > i {

	color:#9ac93d;

}



#header.header4 .menu > li.pull-right.open > a,

#header.header4 .menu > li.pull-right.open > a i {

	color:#eee;

	background-color: transparent;

}



#header.header4 .menu > li.open > a,

#header.header4 .menu > li.active > a {

	background-color: #fff;

}



#header.header4 .tip {

	border-radius: 0;

}



#header.header4 .menu > li > a > .tip {

	right:24px;

	top:-4px;

}



#header.header4 .menu ul,

#header.header4 .menu .megamenu {

	border-top:none;

	border-radius: 0;

}



#header.header4 .menu .megamenu .megamenu-footer {

	border-radius: 0;

}



#header.header4 .currency-switcher > li > a,

#header.header4 .view-switcher > li > a,

.header4 #header-top .welcome-msg,

.header4 #header-top .separator,

#header.header4 .top-links {

	color:#777;

}



#header.header4 .currency-switcher > li:hover > a,

#header.header4 .view-switcher > li:hover > a {

	color:#fff;

	background-color: #9ac93d;

}



#header.header4 .currency-switcher > li > ul,

#header.header4 .view-switcher > li ul {

	background-color: #9ac93d;

	border-radius: 0;

}



#header.header4 .currency-switcher li li:hover > a,

#header.header4 .view-switcher li li:hover > a {

	background-color: #0099e6;

}



#header.header4 .top-links a,

#header.header4 #header-inner .header-contact a,

#header.header4 #mini-cart .minicart-icon,

#header.header4 .searchform button:hover,

#header.header4 .searchform-popup .search-toggle,

#header.header4 .mobile-toggle {

	color:#9ac93d;

}



#header.header4 .top-links a:hover,

#header.header4 #header-inner .header-contact a:hover,

#header.header4 .searchform-popup .search-toggle:hover,

#header.header4 .mobile-toggle:hover {

	color:#0099e6;

}



#header.header4 #header-inner .header-contact {

	color:#777;

}



#header.header4 #mini-cart .cart-items {

	color:#fff;

}



#header.header4 .searchform {

	background-color: #fff;

	border-color:#ccc;

	border-radius: 0;

	line-height: 32px;

}





#header.header4 .searchform input {

	width:302px;

	padding:0 10px 0 10px;

}



@media (max-width: 1053px) {

	#header.header4 .searchform {

		width:368px;

	}





	#header.header4 .searchform input {

		width:202px;

	}

}



@media (max-width: 991px) {

	#header.header4 .searchform {

		width:378px;

	}

}



@media (max-width: 767px) {

	#header.header4 .searchform {

		width:338px;

	}



	#header.header4 .searchform input {

		width:162px;

	}

}



@media (max-width: 480px) {

	#header.header4 .searchform {

		width:288px;

	}



	#header.header4 .searchform input {

		width:132px;

		padding:0 15px;

	}

}





#header.header4 .searchform input,

#header.header4 .searchform select {

	border-color:#ccc !important;

	color:#777;

}



#header.header4 .searchform select {

	padding:0 0 0 5px;

}



#header.header4 .searchform button {

	color:#777;

	padding:0 11px 0 10px;

}



#header.header4 .searchform input,

#header.header4 .searchform select,

#header.header4 .searchform button {

	height:32px;

	line-height:32px;

}



#header.header4 #mini-cart.dropdown .dropdown-menu {

	border-color:#9ac93d;

}



#header.header4 #mini-cart.dropdown .dropdown-menu:before {

	border-bottom-color: #9ac93d;

}



#header.header4 #mini-cart .dropdown-cart-content,

#header.header4 #mini-cart.dropdown .dropdown-menu {

	border-radius: 0;

}



@media (max-width: 480px) {

	#header.header4 #mini-cart {

		background-color: transparent;

	}



	#header.header4 #mini-cart .cart-items {

		color:#9ac93d;

	}

}





/* header5 - index6.html */

#header.header5 {

	background-color: transparent;

}



#header.header5.fixed-header {

	position: absolute;

}



#header.header5 .container{

	width:100%;

}



@media (max-width: 991px) {

	#header.header5 #header-inner .container .header-left {

		display: none !important;

	}

}



#header.header5 .menu li a,

#header.header5 #mini-cart .dropdown-cart-content,

#header.header5 #mini-cart.dropdown .dropdown-menu,

#header.header5 .menu ul,

#header.header5 .menu .megamenu {

	border-radius: 0 !important;

}



#header.header5 .menu > li > a {

	padding:9px 12px 8px;

}



#header.header5 .menu > li > a,

#header.header5 .menu > li > a > i {

	color:#fff;

}



#header.header5 .menu > li.open > a,

#header.header5 .menu > li.open > a > i,

#header.header5 .menu > li.active > a,

#header.header5 .menu > li.active > a > i {

	color:#777;

}



#header.header5 .menu > li.open > a,

#header.header5 .menu > li.active > a {

	background-color: #fff;

}



#header.header5 .menu > li.megamenu-container > .megamenu {

	width:1140px;

}



@media (max-width: 1199px) {

	#header.header5 .menu > li.megamenu-container > .megamenu {

		width:940px;

	}

}



#header.header5 #mini-cart.dropdown .dropdown-menu {

	border-color:#000;

}



#header.header5 #mini-cart.dropdown .dropdown-menu:before {

	border-bottom-color: #000;

}



#header.header5 .menu ul,

#header.header5 .menu .megamenu {

	border-top:none;

}





#header.header5 .menu > li > a > .tip {

	right:10px;

	top:-9px;

	border-radius: 0;

}



#header.header5 .search-toggle {

	display: inline-block;

}



#header.header5 .search-toggle:hover {

	color:#eee;

}



#header.header5 .searchform {

	display: none;

	position: absolute;

	left:auto;

	right:-27px;

	top:35px;

	background-color: #fff;

	border-color:#ccc;

	border-width: 5px;

	width:478px;

	border-radius: 0;

	z-index: 100;

}



#header.header5 .searchform:before {

	display: block;

	left:auto;

	right:27px;

}



#header.header5 .searchform input {

	width:302px;

	padding:0 10px 0 10px;

	border-color:#ccc;

}



#header.header5 .searchform select {

	padding:0 0 0 5px;

	border-color:#ccc;

}



#header.header5 .searchform input,

#header.header5 .searchform select,

#header.header5 .searchform button {

	height:32px;

	line-height: 32px;

	color:#777;

}



#header.header5 .searchform button {

	height:32px;

	line-height: 32px;

	padding:0 11px 0 10px;

}



@media (max-width: 1199px) {



	#header.header5 .searchform {

		width:378px;

	}



	#header.header5 .searchform input {

		width:202px;

	}

}



@media (max-width: 767px) {



	#header.header5 .searchform {

		width:338px;

	}





	#header.header5 .searchform input {

		width:162px;

	}

}



@media (max-width: 480px) {



	#header.header5 .searchform {

		width:288px;

		right:auto;

		left:-30px;

	}



	#header.header5 .searchform:before {

        width: 14px;

        border-width: 7px;

        left: 34px;

        right: auto;

        top: -23px;

        border-color: transparent;

        border-bottom-color: inherit;

	}



	#header.header5 .searchform input {

		width:126px;

		padding:0 15px;

	}

}



#header.header5 .search-popup .searchform:before {

	display: block;

}



#header.header5 #mini-cart.minicart-inline,

#header.header5 .currency-switcher > li > a,

#header.header5 .view-switcher > li > a {

	border-radius: 0;

	background-color: #fff !important;

}



#header.header5 #mini-cart .minicart-icon,

#header.header5 #mini-cart.minicart-inline .cart-items,

#header.header5 .currency-switcher > li > a,

#header.header5 .view-switcher > li > a {

	color:#777;

}



#header.header5 .currency-switcher > li > ul,

#header.header5 .view-switcher >li ul {

	background-color: #000;

	border-radius: 0;

	text-align: left;

}



#header.header5 .currency-switcher > li:hover > a,

#header.header5 .view-switcher > li:hover > a {

	background-color: #000 !important;

	color:#fff;

}



#header.header5 .currency-switcher li li:hover > a,

#header.header5 .view-switcher li li:hover > a {

	background-color: #000 !important;

}



/* header6 - index7.html */

#header.header6 {

	background-color: transparent;

	border-top:4px solid #56738e;

}



#header.header6 #header-top {

	background-color: #65829d;

}



#header.header6 .menu li a,

#header.header6 #mini-cart .dropdown-cart-content,

#header.header6 #mini-cart.dropdown .dropdown-menu,

#header.header6 .menu ul,

#header.header6 .menu .megamenu {

	border-radius: 0 !important;

}



#header.header6 .menu > li > a {

	padding:9px 12px 8px;

}



#header.header6 .menu > li > a,

#header.header6 .menu > li > a > i {

	color:#65829d;

}



#header.header6 .menu > li.open > a,

#header.header6 .menu > li.open > a > i,

#header.header6 .menu > li.active > a,

#header.header6 .menu > li.active > a > i {

	color:#fff;

}



#header.header6 .menu > li.open > a,

#header.header6 .menu > li.active > a {

	background-color: #65829d;

}



#header.header6 #mini-cart.dropdown .dropdown-menu,

#header.header6 .menu ul,

#header.header6 .menu .megamenu {

	border-color:#65829d;

}



@media (min-width: 992px) {

	#header.header6 .menu {

		display:inline-block;

		vertical-align: middle;

	}

}



#header.header6 #mini-cart.dropdown .dropdown-menu:before {

	border-bottom-color: #65829d;

}



#header.header6 .tip {

	border-radius: 0;

}



#header.header6 .menu > li > a > .tip {

	right:10px;

	top:-9px;

}



#header.header6 #header-inner .container > .header-center,

#header.header6 .menu {

	position: static;

}



#header.header6 .menu .megamenu-container .megamenu {

	width:auto;

	left:15px;

	right:15px;

	top:auto;

}



#header.header6 .menu .megamenu .megamenu-footer {

	border-radius: 0;

}



#header.header6 .currency-switcher > li:hover > a,

#header.header6 .view-switcher > li:hover > a {

	color:#fff;

	background-color: #65829d;

}



#header.header6 .currency-switcher > li > ul,

#header.header6 .view-switcher > li ul {

	background-color: #65829d;

	border-radius: 0;

}



#header.header6 .currency-switcher li li:hover > a,

#header.header6 .view-switcher li li:hover > a {

	background-color: #758fa7;

}



#header.header6 #header-inner .header-contact a,

#header.header6 #mini-cart .minicart-icon {

	color:#65829d;

}



#header.header6 .searchform button:hover,

#header.header6 #header-inner .header-contact a:hover,

#header.header6 .searchform-popup .search-toggle:hover,

#header.header6 .mobile-toggle:hover {

	color:#65829d;

}



#header.header6 .searchform-popup .search-toggle,

#header.header6 .mobile-toggle,

#header.header6 #header-inner .header-contact {

	color:#777;

}



#header.header6 #mini-cart .cart-items {

	color:#fff;

}



#header.header6 .searchform-popup .search-toggle {

	display: inline-block;

}



#header.header6 .searchform-popup {

    display: inline-block;

    vertical-align: middle;

    z-index: 0;

}



#header.header6 .searchform {

	display: none;

	background-color: #fff;

	border-color:#ccc;

	border-radius: 0;

	line-height: 32px;

	border-width: 5px;

    position: absolute;

    left: -30px;

    top: 35px;

    z-index: 100;

}



#header.header6 .searchform:before {

	display: block;

}



#header.header6 .searchform input,

#header.header6 .searchform select {

	border-color:#ccc;

	color:#777;

}



#header.header6 .searchform select {

	padding:0 0 0 5px;

}



#header.header6 .searchform button {

	color:#777;

	padding:0 11px 0 10px;

}



#header.header6 .searchform input,

#header.header6 .searchform select,

#header.header6 .searchform button {

	height:32px;

	line-height:32px;

}



@media (max-width: 480px) {

	#header.header6 #mini-cart {

		background-color: transparent;

	}



	#header.header6 #mini-cart .cart-items {

		color:#65829d;

	}

}



/* header7 - index8.html */

#header.header7 {

	background-color: transparent;

}



#header.header7 #header-top {

	background-color: #f7f7f7;

}



#header.header7 #menu-container {

	background-color: transparent;

}



#header.header7 #header-inner .container .header-left,

#header.header7 #header-inner .container .header-right,

#header.header5 #header-inner .container .header-left,

#header.header5 #header-inner .container .header-right {

	width:42%;

}



#header.header7 #header-inner .container .header-right,

#header.header5 #header-inner .container .header-right {

	padding-right:0;

	padding-left: 20px;

}



#header.header7 #header-inner .container .header-left,

#header.header5 #header-inner .container .header-left {

	padding-right:20px;

	padding-left: 0;

}



#header.header7 #header-inner .container .header-center,

#header.header5 #header-inner .container .header-center {

	width:16%;

	padding-right:0;

	padding-left: 0;

	text-align: center;

}



@media (max-width: 991px) {

	#header.header7 #header-inner .container .header-left,

	#header.header7 #header-inner .container .header-center,

	#header.header7 #header-inner .container .header-right,

	#header.header5 #header-inner .container .header-left,

	#header.header5 #header-inner .container .header-center,

	#header.header5 #header-inner .container .header-right {

		width:auto;

	}



	#header.header7 #header-inner .container .header-left,

	#header.header7 #header-inner .container .header-center,

	#header.header5 #header-inner .container .header-left,

	#header.header5 #header-inner .container .header-center {

		display: inline-block;

	}

}





#header.header7 .menu li a,

#header.header7 #mini-cart .dropdown-cart-content,

#header.header7 #mini-cart.dropdown .dropdown-menu,

#header.header7 .menu ul,

#header.header7 .menu .megamenu {

	border-radius: 0 !important;

}



#header.header7 .menu {

	text-align: center;

}



#header.header7 .menu > li,

#header.header7 .menu > li.pull-right {

	float:none !important;

	display: inline-block;

}



#header.header7 .menu > li > a {

	padding:14px 26px 12px 0px;

}



#header.header7 .menu > li > a,

#header.header7 .menu > li > a > i {

	color:#828385;

}



#header.header7 .menu > li.open > a,

#header.header7 .menu > li.open > a > i,

#header.header7 .menu > li.active > a,

#header.header7 .menu > li.active > a > i {

	color:#e13b3f;

}



#header.header7 #mini-cart.dropdown .dropdown-menu,

#header.header7 .menu ul,

#header.header7 .menu .megamenu {

	border-color:#e13b3f;

}



#header.header7 #mini-cart.dropdown .dropdown-menu:before {

	border-bottom-color: #e13b3f;

}



#header.header7 .tip {

	border-radius: 0;

}



#header.header7 .menu > li > a > .tip {

	right:26px;

	top:-1px;

}



#header.header7 .menu .megamenu .megamenu-footer {

	border-radius: 0;

}



#header.header7 #header-top,

#header.header7 .currency-switcher > li > a,

#header.header7 .view-switcher > li > a,

#header.header7 .top-links li:hover > a {

	color:#777;

}



#header.header7 .currency-switcher > li:hover > a,

#header.header7 .view-switcher > li:hover > a {

	color:#fff;

	background-color: #e13b3f;

}



#header.header7 .currency-switcher > li > ul,

#header.header7 .view-switcher > li ul {

	background-color: #e13b3f;

	border-radius: 0;

}



#header.header7 .currency-switcher li li:hover > a,

#header.header7 .view-switcher li li:hover > a {

	background-color: #e45155;

}



#header.header7 #header-inner .header-contact a,

#header.header7 #mini-cart .minicart-icon,

#header.header7 .top-links li  a,

#header.header7 .searchform-popup .search-toggle,

#header.header7 .mobile-toggle {

	color:#e13b3f;

}



#header.header7 .searchform button:hover {

	color:#e13b3f;

}



#header.header7 #header-inner .header-contact a:hover,

#header.header7 .searchform-popup .search-toggle:hover,

#header.header7 .mobile-toggle:hover,

#header.header7 #header-inner .header-contact {

	color:#777;

}



#header.header7 #mini-cart .cart-items {

	color:#fff;

}



#header.header7 .searchform {

	background-color: #fff;

	border-color:#ccc;

	border-radius: 0;

	line-height: 32px;

	width:348px;

}



#header.header7 .searchform input {

	width:182px;

	padding:0 10px 0 10px;

}



@media (max-width: 1199px) {

	#header.header7 .searchform {

		width:288px;

	}



	#header.header7 .searchform input {

		width:122px;

	}

}



@media (max-width: 991px) {

	#header .header-left .searchform {

		top:-6px;

		left:40px;

		width:298px;

	}



	#header .header-left .searchform:before {

        border-bottom-color: transparent;

        border-right-color: inherit;

        left: -23px;

        top: 5px;

    }



	#header.header7 .searchform input {

		width:124px;

	}

}



@media (max-width: 767px) {

	#header.header7 .searchform {

		width:338px;

	}



	#header.header7 .searchform input {

		width:162px;

	}

}



@media (max-width: 480px) {

	#header.header7 .searchform {

		width:288px;

		right:auto;

		left:-30px;

		top:35px;

	}



	#header .header-left .searchform:before {

		width: 14px;

		border-width: 7px;

		left: 34px;

		right: auto;

		top: -23px;

		border-color: transparent;

		border-bottom-color: inherit;

    }



	#header.header7 .searchform input {

		width:132px;

	}

}



#header.header7 .searchform input,

#header.header7 .searchform select {

	border-color:#ccc;

	color:#777;

}



#header.header7 .searchform select {

	padding:0 0 0 5px;

}



#header.header7 .searchform button {

	color:#777;

	padding:0 11px 0 10px;

}



#header.header7 .searchform input,

#header.header7 .searchform select,

#header.header7 .searchform button {

	height:32px;

	line-height:32px;

}





@media (max-width: 480px) {

	#header.header7 #mini-cart {

		background-color: transparent;

	}



	#header.header7 #mini-cart .cart-items {

		color:#e13b3f;

	}

}



/* header8 - index9.html */

#header.header8 {

	background-color: transparent;

}



#header.header8 #header-top {

	background-color: #f5f5f5;

}



#header.header8 #header-inner {

	background-color: #d0205e;

}



#header.header8 #menu-container {

	background-color: #fff;

	border-bottom:1px solid #eee;

}



#header.header8 .menu li a,

#header.header8 #mini-cart .dropdown-cart-content,

#header.header8 #mini-cart.dropdown .dropdown-menu,

#header.header8 .menu ul,

#header.header8 .menu .megamenu {

	border-radius: 0 !important;

}



#header.header8 #mini-cart.dropdown .dropdown-menu {

	border-color:#303030;

}



#header.header8 #mini-cart.dropdown .dropdown-menu:before {

	border-bottom-color: #303030;

}



#header.header8 .menu .megamenu .megamenu-footer {

	border-radius: 0;

}



#header.header8 .tip {

	border-radius: 0;

}



#header.header8 #header-top,

#header.header8 .currency-switcher li a,

#header.header8 .view-switcher li a,

#header.header8 .top-links li a {

	color:#777;

}



#header.header8 .currency-switcher li:hover a,

#header.header8 .view-switcher li:hover a,

#header.header8 .currency-switcher li li a,

#header.header8 .view-switcher li li a {

	color: #fff !important;

}



#header.header8 .currency-switcher li li a,

#header.header8 .view-switcher li li a {

	color:#d0205e;

}



#header.header8 .currency-switcher > li:hover > a,

#header.header8 .view-switcher > li:hover > a {

	color:#d0205e;

	background-color: #f5f5f5;

}



#header.header8 .top-links li a:hover,

#header.header8 .searchform button:hover {

	color:#d0205e;

}



#header.header8 .currency-switcher > li > ul,

#header.header8 .view-switcher > li ul {

	background-color: #f5f5f5;

	border-radius: 0;

}



#header.header8 .currency-switcher li li:hover > a,

#header.header8 .view-switcher li li:hover > a {

	background-color: #fff;

}



#header.header8 #header-inner .header-contact a,

#header.header8 #mini-cart .minicart-icon {

	color:#fff;

}



#header.header8 #header-inner .header-contact a:hover,

#header.header8 .searchform-popup .search-toggle:hover,

#header.header8 .mobile-toggle:hover {

	color:#fff;

}



#header.header8 .searchform-popup .search-toggle,

#header.header8 .mobile-toggle,

#header.header8 #header-inner .header-contact {

	color:#fff;

}



#header.header8 #mini-cart .cart-items {

	color:#000;

}



#header.header8 .searchform {

	background-color: #fff;

	border-color:#ccc;

	border-radius: 0;

	line-height: 32px;

	width:468px;

}



#header.header8 .searchform input  {

	width:302px;

	padding:0 10px 0 10px;

}



@media (max-width: 1199px) {

	#header.header8 .searchform {

		width:368px;

	}



	#header.header8 .searchform input  {

		width:202px;

	}

}



@media (max-width: 991px) {

	#header.header8 .searchform {

		width:378px;

	}



	#header.header8 .searchform input  {

		width:202px;

	}

}



@media (max-width: 767px) {

	#header.header8 .searchform {

		width:338px;

	}



	#header.header8 .searchform input  {

		width:162px;

	}

}



@media (max-width: 480px) {

	#header.header8 .searchform {

		width:288px;

	}



	#header.header8 .searchform input  {

		width:132px;

	}

}



#header.header8 .searchform input,

#header.header8 .searchform select {

	border-color:#ccc;

	color:#777;

}



#header.header8 .searchform select {

	padding:0 0 0 5px;

}



#header.header8 .searchform button {

	color:#777;

	padding:0 11px 0 10px;

}



#header.header8 .searchform input,

#header.header8 .searchform select,

#header.header8 .searchform button {

	height:32px;

	line-height:32px;

}



@media (max-width: 480px) {

	#header.header8 #mini-cart {

		background-color: transparent;

	}



	#header.header8 #mini-cart .cart-items {

		color:#fff;

	}

}



.header8 .sidebar-menu {

	border-bottom:5px solid #303030;

}



.header8 .sidebar-menu > li.active > a {

	color:#d0205e;

}



.header8 .sidebar-menu.menu > li:hover {

	background-color: #d0205e;

	color:#fff;

	border-color:#d0205e;

}



.header8 .sidebar-menu > li > a > .arrow:before {

	border-left-color:#333;

}



.header8 .sidebar-menu.menu > li:hover > a > .arrow:before {

	border-left-color:#fff;

}



.header8 .sidebar-menu.menu li li:hover > a {

	background-color: #d0205e;

}



.header8 .sidebar-menu.menu > li:hover > a {

	background-color: #d0205e;

	color:#fff;

	border-color:#d0205e;

}



.header8 .sidebar-menu li ul,

.header8 .sidebar-menu li .megamenu {

	border-color:#d0205e;

}



.header8 .sidebar-menu.menu li ul {

	background-color: #d0205e;

}



.header8 .sidebar-menu.menu li li:hover > a {

	background-color: #de2b6a;

}



.sidebar-menu.menu li li:last-child  > a{

	border-bottom:none;

}



.menu-custom-block {

    padding: 10px 0 9px;

    line-height: 21px;

    font-weight: 600;

    font-size: 0.8571em;

    margin-left: -10px;

}



.menu-custom-block a,

.menu-custom-block span {

    display: inline-block;

    padding: 0 15px;

    position: relative;

    color:#777;

    text-transform: uppercase;

}



.menu-custom-block a:hover {

	color:#d0205e;

}



.menu-custom-block a .tip {

	top:-14px;

	right:10px;

	font-style: normal;

}



#main-toggle-menu {

	position: relative;

}



#main-toggle-menu .menu-title {

    color: #fff;

    cursor: pointer;

    background: #303030;

    font-size: 0.8571em;

    font-weight: 700;

    line-height: 20px;

    padding: 10px 15px;

    margin: 0;

    text-transform: uppercase;

    position: relative;

    -webkit-transition: all 0.25s ease 0s;

    transition: all 0.25s ease 0s;

}



#main-toggle-menu .menu-title:hover {

    background-color: #555;

}



#main-toggle-menu .menu-title .toggle {

    display: inline-block;

    font-family: "FontAwesome";

    margin: 0 5px 0 0;

}



#main-toggle-menu .menu-title .toggle:before {

    content: "\f0c9";

}



#main-toggle-menu.show-always .toggle-menu-wrap {

	display: block;

	height:auto;

}



.toggle-menu-wrap {

	display: block;

    position: absolute;

    left: 0;

    top: 100%;

    width: 100%;

    background: #fff;

    box-shadow: 0 0 20px rgba(0, 0, 0, .4);

}





/* header9 - index10.html */

#header.header9 {

	background-color: rgba(56,55,52,0.4);

}



#header.header-side-nav .side-top > .container {

	display:block;

	min-height: 0 !important;

	position: static;

}



#header.header-side-nav .side-top > .container > * {

	display: inline-block !important;

	padding:0 !important;

}



#header.header9 .currency-switcher > li > a,

#header.header9 .view-switcher > li > a {

	background-color: #000 !important;

	color:#fff;

}



#header.header9 .currency-switcher > li > ul,

#header.header9 .view-switcher > li ul {

	background-color: #000;

}



#header.header9  .currency-switcher > li:hover > a,

#header.header9  .view-switcher > li:hover > a {

	background-color: #000 !important;

	color:#fff;

	border-radius: 4px 4px 0 0;

}



#header.header9  .currency-switcher li li:hover > a,

#header.header9  .view-switcher li li:hover > a {

	background-color: #000 !important;

}



.header9 .sidebar-menu .megamenu-container {

	position: relative !important;

}



.header9 .sidebar-menu  li a {

	border-color:#484848;

}



.header9 .sidebar-menu > li.active > a,

.header9 .sidebar-menu > li > a  {

	color:#fff;

}



.header9 .sidebar-menu.menu > li:hover {

	background-color: #3b3b3b;

	color:#fff;

	border-color:#3b3b3b;

}



.header9 .sidebar-menu > li > a > .arrow:before {

	border-left-color:#fff;

}



.header9 .sidebar-menu.menu > li:hover > a > .arrow:before {

	border-left-color:#fff;

}



.header9 .sidebar-menu.menu li li:hover > a {

	background-color: #3b3b3b;

}



.header9 .sidebar-menu.menu > li:hover > a {

	background-color: #3b3b3b;

	color:#fff;

	border-color:#3b3b3b;

}



.header9 .sidebar-menu.menu .megamenu-list > li > a {

	border:none;

}



.header9 .sidebar-menu.menu .megamenu-list > li:hover > a{

	background-color: #f4f4f4;

	color:#777;

}



.header9 .sidebar-menu li ul,

.header9 .sidebar-menu li .megamenu {

	border-color:#3b3b3b;

}



.header9 .sidebar-menu.menu li ul {

	background-color: #3b3b3b;

}



.header9 .sidebar-menu.menu li li:hover > a {

	background-color: #484848;

}



#header.header9 .searchform {

	background-color: #fff;

	border-color:#ccc;

	color:#777;

}



#header.header9 .searchform input {

	color:#777;

}



#header.header9 .searchform button {

	color:#777;

}



#header.header9 .searchform button:hover {

	color:#3b3b3b;

}



#header.header-side-nav #header-inner > .container {

	width:100%;

}



@media (min-width:992px) {

	#header.header-side-nav {

		position: absolute;

	    top: 0;

	    left: 0;

	    width: 256px;

	    padding: 10px 15px 145px;

	    min-height: 100vh;

	}



	#header.header-side-nav .side-top > .container {

        padding: 0;

        width: 100%;

    }



	#header.header-side-nav #header-inner {

		position: static;

	}



    #header.header-side-nav #header-inner > .container {

        position: static;

        padding: 0;

        width: 100%;

        display: block;

    }



    #header.header-side-nav #header-inner > .container > * {

        position: static;

        display: block;

        padding: 0 !important;

    }



    #header.header-side-nav .logo {

        text-align: center;

        margin: 30px 0;

    }



    #header.header-side-nav .searchform {

        margin-bottom: 20px;

        width: 226px;

        border-radius: 5px;

    }



    #header.header-side-nav .searchform input {

        padding: 0 10px;

        border-radius: 5px 0 0 5px;

        border-width: 0;

        width: 190px;

    }



    #header.header-side-nav .searchform button {

        padding: 0 10px;

        border-radius: 0 5px 5px 0;

    }



    #header.header-side-nav .top-links {

        display: block;

        font-size: 0.8em;

        margin-bottom: 20px;

    }



    #header.header-side-nav .top-links li {

        display: block;

        float: none;

        margin: 0;

    }



    #header.header-side-nav .top-links li:after {

        display: none;

    }



    #header.header-side-nav .top-links li > a {

    	display: block;

        margin: 0;

        padding-top: 5px;

        padding-bottom: 5px;

        border-radius: 0;

        border-top: 1px solid #484848;

        text-transform: capitalize;

    }



    #header.header-side-nav .top-links li:first-child > a,

    #header.header-side-nav .top-links li:first-child > h5 {

        border-top-width: 0;

    }



    #header.header-side-nav #header-inner .header-contact {

        margin: 0 0 8px;

    }



    #header.header-side-nav .header-copyright {

        font-size: 0.9em;

    }



     #header.header-side-nav #mini-cart.minicart-inline .dropdown-menu {

        left: 0;

        right: auto;

    }



     #header.header-side-nav #mini-cart.minicart-inline .dropdown-menu:before {

        right: auto;

        left: 10px;

    }



     #header.header-side-nav .side-bottom {

        text-align: center;

        position: absolute;

        bottom: 0;

        left: 0;

        right: 0;

        margin: 20px 10px;

    }



}



#header.header-side-nav .header-copyright {

    color:#777;

}



#header.header-side-nav .social-icons {

	margin-bottom: 8px;

}



#header.header-side-nav .social-icon {

	background-color: #9e9e9e;

	margin:5px;

	line-height: 30px;

}



#header.header-side-nav .sidebar-menu {

    margin-bottom: 20px;

}



#header.header-side-nav .sidebar-menu > li > a {

    margin-left: 0;

    margin-right: 0;

}



#header.header-side-nav .sidebar-menu > li > .arrow {

    right: -5px;

}



#header.header-side-nav .sidebar-menu > li:last-child:hover {

    border-radius: 0;

}



#header.header-side-nav .menu-custom-block a {

    margin-left: 0;

    margin-right: 0;

    padding-left: 5px;

    padding-right: 5px;

}



@media (max-width: 991px) {



    #header.header-side-nav .side-top {

        padding-top: 0;

    }



    #header.header-side-nav .side-top > .container > * {

        display: none !important;

    }



	#header.header-side-nav #header-inner .side-top > .container {

		position: static;

	}



    #header.header-side-nav #header-inner .side-top > .container > #mini-cart {

        display: block !important;

        position: absolute !important;

        top: 50%;

        bottom: 50%;

        height: 26px;

        margin-top: -12px;

        right: 15px;

        z-index: 1;

    }



    #header.header-side-nav #header .logo {

        margin: 0;

    }



    #header.header-side-nav .social-icons,

    #header.header-side-nav .header-copyright {

        display: none;

    }



    #header.header-side-nav #header-inner .header-contact {

        margin-right: 100px;

    }



    #header.header-side-nav .searchform input {

    	width:320px;

    	border-color:#ccc;

    }

}



@media (max-width: 767px) {

	#header.header-side-nav #header-inner .header-contact {

        display: none;

    }

}





@media (max-width: 480px) {

	#header.header-side-nav #header-inner .side-top .container {

		padding:0 !important;

	}



	#header.header-side-nav  #header-inner .side-top .container > * {

        display: none !important;

    }



    #header.header-side-nav #header-inner .side-top > .container > #mini-cart {

    	top:9px;

    	right:15px;

    	bottom:auto;

    	margin-top:0;

    }



    #header.header-side-nav .searchform input {

    	width:236px;

    }

}





/* header10 - index11.html */

#header.header10 {

	border-top:5px solid #7aa93c;

	border-bottom:1px solid #e1e1e1;

	background-color: transparent;

}



#header.header10 #header-top {

	background-color: #f7f7f7;

}



.v2 #header .top-links > li:after {

	margin:0 5px 0 6px;

}



#header.header10 #menu-container {

	background-color: transparent;

	margin-bottom: 10px;

}



#header.header10 #header-inner .container .header-left,

#header.header10 #header-inner .container .header-right {

	width:42%;

}



#header.header10 #header-inner .container .header-right {

	padding-right:0;

	padding-left: 20px;

}





#header.header10 #header-inner .container .header-left {

	padding-right:20px;

	padding-left: 0;

}



#header.header10 #header-inner .container .header-center{

	width:16%;

	padding:20px 0;

	text-align: center;

}



@media (max-width: 991px) {

	#header.header10 #header-inner .container .header-left,

	#header.header10 #header-inner .container .header-center,

	#header.header10 #header-inner .container .header-right {

		width: 33.33%;

		display:table-cell;

	}

}



#header.header10 .menu > li,

#header.header10 .menu > li.pull-right {

	float:none !important;

	display: inline-block;

}



#header.header10 .menu > li +li {

	margin-left:3px;

}



#header.header10 .menu > li > a {

	padding:9px 14px;

}



#header.header10 .menu > li > a,

#header.header10 .menu > li > a > i {

	color:#333;

}



#header.header10 .menu > li.open > a,

#header.header10 .menu > li.open > a > i,

#header.header10 .menu > li.active > a,

#header.header10 .menu > li.active > a > i {

	color:#fff;

	background-color: #7aa93c;

	border-radius: 5px;

}



#header .menu > li.has-sub.open > a,

#header .menu > li.has-sub.open > a {

	border-radius:5px 5px 0 0;

}



#header.header10 #mini-cart.dropdown .dropdown-menu,

#header.header10 .menu ul,

#header.header10 .menu .megamenu {

	border-color:#7aa93c;

}



#header.header10 #mini-cart.dropdown .dropdown-menu:before {

	border-bottom-color: #7aa93c;

}



#header.header10 .menu > li > a > .tip {

	right:10px;

	top:-7px;

}



.v2 #header .welcome-msg {

	margin-right: 7px;

}



#header.header10 #header-top,

#header.header10 .currency-switcher > li > a,

#header.header10 .view-switcher > li > a,

#header.header10 .top-links li:hover > a,

#header.header10 .currency-switcher > li:hover > a,

#header.header10 .view-switcher > li:hover > a,

#header.header10 .currency-switcher li li > a,

#header.header10 .view-switcher li li > a {

	color:#777;

}



#header.header10 .currency-switcher > li:hover > a,

#header.header10 .view-switcher > li:hover > a,

#header.header10 .currency-switcher li li > a,

#header.header10 .view-switcher li li > a  {

	color: #fff;

}



#header.header10 .currency-switcher > li:hover > a,

#header.header10 .view-switcher > li:hover > a {

	background-color: transparent;

}



.v2 #header .currency-switcher > li > ul,

.v2 #header .view-switcher > li ul {

	background-color: #fff !important;

	border:1px solid #ccc;

	margin-top:-6px;

	border-radius: 3px;

	box-shadow:0 0 2px rgba(0,0,0,0.1);

	padding:4px 0;

}



.v2 #header .currency-switcher > li ul > li,

.v2 #header .view-switcher > li ul > li {

	padding:0 9px;

	line-height: 17px;

}



.v2 #header .view-switcher li li img {

	margin-top:0;

}



.v2 #header .currency-switcher li li > a,

.v2 #header .view-switcher li li > a {

	padding:0;

	line-height: 1;

	color:#777;

	background: none !important;

}



	.v2 #header .currency-switcher li li:hover > a,

	.v2 #header .view-switcher li li:hover > a  {

		background: none !important;

	}



.v2 #header .currency-switcher li li:hover,

.v2 #header .view-switcher li li:hover,

.v2 #header .currency-switcher li li:hover > a,

.v2 #header .view-switcher li li:hover > a {

	color:#fff;

	background-color: #ccc;

}



.v2 #header .top-links li:hover > a {

	text-decoration: underline;

}





.v2 #header .top-links li > a > i {

	margin:0 0.2em 0 0;

}



#header.header10 #header-inner .header-contact a,

#header.header10 #mini-cart .minicart-icon,

#header.header10 .top-links li  a,

#header.header10 .top-links li:hover > a,

#header.header10 .searchform-popup .search-toggle,

#header.header10 .mobile-toggle {

	color:#7aa93c;

}



#header.header10 #header-inner .header-contact .separator {

	margin:0 8px;

}



.v2 #header #mini-cart.dropdown .dropdown-menu {

	width:300px;

	box-shadow:0 2px 8px rgba(0,0,0,0.5);

}



#header.header10 #mini-cart.dropdown .dropdown-menu ul li.empty {

	padding:5px 0;

}



#header.header10 .searchform button:hover {

	color:#7aa93c;

}



#header.header10 #header-inner .header-contact a:hover,

#header.header10 .searchform-popup .search-toggle:hover,

#header.header10 .mobile-toggle:hover,

#header.header10 #header-inner .header-contact {

	color:#777;

}



#header.header10 #mini-cart .cart-items {

	color:#fff;

}



#header.header10 .searchform {

	background-color: #fff;

	border-color:#ccc;

	line-height: 36px;

	width:366px;

}



#header.header10 .searchform input {

	width:198px;

	padding:0 15px;

}



@media (max-width: 1199px) {

	#header.header10 .searchform {

		width:288px;

	}



	#header.header10 .searchform input {

		width:122px;

	}

}



@media (max-width: 991px) {

	#header .header-left .searchform {

		top:-6px;

		left:40px;

		width:298px;

	}



	#header .header-left .searchform:before {

        border-bottom-color: transparent;

        border-right-color: inherit;

        left: -23px;

        top: 5px;

    }



	#header.header10 .searchform input {

		width:124px;

	}

}



@media (max-width: 767px) {

	#header.header10 .searchform {

		width:338px;

	}



	#header.header10 .searchform input {

		width:162px;

	}

}



@media (max-width: 480px) {

	#header.header10 .searchform {

		width:288px;

		right:auto;

		left:-30px;

		top:35px;

	}



	#header .header-left .searchform:before {

		width: 14px;

		border-width: 7px;

		left: 34px;

		right: auto;

		top: -23px;

		border-color: transparent;

		border-bottom-color: inherit;

    }



	#header.header10 .searchform input {

		width:132px;

	}

}



#header.header10 .searchform input,

#header.header10 .searchform select {

	border-color:#ccc !important;

	color:#777;

}



#header.header10 .searchform select {

	padding:0 10px 0 10px;

}



.v2 #header .searchform select {

	-webkit-appearance: none;

	-moz-appearance:none;

	appearance:none;

}



.v2 select::-ms-expand {

    display: none;

}



#header.header10 .searchform button {

	color:#777;

	padding:0 11px 0 10px;

}



#header.header10 .searchform input,

#header.header10 .searchform select,

#header.header10 .searchform button {

	height:34px;

	line-height:34px;

}





@media (max-width: 480px) {

	#header.header10 #mini-cart {

		background-color: transparent;

	}



	#header.header10 #mini-cart .cart-items {

		color:#7aa93c;

	}

}





/* Header 11 */

#header.header11 {

	background-color: #fff;

}



#header.header11 #header-top {

	background-color: #ee3d43;

	color:#fff;

}



#header.header11 #header-top .top-links > li:hover > a {

	color:#fff;

}



#header.header11 #header-top .view-switcher > li:hover > a,

#header.header11 #header-top .currency-switcher > li:hover > a {

	background-color: transparent;

	color:#fff;

}



#header.header11 #header-inner .header-contact,

#header.header11 #header-inner .header-contact a {

	color:#333745;

}





#header.header11 #mini-cart .minicart-icon {

	color:#393f4f;

}



#header.header11 #mini-cart .cart-items {

	color:#fff;

}



.v2 #header.header11 #header-inner .header-contact .separator {

	margin:0 8px;

}



#header.header11 #menu-container {

	background-color: #393f4f;

}



#header.header11 .menu > li > a > .tip {

	right:10px;

	top:-7px;

	margin:0;

}



#header.header11 #mini-cart.dropdown .dropdown-menu:before {

	border-bottom-color:#ee3d43;

}



#header.header11 #mini-cart.dropdown .dropdown-menu{

	border-top-color:#ee3d43;

}



#header.header11 .searchform {

	border-color:#cececd;

	background-color:#fff;

	width:450px;

}



#header.header11  .searchform input {

	width:278px;

	padding-left:15px;

	padding-right:15px;

}



#header.header11 .searchform input,

#header.header11 .searchform select,

#header.header11  .searchform button {

	border-color:#ccc !important;

	color:#333;

	height:38px;

	line-height: 38px;

}



#header.header11  .searchform button {

	padding-right:13px;

	padding-left:13px;

}



#header.header11 #header-inner .container .header-center {

	padding-left:25px;

}



#header.header11 .mobile-toggle,

#header.header11 .searchform-popup .search-toggle{

	color:#333;

	vertical-align: middle;

}



#header.header11 .mobile-toggle {

	font-size: 20px;

	margin-top:-2px;

}



@media (max-width: 991px) {

	#header.header11 #header-inner .container .header-center {

		position: absolute;

		right:76px;

		top:50%;

		padding:0;

		margin-top:-15px;

		z-index: 999;

	}



	#header.header11 .searchform {

		left:auto;

		right:-60px;

	}



	#header.header11 .searchform:before {

		left:auto;

		right:60px;

	}



	#header.header11  .searchform input {

		width:270px;

	}

}





@media (max-width: 480px) {

	#header.header11 #mini-cart {

		background-color: #ee3d43;

	}



	#header.header11 #mini-cart .minicart-icon {

		color:#fff;

	}



	#header.header11 .searchform {

		right:auto;

		left:-30px;

		width:300px;

	}



	#header.header11 .searchform:before {

		right:auto;

		left:30px;

	}



	#header.header11  .searchform input {

		width:140px;

	}



	#header.header11 .mobile-toggle {

		margin-top:0;

	}

}





/* Header 12 - index13 */

#header.header12 {

	background-color: transparent;

}



#header.header12 #header-top,

#header.header12  .currency-switcher a,

#header.header12  .view-switcher a,

#header.header12  .top-links a,

#header.header12 #header-top .view-switcher > li:hover > a,

#header.header12 #header-top .currency-switcher > li:hover > a {

	background-color: transparent !important;

	color:#777;

}



#header.header12 #header-top .top-links > li > a,

#header.header12 #header-top .top-links > li:hover > a {

	color:#000;

	background-color: transparent;

}



#header.header12 #header-top .view-switcher > li li:hover > a,

#header.header12 #header-top .currency-switcher > li li:hover > a {

	background-color: transparent;

	color:#fff;

}



#header.header12 #header-inner .header-contact {

	color:#777;

}



#header.header12 #header-inner .header-contact a {

	color:#000;

}



#header.header12 #mini-cart .minicart-icon {

	color:#000;

}



#header.header12 #mini-cart .cart-items {

	color:#fff;

}



.v2 #header.header12 #header-inner .header-contact .separator {

	margin:0 8px;

	color:#ccc;

}



#header.header12 .separator {

	color:#ccc;

}



#header.header12 #menu-container {

	background-color: #54555e;

	margin-bottom: 20px;

	position: relative;

}



#header.header12 #menu-container:after {

	content:'';

	position: absolute;

	top:100%;

	left:0;

	right:0;

	z-index: 1;

	display: block;

	height:4px;

	background:#3f4048;

}



#header.header12 .menu > li > a > .tip {

	right:10px;

	top:-7px;

	margin:0;

}



#header.header12 .menu > li > a {

	padding:17px 20px;

}



#header.header12 .menu > li.open > a,

#header.header12 .menu > li.open > a > i,

#header.header12 .menu > li.active > a,

#header.header12 .menu > li.active > a > i {

	color:#fff;

	background-color: #000;

}



#header.header12 .menu > li.open > a,

#header.header12 .menu > li.active > a {

	position: relative;

	padding-bottom:21px;

	margin-bottom:-4px;

	z-index: 10;

}



#header.header12 #mini-cart.dropdown .dropdown-menu:before {

	border-bottom-color:#000;

}



#header.header12 #mini-cart.dropdown .dropdown-menu,

#header.header12 .menu ul,

#header.header12 .menu .megamenu {

	border-top-color:#000;

}



.v2 #header.header12 .currency-switcher > li > ul,

.v2 #header.header12 .view-switcher > li ul,

#header.header12 #mini-cart.dropdown .dropdown-menu,

#header.header12 .menu ul,

#header.header12 .menu .megamenu,

#header.header12 #mini-cart .dropdown-cart-content,

#header.header12 .tip,

#header.header12 .searchform {

	border-radius: 0;

}



.header12 #mini-cart.dropdown .dropdown-menu ul li.empty {

	padding:0;

}



#header.header12 .menu li > ul {

	background-color: #fff;

}



#header.header12 .menu li > ul li a {

	color:#777;

}



#header.header12 .menu .megamenu li:hover > a {

	background-color: transparent;

	color:#777;

	text-decoration: underline;

}



#header.header12 .searchform {

	border-color:#ccc;

	background-color:#fff;

	width:450px;

}



#header.header12 .searchform input {

	width:278px;

	padding-left:15px;

	padding-right:15px;

}



#header.header12 .searchform input,

#header.header12 .searchform select,

#header.header12  .searchform button {

	border-color:#ccc !important;

	color:#777;

	height:38px;

	line-height: 38px;

}



#header.header12  .searchform button {

	padding-right:13px;

	padding-left:13px;

}



#header.header12 #header-inner .container .header-center {

	padding-left:25px;

}



#header.header12 .mobile-toggle,

#header.header12 .searchform-popup .search-toggle{

	color:#333;

	vertical-align: middle;

}



#header.header12 .mobile-toggle {

	font-size: 20px;

	margin-top:-2px;

}



@media (max-width: 991px) {

	#header.header12 #header-inner .container .header-center,

	#header.header14 #header-inner .container .header-center,

	#header.header15 #header-inner .container .header-center {

		position: absolute;

		right:76px;

		top:50%;

		padding:0;

		margin-top:-15px;

		z-index: 999;

	}



	#header.header14 #header-inner .container .header-center {

		right:131px;

	}



	#header.header12 .searchform,

	#header.header15 .searchform {

		left:auto;

		right:-60px;

	}



	#header.header14 .searchform {

		left:auto;

		right:-118px;

	}



	#header.header12 .searchform:before,

	#header.header15 .searchform:before {

		left:auto;

		right:60px;

	}



	#header.header14 .searchform:before{

		left:auto;

		right:116px;

	}



	#header.header12 .searchform input {

		width:270px;

	}

}



@media (max-width: 767px) {

	#header.header14 #header-inner .container .header-center {

		right:86px;

	}

	#header.header14 .searchform {

		left:auto;

		right:-81px;

	}



	#header.header14 .searchform:before{

		left:auto;

		right:81px;

	}

}



@media (max-width: 480px) {

	#header.header12 #mini-cart {

		background-color: #000;

		border-radius: 0;

	}



	#header.header12 #mini-cart .minicart-icon {

		color:#fff;

	}



	#header.header12 .searchform,

	#header.header15 .searchform,

	#header.header14 .searchform   {

		right:auto;

		left:-30px;

		width:300px;

	}



	#header.header12 .searchform:before,

	#header.header15 .searchform:before,

	#header.header14 .searchform:before {

		right:auto;

		left:30px;

	}



	#header.header14  #mini-cart .cart-head {

		background-color: transparent;

	}



	#header.header12 .searchform input {

		width:140px;

	}





	#header.header12 .mobile-toggle {

		margin-top:0;

	}

}





/* header13 - index14.html*/

#header.header13 {

	background-color: #fff;

}



#header.header13 #header-inner .container > div {

	padding-top:15px;

	padding-bottom: 15px;

}



@media (max-width: 767px) {

	#header.fixed-header #header-inner .container > div {

		padding-top:8px;

		padding-bottom: 8px;

	}

}



#header.header13 #header-inner .container .header-center {

	position: static;

	padding-left:30px;

}



#header.header13 .menu {

	position: static;

	vertical-align: middle;

}



@media (min-width: 992px) {

	#header.header13 #header-center-wrapper {

		display: inline-block;

		white-space: nowrap;

	}

}



.header13 .menu > li.open > a > i,

.header13 .menu > li.active > a > i{

	color:#fff;

}



.header13 .menu > li.open > a,

.header13 .menu > li.active > a {

	background-color: #9ac93d;

	color:#fff;

}



.header13 .menu > li > a {

	padding:7px 12px 6px;

	border-radius: 4px;

	color:#9ac93d;

	font-weight: 600;

}



.header13 .menu > li > a > i {

	color:#9ac93d;

}



@media (max-width: 1199px) {

	.header13 .menu > li > a {

		padding:9px 9px 8px;

	}



}



.header13 .menu .megamenu-container .megamenu {

	left:15px;

	right:15px;

	width:auto;

	top:auto;

}



.header13 .menu > li > a > .tip {

	top:-7px;

	right:10px;

}



#header.header13 .search-toggle {

	display:inline-block;

}



#header.header13 .top-links > li:after,

#header.header13 .separator,

#header.header13 .currency-switcher a,

#header.header13 .view-switcher a,

#header.header13 .top-links a,

#header.header13 .searchform-popup .search-toggle,

#header.header13 .currency-switcher li:hover > a,

#header.header13 .view-switcher li:hover > a {

	color:#777;

}



#header.header13 .currency-switcher a,

#header.header13 .view-switcher a {

	padding-left:10px;

	padding-right:10px;

}



#header.header13 .top-links a {

	font-weight: 300;

}



#header.header13 .searchform {

	position: absolute;

	display: none;

	border-color:#cccccc;

	border-width: 5px;

	left:auto;

	right:-29px;

	background-color: #fff;

	z-index: 900;

	border-radius: 25px;

	width:450px;

}



#header.header13 .searchform input,

#header.header13 .searchform select,

#header.header13 .searchform button,

#header.header13 .mobile-toggle  {

	color:#777;

	border-color:#ccc;

}



#header.header13 .searchform button:hover {

	color:#3b3b3b;

}



#header.header13 .searchform {

	width:378px;

}



.header13 .block-nowrap {

	margin-bottom: 2px;

}



@media (min-width: 1200px) {

	#header.header13 .searchform {

		width:450px;

	}



	#header.header13 .searchform input {

		width:265px;

	}

}



@media (min-width: 992px) {

	#header.header13 .searchform {

		margin-top:6px;

	}

}



@media (max-width: 767px) {

	#header.header13 .searchform {

		width:380px;

	}

}



#header.header13 .searchform:before {

	display: block;

	left:auto;

	right:27px;

}



@media (max-width: 480px) {



	.header-minicart-inline {

		line-height: 1.6 !important;height: 0;

	}

	#header.header13 .searchform {

		right:auto;

		left:-27px;

		width:290px;

	}



	#header.header13 .searchform button {

		padding-right: 0;

	}





	#header.header13 .searchform:before {

		right:auto;

		left:27px;

	}

}



.header13 #mini-cart.minicart-inline {

	background-color: #eee !important;

	margin-left:4px;

    border-radius: 2px;

    color:#777;

    padding-left:7px;

    padding-right: 7px;

}



#header.header13 #mini-cart.minicart-inline .dropdown-menu {

	margin-top:8px;

	font-size: 14px;

	border-top-color:#9ac93d;

}



#header.header13 #mini-cart.minicart-inline .cart-items,

#header.header13 #mini-cart .minicart-icon {

	color:#777;

	text-transform: uppercase;

}





#header.header13 #mini-cart.minicart-inline .cart-items {

	font-weight: 400;

}



.header13 #mini-cart.dropdown .dropdown-menu ul li.empty {

	padding:0;

}



#header.header13 #mini-cart.dropdown.minicart-inline .dropdown-menu:before {

	border-bottom-color:#9ac93d;

}



#header.header13 .view-switcher {

	margin-left:4px;

}



#header.header13 .currency-switcher,

#header.header13 .view-switcher {

	text-align: left;

}



#header.header13 .header-link {

	display: inline-block;

	padding:4px 7px;

	line-height:18px;

	border-radius: 2px;

	font-size: 11px;

	text-transform: uppercase;

	color:#777;

	margin:0 0 0 4px;

}



#header.header13 .header-link:hover {

	text-decoration: underline;

}



#header.header13 .header-link > i {

	margin-right: 2px;

}



#header.header13 .currency-switcher > li > a,

#header.header13 .view-switcher > li > a,

#header.header13 .header-link  {

	border-radius: 2px;

	background-color: #eeeeee;

}



#header.header13 .currency-switcher > li:hover > a,

#header.header13 .view-switcher > li:hover > a{

	background-color: #eeeeee;

}



#header.header13 .currency-switcher li > ul,

#header.header13 .view-switcher li > ul {

	background-color: #fff;

	border:none;

	margin-top:0;

	min-width: 100%;

}







/* header14 - index15.html */

#header.header14 {

	background-color: transparent;

	border-top:4px solid #08c;

	color:#777;

	margin-bottom: 20px;

}



#header.header14 #header-top {

	background-color: #f0f0ed;

}



#header.header14 #menu-container {

	background-color: #f0f0ed;

	border-radius: 5px;

}



#header.header14 .currency-switcher li:hover > a,

#header.header14 .view-switcher li:hover > a {

	background-color: transparent;

}



#header.header14 .currency-switcher li:hover > a,

#header.header14 .view-switcher li:hover > a,

#header.header14 .currency-switcher a,

#header.header14 .view-switcher a,

#header.header14 .header-left .top-links a  {

	color:#777;

}



#header.header14 .top-links a {

	color:#08c;

}



#header.header14 .searchform {

	width:450px;

	background-color: #fff;

	border-color:#ccc;

}





#header.header14 .searchform input {

	width:278px;

}



#header.header14 .searchform input,

#header.header14 .searchform select {

	border-color:#ccc;

	color:#777;

}



#header.header14 .searchform-popup .search-toggle,

#header.header14 .mobile-toggle {

	color:#08c;

}



#header.header14 .searchform button {

	padding-right:10px;

	color:#777;

}



#header.header14 .searchform input,

#header.header14 .searchform select,

#header.header14 .searchform button {

	height:38px;

	line-height: 38px;

}



#header.header14 #mini-cart.dropdown .dropdown-menu:before {

	border-bottom-color:#08c;

}



#header.header14 #mini-cart.dropdown .dropdown-menu,

#header.header14 .menu ul,

#header.header14 .menu .megamenu {

	border-top-color:#08c;

}



#header.header14 .menu > li + li {

	margin-left: 2px;

}



#header.header14 .menu > li > a {

	padding:10px 20px;

	border-radius:5px;

}



#header.header14 .menu > li > a > .tip {

	top:-5px;

	right:15px;

}



#header.header14 .menu > li > a,

#header.header14 .menu > li > a > i {

	color:#08c;

}



#header.header14 .menu > li.open > a,

#header.header14 .menu > li.open > a > i,

#header.header14 .menu > li.active > a,

#header.header14 .menu > li.active > a > i {

	color:#fff;

	background-color: #08c;

}



#header.header14 .menu li .megamenu li a:hover {

	background-color: transparent;

	text-decoration: underline;

}



#header.header14 #header-inner .container .header-right {

	position: relative;

}



#header.header14 #mini-cart {

	padding:7px 0;

	border-radius: 5px;

}



#header.header14 #mini-cart.minicart-inline {

	background-color: #08c !important;

}



#header.header14 #mini-cart .minicart-icon {

	color: #fff;

	font-size: 18px;

}



#header.header14 #mini-cart .cart-items {

	color:#fff;

	font-size: 12px;

	text-transform: uppercase;

	font-weight: 600;

	vertical-align: middle;

}



.icon-group {

	display: inline-block;

	vertical-align: middle;

	text-align: left;

}



.icon-group i{

	font-size:20px;

	color:#fff;

	float:left;

	border-radius:50%;

	width:40px;

	height:40px;

	text-align:center;

	line-height:40px;

	background-color:#000;

}



.icon-group i.red {

	background-color:#ee3d43;

}



.icon-group i.green {

	background-color:#33b7ad;

}



.icon-group h3{

	color:#000;

	font-size:14px;

	margin:0;

	line-height:1.5;

	margin-left:48px;

	font-weight: 600;

}



.icon-group p{

	font-size:11px;

	margin:0;

	margin-left:48px;

	line-height:1;

	color:#878787;

}



.icon-group + .icon-group {

	margin-left:30px;

}



@media (min-width: 992px) {

	#header.header14 #mini-cart {

		position: absolute;

		top:100%;

		right:-2px;

		bottom:auto;

		z-index: 999;

		margin:0;

	}

}



@media (min-width: 992px) and (max-width: 1199px) {

	#header.header14 .searchform {

		width:370px;

	}



	#header.header14 .searchform input {

		width:198px;

	}

}



@media (max-width: 991px) {

	#header.header14 .searchform {

		width:370px;

	}



	#header.header14 .searchform input {

		width:190px;

	}



}



@media (min-width: 768px) and (max-width: 991px) {

	.icon-group-container {

		position: absolute;

		left:-220px;

		top:50%;

		white-space: nowrap;

		transform:translateY(-50%);

		-webkit-transform:translateY(-50%);

		-ms-transform:translateY(-50%);

	}

}



@media (max-width: 767px) {

	.icon-group {

		display: none;

	}

}

@media (max-width: 480px) {

	#header.header14 #mini-cart {

		padding:0;

	}



	#header.header14 .searchform {

		width:300px;

	}



	#header.header14 .searchform input {

		width:138px;

	}

}



/* header15- index16.html*/

#header.header15,

#header.header15 #menu-container {

	background-color: transparent;

}



#header.header15 #header-top {

	background-color: #b7a788;

}



#header.header15 #header-inner .container .header-center {

	padding-left:25px;

}



#header.header15 .currency-switcher li:hover > a,

#header.header15 .view-switcher li:hover > a {

	background-color: transparent;

}



.v2 #header.header15  .currency-switcher > li > ul,

.v2 #header.header15 .view-switcher > li ul {

	border-radius: 0;

}



#header.header15 .top-links a:hover {

	color:#fff;

}



.v2 #header.header15 .currency-switcher > li > ul,

.v2 #header.header15 .view-switcher > li ul,

#header.header15 #mini-cart.dropdown .dropdown-menu,

#header.header15 .menu ul,

#header.header15 .menu .megamenu,

#header.header15 #mini-cart .dropdown-cart-content,

#header.header15 .tip,

#header.header15 .searchform {

	border-radius: 0;

}



#header.header15 #header-inner .header-contact {

	color:#777;

}



#header.header15 #header-inner .header-contact a,

#header.header15 #header-inner .header-contact a:hover {

	color:#333745;

}



#header.header15 #header-inner .header-contact a:hover {

	text-decoration: underline;

}





#header.header15 #mini-cart .minicart-icon {

	color:#39333f;

}



#header.header15 #mini-cart .cart-items {

	color:#fff;

}



#header.header15 .searchform-popup .search-toggle,

#header.header15 .mobile-toggle {

	color:#333;

}



.v2 #header.header15 #header-inner .header-contact .separator {

	margin:0 8px;

	color:#999;

}



#header.header15 #mini-cart.dropdown .dropdown-menu:before {

	border-bottom-color:#b7a788;

}



#header.header15 #mini-cart.dropdown .dropdown-menu,

#header.header15 .menu ul,

#header.header15 .menu .megamenu {

	border-top-color:#b7a788;

}



.header15 #mini-cart.dropdown .dropdown-menu ul li.empty {

	padding:0;

}



#header.header15 .searchform {

	background-color: #fff;

	border:3px solid #b7a788;

	width:450px;

}



#header.header15 .searchform input,

#header.header15 .searchform button {

	height:38px;

	line-height: 38px;

}



#header.header15 .searchform input {

	padding-right:15px;

	padding-left:15px;

	color:#777;

}



#header.header15 .searchform button {

	color:#333;

}



#header.header15 .searchform .text {

	width: calc(100% -  40px);

}



#header.header15 .searchform .button-wrap {

	width:40px;

}



#header.header15 .searchform input {

	width:100%;

	border-right:none;

}



#header.header15 .searchform button {

	padding:0 10px;

}



.v2 #header:not(.header13) .currency-switcher > li > a {

	padding-left:0;

}



@media (max-width: 767px) {

	#header.header15 .searchform {

		width:300px;

	}

}



@media (max-width: 480px) {

	#header.header15 #mini-cart .cart-head {

		border-radius: 0;

		background: #b7a788;

	}



	#header.header15 #mini-cart .minicart-icon {

		color:#fff;

	}

}



/* Top Newsletter */

#top-newsletter {

	background-color: #2b262f;

	padding:10px 0;

	color:#fff;

}



#top-newsletter .lside {

	font-size: 16px;

	line-height: 30px;

	font-family: Georgia, Verdana;

}



#top-newsletter .rside > div {

	display: inline-block;

	vertical-align: middle;

}



#top-newsletter .rside-text p {

	margin-bottom: 0;

	line-height: 15px;

}



#top-newsletter .rside-text p:first-child {

	font-size:15px;

	font-weight: 700;

	font-family: Georgia, Verdana;

}



#top-newsletter .rside-text p:last-child {

	color:#a7a7a7;

	font-size:12px;

}



#top-newsletter .rside-form {

	padding-left:20px;

	position: relative;

}



#top-newsletter .rside-form input {

	width:300px;

	height:30px;

	font-size: 13px;

	line-height: 16px;

	padding:6px 8px;

	border:1px solid #ccc;

	color:#777;

}



#top-newsletter .rside-form button  {

	display: block;

	height:30px;

	font-size:14px;

	padding:0 15px;

	line-height: 30px;

	color:#000;

	position: absolute;

	right:0;

	top:0;

	border:none;

	background:transparent;

	text-transform:uppercase;

}



@media (min-width: 992px) {

	#top-newsletter .rside  {

		text-align: right;

	}

}



@media (max-width: 991px) {

	#top-newsletter .rside-form input  {

		width:160px;

	}

}



@media (max-width: 480px) {

	#top-newsletter {

		display: none;

	}

}





/* header13 - absolute- index17.html*/

#header.header13.header-absolute {

	background-color: transparent;

	border-bottom: 1px solid rgba(255,255,255,.25);

}



#header.header13.header-absolute #header-inner .container .header-center {

	padding-left: 8px;

	padding-right: 0;

}



.header13.header-absolute .menu > li.open > a > i,

.header13.header-absolute .menu > li.active > a > i{

	color:#fff;

}



.header13.header-absolute .menu > li.open > a,

.header13.header-absolute .menu > li.active > a {

	background-color: transparent;

	color:#fff;

}



.header13.header-absolute .menu > li > a {

	padding:7px 12.5px 6px;

	border-radius: 0;

	color:#fff;

	font-weight: 700;

}



.header13.header-absolute .menu > li > a > i,

#header.header13.header-absolute .mobile-toggle,

#header.header13.header-absolute .top-links a,

#header.header13.header-absolute .searchform-popup .search-toggle {

	color:#fff;

}



.header13.header-absolute .menu .megamenu-container .megamenu {

	left:45px;

	right:45px;

}



.header13.header-absolute .menu ul,

.header13.header-absolute .menu .megamenu {

	border-top-color: #3f4658;

}



#header.header13.header-absolute .top-links > li:after {

	color:#ccc;

}



#header.header13.header-absolute .separator,

#header.header13.header-absolute .currency-switcher a,

#header.header13.header-absolute .view-switcher a,

#header.header13.header-absolute .currency-switcher li:hover > a,

#header.header13.header-absolute .view-switcher li:hover > a {

	color:#101010;

}



#header.header13.header-absolute .top-links a {

	font-weight: 400;

}



#header.header13.header-absolute .searchform button:hover {

	color:#777;

}



.header13.header-absolute #mini-cart.minicart-inline {

	background-color: #fff !important;

    border-radius: 3px;

    color:#101010;

}



#header.header13.header-absolute #mini-cart.minicart-inline .dropdown-menu {

	border-top-color:#3f4658;

}



#header.header13.header-absolute #mini-cart.minicart-inline .cart-items,

#header.header13.header-absolute #mini-cart .minicart-icon {

	color:#101010;

	text-transform: uppercase;

}



#header.header13.header-absolute #mini-cart.dropdown.minicart-inline .dropdown-menu:before {

	border-bottom-color:#3f4658;

}



#header.header13.header-absolute .header-link {

	color:#fff;

}



#header.header13.header-absolute .header-link:hover {

	text-decoration: underline;

}



#header.header13.header-absolute .currency-switcher > li > a,

#header.header13.header-absolute .view-switcher > li > a,

#header.header13.header-absolute .header-link  {

	border-radius: 3px;

	background-color: #fff;

}



#header.header13.header-absolute .currency-switcher > li:hover > a,

#header.header13.header-absolute .view-switcher > li:hover > a{

	background-color: #fff;

}



#header.header13.header-absolute .switcher-wrap {

	margin-left:5px;

}



@media (max-width: 767px) {

	.skin17 #header #header-inner .container {

		padding-left:15px;

		padding-right:15px;

	}

}

@media (max-width: 480px) {

	#header.header13.header-absolute #header-inner .container {

		padding-top:30px;

		padding-bottom: 20px;

	}



	.header13.header-absolute #mini-cart .dropdown-cart-content {

		padding:30px 15px;

	}

}





/* =============================================

------------------ 5.Content ---------------

==============================================*/



/* Parallax class will trigger plugin for parallax bg */

/* You can use parallax-fixed class for fixed background parallax */

.parallax,

.parallax-fixed {

  position: relative;

  background-attachment: fixed;

  -webkit-background-size: cover;

  background-size: cover;

  background-position: 50% 0;

  /* to prevent empy bg area*/

  background-repeat: repeat-y;

  overflow: hidden;

}



/* vertical center with display table */

.vcenter-container {

  display:table;

  table-layout: fixed;

  width:100%;

  height:100%;

}



.vcenter {

  display:table-cell;

  vertical-align: middle;

}





/* -------------------------

Tabs  -------------------- */

.product-tab {

	margin-bottom: 3em;

}



.product-center .product-tab {

	margin-bottom: 1em;

	margin-top: 0.5em;

}



.nav-tabs {

	border-bottom: 1px solid #eee;

	margin-bottom:0;

}



.nav-tabs > li  {



}



.nav-tabs > li > a {

	color:#606060;

	transition: background 0.5s ease, color 0.04s;

	-webkit-transition: background 0.5s ease, color 0.04s;

}



.nav-tabs > li > a {

	display: inline-block;

    float: none;

    font-size: 1em;

    font-weight: normal;

    line-height: 24px;

    margin-right: 1px;

    border-radius: 5px 5px 0 0;

    padding: 10px 15px;

    color:#9ac93d;

    background: #f4f4f4;

    border-left: 1px solid #eee;

    border-right: 1px solid #eee;

    border-top: 3px solid #eee;

}



.nav-tabs > li > a > i {

	margin-right:10px;

}



.nav-tabs > li > a:hover,

.nav-tabs > li > a:focus  {

	border-bottom-color: transparent;

    border-top: 3px solid #9ac93d;

    box-shadow: none;

}



.nav-tabs > li.active > a,

.nav-tabs > li.active > a:hover,

.nav-tabs > li.active > a:focus {

	color: #9ac93d;

	background: #fff;

    border-left: 1px solid #eee;

    border-right: 1px solid #eee;

    border-top: 3px solid #9ac93d;

    padding: 10px 15px 11px !important;

}



@media (max-width: 767px) {

	.nav-tabs > li {

		float:none;

		width:100%;

	}



	.nav-tabs > li > a,

	.nav-tabs > li.active > a {

		display: block;

		border-radius: 0;

		border-top-width: 1px;

		border-color:#ddd;

	}



	.nav-tabs > li > a:hover,

	.nav-tabs > li > a:focus,

	.nav-tabs > li.active > a,

	.nav-tabs > li.active > a:hover,

	.nav-tabs > li.active > a:focus {

		border-top:1px solid #ddd !important;

		border-color:#ddd;

	}

}





/* Breadcrumb */

.page-top {

	/*-color: #e1e1e1;*/

	margin-bottom: 20px;

	z-index: 2;

	position: relative;

/*border-top:1px solid #e1e1e1;

	border-bottom:1px solid #e1e1e1;*/

}



.skin5 .page-top {

	background: none;

	margin: 0px;

}



.breadcrumb {

	background-color: transparent;

	padding: 7.5px 0 5.5px 0;

	margin-bottom: 0;

	border-radius: 0;

	font-size:0;

}



.breadcrumb > li {

	font-size:12px;

	line-height: 24px;

	font-weight: 600;

}



/*

.breadcrumb > li + li:before {

	display: inline-block;

	content: "\f054";

	font: normal normal normal 14px/1 FontAwesome;

	font-size: 0.8em;

	width:25px;

	text-align: center;

	color:#666;

} */



.skin5 .breadcrumb > li + li:before {

	color: #777;

}



.breadcrumb > li > a:hover {

	color: #088a08;

}



.breadcrumb > li > a,

.breadcrumb > .active {

	/*color:#fff;*/

	color:#0aad0a;

}



.skin5 .breadcrumb > li > a,

.skin5 .breadcrumb > .active {

	color: #777777;

}





/* =============================================

---------------  6.Homepages  -------------

==============================================*/







/* -------------  6.1-index.html  -----------

--------------------------------------------*/





.sidebar {

	padding-bottom: 40px;

}



.widget {

    margin-bottom: 30px;

}



.widget:before,

.widget:after {

    content: " ";

    display: table;

}



.widget:after {

    clear: both;

}





.sidebar .widget .widget-title,

#content .widget .widget-title {

	line-height: 1.4;

	font-weight: 700;

	font-size:1.1429em;

	color: #313131;

	text-transform: uppercase;

	text-decoration: none;

	margin-bottom: 15px;

}



.widget .testimonial-carousel {

	margin-bottom: 0;

}



.skin1 blockquote.testimonial {

	background-color: #9ac93d;

	border-radius: 8px;

}



.skin1 .testimonial-arrow-down {

	border-top-color:#9ac93d;

}



.skin1 .owl-dot {

	background-color: #9ac93d;

	margin-bottom: 0;

}



.sidebar .testimonial-carousel .img-thumbnail {

	border-radius: 8px;

}



.skin1 .post-item .post-date .month {

	background-color: #9ac93d;

}



.skin1 .post-item .post-date .day,

.skin1 .post-item h4 a,

.skin1 .post-item h4 a:hover,

.skin1 .post-item a,

.skin1 .post-item a:hover{

	color: #9ac93d;

}



.widget-banner-slider a {

	display: block;

}



.widget-banner-slider img {

	display:block;

	width:100%;

	height:auto;

}



.widget-banner-slider.owl-carousel .owl-dots {

	margin-top:10px;

}



.widget.newsletter-widget-box {

    background: #f5f5f5;

    background-color: rgba(0, 0, 0, 0);

    background: - webkit-linear-gradient(top, #fff 1%, #f9f9f9 98%) repeat scroll 0 0 rgba(0, 0, 0, 0);

    background: linear-gradient(to bottom, #fff 1%, #f9f9f9 98%) repeat scroll 0 0 rgba(0, 0, 0, 0);

    -webkit-box-sizing: border-box;

    -moz-box-sizing: border-box;

    box-sizing: border-box;

    border-bottom: 1px solid #dfdfdf;

    border-left: 1px solid #ececec;

    border-radius: 8px;

    border-right: 1px solid #ececec;

    box-shadow: 0 1px 1px 0 rgba(0, 0, 0, 0.04);

    margin-left: auto;

    margin-right: auto;

    margin-top: 20px;

    min-height: 100px;

    position: relative;

    text-align: center;

    z-index: 1;

}





.widget.newsletter-widget-box .box-content {

	border-radius: 8px;

	border-top: 3px solid #9ac93d;

	border-top-width: 4px;

	padding: 30px 25px 25px 25px;

}



.widget.newsletter-widget-box .box-content h3 {

	margin-bottom: 10px;

	text-align: center;

}



.widget.newsletter-widget-box .box-content p {

    font-size: 0.9286em;

    margin-bottom: 10px;

}



.widget.newsletter-widget-box .box-content input[type="email"],

.widget.newsletter-widget-box .box-content input[type="text"] {

	width: 100%;

	max-width: 262px;

	text-align: center;

    color: #777;

    background: #fff;

    width: 100%;

    box-shadow: 0 1px 1px rgba(0, 0, 0, 0.075) inset;

    border-radius: 3px;

    outline: none;

    border:1px solid #ccc;

    padding:6px 8px;

}



.widget.newsletter-widget-box .box-content input[type="email"]:focus,

.widget.newsletter-widget-box .box-content input[type="text"]:focus {

	box-shadow:none;

}



.widget.newsletter-widget-box .box-content input[type="submit"] {

	margin:20px auto 0;

	background-color: #9ac93d;

	border-color:#9ac93d;

    border: 1px solid #9ac93d;

    color: #fff;

    padding: 6px 10px;

    border-radius: 3px;

    line-height: 1.42857;

}



.widget.newsletter-widget-box .box-content input[type="submit"]:hover,

.widget.newsletter-widget-box .box-content input[type="submit"]:focus {

	background-color: #0099e6;

	border-color:#0099e6;

}





.skin1 .owl-prev,

.skin1 .owl-next {

	color:#9ac93d;

}



.skin1 .owl-prev:hover,

.skin1 .owl-next:hover {

	color:#0099e6;

}



ul.product_list_widget,

.widget ul.product_list_widget {

    list-style: none outside;

    padding: 0;

    margin: 0;

    border-width: 0 !important;

}



ul.product_list_widget li,

.widget ul.product_list_widget li {

    border-width: 0;

    position: relative;

    padding: 0.5714em 0 0.5714em 0;

    margin: 0;

    list-style: none;

    *zoom: 1;

}



ul.product_list_widget li:before,

.widget ul.product_list_widget li:before,

ul.product_list_widget li:after,

.widget ul.product_list_widget li:after {

    content: " ";

    display: table;

}



ul.product_list_widget li:after, .widget ul.product_list_widget li:after {

    clear: both;

}



ul.product_list_widget li:first-child, .widget ul.product_list_widget li:first-child {

    padding-top: 0;

}



ul.product_list_widget li:last-child, .widget ul.product_list_widget li:last-child {

    padding-bottom: 0;

}



ul.product_list_widget li .product-image,

.widget ul.product_list_widget li .product-image {

    float: left;

    width: 96px;

    padding: 2px;

    margin-bottom: 0;

    border-radius: 5px;

}



ul.product_list_widget li .product-image img,

.widget ul.product_list_widget li .product-image img {

    width: 100%;

    height: auto;

    border-radius: 3px;

}



ul.product_list_widget li .product-image img,

.widget ul.product_list_widget li .product-image img {

    position: relative;

    opacity: 1;

}



ul.product_list_widget li .product-image .product-image-hover,

.widget ul.product_list_widget li .product-image .product-image-hover {

    position: absolute;

    left: 0;

    right: 0;

    top: 0;

    bottom: 0;

    margin: auto;

    opacity: 0;

}



ul.product_list_widget li .product-image:hover .product-image-normal,

.widget ul.product_list_widget li .product-image:hover .product-image-normal {

    opacity: 0;

}



.widget .product-image .inner {

	position: relative;

}



ul.product_list_widget li .product-image:hover .product-image-hover,

 .widget ul.product_list_widget li .product-image:hover .product-image-hover {

    opacity: 1;

}



ul.product_list_widget li .product-details,

.widget ul.product_list_widget li .product-details {

    position: relative;

    padding-top: 3px;

    margin-left:108px;

    margin-bottom: 0;

}



ul.product_list_widget li .product-details a,

.widget ul.product_list_widget li .product-details a {

    display: block;

    color: #777;

    text-decoration: none;

}



ul.product_list_widget li .product-details a:hover,

.widget ul.product_list_widget li .product-details a:hover {

	color:#9ac93d;

}



ul.product_list_widget li .product-details .amount,

.widget ul.product_list_widget li .product-details .amount {

    color: #444;

    font-size: 1.0714em;

    font-weight: 600;

    line-height: 2.3;

    vertical-align: middle;

}



ul.product_list_widget li .product-details .amount .currency,

.widget ul.product_list_widget li .product-details .amount .currency,

ul.product_list_widget li .product-details .amount .decimal,

.widget ul.product_list_widget li .product-details .amount .decimal {

    font-size: 0.75em;

    font-weight: 400;

}



ul.product_list_widget li .product-details .amount .currency .decimal,

.widget ul.product_list_widget li .product-details .amount .currency .decimal {

    font-size: 1em;

}



ul.product_list_widget li .product-details ins,

.widget ul.product_list_widget li .product-details ins {

    text-decoration: none;

    vertical-align: baseline;

}



ul.product_list_widget li .product-details del,

.widget ul.product_list_widget li .product-details del,

ul.product_list_widget li .product-details .from,

.widget ul.product_list_widget li .product-details .from {

    color: #a7a7a7;

    font-size: 0.8em;

    margin-right: 3px;

    vertical-align: baseline;

}



ul.product_list_widget li .product-details del .amount,

.widget ul.product_list_widget li .product-details del .amount,

ul.product_list_widget li .product-details .from .amount,

.widget ul.product_list_widget li .product-details .from .amount {

    color: #a7a7a7;

}



ul.product_list_widget li dl, .widget ul.product_list_widget li dl {

    margin: 0;

    padding-left: 1em;

    border-left: 2px solid rgba(0, 0, 0, 0.1);

    *zoom: 1;

}

ul.product_list_widget li dl:before,

.widget ul.product_list_widget li dl:before,

ul.product_list_widget li dl:after,

.widget ul.product_list_widget li dl:after {

    content: " ";

    display: table;

}



ul.product_list_widget li dl:after, .widget ul.product_list_widget li dl:after {

    clear: both;

}



ul.product_list_widget li dl dt, .widget ul.product_list_widget li dl dt, ul.product_list_widget li dl dd, .widget ul.product_list_widget li dl dd {

    display: inline-block;

    float: left;

    margin-bottom: 1em;

}



ul.product_list_widget li dl dt, .widget ul.product_list_widget li dl dt {

    font-weight: 700;

    padding: 0 0 0.25em 0;

    margin: 0 4px 0 0;

    clear: left;

}



ul.product_list_widget li dl dd, .widget ul.product_list_widget li dl dd {

    padding: 0 0 0.25em 0;

}



ul.product_list_widget li dl dd p:last-child,

.widget ul.product_list_widget li dl dd p:last-child {

    margin-bottom: 0;

}



ul.product_list_widget li .star-rating,

.widget ul.product_list_widget li .star-rating {

    margin: 5px 0 0;

}



.widget .star-rating:before,

.widget .star-rating span:before{

	left:0;

}





.vinfo-boxes-container .vinfo-box {

	padding:0;

}



.vinfo-box-icon.vinfo-box-circle {

	display: inline-block;

	width:64px;

	height:64px;

	line-height: 60px;

	border:2px solid #ccc;

	font-size:28px;

	border-radius: 50%;

	color:#333;

}



.widget .info-box {

	text-align: left;

	padding:0;

	margin-bottom:25px;

}



.widget .info-box-icon {

	display: inline-block;

	width:45px;

	height:45px;

	line-height: 41px;

	border:2px solid #ccc;

	font-size:25px;

	color:#000;

	border-radius: 50%;

	text-align: center;

	margin-right: 15px;

}



.slider-title.text-center > .inline-title {

	padding:0 20px;

}



.slider-title.text-center .line {

	background-image: - webkit-linear-gradient(left, transparent, rgba(0, 0, 0, 0.2), transparent);

	background-image: linear-gradient(to right, transparent, rgba(0, 0, 0, 0.2), transparent);

}





.skin1 .home-banner-group .banner {

	margin-bottom: 35px;

}



.skin1 .banner,

.skin1 .banner img,

.skin1 .banner a:after {

	/*border-radius: 7px !important */

}



	.body-header-type-2 .banner,

	.body-header-type-2 .banner img,

	.body-header-type-2 .banner a:after,

	.skin5 .banner,

	.skin5 .banner img,

	.skin5 .banner a:after,

	.skin8 .banner,

	.skin8 .banner img,

	.skin8 .banner a:after,

	.skin15 .banner,

	.skin15 .banner img,

	.skin15 .banner a:after,

	.skin16 .banner,

	.skin16 .banner img,

	.skin16 .banner a:after {

		border-radius: 0 !important;

	}



@media (max-width: 767px) {

	.home-banner-group .banner {

		max-width: 270px;

		margin-right:auto;

		margin-left:auto;

	}

}



@media (max-width: 992px) {

	.widget-banner-slider {

		max-width: 270px;

		margin-right:auto;

		margin-left:auto;

	}

}







/* -------------  6.2-index2.html  -----------

--------------------------------------------*/



.links-block {

	border: 1px solid #ddd;

	border-radius: 7px;

	background: #fbfbfb;

}



.links-block-title {

	color: #000;

	border-radius: 7px 7px 0 0;

	background: #f5f5f5;

	border-bottom: 1px solid #ddd;

	font-size: 0.9286em;

	font-weight: 700;

	line-height: 20px;

	padding: 11px 15px 9px;

	margin: 0;

    text-transform: uppercase;

    position: relative;

    -webkit-transition: all 0.25s ease 0s;

    transition: all 0.25s ease 0s;

}





.links-block-title i,

.links-block-content ul li i {

	margin-right: 5px;

}



.links-block-content ul {

	margin:0;

}



.links-block-content ul li {

	display: block;

}



.links-block-content ul li > a,

.links-block-content ul li > span {

    color: #777;

    display: block;

    font-size: 1em;

    line-height: 19px;

    padding: 11px 5px;

    margin: 0 10px -1px;

    border-top: 1px solid #ddd;

}



.links-block-content ul li:first-child > a,

.links-block-content ul li:first-child > span {

    border-top: none;

}



.links-block-content ul li > a:hover {

	color:#9ac93d;

}



@media (max-width: 1199px) {



	.links-block {

        font-size: 13px;

    }



    .links-block-title {

        line-height: 20px;

        padding: 8px 12px 6px;

    }



    .links-block-content ul li > a,

	.links-block-content ul li > span {

        padding: 7px 5px;

        line-height: 19px;

        margin: 0 7px -1px;

	}

}



.bg-gray {

	background-color: #f0f0ed;

}



.bg-lightgray	{

	background-color: #f9f9f9;

}



.bg-white {

	background-color: #fff;

}



.clean-row {

	margin:0;

}



.info-boxes-container {

	margin:20px 0 20px;

    background: #fbfbfb;

    border: 1px solid #e1e1e1;

    border-radius: 5px;

}



.info-box {

	display: block;

	text-align: center;

	margin: 0;

	padding: 20px 0;

	font-size: 0;

}

.info-box-container:hover {



background-color: #ccc;

}



.info-box-icon,

.info-box-content {

	display: inline-block;

	vertical-align: middle;

}



.info-box-icon {

	font-size:32px;

	color:#000;

	margin:0 10px 0 0;

	width:1em;

	height:1em;

	line-height: 1em;

	text-align: center;

}



.info-box-content {

	text-align: left;

}





.info-box-content .info-box-title {

	font:600 16px/1.1 'Open Sans', Verdana, sans-serif;

	color:#313131;

	margin:0;

}



.info-box-content .info-box-desc {

	margin:3px 0 0 0;

	line-height: 1.2;

	font-size:12px;

	color:#313131;

}



@media (max-width: 991px) {

	.info-box-content {

		min-width: 215px;

	}



}



@media (min-width: 992px) {

	.info-box-container {

		border-right: 1px solid #e1e1e1;

	}



	.info-box-container:last-child {

		border-right:none;

	}



	.info-box-icon {

		text-align: right;

	}

}



#banner-container .banner {

	width:100%;

	margin-bottom: 1.98%;

	padding:0 11px;

}



.banner-row {

	margin-left:-11px;

	margin-right: -11px;

}



.banner a {

	display: block;

	position: relative;

}



.banner img {

	display: block;

	width:100%;

	height:auto;

	transition: all 0.35s ease 0s;

	-webkit-transition: all 0.35s ease 0s;

}



.banner a:after {

	content:'';

	display:block;

	position: absolute;

	height:100%;

	width:100%;

	left:0;

	top:0;

	transition: all 0.35s ease 0s;

	-webkit-transition: all 0.35s ease 0s;

	background-color: rgba(0,0,0, 0.15);

	opacity:0;

	z-index: 99;

	-webkit-transform: translate3d(0,0,0);

}



.banner:hover a:after {

	opacity:1;

}



.banner:hover img {

	opacity:0.9;

}



#banner-container .grid-sizer,

#banner-container .banner {

	width: 25%;

}



#banner-container .banner.w2 {

	width: 50%;

}



@media (max-width: 767px) {

	#banner-container .grid-sizer,

	#banner-container .banner,

	#banner-container .banner.w2 {

		width: 100%;

	}



}



.title-group {

	position: relative;

}



.slider-title {

	position: relative;

	margin: 0 0 1.25em;

	font-size: 1.1429em;

	line-height: 1.4;

	font-weight: 700;

	color: #313131;

	text-transform: uppercase;

}



.slider-title .inline-title {

	background-color: #fff;

	padding-right: 20px;

	position: relative;

	z-index: 2;

}



.skin5 .slider-title .inline-title {

	background: #fff;

}



.skin9 .slider-title .inline-title {

	background: #fff;

}



.slider-title .line,

.title-group .line {

	display: block;

/*	height: 1px;

	position: relative;

	width: calc( 100% - 50px);

	left:0;

	bottom: 0.7em;

	background-image: - webkit-linear-gradient(left, rgba(0, 0, 0, 0.2), rgba(0, 0, 0, 0.2) 70%, rgba(0, 0, 0, 0) 100%);

	background-image: linear-gradient(to right, rgba(0, 0, 0, 0.2), rgba(0, 0, 0, 0.2) 70%, rgba(0, 0, 0, 0) 100%);

    background: #9ac93d;

height: 3px;

width: 60%;

margin: 12px 0 0;

	z-index: 1;                         */

}



.title-group .line  {

	position: absolute;

	left:0;

	top:50%;

	z-index: 1;

}



@media (max-width: 480px) {

	.slider-title .line,

	.title-group .line {

		display: none;

	}

}





/* -------------  6.3-index4.html  -----------

--------------------------------------------*/



.content-info-box-wrapper {

	background-color: #fbfbfb;

	border-top: 1px solid #e1e1e1;

	border-bottom: 1px solid #e1e1e1;

	margin-bottom: 35px;

}



.content-info-box-wrapper .info-boxes-container {

	margin:0;

	border:none;

}



.skin4 .banner,

.skin4 .banner img,

.skin4 .banner a:after {

	border-radius:7px !important;

}



.skin4 .banner a:after {

	background-color: rgba(0,0,0, 0.04);

}





.icon-box {

	margin-bottom: 30px;

}





.icon-box .icon-container {

	display: block;

	float:left;

	width:64px;

	height:64px;

	border:2px solid #ccc;

	border-radius: 50%;

	line-height: 60px;

	font-size:28px;

	color:#333;

	text-align: center;

}



.icon-box .icon-box-block {

	margin-left:79px;

}





.icon-box .icon-box-block h3 {

	font:600 20px/1.2em 'Open Sans', Verdana;

	color:#000;

	margin:0;

}



.icon-box .icon-box-block h4 {

	color:#888;

	font-weight:300;

	font-size:11px;

	font-style:normal;

	line-height:1;

	margin-top:2px;

	margin-bottom:15px;

	text-transform: uppercase;

}



.icon-box .icon-box-block p {

	color:#666;

	margin:10px 0 0;

}



.skin4 .owl-dot {

	background-color:#9ac93d;

}



.thumb-info {

	display: block;

    overflow: hidden;

    position: relative;

    text-decoration: none;

    max-width: 100%;

}



.thumbnail {

    display: block;

    padding: 0px;

    margin-bottom: 0px;

    line-height: 1.42857;

    background-color: #fff;

    border: 0px solid #ddd;

    border-radius: 0px;

    -webkit-transition: border 0.2s ease-in-out;

    -o-transition: border 0.2s ease-in-out;

    transition: border 0.2s ease-in-out;

}



.thumbnail > img,

.thumbnail a > img {

    display: block;

    max-width: 100%;

    height: auto;

    margin-left: auto;

    margin-right: auto;

    transition: all 0.2s;

    -webkit-transition:all 0.2s;

}



.owl-carousel .thumbnail,

.owl-carousel .img-thumbnail {

	max-width: 99.5%;

}



.thumb-info:hover img {

	transform:scale(1.1, 1.1);

	-webkit-transform:scale(1.1, 1.1);

	-ms-transform:scale(1.1, 1.1);

}



.skin4 .post-item .post-date .month {

	background-color: #9ac93d;

}



.skin4 .post-item .post-date .day,

.skin4 .post-item h4 a,

.skin4 .post-item h4 a:hover,

.skin4 .post-item a,

.skin4 .post-item a:hover{

	color: #9ac93d;

}





.parallax-info {

	position: relative;

	background-image: url('../images/parallaxbg.jpg');

}



.parallax-info.parallax-info2 {

	background-image: url('../images/parallaxbg2.jpg');

}



.parallax-info.parallax-info.v3 {

	background-image: url('../images/parallaxbg7.jpg');

}



.parallax-info .overlay {

	background-color: rgba(32,32,32,0.82);

	position: absolute;

	left:0;

	right:0;

	top:0;

	bottom:0;

	z-index:20;

}



.parallax-info.parallax-info2 .overlay {

	background-color: rgba(0,0,0, 0.75);

}



.parallax-info .container {

	position: relative;

	z-index: 30;

}



.info-carousel-block {

	text-align: center;

}



.info-carousel-block h2,

.info-carousel-block h4 {

	font-family: 'Open Sans', Verdana;

	color:#fff;

}



.info-carousel-block h2 {

	line-height: 1.2;

	font-size: 4.2857em;

	font-weight: 600;

	letter-spacing: -1px;

	margin:0;

	text-transform: uppercase;

}



.parallax-info2 .info-carousel-block h2 {

	margin-bottom: 5px;

}



.parallax-info2 .info-carousel-block h2 strong {

	font-weight: 800;

}



.info-carousel-block h4 {

	font-size:1.5714em;

	font-weight: 300;

	margin:0 0 14px 0;

}



.info-carousel-block .btn-link {

	font-size:1.1429em;

	padding:0;

	margin:15px 0;

}



.parallax-info2 .info-carousel-block .btn-link {

	margin-bottom: 0;

}



.info-carousel-block .btn-link,

.info-carousel-block .btn-link:hover,

.info-carousel-block .btn-link:focus {

	color:#fff;

}



.info-carousel-block .btn-link:hover,

.info-carousel-block .btn-link:focus {

	text-decoration: underline

}





.parallax-info .owl-dot {

	background-color: #fff;

	width:11px;

	height:11px;

	margin:0 6px;

}



.parallax-info.parallax-info2 .owl-dot {

	width:8px;

	height:8px;

	background-color: #a0a09f;

	margin:0 7px;

	opacity:1;

}



.skin11 .parallax-info.parallax-info2 .owl-dot:hover,

.skin11 .parallax-info.parallax-info2 .owl-dot.active {

	background-color: #7aa93c;

}



/* -------------  6.4-index5.html  -----------

--------------------------------------------*/



@media (min-width: 768px) {

	.container.no-padding {

		padding:0;

	}

}



.container-heading {

	padding:15px 0;

}



.container-heading h3 {

	font-size:16px;

	color:#333;

	text-align: center;

	font-family: 'Open Sans', Verdana;

	font-weight: 700;

	line-height: 27px;

	margin: 0;

}



.product-slider {

	padding-bottom:35px;

}



.skin5 .product-image .onhot,

.skin5 .product-image .onsale,

.skin5 .onhot,

.skin5 .onsale,

.skin5 .product-action .product-btn   {

    border-radius: 0;

}



.skin5 .product-image,

.skin5 .product-image img{

	padding:0;

	border:none;

	border-radius: 0;

}



.product-slider .product-image {

	font-size:1.2em;

}



.skin5  .owl-dot {

	background-color:#9ac93d;

}



.skin5 .banner a:after {

	background-color: rgba(0,0,0, 0.05);

}



@media (max-width: 480px) {

	.col-xss-12 {

		float:none;

		width:100%;

	}

}



.product-group-container {

	padding-top:15px;

	padding-bottom: 35px;

}



.product-group-container .product {

	margin-bottom: 30px;

}



.vinfo-box {

	text-align: center;

	padding:0 50px;

	margin-bottom: 30px;

}



.vinfo-box-icon {

	display: inline-block;

	font-size: 28px;

	color:#333;

}



.vinfo-box-title {

	font-family: 'Open Sans', Verdana;

	font-size:15px;

	font-weight: 600;

	margin:25px 0 15px;

	line-height: 1.2em;

	color:#000;

}





.vinfo-box-desc {

	color:#666;

	margin:0 auto;

}



.icon-read {

	display: block;

	padding:10px 0;

	color:#9ac93d;

}



.icon-read:hover,

.icon-read:focus {

	color:#0099e6;

	text-decoration: underline;

}





/* Partners Carousel */

.brands-carousel-container {

	padding:0 20px;

}



.brands-carousel-container.no-padding {

	padding:0;

}



.brand a {

	display:block;

	transition: all 0.4s ease;

	-webkit-transition: all 0.4s ease;

	position: relative;

	text-align: center;

}



.owl-item .brand img {

	display:inline-block;

	max-width:none;

	width:100%;

	height: auto;

}



.brands-carousel-container .owl-carousel .owl-item .brand img {

	display:inline-block;

	max-width:100%;

	width:auto;

	height: auto;

}





/* -------------  6.5-index6.html  -----------

--------------------------------------------*/



.banner-group-row .container-fluid {

	padding:0 10px;

}



.banner-group-row .row {

	margin:0 -10px;

}



.banner-group-row [class^="col-"],

.fullwidth-row [class^="col-"] {

	padding:0;

}



.skin6 .banner a:after {

	background-color: rgba(0, 136, 204, 0.15);

}





.fullwidth-row .row {

	margin:0;

	position: relative;

}



.fullwidth-row .special-col {

	padding-top: 4% !important;

	padding-right: 6% !important;

	padding-bottom: 4% !important;

	padding-left: 6% !important;

	background-color: #f9f9f9;

}



.bg-col-container {

	position: static;

}



.fullwidth-row .bg-col {

	background-size: cover;

	background-position: center center;

	background-color: rgb(249, 249, 249);

	background-repeat: no-repeat;

	position: absolute;

	width:50%;

	left:0;

	right:0;

	bottom:0;

	margin-right: 50%;

	top:0;

}



.fullwidth-row .special-col + .bg-col-container > .bg-col {

	margin-left:50%;

	margin-right: 0;

	right:0;

}



.fullwidth-row .bg-col.bg-1 {

	background-image: url('../images/background1.jpg');

}





.fullwidth-row .bg-col.bg-2 {

	background-image: url('../images/background2.jpg');

}



.title {

	color:#000;

	font:600 28px/34px 'Open Sans', Verdana;

	margin-bottom: 5px;

}



.title-desc {

	margin-bottom: 25px;

	font-weight: 400;

}



.title.spaced {

	margin:35px 0 25px;

}



@media (max-width: 480px) {

	.title {

		font-size:20px;

	}

}



.skin6 .product-image .onhot,

.skin6 .product-image .onsale {

    border-radius: 0;

}



.skin6 .product-image,

.skin6 .product-image img{

	padding:0;

	border:none;

	border-radius: 0;

}



.skin6 .product h3 a:hover,

.skin6 .product h3 a:focus {

	color:#000;

}



.product .product-image .product-btn {

	border-radius:0;

	background-color: #fff;

	position: absolute;

	bottom:16px;

	padding:0;

	width:2.2em;

}



.product:hover .product-image .product-btn.btn-add-cart,

.product .product-image .product-btn.btn-add-cart {

	border-radius:0;

	border-color: #000000;

	color:#000000;

	background-color: #fff;

	position: absolute;

	left:0.8em;

	opacity:0;

}



.product .product-image .product-btn.btn-add-cart i {

	margin:0;

}



.product .product-image .product-btn.btn-add-cart:hover,

.product .product-image .product-btn.btn-add-cart:focus {

	background-color: #000;

	border-color: #000000;

	color:#fff;

}



.product .product-image .product-btn.btn-wishlist {

	right:0.8em;

}



.product .product-image .product-btn.btn-quickview {

	font-size: 0.9em;

	position: absolute;

	top: 0;

	right: 0;

	left: auto !important;

	bottom:auto !important;

	width: auto;

	height: auto;

	line-height: 1.1;

	margin: 0;

	padding:0.7937em;

	text-indent: 0;

	border-radius: 0 0 0 0 !important;

	background: #52b9b5;

	color: #fff;

	-webkit-transition: all 0.25s ease 0s;

	-moz-transition: all 0.25s ease 0s;

	transition: all 0.25s ease 0s;

}



.product .product-image .product-btn.btn-quickview i {

	margin-right: 0.5714em;

}



.product .product-image .product-btn.btn-wishlist,

.product .product-image .product-btn.btn-quickview {

	opacity:0;

	transform:translateX(0);

	-webkit-transform:translateX(0);

	-ms-transform:translateX(0);

}



.product .product-image .product-btn.btn-quickview:hover,

.product .product-image .product-btn.btn-quickview:focus {

	background-color: #64c0bd;

}



.product:hover .product-image .product-btn.btn-add-cart,

.product:hover .product-image .product-btn.btn-wishlist,

.product:hover .product-image .product-btn.btn-quickview {

	opacity:1;

}





/* -------------  6.6 index7.html  -----------

--------------------------------------------*/



.banner-home-group  {

	margin-bottom: 25px;

}



@media (max-width: 991px) {

	.banner-home-group  {

		margin-bottom: 15px;

	}

}



.banner-home-group [class^="col-"] {

	padding:0 4px;

}



.banner-home-group .row {

	margin-left:-4px;

	margin-right:-4px;

}



.banner-home-group .banner {

	margin-bottom: 8px;

}



.skin7 .banner a:after {

	background-color: rgba(0,0,0, 0.1);

}



.skin7 .product h3 a:hover {

	color:#65829d;

}



.skin7 .product-image .onhot,

.skin7 .product-image .onsale,

.skin7 .onhot,

.skin7 .onsale,

.skin7 .product-action .product-btn   {

    border-radius: 0;

}



.skin7 .product-image,

.skin7 .product-image img{

	padding:0;

	border:none;

	border-radius: 0;

}



.skin7 .owl-dot {

	background-color:#65829d;

}



.skin7 .product:hover .product-btn.btn-add-cart {

	background-color: #65829d;

	border-color:#65829d;

}



.skin7 #main-content .product .product-image .product-btn.btn-add-cart {

	background-color: #fff;

	color:#65829d;

}



.skin7 #main-content .product .product-image .product-btn.btn-add-cart:hover {

	background-color: #65829d;

	border-color:#65829d;

	color:#fff;

}



.skin7 .owl-prev,

.skin7 .owl-next {

	color:#65829d;

}



.skin7 .owl-prev:hover,

.skin7 .owl-next:hover {

	color:#758fa7;

}



.banners-carousel {

	margin-bottom: 50px;

}



.banners-carousel .banner {

	margin-bottom:0;

	overflow: hidden;

}



.banners-carousel .banner a:after {

	opacity:0;

}



.banners-carousel .banner img {

	transition: all 0.2s linear;

	-webkit-transition: all 0.2s linear;

}



.banners-carousel .banner:hover img {

	transform:scale(1.08);

	-webkit-transform:scale(1.08);

	-ms-transform:scale(1.08);

	opacity:1;

}



.banner-info {

    bottom: 10%;

    position: absolute;

    left: 0;

    right: 0;

    text-align: center;

}



.banner-info h3 {

    display: inline-block;

    -webkit-transition: all 0.3s;

    -moz-transition: all 0.3s;

    transition: all 0.3s;

    background: rgba(36, 27, 28, 0.9);

    color: #fff;

    font-size: 18px;

    line-height: 1em;

    font-weight: 700;

    letter-spacing: -1px;

    padding: 9px 11px 9px;

    text-shadow: 1px 1px 1px rgba(0, 0, 0, 0.2);

    text-transform: uppercase;

    z-index: 1;

    margin:0;

}





.col-md-2 .product {

	margin-bottom: 20px;

}



.post-carousel {

	margin-bottom: 30px;

}



.post-item .post-date {

	float:left;

	margin:3px 10px 8px 0;

	width:40px;

	text-align: center;

}



.post-item h4 {

	margin-bottom: 7px;

}



.post-item h4 a,

.post-item h4 a:hover,

.post-item a,

.post-item a:hover {

	color:#65829d;

}



.post-item h4 a:hover,

.post-item a:hover {

	text-decoration: underline;

}



.post-item .post-date .day {

	color: #65829d;

	background-color: #f4f4f4;

	border-radius: 0 0 0 0;

	display: block;

	font-size: 16px;

	font-weight: 500;

	font-weight: bold;

	padding: 10px 0;

}



.post-item .post-date .month {

	background-color: #65829d;

	border-radius: 0 0 0 0;

	box-shadow:inset 0 -1px 0 0 rgba(0, 0, 0, 0.07);

	color: #fff;

	font-size: 0.9em;

	padding: 0 0 2px;

	display: block;

}



.post-item .post-excerpt {

	margin-bottom: 10px;

	max-width: 270px;

}



.testimonial-carousel {

	margin-bottom: 30px;

}



blockquote.testimonial {

    background: #758fa7;

    border-radius: 0;

    border: 0;

    color: #666;

    font-family: Georgia, serif;

    font-style: italic;

    margin: 0;

    padding: 10px 50px;

    position: relative;

}



	.skin7 blockquote.testimonial {

		border-radius: 0;

	}



blockquote.testimonial:before {

    content: "\201C";

    left: 10px;

    top: 0;

    color: #fff;

    font-size: 80px;

    font-style: normal;

    line-height: 1;

    position: absolute;

}



blockquote.testimonial:after {

    color: #fff;

    font-size: 80px;

    font-style: normal;

    line-height: 1;

    position: absolute;

    bottom: -0.5em;

    content: "\201D";

    right: 10px;

}



blockquote.testimonial p {

    color: #fff;

    font-family: Georgia, serif;

    font-style: italic;

    font-size: 1.2em;

    line-height: 1.3;

}



.testimonial-arrow-down {

    border-left: 15px solid transparent;

    border-right: 15px solid transparent;

    border-top: 15px solid #758fa7;

    height: 0;

    margin: 0 0 0 25px;

    width: 0;

}



.testimonial-author {

    margin: 8px 0 0 8px;

}



.testimonial-author .img-thumbnail {

    float: left;

    margin-right: 10px;

    width: auto;

}



.testimonial-author .img-thumbnail img {

    max-width: 60px;

    height: auto;

}



.testimonial-author a {

    text-decoration: none;

}



.testimonial-author strong {

    color: #111;

    display: block;

    padding-top: 7px;

}



.testimonial-author span {

    color: #666;

    display: block;

    font-size: 12px;

}



.testimonial-author p {

    color: #999;

    margin: 0 0 0 25px;

    text-align: left;

}



.owl-carousel.close-dots .owl-dots {

	margin-top:0;

}



.owl-carousel.testimonial-carousel.close-dots .owl-dots {

	margin-top:10px;

}



/* -------------  6.7-index8.html  -----------

--------------------------------------------*/



.category-box {

	margin-bottom: 30px;

	overflow: hidden;

}



.category-box h4 {

	font:600 17px/27px 'Open Sans', Verdana;

	margin:0 0 14px 0;

	text-align: center;

	color:#818385;

}



.category-box .banner {

	position: relative;

}



.category-box .banner a:after {

	background-color: rgba(0,0,0, 0.2);

}



.category-box .banner-footer {

	position: absolute;

	left:0;

	right:0;

	top: auto;

	bottom: 0;

	z-index: 99;

	height: auto;

	background: #a1a2a3;

	color: #fff;

	-webkit-transition: -webkit-transform .35s;

	transition: transform .35s;

	-webkit-transform: translate3d(0,100%,0);

	-moz-transform: translate3d(0,100%,0);

	transform: translate3d(0,100%,0);

	text-align:center;

}



.category-box:hover .banner-footer,

.category-box:hover .banner-footer h2 {

	-ms-transform:translateY(0);

	-webkit-transform:translateY(0);

	transform:translateY(0);

}



.category-box .banner-footer h2 {

	margin:0;

	color:#fff;

	padding: 15px;

	font-size:14px;

	line-height: 1.35em;

	font-weight: normal;

	letter-spacing: normal;

	-webkit-transition: -webkit-transform .35s;

	transition: transform .35s;

	-webkit-transform: translate3d(0,100%,0);

	-moz-transform: translate3d(0,100%,0);

	transform: translate3d(0,100%,0);

	transition-delay:0.05s;

	-webkit-transition-delay:0.05s;

}





.skin8 .product h3 a:hover {

	color:#e13b3f;

}



.skin8 .product-image .onhot,

.skin8 .product-image .onsale,

.skin8 .onhot,

.skin8 .onsale,

.skin8 .product-action .product-btn   {

    border-radius: 0;

}



.skin8 .product-image,

.skin8 .product-image img{

	padding:0;

	border:none;

	border-radius: 0;

}



.skin8 .owl-dot {

	background-color:#e13b3f;

}



.small-title {

	font:600 17px/27px 'Open Sans', Verdana;

	margin:0 0 14px 0;

	color:#818385;

}



.skin8 .product .product-image .product-btn.btn-wishlist,

.skin8 .product .product-image .product-btn.btn-add-cart {

	background-color: #fff;

	color:#ed4949;

	border-color:#ed4949;

}



.skin8 .product .product-image .product-btn.btn-wishlist:hover,

.skin8 .product .product-image .product-btn.btn-add-cart:hover {

	background-color: #ed4949;

	color:#fff;

	border-color:#ed4949;

}





/* -------------  6.8-index9.html  -----------

--------------------------------------------*/



.skin9 .row {

	margin-left:-8px;

	margin-right:-8px;

}



.skin9 [class^="col-"] {

	padding:0 8px;

}



#slider-wrapper {

	padding:0 0 44.5px;

}





.content-info-box-wrapper.white {

	background-color: #fff;

	border:none;

	margin-bottom: 0;

}



.content-info-box-wrapper.white .info-box-container {

	background-color: #fff;

	border-color:#f5f5f5 !important;

}



.skin9 .content-info-box-wrapper.white .row.clean-row {

	margin-left:0px;

	margin-right: 0px;

	border-top: 1px solid #f5f5f5;

	border-bottom: 1px solid #f5f5f5;

}



.content-info-box-wrapper.white [class^=col-] {

	padding:0 15px;

}





.skin9 .banner a:after {

	background-color: rgba(0,0,0, 0.04);

}



.skin9 .container > .banner a:after {

	background-color: rgba(0,0,0, 0.005);

}



.skin9 .product h3 a:hover {

	color:#e13b3f;

}



.skin9 .product-image .onhot,

.skin9 .product-image .onsale,

.skin9 .onhot,

.skin9 .onsale,

.skin9 .product-action .product-btn   {

    border-radius: 0;

}



.skin9 .product-image,

.skin9 .product-image img{

	padding:0;

	border:none;

	border-radius: 0;

}



@media (max-width: 767px) {

	.col-xs-6 .banner {

		margin-bottom: 15px;

	}

}







/* -------------  6.9-index11.html  -----------

--------------------------------------------*/



.skin11 ul.product_list_widget li .product-details a:hover,

.skin11 .widget ul.product_list_widget li .product-details a:hover,

.skin11 .product h3 a:hover {

	color:#7aa93c;

}



.skin11 .owl-prev,

.skin11 .owl-next {

	color:#7aa93c;

	opacity:1;

}



.skin11 .owl-prev:hover,

.skin11 .owl-next:hover {

	color:#7aa93c;

	opacity:0.9;

}



.content-widgets.content-widgets2 {

	margin-bottom: 55px;

	font-size:12px;

}



.nav-ralign .owl-nav {

	margin-right:-9px;

}



#content .content-widgets2 .widget .widget-title {

	font-size:1.3em;

}



.v2 .sidebar ul.product_list_widget li .product-image,

.v2 .sidebar .widget ul.product_list_widget li .product-image,

.content-widgets2 ul.product_list_widget li .product-image,

.content-widgets2 .widget ul.product_list_widget li .product-image {

	width:86px;

}



.v2 .sidebar ul.product_list_widget li .product-details,

.v2 .sidebar .widget ul.product_list_widget li .product-details,

.content-widgets2 ul.product_list_widget li .product-details,

.content-widgets2 .widget ul.product_list_widget li .product-details {

	margin-left:98px;

}



.v2 .star-rating:before {

	color:#c3c5c9;

}



.v2 .sidebar ul.product_list_widget li .product-details .amount,

.v2 .sidebar .widget ul.product_list_widget li .product-details .amount,

.content-widgets2 ul.product_list_widget li .product-details .amount,

.content-widgets2 .widget ul.product_list_widget li .product-details .amount {

	font-size:1.25em;

}



.v2 .sidebar ul.product_list_widget li .star-rating,

.v2 .sidebar .widget ul.product_list_widget li .star-rating ,

.content-widgets2 ul.product_list_widget li .star-rating,

.content-widgets2 .widget ul.product_list_widget li .star-rating {

	margin-top:0;

	margin-bottom: 8px;

}



.skin11 .product .product-image .product-btn.btn-quickview {

	background: #7aa93c;

	border-color:#7aa93c;

}



.v2 .product .product-image .product-btn.btn-quickview {

	border-radius: 0 5px !important;

	font-size: 0.85em;

	line-height: 1.35;

}



.v2 .product .product-image .product-btn.btn-quickview:hover {

	text-decoration: underline;

	opacity:0.9;

}



.title-group  {

	margin-bottom: 10px;

	line-height: 0;

}



.title-group .nav-tabs.nav-links {

	display: inline-block;

	padding-right: 20px;

	background-color: #fff;

	position: relative;

	z-index: 5;

}



.nav-tabs.nav-links {

	border:none;

	margin-bottom: 0;

}



.nav-tabs.nav-links > li {

	line-height: 43px;

}



.nav-tabs.nav-links > li > a {

	background-color: transparent;

	border:none;

	color:#313131;

	padding:0;

	padding-left:15px;

	margin-left:12px;

	border-left:1px solid #ddd;

	font:700 16px/22px 'Open Sans', Verdana;

	text-transform: uppercase;

}



.nav-tabs.nav-links > li.active > a {

	padding:0 0 0 7px !important;

	padding-left:15px !important;

	margin-left:12px;

	border:none;

	border-left:1px solid #ddd;

}



.nav-tabs.nav-links > li:first-child > a,

.nav-tabs.nav-links > li.active :first-child > a  {

	padding-left:0 !important;

	margin-left:0 !important;

	border-left:none;

}



.nav-tabs.nav-links > li.active > a,

.nav-tabs.nav-links > li.active > a:hover,

.nav-tabs.nav-links  > li.active > a:focus {

	background-color: transparent;

	color:#7aa93c;

}



.nav-tabs.nav-links > li > a:hover,

.nav-tabs.nav-links  > li > a:focus {

	text-decoration: underline;

}





.tabs-container .tab-content {

	padding:0;

	border:none;

	box-shadow: none;

	-webkit-box-shadow:none;

}



@media (max-width: 767px) {

	.nav-tabs.nav-links > li {

		float:left;

		width:auto;

	}



	.nav-tabs.nav-links > li.active > a,

	.nav-tabs.nav-links > li.active > a:hover,

	.nav-tabs.nav-links > li.active > a:focus,

	.nav-tabs.nav-links > li > a:hover,

	.nav-tabs.nav-links > li > a:focus {

		border-top:none !important;

	}



	 .title-group {

	 	margin-bottom: 22px;

	 }

}



@media (max-width: 480px) {

	.title-group .nav-tabs.nav-links {

		padding-right: 0;

	}

}





/* -------------  6.10 - index12.html  -----------

-----------------------------------------------*/



.top-container {

	padding:29px 0 35px;

	background-color: #f4f4f4;

}



.top-container .row {

	margin-left:-8px;

	margin-right:-8px;

}



.top-container .slider-area,

.top-container  .side-area {

	padding:0 8px;

}



.top-container .side-area .row {

	margin:0;

}



@media (min-width: 992px) {



	.top-container .slider-area {

		width:72.3%;

	}



	.top-container  .side-area {

		width:27.7%;

	}



	.top-container  .slider-area,

	.top-container  .side-area  {

		float:left;

	}



	.top-container  .side-area .banner {

		margin-bottom: 10px;

	}

}



@media (min-width: 768px) and (max-width: 991px) {

	.top-container  .side-area .banner {

		float:left;

		width:33.3%;

		padding:8px;

	}



	.top-container  .side-area .row {

			margin:0 -8px;

	}

}



@media (max-width: 767px) {

	.top-container  .side-area .banner {

		padding:8px 0 0;

	}

}





.top-container .owl-carousel .owl-controls {

	position: absolute;

	bottom:20px;

	width:100%;

	margin:0;

}



.top-container .owl-carousel .owl-dots {

	margin:0;

	line-height: 0;

}



.skin12 .owl-carousel .owl-dot,

.top-container .owl-carousel .owl-dot {

	width:8px;

	height:8px;

	opacity:1;

	background-color: #a0a09f;

	margin:5px 7px;

}



.skin12 .owl-carousel .owl-dot:hover,

.skin12 .owl-carousel .owl-dot.active,

.skin12 .top-container .owl-carousel .owl-dot:hover,

.skin12 .top-container .owl-carousel .owl-dot.active {

	background-color: #ee3d43;

}



.tabs-container.grid .product {

	margin-bottom: 10px;

}



@media (min-width: 1200px) {

	.tabs-container.grid .product {

		margin-bottom: 30px;

	}

}



.grid-banners {

	margin:10px 0 30px;

}



.grid-banners .banner {

	margin-bottom: 10px;

}



.skin12 .product h3 > a:hover,

.skin12 .nav-tabs.nav-links > li.active > a,

.skin12 .nav-tabs.nav-links > li.active > a:hover,

.skin12 .nav-tabs.nav-links > li.active > a:focus,

.skin12 .post-item h4 a, .post-item h4 a:hover,

.skin12 .post-item a,

.skin12 .post-item a:hover,

.skin12 .post-item .post-date .day {

	color:#ee3d43;

}



.skin12 .post-item .post-date .month,

.skin12 .product .product-image .product-btn.btn-quickview {

	background: #ee3d43;

	border-color:#ee3d43;

}



.skin12 .product:hover .product-image .product-btn.btn-add-cart,

.skin12 .product .product-image .product-btn.btn-add-cart {

	background-color: #fff;

	color:#ee3d43;

	border-color:#ee3d43;

}



.skin12 .product .product-image .product-btn.btn-add-cart {

	border-radius: 4px;

}





.sidebar .widget-block .widget {

	margin:0;

}



.sidebar .widget-block {

	padding-bottom: 37px;

	margin-bottom: 30px;

	background: url('../images/border.png') center bottom no-repeat;

}



.custom-text-widget h2 {

	font-size: 20px;

	font-weight: 600;

	line-height: 1;

	color:#000;

	margin-bottom: 15px;

}



.custom-text-widget h5 {

	font:400 11px/1 Arial, Verdana;

	color:#878787;

	margin-bottom: 13px;

}



.custom-text-widget p {

	font-size: 14px;

	font-weight: 400;

	line-height: 1.42;

	color:#666;

}





/* -------------  6.11 - index13.html  -----------

-----------------------------------------------*/



.skin13 .info-boxes-container {

	border-radius: 0;

}



.info-boxes-sm .info-box {

	padding:13px 0;

}



.info-boxes-sm .info-box-icon {

	font-size: 34px;

}



.info-boxes-sm .info-box-content .info-box-title {

	font-size: 14px;

}



.skin13 .product h3 > a:hover,

.skin13 .nav-tabs.nav-links > li.active > a,

.skin13 .nav-tabs.nav-links > li.active > a:hover,

.skin13 .nav-tabs.nav-links > li.active > a:focus,

.skin13 .post-item h4 a, .post-item h4 a:hover,

.skin13 .post-item a,

.skin13 .post-item a:hover,

.skin13 .post-item .post-date .day,

.skin13 .product-categories li a:hover {

	color:#000;

}



.skin13 .owl-carousel .owl-dot:hover,

.skin13 .owl-carousel .owl-dot.active,

.skin13 .top-container .owl-carousel .owl-dot:hover,

.skin13 .top-container .owl-carousel .owl-dot.active {

	background-color: #000;

}



.skin13 .owl-prev,

.skin13 .owl-next {

	color:#000;

	opacity:1;

}



.skin13 .owl-prev:hover,

.skin13 .owl-next:hover {

	color:#000;

	opacity:0.9;

}



.skin13 .product-image {

	padding:0;

	border:none;

}



.skin13 .product-image,

.skin13 .product .product-image .product-btn.btn-quickview,

.skin13 .product-image img {

	border-radius: 0 !important;

}



.skin13 .product .product-image .product-btn.btn-quickview {

	background: #000;

	border-color:#000;

}



@media (min-width: 1200px) {

	.col-lg-2-4 {

		width:20%;

	}



	.col-lg-9-6 {

		width:80%;

	}

}



.skin13 .product .product-image .product-btn.btn-add-cart,

.skin13 .product .product-image .product-btn.btn-wishlist,

.skin13 .product .product-image .product-btn.btn-compare {

	bottom:16px;

	transition: all 0.1s linear;

	-webkit-transition: all 0.1s linear;

}



.skin13 .product .product-image .product-btn.btn-add-cart {

	left:46px;

	bottom:16px;

}



.skin13 .product .product-image .product-btn.btn-wishlist {

	right:auto;

	left:10px;

	bottom:16px;

}



.skin13 .product .product-image .product-btn.btn-compare {

	right:auto;

	left:82px;

	bottom:16px;

	opacity:0;

	border-color:#52b9b5;

	color: #52b9b5;

}



.skin13 .product .product-image .product-btn.btn-compare:hover {

	background-color: #52b9b5;

	color:#fff;

}



.skin13 .product:hover .product-image .product-btn.btn-compare {

	opacity:1;

}



.skin13 .product .product-image .product-btn {

	width:1.95em;

}



.skin13 .product .product-image .product-btn.btn-quickview {

	width:auto;

}



.skin13 #content .sidebar .widget .widget-title,

.skin13 .sidebar .widget .widget-title {

	color:#333;

	font-size: 15px;

	font-weight: 600;

	padding:8px 0;

	border-bottom: 1px solid #ddd;

}



.sidebar .widget .widget-title i {

	margin-right: 5px;

	font-size: 18px;

}



.feature-box-widget p {

	font-size: 14px;

	line-height: 1.5;

	margin-bottom: 10px;

}



.feature-box-widget a,

.feature-box-widget a:hover {

	color:#000;

}



.feature-box-widget a:hover {

	text-decoration: underline;

}



.category-shop-widget .product-categories {

	padding:0;

	margin-bottom: 5px;

}



.category-shop-widget .product-categories li {

	line-height: 40px;

	padding-left:12px;

	border-bottom:1px solid #ddd;

}



.category-shop-widget .product-categories li a {

	font-size: 15px;

	padding:0;

}



.skin13 #content .sidebar .widget.widget-shop2 .widget-title,

.skin13 .sidebar .widget.widget-shop2 .widget-title {

	padding-bottom:18px;

	margin-bottom: 0;

}



.widget.widget-shop2:first-child {

	margin-top:-8px;

}



.skin13 .slider-title {

	font-size: 15px;

	font-weight: 600;

}



/* -------------  6.12 - index14.html  -----------

-----------------------------------------------*/



.fullscreen {

	height:100vh;

}



#parallax-1 {

	background-image: url('../images/parallaxbg3.jpg');

}



#parallax-2 {

	background-image: url('../images/parallaxbg4.jpg');

}



#parallax-3 {

	background-image: url('../images/parallaxbg5.jpg');

}



#parallax-4 {

	background-image: url('../images/parallaxbg6.jpg');

}



.parallax-content {

	display: inline-block;

}



.parallax-content  h2,

.parallax-content  h3,

.parallax-content  h4 {

	color:#fff;

	line-height: 1;

}



.parallax-content.dark  h2,

.parallax-content.dark  h3,

.parallax-content.dark  h4 {

	color:#333;

}



.parallax-content  h2 {

	font-size: 79px;

	font-weight: 800;

	margin:5px 0 10px;

}



.parallax-lg .parallax-content h2 {

	letter-spacing: -6px;

	margin:0;

}



.parallax-content.smaller h2 {

	font-size: 61px;

	letter-spacing: -3px;

}



.parallax-content  h3 {

	font-weight: 300;

	font-size: 26px;

	text-transform: uppercase;

	margin:0;

}



.parallax-lg .parallax-content h3 {

	font-weight: 600;

}



.parallax-content  h3 * {

	vertical-align: middle;

}



.parallax-content  h3 > span {

	margin:0 15px;

}



.parallax-content  h4 {

	font-weight: 300;

	font-size: 23px;

	margin:0;

}



.parallax-content.smaller h4 {

	font-size: 18px;

	margin-bottom: 15px;

}



.parallax-content  h4 > span {

	display: inline-block;

	vertical-align: top;

	margin-top:5px;

}



.parallax-content img {

	display: inline-block;

	max-width: 100%;

	height:auto;

}



.parallax-lg .parallax-content h4 {

	font-weight: 400;

}



.parallax-content  h4 strong {

	font-weight: 800;

}



.parallax-lg {

	padding:250px 0;

}



.parallax-content .btn {

	font-size: 16px;

	padding:9px 27px;

	vertical-align: top;

	margin:5px 0 0 17px;

	font-weight: 600;

	transition: all 0.3s;

}



.parallax-content.smaller .btn {

	padding:7px 34px;

	font-weight: 400;

}



.btn.no-radius {

	border-radius: 0;

}



.btn-dark,

.btn-dark:hover,

.btn-dark:focus {

	background-color: #333;

	color:#fff;

}



.btn-white,

.btn-white:hover,

.btn-white:focus {

	background-color: #fff;

	color:#333;

}



.btn-white:hover,

.btn-white:focus,

.btn-dark:hover,

.btn-dark:focus {

	opacity:0.9;

}



.parallax-section .slider-title {

	font-size: 15px;

	margin:3px 0 15px;

	color:#fff;

	font-weight: 600;

}



.skin14.common-home .product-image {

	padding:0;

	border:none;

}



.skin14.common-home .product h3 > a,

.skin14.common-home .product h3 > a:hover,

.skin14.common-home .star-rating:before,

.skin14.common-home .price  {

	color:#fff;

}



.skin14 .light .rating-wrap .rating-before .rating-line {

    background-image: - webkit-linear-gradient(right, rgba(255, 255, 255, 0.1), rgba(255, 255, 255, 0.1) 40%, transparent);

    background-image: linear-gradient(to left, rgba(255, 255, 255, 0.1), rgba(255, 255, 255, 0.1) 40%, transparent);

}



.skin14 .light .rating-wrap .rating-after .rating-line {

    background-image: - webkit-linear-gradient(left, rgba(255, 255, 255, 0.1), rgba(255, 255, 255, 0.1) 40%, transparent);

    background-image: linear-gradient(to right, rgba(255, 255, 255, 0.1), rgba(255, 255, 255, 0.1) 40%, transparent);

}



.parallax-section .dark .slider-title,

.skin14 .dark .product h3 > a,

.skin14 .dark .product h3 > a:hover,

.skin14 .dark .star-rating:before,

.skin14 .dark .price {

	color:#333;

}



.skin14 .owl-carousel .owl-dot {

	width:8px;

	height:8px;

	opacity:1;

	background-color: #a0a09f;

	margin:5px 7px;

}



.skin14 .owl-carousel .owl-dot:hover,

.skin14 .owl-carousel .owl-dot.active,

.skin14 .top-container .owl-carousel .owl-dot:hover,

.skin14 .top-container .owl-carousel .owl-dot.active {

	background-color: #08c;

}



.skin14.common-home .product-image,

.skin14.common-home .product .product-image .product-btn.btn-quickview,

.skin14.common-home .product-image img {

	border-radius: 0 !important;

}



.skin14 .product .product-image .product-btn.btn-quickview {

	background: #08c;

	border-color:#08c;

}





@media (max-width: 991px) {

	.parallax-lg {

		padding:150px 0;

	}

}



@media (max-width: 767px) {

	.parallax-lg {

		padding:50px 0;

	}



	.parallax-content h3 > img {

		width:20px;

	}





	.parallax-content  h2 {

		font-size: 35px;

		margin:4px 0 7px;

	}



	.parallax-lg .parallax-content h2 {

		font-size: 30px;

		letter-spacing: -1px;

		margin:0;

	}



	.parallax-content.smaller h2 {

		font-size: 22px;

		letter-spacing: -1px;

	}



	.parallax-content  h3 {

		font-size: 12px;

	}



	.parallax-content  h3 > span {

		margin:0 10px;

	}



	.parallax-content  h4 {

		font-size: 11px;

	}

	.parallax-content  h4 > span {

		display: block;

	}



	.parallax-content.smaller h4 {

		font-size: 10px;

	}



	.parallax-content .btn {

		font-size: 10px;

		padding:5px 12px;

		margin:8px 0 0 0;

	}



	.parallax-content .btn,

	.parallax-content .btn.pull-right {

		float:none !important;

	}



	.parallax-content.smaller .btn {

		padding:4px 19px;

		margin:0;

	}

}



/* -------------  6.13 - index15.html  ----------

-----------------------------------------------*/



.grid-banners.smaller .row {

	margin:0 -4px;

}



.grid-banners.smaller [class^="col-"]{

	padding:0 4px;

}



.skin15 .product:hover .product-image .product-btn.btn-add-cart,

.skin15 .product .product-image .product-btn.btn-add-cart {

	border-color:#08c;

	color:#08c;

	border-radius:5px;

}



.skin15 .product .product-image .product-btn.btn-add-cart:hover {

	background-color: #08c;

	color:#fff;

}



.skin15 .product h3 > a:hover,

.skin15 .nav-tabs.nav-links > li.active > a,

.skin15 .nav-tabs.nav-links > li.active > a:hover,

.skin15 .nav-tabs.nav-links > li.active > a:focus,

.skin15 .post-item h4 a, .post-item h4 a:hover,

.skin15 .post-item a,

.skin15 .post-item a:hover,

.skin15 .post-item .post-date .day,

.skin15 .product-categories li a:hover {

	color:#08c;

}



.skin15 .owl-carousel .owl-dot {

	width:8px;

	height:8px;

	opacity:1;

	background-color: #a0a09f;

	margin:5px 7px;

}



.skin15 .owl-carousel .owl-dot:hover,

.skin15 .owl-carousel .owl-dot.active,

.skin15 .top-container .owl-carousel .owl-dot:hover,

.skin15 .top-container .owl-carousel .owl-dot.active {

	background-color: #08c;

}



.skin15 .product .product-image .product-btn.btn-quickview {

	background: #08c;

	border-color:#08c;

}



.skin15 .owl-prev,

.skin15 .owl-next {

	color:#08c;

	opacity:1;

}



.skin15 .owl-prev:hover,

.skin15 .owl-next:hover {

	color:#08c;

	opacity:0.9;

}



.skin15 .post-item .post-date .month,

.skin15 .product .product-image .product-btn.btn-quickview {

	background: #08c;

	border-color:#08c;

}



.skin15 .product:hover .product-image .product-btn.btn-add-cart,

.skin15 .product .product-image .product-btn.btn-add-cart {

	background-color: #fff;

	color:#08c;

	border-color:#08c;

}



.v2 .sidebar .widget .product_list_widget {

	font-size: 12px;

	margin-bottom: 6px;

}



.widget:first-child .icon-group:first-child {

	margin-top:10px;

}



.widget .icon-group {

	margin-bottom: 20px;

	min-height: 50px;

	display: block;

}

.widget .icon-group + .icon-group {

	margin-left:0;

}



.widget .icon-group i {

	width:50px;

	height:50px;

	font-size: 32px;

	line-height: 48px;

	border:1px solid #bbb;

	color:#000;

	background-color: transparent;

	margin-left:-5px;

}



.widget .icon-group h3 {

	color:#313131;

	font-size:16px;

	margin:0;

	line-height:1.5;

	margin-left:50px;

	padding-top:4px;

}



.widget .icon-group p {

	font-size:12px;

	margin:0;

	margin-left:50px;

	line-height:1;

}



@media (min-width: 1200px) {

	.grid-banners.smaller {

		margin-top:0;

	}

	.tabs-container.grid .product {

		margin-bottom: 20px;

	}

}



/* -------------  6.14 - index16.html  -----------

-----------------------------------------------*/

.banner-group .row {

	margin:0 -8px;

}



.banner-group [class^="col-"]{

	padding:0 8px;

}



.banner-group .banner {

	margin-bottom: 16px;

	position: relative;

}



.banner-content {

	position: absolute;

	top:0;

	left:0;

	right:0;

	bottom:0;

	z-index: 100;

	padding:0 25px;

	font-family: Georgia, sans-serif;

	font-size: 15px;

	line-height: 1.5;

	background-color: #b7a788;

	color:#564a34;

	text-align: left;

}



.banner-content.light {

	background-color: #2b262f;

	color:#ada4b5;

}



.banner-content h3 {

	font-size: 24px;

	color:#2b262e;

	line-height: 1;

	margin:0 0 5px;

	font-family: Georgia, sans-serif;

}



.banner-content.light h3 {

	color:#f2f4f3;

}



.banner-content hr {

	display: inline-block;

	background-image: none;

	border-top:1px solid #564a34;

	margin:15px 0;

	width:90px;

}



.banner-content.light hr {

	border-top-color:#ada4b5;

}



.banner-content p {

	line-height: 1.5;

	margin-bottom: 15px;

}



.banner-content a {

	color:#2b262f;

	text-transform: uppercase;

}



.banner-content a:after {

	display: none;

}



.banner-content a:hover,

.banner-content a:focus {

	color:#2b262f;

	text-decoration: underline;

}



.banner-content.light a,

.banner-content.light a:hover,

.banner-content.light a:focus {

	color:#fff;

}



@media (min-width: 768px)  and (max-width: 991px) {



	.banner-content {

		font-size: 10px;

		line-height: 1.5;

		padding:0 16px;

	}



	.banner-content h3 {

		font-size: 16px;

	}



	.banner-content hr  {

		width:60px;

	}



}



@media (max-width: 767px) {

	.blank-img {

		width:100%;

		max-height: 480px;

	}

}





/* -------------  6.15 - index17.html  -----------

-----------------------------------------------*/



.banner-side-group .row {

	margin-left:-15px;

	margin-right:-15px;

}



.banner-side-group [class^="col-"] {

	padding:0 15px;

}



.banner-side-group .banner {

	position: relative;

	margin-bottom: 20px;

}



.banner .category-title {

	display:block;

	position:absolute;

	left:-10px;

	bottom:20px;

	color:#fff;

	padding:15px 17px;

	font-size:15px;

	font-weight:600;

	line-height:1;

	min-width:174px;

	text-align:left;

	background-color:#3f4658;

}



.banner .category-title:after {

	content:"";

	width:10px;

	height:10px;

	border:5px solid transparent;

	border-right-color:#3f4658;

	border-top-color:#3f4658;

	display:block;

	position:absolute;

	left:0;

	top:100%;

}



.skin17 .product-image {

	padding:0;

	border:none;

	border-radius: 0;

}



	.skin17 .popup-gallery .product-image {

		padding: 0.2381em;

	}



.skin17 .product h3 a:hover {

	color:#3f4658;

}



.skin17 .product .product-image .product-btn.btn-quickview {

	background-color: #3f4658;

	border-color: #3f4658;

}



.skin17 .slider-title,

.skin17 .sidebar .widget .widget-title,

.skin17 #content .widget .widget-title {

	color:#3f4658;

	font-weight: 600;

	font-size: 19px;

	line-height: 26px;

	letter-spacing: 0;

	text-align: center;

	margin: 0 0 1.25em;

}



.skin17 .owl-carousel .post-item .post-excerpt {

	margin-right:0;

	text-indent: 0;

	max-width: none;

}



.skin17 .post-item h4  {

	font-size: 20px;

}



.skin17 .thumbnail {

	padding:2px;

	border-radius: 5px;

}



.skin17 .thumbnail a > img {

	border-radius: 4px;

}



.skin17 .thumb-info:hover img {

	transform:scale(1, 1);

	-webkit-transform:scale(1, 1);

	-ms-transform:scale(1, 1);

}



.skin17 .post-item a,

.skin17 .post-item h4 a,

.skin17 .post-item h4 a:hover,

.skin17 .post-item .post-date .day {

	color:#3f4658;

}



.skin17 .post-item h4 a:hover {

	text-decoration: none;

}



.skin17 .post-item .post-date {

	width:45px;

}



.skin17 .post-item .post-date .month {

	line-height: 18px;

	background-color: #3f4658;

}



.skin17 .owl-carousel .post-item  h4 {

	min-height: 58px;

	margin-bottom: 15px;

}



.skin17 .post-item .post-date {

	margin-top:0;

}



/* =============================================

-----------------  7.Category -------------

==============================================*/



.shop-loop-before,

.shop-loop-after {

	font-size:13px;

}



.shop-loop-before .product-ordering,

.shop-loop-before .pagination-container > *,

.shop-loop-before .gridlist-toggle {

	margin-bottom: 17px;

}



.shop-loop-before .product-ordering {

	float:left;

	margin-right: 20px;

}



.product-ordering {

	font-size:0.9286em;

}



.shop-loop-before label,

.shop-loop-after label {

    margin-bottom: 0;

    vertical-align: middle;

}



.product-ordering select,

.product-viewing select {

	margin-left: 7px;

	padding: 0 0 0 0.22em;

	height: 2.2em;

    box-shadow:0 1px 1px rgba(0, 0, 0, 0.075) inset;

    font-size:1em;

    line-height: 1.42857;

    vertical-align: middle;

    border:1px solid #ccc;

    border-radius: 3px;

}



.product-viewing,

.product-viewing select {

    display: inline-block;

    vertical-align: top;

}



.gridlist-toggle {

	float:left;

	vertical-align: top;

	font-size:0.9286em;

}



.gridlist-toggle > a {

    border: 1px solid #ccc;

    border-radius: 3px;

    color: #ccc;

    display: inline-block;

    font-family: "Elusive-Icons";

    width: 2.2em;

    height: 2.2em;

    line-height: 2.15em;

    margin-right: 4px;

    text-decoration: none;

    text-align: center;

    -webkit-transition: all 0.25s ease 0s;

    -moz-transition: all 0.25s ease 0s;

    transition: all 0.25s ease 0s;

}



.gridlist-toggle > a:before {

    font-size: 1.231em;

}



.gridlist-toggle > a:hover,

.gridlist-toggle > a:focus,

.gridlist-toggle > a.active {

    color: #fff;

}

.gridlist-toggle #grid:before {

    content: "\f20b";

}

.gridlist-toggle #list:before {

    content: "\f20a";

}



.gridlist-toggle > a:hover,

.gridlist-toggle > a:focus,

.gridlist-toggle > a.active {

  background-color: #9ac93d;

  border-color: #9ac93d;

}



form label {

	display: inline-block;

	font-weight: normal;

}



.shop-loop-before .pagination-container {

	margin-bottom: -10px;

	font-size:0.9286em;

	text-align: right;

	float:right;

	white-space: nowrap;

}



.shop-loop-after .pagination-container {

	float:none;

	text-align: center;

}



.pagination-container {

	position: relative;

}



.pagination {

	margin: 0 ;

	border-radius: 0;

    display: inline-block;

    white-space: nowrap;

    padding: 0;

    margin: 0 0 15px 10px;

    clear: both;

}



.pagination > li {

    float: left;

    margin-left: 5px;

    display: inline;

    padding: 0;

}



.pagination > li > a,

.pagination > li > span {

    border: 1px solid #ccc;

    border-radius: 3px;

    display: block;

    margin: 0 0 5px;

    padding: 0 0.5em;

    line-height: 24px;

    min-width: 26px;

    height: 26px;

    text-decoration: none;

    text-align: center;

}



.pagination > li:first-child > a,

.pagination > li:first-child > span {

	margin-left: 0;

	border-radius:3px;

}



.pagination > li:last-child > a,

.pagination > li:last-child > span {

	border-radius:3px;

}



.pagination > li > a:hover,

.pagination > li > span:hover,

.pagination > li > a:focus,

.pagination > li > span:focus {

	color: #fff;

	background-color: #9ac93d;

	border-color: #9ac93d;

}



.pagination > .active > a,

.pagination > .active > span,

.pagination > .active > a:hover,

.pagination > .active > span:hover,

.pagination > .active > a:focus,

.pagination > .active > span:focus {

	color: #fff;

	background-color: #9ac93d;

	border-color: #9ac93d;

}



@media (max-width: 1199px) {

	.shop-loop-before .pagination-container {

		float:none;

		clear:both;

		margin-top: 15px;

		text-align: center;

	}



	.shop-loop-before .product-viewing {

		position: absolute;

        top: -2.2em;

        right: 0;

        margin-top: -15px;

	}

}



@media (max-width: 767px) {

	.shop-loop-before .product-ordering {

		float:none;

		text-align: right;

		margin-right:0;

	}

}



/* Category Sidebar */



.widget.widget-shop {

	border: 1px solid #ddd;

	border-radius: 7px;

	background: #fbfbfb;

	overflow: hidden;

	margin-bottom: 1.0714em;

	margin-top: 0;

}



.sidebar .widget .widget-title.boxed-title,

#content .widget .widget-title.boxed-title {

    color: #777;

    background: #f5f5f5;

    border-bottom: 1px solid #ddd;

    font-size: 0.9286em;

    font-weight: 700;

    line-height: 1.4;

    padding: 0.7143em 1.0714em;

    margin: 0;

    text-transform: uppercase;

    position: relative;

    -webkit-transition: all 0.25s ease 0s;

    -moz-transition: all 0.25s ease 0s;

    transition: all 0.25s ease 0s;

}



.widget-title .toggle {

	color: #ccc;

    display: inline-block;

    width: 1.8571em;

    height: 1.8571em;

    line-height: 1.7572em;

    background: #fff;

    border: 1px solid #ccc;

    border-radius: 3px;

    position: absolute;

    right: 1.0714em;

    top: 1px;

    bottom: 0;

    margin:auto;

    font-family: "FontAwesome";

    text-align: center;

    -webkit-transition: all 0.25s ease 0s;

    transition: all 0.25s ease 0s;

}



.widget-title .toggle:hover {

	color: #fff;

	background-color: #9ac93d;

	border-color:#9ac93d;

}





.widget-title .toggle:before {

    content: "\f0d8";

}



.widget-title .toggle.collapsed:before {

    content: "\f0d7";

}



.filter-color-container,

.filter-size-container  {

	padding:11px;

	font-size: 0.9286em;

	margin:0;

}



.filter-color-container li,

.filter-size-container li {

	float:left;

	width: 14.2857%;

	min-width: 34px;

	max-width: 35px;

	text-align: center;

	line-height: 10px;

}



.filter-color-box,

.filter-size-box {

	display: inline-block;

    border-width: 0;

    width: 26px;

    height: 26px;

    margin: 4px;

    box-shadow: 1px 1px 0 rgba(0, 0, 0, .35);

    border-radius: 5px;

}



.filter-size-box {

	border-radius: 5px;

    min-width: 2em;

    text-align: center;

    margin: 0.3846em;

    color: #777;

    border: 1px solid #ccc;

    background: #efefef;

    padding: 0.3846em;

    line-height: 1.2;

    text-transform: uppercase;

}





.filter-size-box.active,

.filter-size-box:hover,

.filter-size-box:focus {

	color:#fff;

	border-color:#9ac93d;

	background-color: #9ac93d;

	cursor: pointer;

}



.filter-color-box.active {

	position: relative;

	font: 13px/37px FontAwesome;

	text-align: center;

}



.filter-color-box.active:before {

	content:"\f00c";

	color:#fff;

	position: absolute;

	margin-left:-6px;

}



.filter-color-box:hover {

	border:1px solid #444;

}





.sidebar .filter-group-widget .panel-body {

	padding:35px 20px 25px;

}



/* noUiSlider Styles */

noUi-target,

.noUi-target * {

-webkit-touch-callout: none;

-webkit-user-select: none;

-ms-touch-action: none;

-ms-user-select: none;

-moz-user-select: none;

-moz-box-sizing: border-box;

	box-sizing: border-box;



}



.noUi-base {

	width: 100%;

	height: 100%;

	position: relative;

}



.noUi-origin {

	position: absolute;

	right: 0;

	top: 0;

	left: 0;

	bottom: 0;

}



.noUi-handle {

	position: relative;

	z-index: 1;

}



.noUi-stacking .noUi-handle {

/* This class is applied to the lower origin when

   its values is > 50%. */

	z-index: 10;

}



.noUi-stacking + .noUi-origin {

/* Fix stacking order in IE7, which incorrectly

   creates a new context for the origins. */

	*z-index: -1;

}



.noUi-state-tap .noUi-origin {

-webkit-transition: left 0.3s, top 0.3s;

	transition: left 0.3s, top 0.3s;

}



.noUi-state-drag * {

	cursor: inherit !important;

}



/* Slider size and handle placement;

 */

.noUi-horizontal {

	height: 0.5em;

    margin-top: 1.4286em;

    margin-bottom: 2.1428em;

}



.noUi-horizontal .noUi-handle {

	position: absolute;

	left: 0;

	top: -3px;

	width: 0.9286em;

    height: 1.2857em;

    cursor: pointer;

    outline: none;

    top: -0.40715em;

    border-radius: 3px;

    box-shadow: 0 1px 2px rgba(0, 0, 0, .3);

}



.noUi-horizontal .noUi-handle.noUi-handle-upper {

	margin-left:-13px;

}



.noUi-horizontal.noUi-extended {

	padding: 0 15px;

}



.noUi-horizontal.noUi-extended .noUi-origin  {

	right: -15px;

}



/* Styling */

.noUi-background {

	background: #eee;

}



.noUi-connect {

	background: #9ac93d;

	-webkit-transition: background 450ms;

	transition: background 450ms;

}



.noUi-target.noUi-connect {

	box-shadow: inset 0 0 3px rgba(51,51,51,0.45), 0 3px 6px -5px #BBB;

}



/* Handles and cursors;*/

.noUi-dragable {

	cursor: w-resize;

}



.noUi-handle {

	background: #9ac93d;

	cursor: default;

}



/* Blocked state */

.noUi-state-blocked.noUi-connect,

.noUi-state-blocked .noUi-connect {

	background: #4FDACF;

}



/* fix for display:inline-block auto margin for child elements*/

.filter-slider {

	padding:0.7143em 1.0714em;

}



.filter-slider-action {

	margin-bottom: 4px;

}



.filter-slider-action .filter-slider-value {

	float:right;

    text-align: right;

    line-height: 2.4em;

    font-size: 0.8751em;

}



.filter-slider-value > span {

	font-weight: 600;

}



.filter-slider-action  .btn {

    padding: 0.2143em 0.7143em;

    text-transform: uppercase;

    float: left;

	border-color: #9ac93d;

	color: #fff;

	text-shadow: 0 -1px 0 rgba(0,0,0,0.25);

	background-color: #9ac93d;

}



.filter-slider-action .btn:hover {

	border-color: #0099e6;

	background-color: #0099e6;

}



.product-categories {

	font-size: 0.9286em;

	padding:0.7143em 1.0714em;

	margin:0;

}



.product-categories li  {

	position: relative;

	margin: 0;

	padding: 0;

	line-height: 24px;

	-webkit-transition: all 0.3s;

	-moz-transition: all 0.3s;

	transition: all 0.3s;

}



.product-categories li a {

	display: inline-block;

	padding:4px 0;

	color: #777;

}



.product-categories li a:hover {

	color:#0099e6;

}



.products .product {

	margin-bottom: 30px;

}





/* =============================================

-------------------  17. Products --------------

==============================================*/



.product {

	position: relative;

	overflow: hidden;

	/*text-align: center; */

}



.product-image {

    display: block;

    position: relative;

    background: #fff;

    border: 0px solid #ddd;

    border-radius: 7px;

    width: 100%;

    padding: 0.2381em;

    overflow: hidden;

    margin-bottom: 1em;

}



.product-image a {

	display: block;

}



.product-image img {

    border-radius: 5px;

    display: inline-block;

    width: 100%;

    height: auto;

    -webkit-transition: opacity 0.3s ease-in-out 0s;

    -moz-transition: opacity 0.3s ease-in-out 0s;

    transition: opacity 0.3s ease-in-out 0s;

    position: relative;

	opacity:1;

}



.product-image .inner-image {

	position: relative;

}



.product-image .inner-image {

	overflow: hidden;



}



.product-image .inner-image .zoom-image-effect {

	transition: all 0.2s ease-in;

	-webkit-transition: all 0.2s ease-in;

	-moz-transition: all 0.2s ease-in;

}



.product-image:hover .inner-image .zoom-image-effect {

	transform: scale(1.07);

	-moz-transform: scale(1.07);

	-webkit-transform: scale(1.07);

}



.product .product-image .product-image-hover {

    position: absolute;

    left: 0;

    right: 0;

    top: 0;

    bottom: 0;

    margin: auto;

    opacity: 0;

}



.product-image:hover .product-image-normal {

	opacity:0;

}



.product-image:hover .product-image-hover {

	opacity:1;

}



.product-image .onhot,

.product-image .onsale,

.product-info .onsale,

.product-info .onsale1

 {

    line-height: 1;

    color: #fff;

    font-weight: 600;

    text-transform: uppercase;

    position: absolute;

    z-index: 1;

    top: 0.8em;

    border-radius: 4px;

    font-size: 0.8571em;

    padding: 0.5833em 0.6333em;

}



.product-image .onhot {

    background: #62b959;

    left: 0.8em;

}



.product-image .onsale,

.product-info .onsale {

    background: #e27c7c;

    right: 0.8em;

}



.product-image .viewcart {

    font-size: 1.8em;

    background: #fff;

    border-radius: 50%;

    position: absolute;

    top: 0;

    bottom: 0;

    left: 0;

    right: 0;

    margin: auto;

    z-index: 1;

    text-align: center;

    width: 2.2em;

    height: 2.2em;

    line-height: 2.1em;

    display: none;

    opacity: 0;

    filter: alpha(opacity=0);

    -webkit-transition: all 0.25s ease 0s;

    -moz-transition: all 0.25s ease 0s;

    transition: all 0.25s ease 0s;

}



.product-image .viewcart:before {

    font-family: "minicart-font" !important;

    font-style: normal !important;

    font-weight: normal !important;

    font-variant: normal !important;

    text-transform: none !important;

    speak: none;

    -webkit-font-smoothing: antialiased;

    -moz-osx-font-smoothing: grayscale;

    content: "\e800";

    font-size: 0.9em;

    vertical-align: top;

}



.product-image .viewcart:hover {

    color: #fff;

}



.product h3 {

	color: #777;

	font-size: 1em;

	line-height: 1.35;

	margin-bottom: 0.7143em;

	min-height: 5rem;

    max-height: 5.5rem;

    overflow: hidden;

}



  @media (max-width: 768px) {

        .product h3 {

        	font-size: 1em;

        	line-height: 1.1;

        	margin-bottom: 0.7143em;

        	min-height: 5rem;

            max-height: 5rem;

            overflow: hidden;

        }





  }



.product h3 a {

	font-size: 1em;

}



.product h3 a:hover {

    color: #9ac93d;

}



.rating-wrap {

	position: relative;

	display: table;

	font-size: 0.8571em;

	margin: 0 auto 1.2em;

	height: 1px;

}



.rating-wrap .rating-before,

.rating-wrap .rating-after {

	display: table-cell;

	width: 50%;

	height: 1px;

	vertical-align: middle;

}



.rating-wrap .rating-content {

    display: table-cell;

}



.rating-wrap .star-rating {

    width: 6.7em;

    margin-right: -2px;

}



.rating-wrap .rating-line {

    display: block;

    height: 1px;

    width: 100%;

    margin-top: 1px;

}



.rating-wrap .rating-before .rating-line {

    background-image: - webkit-linear-gradient(right, rgba(0, 0, 0, 0.1), rgba(0, 0, 0, 0.1) 40%, transparent);

    background-image: linear-gradient(to left, rgba(0, 0, 0, 0.1), rgba(0, 0, 0, 0.1) 40%, transparent);

}



.rating-wrap .rating-after .rating-line {

    background-image: - webkit-linear-gradient(left, rgba(0, 0, 0, 0.1), rgba(0, 0, 0, 0.1) 40%, transparent);

    background-image: linear-gradient(to right, rgba(0, 0, 0, 0.1), rgba(0, 0, 0, 0.1) 40%, transparent);

}



.star-rating {

	position: relative;

	height: 1em;

	width: 5.4em;

	overflow: hidden;

	font-family: 'Elusive-Icons';

    font-size: 1em;

    line-height: 1em;

	letter-spacing: 0.1em;

	text-align: center;

	cursor: pointer;

}



.star-rating:before {

    color: #ddd;

    color: rgba(0, 0, 0, 0.13);

    content: "\f1fe" "\f1fe" "\f1fe" "\f1fe" "\f1fe";

    float: left;

    position: absolute;

    top: 0;

	left: 0.6em;

}



.star-rating span {

    float: left;

    left: 0;

    overflow: hidden;

    padding-top: 1.5em;

    position: absolute;

    top: 0;

    width:100%;

}



.star-rating span:before {

    color: #ffc600;

    content: "\f1fe" "\f1fe" "\f1fe" "\f1fe" "\f1fe";

    left: 0.6em;

    position: absolute;

    top: 0;

}



.price {

	display: block;

    font-size: 1.4286em;

    margin: -0.25em 0 0.75em;

    color: #444;

    line-height: 1;

    font-weight: 600;

}



.price del {

	display: inline-block;

	color: #a7a7a7;

	font-size: 0.8em;

	margin-right: 0.2143em;

	vertical-align: baseline;

}



.price .amount {

	vertical-align: middle;

}



.price ins {

	display: inline-block;

	text-decoration: none;

	vertical-align: baseline;

}



.product-image .product-action {

	margin:0;

}



.product-action {

	margin-bottom: 5px;

	white-space: nowrap;

}



.product-action .product-btn {

	display: inline-block;

	background: transparent;

	border: 1px solid #333;

	padding: 0 0.7143em;

	font-size:1em;

	line-height: 2.0571em;

	z-index: 1;

	color: #333;

	white-space: nowrap;

	text-shadow: none;

}



.product-btn.btn-add-cart {

	position: relative;

	z-index: 2;

}



.product-btn.btn-add-cart.small i {

	margin-right: 0;

}



.product-btn.btn-add-cart.small > span {

	display: none;

}



.product-btn.btn-add-cart i {

	margin-right:0.5714em;

}



.product-btn.btn-quickview,

.product-btn.btn-wishlist {

	-webkit-transition: all 0.25s ease 0s;

    transition: all 0.25s ease 0s;

    position: relative;

    z-index: 1;

}



.six-products .product-btn.btn-wishlist {

	display: none !important;

}



.product-btn.btn-quickview {

	position: relative;

    width: 2.2em;

    padding: 0;

    border: 1px solid #333;

    background: transparent;

    color: #333;

    opacity:0;

    transform:translateX(-60px);

    -webkit-transform:translateX(-60px);

    -ms-transform:translateX(-60px);

    margin-left: 3px;

}



.six-products .product-btn.btn-quickview {

	display: none !important;

}



.product-btn.btn-wishlist {

	width: 2.2em;

    padding: 0;

    border: 1px solid #333;

    color: #333;

    opacity:0;

    margin-right: 3px;

    transform:translateX(60px);

    -webkit-transform:translateX(60px);

    -ms-transform:translateX(60px);

}



@media (max-width: 480px) {

	.product-btn.btn-quickview,

	.product-btn.btn-wishlist {

		display: none;

	}

}



.product-btn.btn-quickview:hover,

.product-btn.btn-quickview:focus {

    background-color: #52b9b5;

    color:#fff;

}



.product-btn.btn-wishlist:hover,

.product-btn.btn-wishlist:focus {

    background-color: #ed4949;

    color:#fff;

}



.product:hover .product-btn.btn-add-cart {

	background-color: #9ac93d;

	border-color: #9ac93d;

	color:#fff;

}



.product:hover .product-btn.btn-wishlist,

.product:hover .product-btn.btn-quickview {

    opacity:1;

    transform:translateX(0);

    -webkit-transform:translateX(0);

    -ms-transform:translateX(0);

}





/* Product Singe (product.html) ---------

---------------------------------------*/



.widget-block2.widget  {

	margin-top:15px;

}



.widget-block2 hr:last-child{

	margin-bottom: 20px;

}



.product-gallery-container {

	margin-bottom: 40px;

}





@media (min-width: 992px) {

	.product-gallery-container {

		margin-bottom: 65px;

	}

}



.product-gallery-container .product-top {

	border: 1px solid #ddd;

	border-radius: 7px;

	padding: 3px;

	margin:0 0 8px 0;

}



.pgallery-wrapper {

	border: 1px solid #ddd;

	border-radius: 7px;

	padding: 4px;

}



.product-gallery-container img {

	display:block;

	width:100%;

	height:auto;

}



.product-details {

	padding-right: 4px;

}



.product-details .product-title {

	color: #555;

	font-size: 2em;

	font-weight: 600;

	margin-bottom: 0.3571em;

}



.product-rating-container {

    color: #bdbdbd;

    margin-bottom: 1.4286em;

}



.product-rating-container .star-rating {

	font-size:1.2857em;

    display: inline-block;

    vertical-align: top;

    margin-right: 0.7143em;

    text-align: left;

}



.product-rating-container .star-rating:before,

.product-rating-container .star-rating span:before {

	left:0;

}



.product-rating-container  .review-link {

	display: inline-block;

}



.review-link a {

    color: #bdbdbd;

    display: inline-block;

    vertical-align: bottom;

    padding: 0 0.7143em;

}



.review-link a:first-child {

	padding-left: 0;

}



.review-link a:hover, .review-link a:active {

    color: #888;

}



.product-details .price {

	margin-bottom: 0.5556em;

	color: #9ac93d;

    line-height: 1;

    font-weight: 600;

    font-size: 2.5714em;

}



.product-details .description {

    margin-bottom: 1.7857em;

    font-size: 1.1429em;

}



.product-details .cart {

	   border-top: 1px solid #ebebeb;

    border-bottom: 1px solid #ebebeb;

    padding: 1.7857em 0;

    margin-bottom: 1.7857em;

}



.product-details .single_add_to_cart_button {

    height: 2.7143em;

    padding: 0 2.1429em;

    text-shadow: none;

    background-color: #9ac93d;

    border-color:#9ac93d;

    color:#fff;

    border: 1px solid transparent;

    white-space: nowrap;

    font-size: 14px;

    line-height: 1.42857;

    border-radius: 4px;

}



.product-details .single_add_to_cart_button:hover {

	border-color: #0099e6;

	background-color: #0099e6;

}



@media (max-width: 991px) {

    .product-details .single_add_to_cart_button {

        padding: 0 1.4286em;

    }

}



@media (max-width: 480px) {

    .product-details .single_add_to_cart_button {

        padding: 0 0.7143em;

    }

}





.product-details .single_add_to_cart_button:before {

    display: inline-block;

    content: "\f07a";

    font-family: "FontAwesome";

    margin-right: 0.7143em;

}

.product-details a.single_add_to_cart_button {

    line-height: 2.5714em;

}

.product-details .stock {

    font-size: 1.1429em;

    font-weight: 600;

}



.product-center .single-add-to-wishlist a {

    width: auto;

    text-indent: 0;

    overflow: visible;

    padding-left: 2.8em;

    position: relative;

    color:inherit;

    display: inline-block;

    cursor: pointer;

    font-size: inherit;

    height: 2.2em;

    line-height: 2.2em;

    text-decoration: none;

    text-align: center;

    vertical-align: top;

    border-radius: 5px !important;

    text-shadow: none;

    -webkit-transition: all 0.25s ease 0s;

    -moz-transition: all 0.25s ease 0s;

    transition: all 0.25s ease 0s;

}

.product-center .single-add-to-wishlist a:before {

	font-family: "FontAwesome";

	content:"\f08a";

    position: absolute;

    left: 0;

    right: 0;

    text-indent: 0;

    font-size: 1.1em;

    border: 1px solid #ed4949;

    color: #ed4949;

    border-radius: 5px;

    width: 2em;

    top: 0;

    bottom: 0;

}



.product-center .single-add-to-wishlist a:hover {

    color: #ed4949;

}



.product-center .single-add-to-wishlist a:hover:before {

    color: #fff;

    background-color: #ed4949;

}





.product-center .single-add-to-compare a {

    width: auto;

    text-indent: 0;

    overflow: visible;

    padding-left: 2.8em;

    position: relative;

    color:inherit;

    display: inline-block;

    cursor: pointer;

    font-size: inherit;

    height: 2.2em;

    line-height: 2.2em;

    text-decoration: none;

    text-align: center;

    vertical-align: top;

    border-radius: 5px !important;

    text-shadow: none;

    -webkit-transition: all 0.25s ease 0s;

    -moz-transition: all 0.25s ease 0s;

    transition: all 0.25s ease 0s;

}

.product-center .single-add-to-compare a:before {

	font-family: "FontAwesome";

	content: "\f0ec";

    position: absolute;

    left: 0;

    right: 0;

    text-indent: 0;

    font-size: 1.1em;

    border: 1px solid #52b9b5;

    color: #52b9b5;

    border-radius: 5px;

    width: 2em;

    top: 0;

    bottom: 0;

}



.product-center .single-add-to-compare a:hover {

    color: #52b9b5;

}



.product-center .single-add-to-compare a:hover:before {

    color: #fff;

    background-color: #52b9b5;

}



.product-details .quantity {

	display: inline-block;

    position: relative;

    width: 4.1429em;

    margin-right: 0.8571em;

    vertical-align: top;

}



/*

 *  Bootstrap TouchSpin - v3.0.1

 *  A mobile and touch friendly input spinner component for Bootstrap 3.

 *  http://www.virtuosoft.eu/code/bootstrap-touchspin/

 *

 *  Made by István Ujj-Mészáros

 *  Under Apache License v2.0 License

 */



.bootstrap-touchspin .form-control.vertical-spinner {

	border-radius: 3px !important;

	-moz-appearance: textfield;

	text-align: center;

	width: 2.5em;

	height: 2.7143em;

	padding-left: 0;

	padding-right: 0;

	display: inline-block !important;

	vertical-align: middle;

}



.bootstrap-touchspin .input-group-btn-vertical {

	position: relative;

	white-space: nowrap;

	width: 15px;

	vertical-align: middle;

	display: inline-block;

	margin-left:5px;

	vertical-align: middle;

	margin-top:-29px;

}



.bootstrap-touchspin .input-group-btn-vertical > .btn {

	display: block;

	float: none;

	width: 100%;

	max-width: 100%;

	padding:0;

	width:15px;

	height:1.1428em;

	font-size:14px;

	line-height: 1;

	position: relative;

	border-radius: 3px;

	margin-bottom:5px;

}



.bootstrap-touchspin .input-group-btn-vertical > .btn:last-child {

	margin-bottom: 0;

}



.customup:before,

.customdown:before {

	position: absolute;

	left:50%;

	top:50%;

	margin-top:-5px;

	font-size:14px;

	line-height: 1;

	z-index: 99;

}





.customup:before {

	content:'+';

	margin-left: 1px;

}



.customdown:before {

	content:'-';

	margin-left: 2px;

	margin-top:-6px;



}



.bootstrap-touchspin .btn.btn-default {

	border-color:#ccc;

}



.bootstrap-touchspin .input-group-btn-vertical > .btn.btn-default:hover,

.bootstrap-touchspin .input-group-btn-vertical > .btn.btn-default:focus {

	border-color:#dadada;

}



.bootstrap-touchspin-up.btn,

.bootstrap-touchspin-down.btn {

	padding:9px 12px;

	border-radius:0 4px 4px 0;

	text-align: center;

}



.bootstrap-touchspin-down.btn {

	margin-right: -1px !important ;

	border-radius: 4px 0 0 4px;

}





.bootstrap-touchspin .input-group-btn-vertical i {

	position: absolute;

	top: 5px;

	left: 50%;

	margin-left:-4.5px;

	font-size: 9px;

	font-weight: normal;

}



.product-details .product_meta {

    margin: 1.2143em 0 0;

}

.product-details .product_meta span span,

.product-details .product_meta span a {

    display: inline-block;

}



.product-details .product_meta span a {

    color:#9ac93d;

}



.product-details .product_meta span a:hover {

	text-decoration: underline;

}



.product-details .share-links {

    margin: 2.2143em 0 0;

}



.product-details .posted_in,

.product-details .sku_wrapper,

.product-details .tags {

    display: block;

    margin-bottom: 0.5em;

}



.product-details .social-icons {

	font-size:14px;

	margin:2.2143em 0 1.0714em;

}



.product-details .social-icons .social-icon {

	margin:0 3.5px 0 0;

	width:2.2857em;

	height:2.2857em;

	line-height: 2.2857em;

	border-radius: 4px;

}



/* sidebar */

.sidebar .widget-banner {

	margin-bottom:15px;

}



.widget-banner {

	text-align: center;

	background-color: #fafafa;

	padding:7px 25px 14px;

}



.widget-banner img {

	display:inline-block;

	max-width: 100%;

	height: auto;

}



.widget-banner hr {

	margin-top:0;

	margin-bottom: 20px;

	border-color:#e6e6e6;

}



.widget-banner h5 {

	font-size:12px;

}



.widget-banner h5 a:hover {

	color:#262626;

}



.widget-products {

	padding:32px 28px;

	border:1px solid #f0f0f0;

}



.sidebar .widget-products .widget-title {

	border-bottom:none;

	padding-bottom:0;

	margin-bottom: 17px;

}





.sidebar .widget-products .product-list .product-title {

	font-size:14px;

	line-height: 18px;

	font-weight: 500;

	margin-top:-3px;

}



.sidebar .widget-products .product-list .product-price,

.sidebar .widget-products .product-list .product-old-price {

	font-size:13px;

}



.sidebar .widget-products.widget .product-list li {

	padding-bottom:0;

	border-bottom:none;

}



.product-details-tab {

	margin-bottom: 35px;

}



@media (min-width: 768px) {

	.product-details-tab {

		margin-bottom: 50px;

	}

}



.product-details-tab h5 {

	margin-bottom:19px;

}



.product-details-tab p,

.panel-group p {

	line-height: 26px;

	margin-bottom: 18px

}



.product-details-tab ul li,

.panel-group ul li {

	line-height: 30px;

}



.product-details-tab ul.fa-ul,

.panel-group ul.fa-ul {

	margin-left:25px;

}



.product-details-tab ul.fa-ul li,

.panel-group ul.fa-ul li {

	margin-bottom: 0;

}



.product-details-tab ul.fa-ul .fa-li,

.panel-group ul.fa-ul .fa-li {

	top:9px;

	left:-22px;

	font-size:12px;

	color:#a8a8a8;

}







/* =============================================

-------------------- 19. Footer -----------------

==============================================*/



#footer {



    font-size: 0.9em;

    padding-bottom: 100px;

    position: relative;

    color:#fff;

      background: url(../../../../../image/catalog/magic/bg.jpg) bottom  repeat-x #9ac93d;



}



#wrapper.boxed.boxed-short #footer {

	margin-top:15px;

}



#footer a,

#footer a:hover {

	color:#fff;

}



#footer a:hover {

    text-decoration: underline;

}



#footer .footer-ribbon {

    background: #9ac93d;

    position: absolute;

    margin: -70px 0 0 0;

    padding: 10px 20px 6px 20px;

    color: #fff;

    font:400 1.6em/ 22px "Shadows Into Light", Verdana;

}



#footer .footer-ribbon a:hover {

	text-decoration: none !important

}



.v2 #footer .footer-ribbon {

	margin-top:-56px;

}



#footer .footer-ribbon:before {

    border-right: 10px solid #005580;

    left: -10px;

    border-top: 16px solid transparent;

    content: "";

    display: block;

    height: 0;

    position: absolute;

    top: 0;

    width: 7px;

}



#footer > .container {

    padding-top: 40px;

    padding-bottom: 10px;

}



#footer.footer-ribbon > .container {

	padding-top:54px;

}



.v2 #footer.footer-ribbon > .container {

	padding-top:40px;

}

/*

.widget {

	margin-top:30px;

	margin-bottom: 30px;

} */



.widget .widget-title {

	line-height: 1.4;

	font-weight: 400;

	font-size:1.2698em;

	margin-bottom: 15px;

	text-transform: uppercase;

}



#footer .widget-title {

	color:#fff;

   text-transform: uppercase;

}



#footer .widget > div > ul,

#footer .widget > ul {

	font-size:1em;

}



#footer .widget .contact-info,

#footer .widget .contact-details {

    margin-top: -6px;

}



.widget .tagcloud {

	margin:-0.3846em 0 -0.3846em;

}



.widget .tagcloud a {

    margin: 0.3846em 0.3846em 0.3846em 0;

    color: #777;

    border: 1px solid #ccc;

    border-radius: 3px;

    background: #efefef;

    padding: 0.3846em;

    line-height: 1.2;

    display: inline-block;

    text-decoration: none;

    font-size: 0.8571em !important;

}



#footer .widget .tagcloud a {

    text-decoration: none;

    border-color:rgba(119,119,119,0.3);

    background-color: transparent;

}



.widget .tagcloud a:hover,

#footer .widget .tagcloud a:hover {

	color: #fff;

	border-color:#9ac93d;

	background-color:#9ac93d;

}



.widget.contact-info ul,

.widget.contact-info li {

    margin: 0;

    padding: 0;

}



.widget.contact-info p {

    margin-bottom: 10px;

}



.widget.contact-info li i {

    text-align: center;

    width: 16px;

    top: -2px;

    margin: 7px 6px 0 0;

    font-size: 1.2em;

}



.widget.contact-info .contact-details span {

    display: block;

    padding-left: 25px;

    line-height: 18px;

    padding-bottom: 10px;

}



.v2 .widget.contact-info .contact-details span {

	padding-bottom: 5px;

}



.post-item-small {

    margin: 0 10px;

    padding: 15px 0;

    *zoom: 1;

    border-top: 1px solid #ececec;

}



.post-item-small:before,

.post-item-small:after {

    content: " ";

    display: table;

    clear: both;

}



.post-item-small:first-child {

    padding-top: 0;

    border-top-width: 0;

}



.post-item-small .post-image {

    float: left;

    margin: 0 10px 0 0;

}



.post-item-small .post-image img {

    width: 50px;

    height: auto;

}



.post-item-small .post-date {

    font-size: 0.9286em;

}



#footer .post-item-small {

	border-color:rgba(119,119,119,0.3);

}



#footer .post-item-small .post-date {

	display:block;

	color:#888;

}



#footer .thumbnail,

#footer .img-thumbnail {

	padding:0;

	border:none;

	background-color: transparent;

}



#footer .thumbnail img,

#footer .img-thumbnail img {

	border-radius: 3px;

}



#footer .widget p {

	margin-top:-3px;

	margin-bottom: 13px;

}



.newsletter-widget input[type="text"],

.newsletter-widget input[type="email"] {

	display: block;

	color:#777;

	background-color: #fff;

	box-shadow:0 1px 1px rgba(0, 0, 0, 0.075) inset;

	line-height: 1.42857;

	padding:6px 8px;

	font-size:1em;

	border:1px solid #ccc;

	border-radius:3px;

	width: 100%;

	max-width: 262px;

}



#footer .container input:focus {

	box-shadow: none;

}



.newsletter-widget input::-moz-placeholder {

	color: #777;

}



.newsletter-widget input:-ms-input-placeholder {

	color: #777;

}



.newsletter-widget input::-webkit-input-placeholder {

	color: #777;

}



.newsletter-widget input[type="submit"] {

	display:block;

	margin-top:20px;

    background: #9ac93d;

    border: 1px solid #9ac93d;

    color: #fff;

    padding: 6px 11.5px;

    border-radius: 3px;

    line-height: 1.42857;

}



.newsletter-widget input[type="submit"]:hover,

.newsletter-widget input[type="submit"]:active {

	background: #0099e6;

	border-color: #0099e6;

}



#footer .input-box {

	margin-top:45px;

}



#footer .newsletter-widget .input-box input[type="text"],

.newsletter-widget .input-box  input[type="email"] {

	background-color: #dcdcdc;

	height:30px;

	padding:5px 10px;

	border-radius: 5px;

}



#footer .input-box-wrapper {

	position: relative;

	max-width: 300px;

}



#footer .newsletter-widget .input-box-wrapper input[type="submit"] {

	position: absolute;

	right:0;

	top:0;

	padding:4.5px 13.5px;

	margin:0;

	border-radius:0 5px 5px 0;

	font-size:14px;

}





#footer .widget .label {

	display: block;

	font-size:13px;

	line-height: 19px;

	font-weight: 400;

	padding:0;

	text-align: left;

	margin:0 0 15px;

	color:#777;

}



#footer .widget .links {

	margin:-5px 0 0;

}



#footer .widget .links li {

	display: block;

	position: relative;

	padding:10px 0;

	line-height: 1;

}



#footer .widget .links li > i {

	margin-right:6px;

}



#footer #footer-bottom {

	padding:15px 0;

	background-color: #060606;

}



#footer #footer-bottom a,

#footer #footer-bottom a:hover {

	color:#777;

}



#footer #footer-bottom address {

	margin: 0px;

	text-align: center;

	font-size: 12px;

	line-height: 40px;

	border-top: 1px solid #0f0f0f;

	margin-top: -15px;

	padding-top: 15px;

}



#footer.fixed {

	position: fixed;

	left:0;

	right:0;

	bottom:0;

	z-index: 999;

	background-color: transparent;

}



#footer.fixed #footer-bottom {

	padding:0;

	background-color: rgba(255,255,255,0.85);

}



#footer-bottom > .container .footer-left {

	padding: 10px 8px 10px 0;

    text-align: left;

}



#footer-bottom > .container .footer-center {

	padding: 10px 8px;

}



#footer-bottom > .container .footer-right {

    padding: 10px 0 10px 8px;

    text-align: right;

}



#footer.fixed #footer-bottom > .container .footer-left,

#footer.fixed #footer-bottom > .container .footer-center,

#footer.fixed #footer-bottom > .container .footer-right {

    padding-top:8px;

    padding-bottom: 8px;

}



#footer-bottom .footer-menu {

	margin:0;

	display: inline-block;

}



#footer-bottom .footer-menu li {

	display: inline-block;

	padding:0 5px 0 0;

	line-height: 24px;

	letter-spacing: 0.4px;

}



#footer-bottom .footer-menu li:last-child {

	padding:0;

}



#footer-bottom .footer-menu li + li:before {

    content: "|";

    font-weight: 300;

    position: relative;

    top: -1px;

    margin: 0 9.5px 0 0;

}



.v2 #footer-bottom .logo {

	min-width: 0;

}





@media (max-width: 480px) {

	#footer.fixed #footer-bottom > .container .footer-left {

		text-align: center;

	}



	#footer.fixed #footer-bottom > .container .footer-right {

		display:none;

	}

}



@media (max-width: 991px) {

    #footer .logo {

        display: block;

        margin-bottom: 15px;

        margin-right: 0;

    }



    #footer-bottom > .container .footer-left,

	#footer-bottom > .container .footer-center,

	#footer-bottom > .container .footer-right  {

    	padding: 10px 0;



    }



    #footer.fixed #footer-bottom .social-icons {

    	margin: 5px 0;

    }



}



@media (min-width: 768px) and (max-width: 991px) {

	.v2 #footer-bottom > .container .footer-left {

    	margin-right:60px;

    }



    .v2 #footer-bottom > .container .footer-left .logo {

		margin-right:45px;

    }



	.v2 #footer-bottom > .container .footer-left > *,

    .v2 #footer-bottom > .container .footer-left,

	.v2 #footer-bottom > .container .footer-center {

		float:left;

	}



	.v2 #footer-bottom > .container .footer-right {

    	float:right;

    }

}



@media (max-width: 767px) {



	.v2 #footer .logo  {

		margin-bottom: 5px;

	}



	.v2 #footer #footer-bottom img.img-responsive {

    	display: inline-block;

    }



	.v2 #footer-bottom > .container .footer-left {

		padding-bottom: 0;

	}



    .v2 #footer-bottom > .container .footer-left,

	.v2 #footer-bottom > .container .footer-center,

	.v2 #footer-bottom > .container .footer-right {

    	text-align: center !important;

    	float:none;

    }



    .v2 #footer-bottom > .container .footer-right {

    	padding-top:0;

    }

}



@media (min-width: 481px) and (max-width: 991px) {

	#footer.fixed #footer-bottom > .container {

		display: table;

		table-layout: fixed;

	}



	#footer.fixed #footer-bottom > .container .footer-left,

	#footer.fixed #footer-bottom > .container .footer-right {

		display: table-cell;

		vertical-align: middle;

		width:50%;

		float:none;

	}

}



@media (min-width: 992px) {



	#footer-bottom .logo,

	#footer-bottom .social-icons  {

	    display: inline-block;

	    margin-right: 25px;

	}



	.v2 #footer-bottom .logo {

		margin-right: 45px;

	}



	#footer.fixed #footer-bottom .social-icons  {

	    margin-right: 10px;

	}



	.skin7 #footer #footer-bottom .social-icons  {

	    margin-right: 0;

	}



	#footer-bottom > .container {

		display: table;

	}



	#footer-bottom > .container .footer-left,

	#footer-bottom > .container .footer-center,

	#footer-bottom > .container .footer-right {

		display: table-cell;

		vertical-align: middle;

	}



	#footer-bottom > .container .footer-left * {

		vertical-align: middle;

	}



	#footer-bottom > .container .footer-center {

	    text-align: center;

	    width:350px;

	}



	.v2 #footer-bottom > .container .footer-center {

		width:360px;

		padding-left:0;

		padding-right:0;

	}



	#footer-bottom .footer-menu {

		margin-left:-7px;

	}



}



/* Skin5 Footer */

.skin5 #footer,

.skin5 #footer #footer-bottom {

	background-color: #fff;

	color:#777;

}



.skin5 #footer a,

.skin5 #footer a:hover,

.skin5 #footer .widget-title {

	color:#9ac93d;

}



.skin5 #footer .newsletter-widget input[type="text"],

.skin5 #footer .newsletter-widget input[type="email"],

.skin5 #footer .widget .tagcloud a,

.skin5 #footer.newsletter-widget input[type="submit"] {

	border-radius: 0;

}



.skin5 #footer  .thumbnail img,

.skin5 #footer .img-thumbnail img {

	border-radius: 0;

}





/* Footer top */

#footer-top {

    background: #08c;

    border: 1px solid #08c;

    margin-left: -10px !important;

    margin-right: -10px !important;

    padding: 10px 0;

    border-radius: 0;

    color:#fff;

}



.info-boxes-fullwidth-container {

	padding: 11px 0;

    border-radius: 0;

    color:#fff;

    background-color: #171717;

    margin-bottom: 40px;

}



#footer-top .info-boxes-container,

.info-boxes-fullwidth-container .info-boxes-container {

	background-color: transparent;

	border:none;

	margin:0;

}



.info-boxes-fullwidth-container .info-box-content .info-box-title,

.info-boxes-fullwidth-container .info-box-icon,

#footer-top .info-box-content .info-box-title,

#footer-top .info-box-icon {

	color:#fff;

}



@media (min-width: 992px) {

	#footer-top .info-box-container {

		border-right: 1px solid #149ce0;

	}



	.info-boxes-fullwidth-container .info-box-container {

		border-right: 1px solid #353535;

	}



	.info-boxes-fullwidth-container .info-box-container:last-child,

	#footer-top .info-box-container:last-child {

		border-right: none;

	}

}



/* Skin6 Footer */

.skin6 #footer .container {

	width:100%;

}



.skin6 #footer {

	background-color: #f6f6f6;

}



.skin6 #footer #footer-bottom {

	background-color: #fff;

	color:#777;

}



.skin6 #footer a,

.skin6 #footer a:hover,

.skin6 #footer .widget-title {

	color:#9ac93d;

}



.skin6 #footer .newsletter-widget input[type="text"],

.skin6 #footer .newsletter-widget input[type="email"],

.skin6 #footer .widget .tagcloud a,

.skin6 #footer .newsletter-widget input[type="submit"] {

	border-radius: 0;

}



.skin6 #footer .newsletter-widget input[type="submit"] {

	background-color: #000;

	border-color:#000;

}



.skin6 #footer  .thumbnail img,

.skin6 #footer  .img-thumbnail img {

	border-radius: 0;

}



/* Skin7 Footer */

.skin7 #footer {

	background-color: #121214;

}



.skin7 #footer #footer-bottom {

	background-color: #0c0c0c;

	color:#777;

}



.skin7 #footer a,

.skin7 #footer a:hover,

.skin7 #footer .widget-title {

	color:#fff;

}



.skin7 #footer .newsletter-widget input[type="text"],

.skin7 #footer .newsletter-widget input[type="email"],

.skin7 #footer .widget .tagcloud a,

.skin7 #footer .newsletter-widget input[type="submit"] {

	border-radius: 0;

}



.skin7 #footer .widget .tagcloud a:hover,

.skin7 #footer .newsletter-widget input[type="submit"] {

	background-color: #65829d;

	border-color:#65829d;

}



.skin7 #footer .newsletter-widget input[type="submit"]:hover,

.skin7 #footer .newsletter-widget input[type="submit"]:active {

	background-color: #758fa7;

	border-color:#758fa7;

}



.skin7 #footer .thumbnail img,

.skin7 #footer .img-thumbnail img {

	border-radius: 0;

}



/* Skin8 */

.skin8 #footer {

	background-color: #f7f7f7;

}



.skin8 #footer  #footer-bottom {

	background-color: #fff;

	color:#777;

}



.skin8 #footer a,

.skin8 #footer a:hover {

	color:#777;

}



.skin8 #footer .widget-title {

	color:#e13b3f;

}



.skin8 #footer  .newsletter-widget input[type="text"],

.skin8 #footer .newsletter-widget input[type="email"],

.skin8 #footer  .widget .tagcloud a,

.skin8 #footer .newsletter-widget input[type="submit"] {

	border-radius: 0;

}



.skin8 #footer  .widget .tagcloud a:hover,

.skin8 #footer  .newsletter-widget input[type="submit"] {

	background-color: #e13b3f;

	border-color:#e13b3f;

}



.skin8 #footer  .newsletter-widget input[type="submit"]:hover,

.skin8 #footer  .newsletter-widget input[type="submit"]:active {

	background-color: #e45155;

	border-color:#e45155;

}



.skin8 #footer  .thumbnail img,

.skin8 #footer  .img-thumbnail img {

	border-radius: 0;

}



/* Skin9 Footer */

.skin9 #footer {

	background-color: #fff;

}



.skin9 #footer #footer-bottom {

	background-color: #f7f7f7;

	color:#777;

}



.skin9 #footer a,

.skin9 #footer a:hover {

	color:#777;

}



.skin9 #footer .widget-title {

	color:#333;

}



.skin9 #footer .newsletter-widget input[type="text"],

.skin9 #footer .newsletter-widget input[type="email"],

.skin9 #footer .widget .tagcloud a,

.skin9 #footer .newsletter-widget input[type="submit"] {

	border-radius: 0;

}



.skin9 #footer .widget .tagcloud a:hover,

.skin9 #footer .newsletter-widget input[type="submit"] {

	background-color: #d0205e;

	border-color:#d0205e;

}



.skin9 #footer .newsletter-widget input[type="submit"]:hover,

.skin9 #footer .newsletter-widget input[type="submit"]:active {

	background-color: #de2b6a;

	border-color:#de2b6a;

}



.skin9 #footer .thumbnail img,

.skin9 #footer .img-thumbnail img {

	border-radius: 0;

}



@media (min-width: 1200px) {

	.skin9 #footer #footer-bottom > .container .footer-left,

	.skin9 #footer #footer-bottom > .container .footer-right {

		width: 395px;

	}

}





/* V2 Skin */

.v2 #footer  {

	background-color: #121214;

}



.v2 #footer #footer-bottom {

	padding:16.5px 0;

	background-color: #0c0c0c;

}





/* Skin11 - index11*/

.skin11 #footer .footer-ribbon {

	background-color: #7aa93c;

}



.skin11 #footer .footer-ribbon:before {

	border-right-color:#6a9234;

}



.skin11 .newsletter-widget input[type="submit"] {

    background: #7aa93c;

    border: 1px solid #7aa93c;

}



.skin11.newsletter-widget input[type="submit"]:hover,

.skin11 .newsletter-widget input[type="submit"]:active {

	background: #84ae4c;

	border-color: #84ae4c;

}



.skin11 #footer .widget .links li > i {

	color:#7aa93c;

}



.skin11 #scroll-top,

.skin11 #scroll-top:hover {

	color:#7aa93c;

}





/* Skin12 - index12 */

.skin12 #footer .footer-ribbon {

	background-color: #ee3d43;

}



.skin12 #footer .footer-ribbon:before {

	border-right-color:#ca3136;

}



.skin12 .newsletter-widget input[type="submit"] {

    background: #ee3d43;

    border: 1px solid #ee3d43;

}



.skin12 .newsletter-widget input[type="submit"]:hover,

.skin12 .newsletter-widget input[type="submit"]:active {

	background: #ec4d53;

	border-color: #ec4d53;

}



.skin12 #footer .widget .links li > i {

	color:#ee3d43;

}



.skin12 #scroll-top,

.skin12 #scroll-top:hover {

	color:#ee3d43;

}





/* Skin13 - index13 */

.skin13 #footer {

	background-color: #50515a;

	color:#bbb;

}



.skin13 #footer a,

.skin13 #footer a:hover {

	color:#bbb;

}



.skin13 #footer .widget-title {

	text-transform: uppercase;

	margin-bottom: 20px;

}



.contact-info.info2 p {

	line-height: 20px;

}



.skin13 .contact-info .social-icons {

	margin-left:20px;

}



.skin13 .contact-info .social-icons .social-icon {

	text-align: center;

}



#footer-inner {

	padding:40px 0 10px;

}



.skin13 #footer ul.product_list_widget li .product-image,

.skin13 #footer .widget ul.product_list_widget li .product-image {

	border-radius: 0;

	padding:1px;

	width:84px;

}



.skin13 #footer ul.product_list_widget li .product-details,

.skin13 #footer .widget ul.product_list_widget li .product-details {

	margin-left:98px;

	padding-top:7px;

}



@media (min-width: 768px) and (max-width: 991px) {

	.skin13 #footer ul.product_list_widget li .product-image,

	.skin13 #footer .widget ul.product_list_widget li .product-image {

		width:44px;

	}



	.skin13 #footer ul.product_list_widget li .product-details,

	.skin13 #footer .widget ul.product_list_widget li .product-details {

		margin-left:54px;

		padding-top:0;

	}

}



.skin13 #footer ul.product_list_widget li .product-details a,

.skin13 #footer ul.product_list_widget li .product-details a:hover {

	color:#fff;

}



.skin13 #footer .star-rating:before {

	color:#c3c5c9;

}



.skin13 #footer ul.product_list_widget li .star-rating,

.skin13 #footer .widget ul.product_list_widget li .star-rating {

	margin-top:2px;

	margin-bottom: 10px;

}



#footer-inner .widget .tagcloud {

	font-size:0;

}



#footer-inner .widget .tagcloud a {

	border:none;

	font-size: 12px !important;

	line-height: 25px;

	background-color: #000;

	padding:0 7px;

	color:#fff;

	margin:0 3px 3px 0;

}



#footer-inner .contact-details > li {

	margin-bottom: 4px;

}



#footer-inner .widget .tagcloud a:hover,

#footer-inner .widget .tagcloud a:hover {

	color:#fff;

	background-color: #000;

	text-decoration: underline;

}



.skin13 #footer ul.product_list_widget li .product-details del .amount,

.skin13 #footer .widget ul.product_list_widget li .product-details del .amount,

.skin13 #footer ul.product_list_widget li .product-details .from .amount,

.skin13 #footer .widget ul.product_list_widget li .product-details .from .amount,

.skin13 #footer ul.product_list_widget li .product-details .amount,

.skin13 #footer .widget ul.product_list_widget li .product-details .amount {

	color:#fff;

}



.skin13 #footer ul.product_list_widget li .product-details del .amount,

.skin13 #footer .widget ul.product_list_widget li .product-details del .amount {

	font-size: 12px;

}



.skin13 #footer ul.product_list_widget li .product-details ins .amount,

.skin13 #footer .widget ul.product_list_widget li .product-details ins.amount  {

	font-size: 15px;

}



.skin13 #footer-inner {

	background-color: #50515a;

}



.skin13 #footer .widget .label {

	color:#bbb;

}



.skin13 #footer #footer-bottom {

	background-color: #45464e;

}



.skin13 #footer .newsletter-widget .input-box input[type="text"],

.skin13 .newsletter-widget .input-box input[type="email"] {

	border-radius: 0;

	background-color: #45464e;

	border-color:#45464e;

	color:#fff;

	height:36px;

	padding:8px 10px;

	box-shadow:none;

	-webkit-box-shadow:none;

}



.skin13 #footer .newsletter-widget .input-box-wrapper input[type="submit"] {

	border-radius: 0;

    padding:7.5px 13.5px;

}



.skin13 .newsletter-widget input[type="submit"] {

    background: #000;

    border: 1px solid #000;

    text-transform: uppercase;

}



.skin13 .newsletter-widget input[type="submit"]:hover,

.skin13 .newsletter-widget input[type="submit"]:active {

	background: #000;

	border-color: #000;

	color:#eee;

}



.skin13 #footer .widget .links li > i,

.skin13 .widget.contact-info li i {

	color:#bbb !important;

}



.skin13 #footer-bottom > .container .footer-left {

	padding-right: 0;

}





@media (min-width: 992px) {

	.skin13.v2 #footer-bottom .logo {

		margin-right: 0;

	}

}





/* Skin14 - index14 */

.skin14.v2 #footer #footer-bottom {

	background-color: #fff;

}



.skin14.v2 #footer #footer-bottom .logo {

	margin-right: 15px;

}



/* Skin15 - index15 */



.skin15 .newsletter-widget input[type="submit"] {

    border: 1px solid #08c;

}





/* Skin16 - index16 */

.skin16 #footer,

.skin16 #footer #footer-bottom {

	background-color: transparent;

}



.skin16 #footer,

.skin16 #footer a,

.skin16 #footer a:hover {

	color:#777;

}



.skin16 #footer > .container {

	padding:0 15px;

}



.skin16 #footer .widget .widget-title {

	color:#313131;

}



.skin16 #footer .widget .links li > i {

	color:#333 !important;

}



.skin16 #footer #footer-wrapper {

	padding:45px 15px 10px;

}



.skin16 #footer #footer-wrapper {

	background-color: #e7e8e9;

}



@media (min-width: 768px) {

	.skin16 #footer-bottom .container {

		padding:0 45px;

	}



	.skin16 #footer-bottom .social-icons {

		margin-right:0;

	}



	.skin16 #footer #footer-wrapper {

		padding-left:30px;

		padding-right:30px;

	}

}



@media (max-width: 767px) {

	.skin16 #footer > .container {

		padding:0;

	}

}





/* Skin17 - index17 */

.skin17 #footer {

	background-color: #f5f5f5;

}



.skin17 #footer #footer-bottom {

	background-color: #fff;

}



.skin17 #footer,

.skin17 #footer a,

.skin17 #footer a:hover {

	color:#777;

}



.skin17 #footer .widget .widget-title {

	color:#313131;

	text-transform: uppercase;

	font-weight: bold;

}



.skin17 #footer .widget .links li > i {

	color:#777777 ;

}



.skin17 .newsletter-widget input[type="submit"] {

	background-color: #3f4658;

	border-color:#3f4658;

}



.skin17 .newsletter-widget input[type="submit"]:hover,

.skin17 .newsletter-widget input[type="submit"]:focus {

	opacity: 0.9;

}



.skin17 #scroll-top {

	background-color: #404040;

	color:#fff;

}



.skin17 #scroll-top:hover {

	background-color:#555;

}





/* =============================================

-----------------  20. Social Icons -------------

==============================================*/



.social-icons {

	font-size:0;

}



.social-icon {

	display:inline-block;

width: 50px;

height: 50px;

font-size: 40px;

line-height: 52px;

	margin:0 7.5px 15px;

	color:#95ca48  !important;

	background-color: #fff;

	margin:0.2857em 0.5714em 0.2857em 0;

	text-align: center;

	border-radius: 5px;

	transition:all 0.25s ease 0s;

	-webkit-transition:all 0.25s ease 0s

}





.social-icon.first {

	margin-left:0;

}



.social-icon.icon-facebook:hover,

.social-icons2 .social-icon.icon-facebook {

	background-color:#3b5998 !important;

}



.social-icon.icon-twitter:hover,

.social-icons2 .social-icon.icon-twitter {

	background-color:#55acee !important;

}



.social-icon.icon-linkedin:hover,

.social-icons2 .social-icon.icon-linkedin {

	background-color:#0976b4 !important;

}



.social-icon.icon-google-plus:hover,

.social-icons2 .social-icon.icon-google-plus {

	background-color:#dd4b39 !important;

}



.social-icon.icon-pinterest:hover,

.social-icons2 .social-icon.pinterest {

	background-color:#cc2127 !important;

}



.social-icon.icon-envelope:hover,

.social-icons2 .social-icon.icon-envelope {

	background-color:#dd4b39 !important;

}





.social-icons2 .social-icon.icon-facebook:hover,

.social-icons2 .social-icon.icon-twitter:hover,

.social-icons2 .social-icon.icon-linkedin:hover,

.social-icons2 .social-icon.icon-google-plus:hover,

.social-icons2 .social-icon.icon-envelope:hover {

	opacity:0.9;

}



@media (max-width: 767px) {

	.product-gallery-container {

		margin-bottom: 30px;

	}

}





/* =============================================

--------  21.Owl Carousel - Animate Plugin -----

==============================================*/



/* Change duration for animation speed for product sliders */

.owl-carousel .animated {

	-webkit-animation-duration: 500ms;

	animation-duration: 500ms;

	-webkit-animation-fill-mode: both;

	animation-fill-mode: both;

}



.owl-carousel .owl-animated-in {

	z-index: 0;

}

.owl-carousel .owl-animated-out {

	z-index: 1;

}

.owl-carousel .fadeOut {

	-webkit-animation-name: fadeOut;

	animation-name: fadeOut;

}



@-webkit-keyframes fadeOut {

	0% {

		opacity: 1;

	}



	100% {

		opacity: 0;

	}

}

@keyframes fadeOut {

	0% {

		opacity: 1;

	}



	100% {

		opacity: 0;

	}

}



/*

 * 	Owl Carousel - Auto Height Plugin

 */

.owl-height {

	-webkit-transition: height 500ms ease-in-out;

	transition: height 500ms ease-in-out;

}



/*

 *  Core Owl Carousel CSS File

 */

.owl-carousel {

	display: none;

	width: 100%;

	-webkit-tap-highlight-color: transparent;

	/* position relative and z-index fix webkit rendering fonts issue */

	position: relative;

	z-index: 1;

}

.owl-carousel .owl-stage {

	position: relative;

	-ms-touch-action: pan-Y;

}

.owl-carousel .owl-stage:after {

	content: ".";

	display: block;

	clear: both;

	visibility: hidden;

	line-height: 0;

	height: 0;

}

.owl-carousel .owl-stage-outer {

	position: relative;

	overflow: hidden;

	/* fix for flashing background */

	-webkit-transform: translate3d(0px, 0px, 0px);

}

.owl-carousel .owl-controls .owl-nav .owl-prev,

.owl-carousel .owl-controls .owl-nav .owl-next,

.owl-carousel .owl-controls .owl-dot {

	cursor: pointer;

	cursor: hand;

	-webkit-user-select: none;

	-khtml-user-select: none;

	-moz-user-select: none;

	-ms-user-select: none;

	user-select: none;

}

.owl-carousel.owl-loaded {

	display: block;

}

.owl-carousel.owl-loading {

	opacity: 0;

	display: block;

}

.owl-carousel.owl-hidden {

	opacity: 0;

}

.owl-carousel .owl-refresh .owl-item {

	display: none;

}

.owl-carousel .owl-item {

	position: relative;

	min-height: 1px;

	float: left;

	-webkit-backface-visibility: hidden;

	-webkit-tap-highlight-color: transparent;

	-webkit-touch-callout: none;

	-webkit-user-select: none;

	-moz-user-select: none;

	-ms-user-select: none;

	user-select: none;

	z-index: 1;

}

.owl-carousel .owl-item img {

	display: block;

	width: 100%;

	-webkit-transform-style: preserve-3d;

}

.owl-carousel.owl-text-select-on .owl-item {

	-webkit-user-select: auto;

	-moz-user-select: auto;

	-ms-user-select: auto;

	user-select: auto;

}

.owl-carousel .owl-grab {

	cursor: move;

	cursor: -webkit-grab;

	cursor: -o-grab;

	cursor: -ms-grab;

	cursor: grab;

}

.owl-carousel.owl-rtl {

	direction: rtl;

}

.owl-carousel.owl-rtl .owl-item {

	float: right;

}



/* No Js */

.no-js .owl-carousel {

	display: block;

}



/*

 * 	Owl Carousel - Lazy Load Plugin

 */

.owl-carousel .owl-item .owl-lazy {

	opacity: 0;

	-webkit-transition: opacity 400ms ease;

	transition: opacity 400ms ease;

}

.owl-carousel .owl-item img {

	transform-style: preserve-3d;

}



/*

 * 	Owl Carousel - Video Plugin

 */

.owl-carousel .owl-video-wrapper {

	position: relative;

	height: 100%;

	background: #000;

}

.owl-carousel .owl-video-play-icon {

	position: absolute;

	height: 80px;

	width: 80px;

	left: 50%;

	top: 50%;

	margin-left: -40px;

	margin-top: -40px;

	cursor: pointer;

	z-index: 1;

	-webkit-backface-visibility: hidden;

	-webkit-transition: scale 100ms ease;

	transition: scale 100ms ease;

}



.owl-carousel .owl-video-playing .owl-video-tn,

.owl-carousel .owl-video-playing .owl-video-play-icon {

	display: none;

}



.owl-carousel .owl-video-tn {

	opacity: 0;

	height: 100%;

	background-position: center center;

	background-repeat: no-repeat;

	-webkit-background-size: contain;

	-moz-background-size: contain;

	-o-background-size: contain;

	background-size: contain;

	-webkit-transition: opacity 400ms ease;

	transition: opacity 400ms ease;

}



.owl-carousel .owl-video-frame {

	position: relative;

	z-index: 1;

}



/* Nav Dots*/

.owl-dots {

	text-align: center;

	margin-top:20px;

}



.owl-dot {

	display:inline-block;

	width:10px;

	height:10px;

	background-color: #000000;

	margin:5px 7px;

	border-radius: 50%;

	opacity:0.5;

}



.owl-dot:hover,

.owl-dot.active {

	opacity:1;

}



/* Owl carousel Controls */



/* To not crush dragging

styled buttons not container for vertical centered navs*/

.owl-nav {

	position: absolute;

	bottom:auto;

	top:-3em;

	left:auto;

	right:0;

}



.owl-prev,

.owl-next {

	position: static;

	display:inline-block;

	font-size:1.2857em;

	line-height:1;

	color:#9ac93d;

	padding:1px 9px;

	opacity:1;

}



.owl-prev {

	left:0;

	text-align: left;

	padding-right:5px;

}



.owl-next {

	right:0;

	text-align: right;

	padding-left:5px;

}



.owl-prev:hover,

.owl-next:hover {

	color:#ff5400;

}





/* =============================================

-----------------  22. 404 Page  ---------------

==============================================*/



.error-content {

	text-align: center;

	padding:35px 0 40px;

}



.error-title {

	font:400 150px/1 'Montserrat', Verdana;

	color:#343434;

	margin-bottom:11px;

}



.error-title > span {

	display:block;

	font:300 48px/1 'Raleway', Verdana;

	margin-top:-3px;

}



.error-content p {

	font-weight: 400;

}



.error-content p > a {

	font-weight: 600;

	text-decoration: underline;

}



.error-content p > a:hover,

.error-content p > a:focus {

	color:#2e2e2e;

	text-decoration: underline;

}



@media (min-width: 768px) {

	.error-content {

		padding:50px 0 60px;

	}



	.error-title {

		font-size:300px;

	}



	.error-title > span {

		font-size:70px;

		margin-top:-3px;

	}



}





@media (min-width: 768px) {

	.error-content {

		padding:80px 0 90px;

	}

}







/* =============================================

----------------  23. Coming Soon --------------

==============================================*/



#coming-soon {

	width:100%;

	height:100%;

	position: relative;

	color:#b6b6b6;

	font:400 15px/22px 'Raleway', Verdana;

	text-align: center;

	background-color: #f8f8f8;

}



#coming-soon.coming-soonbg {

	background-image: url('../images/comingsoon.html');

	background-position: center center;

	-webkit-background-size: cover;

	background-size: cover;

}



#coming-soon .logo {

	position: absolute;

	top:40px;

	left:0;

	right:0;

}



#coming-soon .logo > a {

	display: inline-block;

}



#coming-soon-wrapper  {

	background-color: #fff;

	padding:30px 0 40px;

}



#coming-soon h2 {

	font: 700 48px/1 'Montserrat', Verdana;

	text-transform: uppercase;

	color:#ffffff;

	margin-bottom: 11px;

}



#coming-soon #coming-soon-wrapper h2 {

	color:#262626;

}



#coming-soon p {

	max-width:560px;

	margin-right: auto;

	margin-left: auto;

	margin-bottom: 36px;

}



#coming-soon form {

	max-width: 435px;

	margin-right: auto;

	margin-left: auto;

	text-align: left;

}



#countdown {

	margin-bottom:25px;

}



#coming-soon-wrapper #countdown {

	margin-bottom:48px;

}



/* jQuery Countdown styles 2.0.0.

.countdown-rtl {

	direction: rtl;

}



.countdown-row {

	width: 100%;

	font-size:0;

}



.countdown-section {

	display:inline-block;

	position: relative;

	padding-right:50px;

	margin-right:60px;

	font-family: 'Montserrat', Verdana;

	font-weight: 700;

	text-transform: uppercase;

}



.countdown-section:last-child {

	padding-right: 0;

	margin-right: 0;

}



.countdown-section:after {

	content:'';

	position: absolute;

	right:0;

	top:50%;

	margin-top:-30px;

	display:block;

	height:60px;

	width:1px;

	background-color: rgba(255, 255, 255, 0.3);

}



#coming-soon-wrapper .countdown-section:after {

	background-color: #dcdcdc;

}



.countdown-section:last-child:after {

	display: none;

}



.countdown-amount {

	display: block;

    font-size:72px;

    line-height: 70px;

    font-weight: 400;

    color:#fff;

}



#coming-soon #coming-soon-wrapper .countdown-amount {

	color:#262626;

}



.countdown-period {

    display: block;

    position: relative;

    font-size:15px;

    line-height:1;

    color:#edc32f;

}



#coming-soon #coming-soon-wrapper .countdown-period {

	color:#c8c8c8;

}



.countdown-descr {

	display: block;

	width: 100%;

}



#coming-soon .input-desc {

	color:#313131;

	font-size:13px;

	line-height: 1;

	margin-bottom: 9px;

}



#coming-soon .input-group {

	margin-bottom: 0;

}



#coming-soon .input-group .form-control {

	background-color: rgba(255, 255, 255, 0.08);

	border-color:#828282;

	color:#ffffff;

}



#coming-soon .input-group .form-control::-moz-placeholder {

	color: #ffffff;

}



#coming-soon .input-group .form-control:-ms-input-placeholder {

	color: #ffffff;

}



#coming-soon .input-group .form-control::-webkit-input-placeholder {

	color: #ffffff;

}



#coming-soon #coming-soon-wrapper .input-group .form-control {

	background-color: transparent;

	border-color:#e5e5e5;

	color:#c2c2c2;

}



#coming-soon #coming-soon-wrapper .input-group .form-control:focus {

	border-color:#888;

}



#coming-soon #coming-soon-wrapper .input-group .form-control::-moz-placeholder {

	color: #c2c2c2;

}



#coming-soon #coming-soon-wrapper .input-group .form-control:-ms-input-placeholder {

	color: #c2c2c2;

}



#coming-soon #coming-soon-wrapper .input-group .form-control::-webkit-input-placeholder {

	color: #c2c2c2;

}



#coming-soon .btn.btn-custom {

	background-color: #d7af23;

	border-color:#d7af23;

	letter-spacing: 1px;

	padding-left:23px;

	padding-right: 23px;

}



#coming-soon .btn.btn-custom:hover,

#coming-soon .btn.btn-custom:focus {

	background-color: #262626;

	border-color: #262626;

}





#coming-soon footer {

	color:#cccccc;

	font-weight: 400;

	font-size:14px;

	line-height:30px;

	position: absolute;

	bottom:42px;

	left:0;

	right:0;

}



#coming-soon footer.dark {

	color:#8c8c8c;

}



#coming-soon  footer a {

	color:#d7af23;

	font-weight: 600;

}



#coming-soon  footer a:hover {

	color:#262626;

}



@media (max-width: 768px) {



	#coming-soon h2 {

		font-size:36px;

		margin-bottom:48px

	}



	#coming-soon p {

		display: none;

		margin-bottom:50px;

	}



	.countdown-section {

		padding-right:0;

		margin-right:25px;

	}



	.countdown-section:after {

		display: none;

	}



	.countdown-amount {

		font-size:36px;

		line-height: 35px;

	}



	.countdown-period {

	    font-size:13px;

	}

}



@media (max-width: 360px) {

	.countdown-section {

		margin-right:15px;

	}

}



@media (max-height: 400px) {

	#coming-soon .logo {

		top:10px;

	}



	#coming-soon footer {

		bottom:10px;

	}



	#coming-soon h2 {

		font-size:28px;

		margin:25px 0 30px;

	}



	#countdown {

		margin-bottom: 10px;

	}



	#coming-soon #coming-soon-wrapper #countdown {

		margin-bottom:25px;

	}



	#coming-soon #coming-soon-wrapper h2 {

		font-size:28px;

		margin:10px 0 30px;

	}



	#coming-soon-wrapper  {

		padding:10px 0 25px;

	}

}



@media (min-width: 768px) {

	#coming-soon .logo {

		top:30px;

	}



	.countdown-section {

		min-width: 120px;

		margin-right:40px;

	}



	#coming-soon footer {

		bottom:32px;

	}



	#coming-soon.simple .logo {

		top:20px;

	}



	#coming-soon.simple footer {

		bottom:22px;

	}

}



@media (min-width: 992px) {



	.countdown-section {

		min-width: 135px;

		margin-right:60px;

	}

}





@media (min-width: 1199px) {

	#coming-soon .logo {

		top:60px;

	}



	#coming-soon footer {

		bottom:52px;

	}



	#coming-soon.simple .logo {

		top:30px;

	}



	#coming-soon.simple footer {

		bottom:27px;

	}



}



@media (min-height: 800px) {

	#coming-soon-wrapper  {

		padding:65px 0 70px;

	}



	#coming-soon.simple .logo {

		top:60px;

	}



	#coming-soon.simple footer {

		bottom:52px;

	}

}



*/



/* =============================================

-------------  25. Scroll Top Button  ----------

==============================================*/



#scroll-top {

	position:fixed;

	bottom:0;

	right:20px;

	display: none;

	cursor:pointer;

	background: #404040;

    background: rgba(64, 64, 64, 0.75);

    border-radius: 4px 4px 0 0;

    color: #fff;

    height: 9px;

    padding: 7px 10px 30px;

    text-align: center;

    text-decoration: none;

    min-width: 40px;

}



#scroll-top:hover {

	background:#404040;

}



#scroll-top.fixed {

	opacity:1;

	visibility:visible;

}



/* @group Custom styles */



.currency_language_form {

	display: inline-block;

}



	.currency_language_form .arrow {

		display: none;

	}



/* @end */



.main-content {

	/*padding-bottom: 40px; */

	min-height: 400px;

}



.body-header-type-1.common-home header .container-megamenu {

	display: none;

}



/* @group Camera slider */



.camera_slider {

	margin-bottom: 20px;

}



	.skin5 .camera_slider {

		margin-bottom: 15px;

	}



	.camera_slider .owl-dots {

		position: absolute;

		left: 0;

		right: 0;

		margin-top: -40px;

	}



	.camera_slider img {

		border-radius: 5px;

		-webkit-border-radius: 5px;

		-moz-border-radius: 5px;

	}



	.skin5 .camera_slider img,

	.skin8 .camera_slider img,

	.skin12 .camera_slider img {

		border-radius: 0;

		-webkit-border-radius: 0;

		-moz-border-radius: 0;

	}



/* @end */



/* @group Mobile menu */



#mobile-menu .fa-caret-down {

	display: none;

}



#mobile-menu .currency_language_form {

	display: block;

}



#mobile-menu .arrow {

	display: block;

}



/* @end */



/* @group Cart block */



#mini-cart .dropdown-menu {

	color: #777;

}



#mini-cart .checkout {

	padding: 0px 20px 20px 20px;

}



#mini-cart .checkout:before,

#mini-cart .checkout:after {

  display: table;

  content: " ";

}

#mini-cart .checkout:after {

  clear: both;

}



	#mini-cart .checkout .btn {

		display: block;

		width: 48%;

		float: left;

	}



		#mini-cart .checkout .btn:last-of-type {

			float: right;

		}



#mini-cart .mini-cart-info {



}



	#mini-cart .mini-cart-info table tr {

		padding: 20px 20px 0px 20px;

		display: block;

	}



		#mini-cart .mini-cart-info table td {

			vertical-align: top;

		}



			#mini-cart .mini-cart-info table td.image {

				padding-right: 10px;

			}



				#mini-cart .mini-cart-info table td.image img {

					display: block;

					margin: 0px auto;

					border-radius: 5px;

					-webkit-border-radius: 5px;

					padding: 3px;

					-moz-border-radius: 5px;

					border: 1px solid #ddd;

				}



		#mini-cart .mini-cart-info table td.name {

			padding-top: 10px;

			width: 200px;

		}



			#mini-cart .mini-cart-info table td.name .price2 {

				color: #9ac93d;

				padding-top: 5px;

			}



		#mini-cart .mini-cart-info table td.remove {

			font-weight: bold;

			width: 100px;

			padding-top: 8px;

			text-align: right;

		}



#mini-cart .mini-cart-total {

	padding: 13px 16px;

}



	#mini-cart .mini-cart-total tr {

		display: none;

	}



		#mini-cart .mini-cart-total tr td {

			width: 300px;

			padding-left: 4px;

			padding-right: 4px;

		}



			#mini-cart .mini-cart-total tr td:first-child {

				text-align: right;

				font-size: 18px;

				font-weight: bold;

			}



			#mini-cart .mini-cart-total tr td:last-child {

				font-size: 18px;

				color: #08c;

				font-weight: 700;

			}



		#mini-cart .mini-cart-total tr:last-child {

			display: block;

		}



/* @end */



/* @group Buttons */



.btn-default,

.btn,

.button {

	display: inline-block;

	padding: 6px 12px;

	margin-bottom: 0;

	font-size: 14px;

	font-weight: normal;

	line-height: 1.42857143;

	text-align: center;

	white-space: nowrap;

	vertical-align: middle;

	-ms-touch-action: manipulation;

	    touch-action: manipulation;

	cursor: pointer;

	-webkit-user-select: none;

	   -moz-user-select: none;

	    -ms-user-select: none;

	        user-select: none;

	background-image: none;

	border: 1px solid transparent;

	border-radius: 4px;

    color: #fff;

    font-weight: 400;

    background-color: #9ac93d;

    text-shadow: none;

    border: 0;

    opacity: 1;

    filter: alpha(opacity=100);

    transition: all 0.2s ease-in;

    -webkit-transition: all 0.2s ease-in;

    -moz-transition: all 0.2s ease-in;

}



	.btn-default:hover,

	.btn:hover,

	.button:hover {

		background: #ed4949;

		color: #fff;

	}



/* @end */



/* @group Quickview */



a.quickview-icon {

    position: absolute;

    right: 0;

    top: 0;

    background-color: #000;

    color: #fff;

    padding: 10px;

    z-index: 9;

    border-radius: 0 5px;

    opacity: 0;

    visibility: hidden;

    transition: 0.1s all;

    font-size: 12px;

    line-height: 1.4;

}



	.product:hover a.quickview-icon {

		opacity: 1;

		visibility: visible;

	}



		.product:hover a.quickview-icon:hover {

			opacity: 0.9;

		}



/* @end */



/* @group Megamenu */



.container-megamenu + .widget {

	margin-top: 20px;

}



@media (max-width: 991px) {

	.mobile-disabled {

		display: none !important;

	}

}



.megamenu .megamenu-footer {

    background-color: #f6f6f6;

    padding: 0;

    border: 2px solid #fff;

    color: #000000;

    font-weight: 400;

    margin-left: -30px;

    margin-bottom: -30px;

    margin-right: -30px;

    border-radius: 0 0 6px 6px;

}



	.megamenu .megamenu-footer .info-box-container {

	    border-right: 2px solid #fff;

	}



	.megamenu .megamenu-footer .info-box-container:last-child {

		border: none;

	}

/* @end */



/* @group Product category page */



.product-grid .product {

	padding-bottom: 30px;

}



/* @end */



/* @group 22. Magnific popup */



.mfp-iframe-scaler iframe {

     background: url("../images/loader.gif") no-repeat scroll center center #ffffff !important;

}



.quickview {

}



     .quickview body {

          background: #fff;

          padding: 30px 30px 0px 30px;

     }



     .quickview .mfp-iframe-holder .mfp-content {

          max-width: 900px;

          height:620px;

     }



     .quickview .mfp-iframe {

          opacity: 0;

          transition: all 0.2s ease-in-out;

          -webkit-transform: scale(0.7);

          -moz-transform: scale(0.7);

          -ms-transform: scale(0.7);

          transform: scale(0.7);

     }



     .quickview.mfp-bg {

          opacity: 0.01;

          transition: all 0.2s ease-out;

     }



     .quickview.mfp-ready .mfp-iframe {

          opacity: 1;

          -webkit-transform: scale(1);

          -moz-transform: scale(1);

          -ms-transform: scale(1);

          transform: scale(1);

     }



     .quickview.mfp-ready.mfp-bg {

          opacity: 0.75;

     }



     .quickview.mfp-removing .mfp-iframe {

          -webkit-transform: scale(0.7);

          -moz-transform: scale(0.7);

          -ms-transform: scale(0.7);

          transform: scale(0.7);

          opacity: 0;

     }



     .quickview.mfp-removing.mfp-bg {

          opacity: 0;

     }



.mfp-with-zoom .mfp-container,

.mfp-with-zoom.mfp-bg {

	opacity: 0;

	-webkit-backface-visibility: hidden;

	-webkit-transition: all 0.3s ease-out;

	-moz-transition: all 0.3s ease-out;

	-o-transition: all 0.3s ease-out;

	transition: all 0.3s ease-out;

}



.mfp-with-zoom.mfp-ready .mfp-container {

	opacity: 1;

}

.mfp-with-zoom.mfp-ready.mfp-bg {

	opacity: 0.8;

}



.mfp-with-zoom.mfp-removing .mfp-container,

.mfp-with-zoom.mfp-removing.mfp-bg {

	opacity: 0;

}



/* @end */



/* @group OpenCart styles */



.success,

.warning,

.attention,

.information {

	padding: 10px 10px 10px 40px;

	margin:0px 0px 20px 0px;

	clear: both;

	border-radius:2px;

	-webkit-border-radius:2px;

	-moz-border-radius:2px;

}



	.success {

		background: #EAF7D9 url('../images/success.png') 13px center no-repeat;

		border: 1px solid #BBDF8D;

	}



	.warning {

		background: #FFD1D1 url('../images/warning.png') 13px center no-repeat;

		border: 1px solid #F8ACAC;

	}



	.attention {

		background: #FFF5CC url('../images/attention.png') 13px center no-repeat;

		border: 1px solid #F2DD8C;

	}



	.information {

		background: #E8F6FF url('../images/information.html') 13px center no-repeat;

		border: 1px solid #B8E2FB;

	}



/* @group Review */



.review-list .author,

.review-list .rating {

	display: inline-block;

}



	.review-list .rating {

		float: right;

		width: auto;

		padding-top: 8px;

	}



	.review-list .author span {

		font-size: 10px;

		opacity: 0.8;

		font-style: italic;

		padding-left: 3px;

	}



.review-list .text {

	margin: 15px 0px 20px 0px;

	padding: 20px;

	position: relative;

	background: #fff;

	border: 1px solid #e6e6e6;

	border-radius:         2px;

	-moz-border-radius:    2px;

	-webkit-border-radius: 2px;

}



	.review-list .text:before {

		position: absolute;

		top: -9px;

		left: 9px;

		display: inline-block;

		border-right: 9px solid transparent;

		border-bottom: 9px solid #ccc;

		border-left: 9px solid transparent;

		border-bottom-color: #e6e6e6;

		content: '';

	}



	.review-list .text:after {

		position: absolute;

		top: -8px;

		left: 10px;

		display: inline-block;

		border-right: 8px solid transparent;

		border-bottom: 8px solid #ffffff;

		border-left: 8px solid transparent;

		content: '';

	}



/* @end */



/* @group Tables

------------------*/



table.attribute,

table.list,

.wishlist-product table,

.wishlist-info table,

.compare-info,

.cart-info table,

.checkout-product table,

.table {

	border-collapse: separate;

	border-spacing: 0;

    border: solid #ddd 1px;

    width: 100%;

    margin: 0px 0px 20px 0px;

    -moz-border-radius: 5px;

    -webkit-border-radius: 5px;

    border-radius: 5px;

}



	table.attribute tr,

	table.list tr,

	.wishlist-product table tr,

	.wishlist-info table tr,

	.compare-info tr,

	.cart-info table tr,

	.checkout-product table tr,

	.table {

	    background: #fff;

	}



		table.attribute tr:hover,

		table.list tr:hover,

		.wishlist-product table tr:hover,

		.wishlist-info table tr:hover,

		.compare-info tr:hover,

		.cart-info table tr:hover,

		.checkout-product table tr:hover,

		.table tr:hover {

		    background: #f7f7f7;

		    -webkit-transition: all 0.1s ease-in-out;

		    -moz-transition: all 0.1s ease-in-out;

		    transition: all 0.1s ease-in-out;

		}



	table.attribute td,

	table.list td,

	.wishlist-product table td,

	.wishlist-info table td,

	.compare-info td,

	.cart-info table td,

	.checkout-product table td,

	.table td {

	    border-left: 1px solid #ddd;

	    border-top: 1px solid #ddd;

	    padding: 10px;

	    text-align: left;

	    vertical-align: top;

	}



		.table td.text-center {

			text-align: center;

		}



			.table td.text-center .input-group {

				margin: 0px auto;

			}



		.table td.text-right {

			text-align: right;

		}



	table.attribute thead td,

	table.list thead td,

	.wishlist-product table thead td,

	.wishlist-info table thead td,

	.compare-info thead td,

	.cart-info table thead td,

	.checkout-product table thead td,

	.table thead td {

	    background-color: #f5f5f5;

	    border-radius: 0 !important;

	    -webkit-border-radius: 0 !important;

	    -moz-border-radius: 0 !important;

	    color: #777;

	    font-size: 0.9286em;

	    font-weight: 700;

	    line-height: 1.4;

	    text-transform: uppercase;

	}



		table.attribute thead:first-child td,

		table.list thead:first-child td,

		.wishlist-product table thead:first-child td,

		.wishlist-info table thead:first-child td,

		.compare-info thead:first-child td,

		.cart-info table thead:first-child td,

		.checkout-product table thead:first-child td,

		.table thead:first-child td {

			border-top: none;

		}



	table.attribute td:first-child,

	table.list td:first-child,

	.wishlist-product table td:first-child,

	.wishlist-info table td:first-child,

	.compare-info td:first-child,

	.cart-info table td:first-child,

	.checkout-product table td:first-child,

	.table td:first-child {

	    border-left: none;

	}



	table.attribute thead td:first-child,

	table.list thead td:first-child,

	.wishlist-product table thead td:first-child,

	.wishlist-info table thead td:first-child,

	.compare-info thead td:first-child,

	.cart-info table thead td:first-child,

	.checkout-product table thead td:first-child,

	.table thead td:first-child {

	    -moz-border-radius: 5px 0 0 0;

	    -webkit-border-radius: 5px 0 0 0;

	    border-radius: 5px 0 0 0;

	}



	table.attribute thead td:last-child,

	table.list thead td:last-child,

	.wishlist-product table thead td:last-child,

	.wishlist-info table thead td:last-child,

	.compare-info thead td:last-child,

	.cart-info table thead td:last-child,

	.checkout-product table thead td:last-child,

	.table thead td:last-child {

	    -moz-border-radius: 0 5px 0 0;

	    -webkit-border-radius: 0 5px 0 0;

	    border-radius: 0 5px 0 0;

	}



	table.attribute thead td:only-child,

	table.list thead td:only-child,

	.wishlist-product table thead td:only-child,

	.wishlist-info table thead td:only-child,

	.compare-info thead td:only-child,

	.cart-info table thead td:only-child,

	.checkout-product table thead td:only-child,

	.table thead td:only-child {

	    -moz-border-radius: 5px 5px 0 0;

	    -webkit-border-radius: 5px 5px 0 0;

	    border-radius: 5px 5px 0 0;

	}



	table.attribute tr:last-child td:first-child,

	table.list tr:last-child td:first-child,

	.wishlist-product table tr:last-child td:first-child,

	.wishlist-info table tr:last-child td:first-child,

	.compare-info tr:last-child td:first-child,

	.cart-info table tr:last-child td:first-child,

	.checkout-product table tr:last-child td:first-child,

	.table tr:last-child td:first-child {

	    -moz-border-radius: 0 0 0 5px;

	    -webkit-border-radius: 0 0 0 5px;

	    border-radius: 0 0 0 5px;

	}



	table.attribute tr:last-child td:last-child,

	table.list tr:last-child td:last-child,

	.wishlist-product table tr:last-child td:last-child,

	.wishlist-info table tr:last-child td:last-child,

	.compare-info tr:last-child td:last-child,

	.cart-info table tr:last-child td:last-child,

	.checkout-product table tr:last-child td:last-child,

	.table tr:last-child td:last-child {

	    -moz-border-radius: 0 0 5px 0;

	    -webkit-border-radius: 0 0 5px 0;

	    border-radius: 0 0 5px 0;

	}



/* @end */



/* @group Wishlist info */



.wishlist-info table td {

	vertical-align: middle;

	text-align: center;

}



/* @end */



/* @group Cart info */



.cart-info table td {

	vertical-align: middle;

	text-align: center;

}



/* @end */



/* @group Price Compare */



.compare-info .price-new {

	color: #ff6b6b;

}



	.compare-info .price-old {

		color: #808080;

		text-decoration: line-through;

		padding-right: 2px;

	}



/* @end */



/* @group Table img */



table img {

	max-width: none;

}



/* @end */



/* @group Cart Total */



.cart-total {

	overflow: auto;

	margin-bottom: 20px;

	padding-top: 10px;

}



	.cart-total table {

		float: right;

	}



		.cart-total td {

			padding: 0px 0px 0px 20px;

			text-align: right;

			font-weight: normal;

		}



			.cart-total td strong {

				font-weight: normal;

			}



		.cart-total table tr td:last-child {

			color: #444;

			font-weight: 600;

		}



/* @end */



/* @group Download List, Orders */



.download-list,

.order-list {

	overflow:auto;

}



	.download-list .download-id,

	.order-list .order-id {

		width: 49%;

		float: left;

		margin-bottom: 2px;

	}



	.download-list .download-status,

	.order-list .order-status {

		width: 49%;

		float: right;

		text-align: right;

		margin-bottom: 2px;

	}



	.download-list .download-content,

	.order-list .order-content {

		padding: 10px 0px;

		display: inline-block;

		width: 100%;

		margin-bottom: 20px;

		border-top: 1px solid #e6e6e6;

		border-bottom: 1px solid #e6e6e6;

	}



	.download-list .download-content div,

	.order-list .order-content div {

		float: left;

		width: 33.3%;

	}



	.download-list .download-info,

	.order-list .order-info {

		text-align: right;

	}



/* @end */



/* @group manufacturer */



.manufacturer-list {

	border: 1px solid #ddd;

	border-radius:         6px;

	-moz-border-radius:    6px;

	-webkit-border-radius: 6px;

	padding: 0px;

	overflow: auto;

	margin-bottom:20px;

	background: #fff;

}



	.manufacturer-heading {

		background: #f3f4f5;

		border-bottom: 1px solid #ddd;

		padding: 10px;

	}



	.manufacturer-content {

		padding: 10px;

		overflow:auto;

	}



	.manufacturer-list ul {

		float: left;

		width: 25%;

		margin: 0 0 0 20px;

		padding: 0;

	}



/* @end */



/* @group checkout */



.center-column .panel {

	position:relative;

	border: none;

	margin: 0px 0px 20px 0px;

}



	.center-column .panel-heading {

		border-radius:6px;

		-moz-border-radius:6px;

		-webkit-border-radius:6px;

		background: #f4f4f4;

		border: 1px solid #ddd;

		padding: 10px;

	}



		.center-column .panel-heading h4 {

			padding: 0px;

			margin: 0px;

			font-size: 13px !important;

			color: #777;

			    font-size: 0.9286em;

			    font-weight: 700;

			    line-height: 1.4;

			    text-transform: uppercase;

		}



	.center-column .panel-body {

		border-radius:0px 0px 2px 2px;

		-moz-border-radius:0px 0px 2px 2px;

		-webkit-border-radius:0px 0px 2px 2px;

		position:relative;

		border: 1px solid #e6e6e6;

		background: #fff;

		padding:20px;

		position: relative;

		margin-top: -3px;

	}



		.center-column .panel-body .buttons {

			margin: 0px;

		}



		.center-column h2 {

			margin-bottom: 10px;

		}



			.center-column h2.slider-title {

				margin-bottom: 20px;

			}



/* @end */



/* @group Returns */



.return-list {

}



	.return-list .return-id {

		width: 49%;

		float: left;

		margin-bottom: 2px;

	}



	.return-list .return-status {

		width: 49%;

		float: right;

		text-align: right;

		margin-bottom: 2px;

	}



	.return-list .return-content {

		padding: 10px 0px;

		display: inline-block;

		width: 100%;

		margin-bottom: 20px;

		border-top: 1px solid #e6e6e6;

		border-bottom: 1px solid #e6e6e6;

	}



	.return-list .return-content div {

		float: left;

		width: 33.3%;

	}



	.return-list .return-info {

		text-align: right;

	}



.return-product {

	overflow: auto;

	margin-top: 10px;

	margin-bottom: 20px;

}



.return-detail {

}



	.return-opened textarea {

		width: 100%;

	}



/* @end */



/* @group Filter */



ul.box-filter {

	list-style: none;

	margin: 0px;

	padding: 0px 0px 5px 0px;

}



	ul.box-filter > li {

		padding: 0px 0px 15px 0px;

	}



		ul.box-filter > li > span {

			font-weight: bold;

		}



	ul.box-filter ul {

		list-style: none;

		padding: 0px;

	}



/* @end */



/* @end */



/* @group 14. Facebook Widget  */



.facebook_left {

    width: 308px;

    position: fixed;

	left: -308px;

	top: 150px;

	z-index: 999;

}



.facebook_right {

    width: 308px;

    position: fixed;

	right: -308px;

	top: 150px;

	z-index: 999;

}



	.facebook_left .facebook-icon,

	.facebook_right .facebook-icon {

		height: 50px;

	    width: 50px;

		right: -50px;

	    background: url(../images/facebook-icon.png) no-repeat;

		cursor: pointer;

		position: absolute;

	    z-index: 999;

	}



	.facebook_right .facebook-icon {

		left: -50px;

		right: auto;

	}



	.facebook_right .facebook-content,

	.facebook_left .facebook-content {

	    background-color: #FFFFFF;

		border: 4px solid #4b6baf;

		position: relative;

	    z-index: 999;

	}



/* @end */



/* @group 15. Twitter Widget  */



.twitter_left {

    width: 250px;

    position: fixed;

	left: -250px;

	top: 150px;

	z-index: 998;

}



.twitter_right {

    width: 250px;

    position: fixed;

	right: -250px;

	top: 150px;

	z-index: 998;

}



	.facebook_right + .twitter_right,

	.facebook_left + .twitter_left {

		top: 210px;

	}



	.twitter_left .twitter-icon,

	.twitter_right .twitter-icon {

		height: 50px;

	    width: 50px;

		right: -50px;

	    background: url(../images/twitter-icon.png) no-repeat;

		cursor: pointer;

		position: absolute;

	    z-index: 998;

	}



	.twitter_right .twitter-icon {

		left: -50px;

		right: auto;

	}



	.twitter_right .twitter-content,

	.twitter_left .twitter-content {

	    background-color: #FFFFFF;

		border: 4px solid #36a7e5;

		position: relative;

	    z-index: 998;

	}



/* @end */



/* @group 16. Custom Widget  */



.custom_left {

    width: 250px;

    position: fixed;

	left: -250px;

	top: 150px;

	z-index: 996;

}



.custom_right {

    width: 250px;

    position: fixed;

	right: -250px;

	top: 150px;

	z-index: 996;

}



	.facebook_right + .twitter_right + .custom_right,

	.facebook_left + .twitter_left + .custom_left {

		top: 270px;

	}



	.facebook_right + .custom_right,

	.twitter_right + .custom_right,

	.twitter_left + .custom_left,

	.facebook_left + .custom_left {

		top: 210px;

	}



	.custom_left .custom-icon,

	.custom_right .custom-icon {

		height: 50px;

	    width: 50px;

		right: -50px;

	    background: url(../images/custom-icon.png) no-repeat;

		cursor: pointer;

		position: absolute;

	    z-index: 996;

	}



		.custom_left .custom-icon {

			background: url(../images/custom-icon-right.png) no-repeat;

		}



	.custom_right .custom-icon {

		left: -50px;

		right: auto;

	}



	.custom_right .custom-content,

	.custom_left .custom-content {

	    background-color: #FFFFFF;

		border: 4px solid #ea2e49;

		position: relative;

	    z-index: 996;

	    padding: 10px;

	}



/* @end */



/* @group 17. Opencart 2.0 */



.picker-switch .btn {

	background: none !important;

	color: #808080 !important;

	text-shadow: none !important;

	-webkit-text-shadow: none !important;

	-moz-text-shadow: none !important;

}



.timepicker-picker .btn {

	background: none !important;

	color: #808080 !important;

	text-shadow: none !important;

	-webkit-text-shadow: none !important;

	-moz-text-shadow: none !important;

}



div.required .control-label:before {

	content: '* ';

	color: #F00;

	font-weight: bold;

}



/* @end */



/* @group 18. Carousel Brands */



.carousel-brands {

	background: #fff;

	margin: 30px 0px 0px 0px !important;

	padding: 10px 70px;

	border: 1px solid #e6e6e7;

	border-radius:         2px;

	-moz-border-radius:    2px;

	-webkit-border-radius: 2px;

	position: relative;

}



@media (max-width: 767px) {

	.responsive .carousel-brands {

		margin-top: 20px !important;

	}

}



     /** Carousel Controls **/



     .carousel-brands .owl-prev,

     .carousel-brands .owl-next {

     	position: absolute;

     	top: 50%;

     	margin-top: -14px;

     	right: 20px;

     	cursor: pointer;

     	width: 28px;

     	height: 28px;

     	border-radius:         2px;

     	-moz-border-radius:    2px;

     	-webkit-border-radius: 2px;

     	background: #43c6bc; /* Old browsers */

     	background: -moz-linear-gradient(top, #43c6bc 0%, #59d4cc 0%, #43c6bc 99%); /* FF3.6+ */

     	background: -webkit-gradient(linear, left top, left bottom, color-stop(0%,#43c6bc), color-stop(0%,#59d4cc), color-stop(99%,#43c6bc)); /* Chrome,Safari4+ */

     	background: -webkit-linear-gradient(top, #43c6bc 0%,#59d4cc 0%,#43c6bc 99%); /* Chrome10+,Safari5.1+ */

     	background: -o-linear-gradient(top, #43c6bc 0%,#59d4cc 0%,#43c6bc 99%); /* Opera 11.10+ */

     	background: -ms-linear-gradient(top, #43c6bc 0%,#59d4cc 0%,#43c6bc 99%); /* IE10+ */

     	background: linear-gradient(to bottom, #43c6bc 0%,#59d4cc 0%,#43c6bc 99%); /* W3C */

     }



     	.carousel-brands .owl-next:before {

     		content: "";

     		background: url(../images/right.html) no-repeat;

     		width: 8px;

     		height: 14px;

     		margin: 8px auto 0px auto;

     		display: block;

     	}



     .carousel-brands .owl-prev {

     	left: 20px;

     }



     	.carousel-brands .owl-prev:before {

     		content: "";

     		background: url(../images/left.html) no-repeat;

     		width: 8px;

     		height: 14px;

     		margin: 8px auto 0px auto;

     		display: block;

     	}



/* @end */



/* @group Header notice */



.header-notice {

     background: #0083c1;

     color: #fff;

     font-size: 12px;

     font-weight: 600;

     display: none;

}



     .header-notice a {

          color: #fff;

     }



     .header-notice p {

          padding: 14px 0px 18px 0px;

          margin: 0px;

     }



     .header-notice a.close-notice {

          display: block;

          float: right;

          width: 36px;

          height: 36px;

          border-radius: 100%;

          -webkit-border-radius: 100%;

          -moz-border-radius: 100%;

          background: #fff;

          margin: 6px 10px;

          text-align: center;

          padding: 9px 0px 0px 0px;

          color: #0083c1;

          -webkit-transition: all 0.2s ease-out;

          -moz-transition: all 0.2s ease-out;

          -o-transition: all 0.2s ease-out;

          -ms-transition: all 0.2s ease-out;

          transition: all 0.2s ease-out;

     }



          .header-notice a.close-notice:before {

                 content: "\f00d";

                 font: normal normal normal 14px/1 FontAwesome;

                 text-rendering: auto;

                 -webkit-font-smoothing: antialiased;

                 -moz-osx-font-smoothing: grayscale;

          }



          .header-notice a.close-notice:hover {

               background: #333333;

               color: #fff;

          }



/* @end */



/* @group Popup Module */



.popup {

     padding: 40px 40px 40px 40px;

     text-align: left;

     max-width: 750px;

     margin: 40px auto;

     position: relative;

     border-top: 0px solid #08c;

     border-radius: 5px;

     -webkit-border-radius: 5px;

     -moz-border-radius: 5px;

     background: #fff;

     -webkit-box-shadow: 0 10px 25px rgba(0,0,0,0.5);

     -moz-box-shadow: 0 10px 25px rgba(0,0,0,0.5);

     box-shadow: 0 10px 25px rgba(0,0,0,0.5);

}



body .popup-module .mfp-close {

     top: -4px;

     right: -6px;

     text-align: right;

     padding-right: 19px;

     width: 100%;

     color: #08c;

     font-size: 22px;

     opacity: 1;

     font-weight: bold;

}



	body .popup-module .mfp-close:hover {

		opacity: 0.85;

	}



     body .popup-module.without-button-close .mfp-close {

          display: none;

     }



     .popup h4 {

     	padding: 0px 0px 29px 0px;

     	margin: 0px;

     	font-weight: 700;

     	color: #313131;

     	font-size: 16px;

     	line-height: 1;

     }



     .popup .content {

          padding: 0px 0px 10px 0px;

          margin: 0px;

     }



     .popup .contact-label {

     	padding-bottom: 20px;

     }



     .popup .btn-primary {

     	margin: 10px 0 0px 0;

     	display: block;

     }



     /* @group Newsletter */



     .popup .newsletter-content {

     	max-width: 312px;

     	text-align: center;

     	padding: 6px 0px 0px 0px;

     }



     	.popup .newsletter-content h2 {

     		padding: 29px 0px 0px 0px;

     		margin: 0px;

     		font-weight: 700;

     		color: #313131;

     		font-size: 16px;

     		line-height: 1;

     	}



     	.popup .newsletter-content p {

     		padding: 12px 10px 0px 10px;

     		margin: 0px;

     		font-size: 13px;

     		line-height: 1.4;

     		color: #444;

     	}



     .popup .newsletter {

     	position: relative;

     	max-width: 300px;

     	margin: 15px 0px 0px 0px;

     }



     	.popup .newsletter input {

     		display: block;

     		width: 100%;

     		background: #fff;

     		border: 1px solid #ccc;

     		color: #777;

     		font-size: 13px;

     		height: 34px;

     		padding: 2px 13px;

     		line-height: 30px;

     		border-radius: 3px;

     	}



     	.popup .newsletter .buton {

     		display: block;

     		border: 0;

     		padding: 0 15px;

     		font-weight: normal;

     		font-size: 14px;

     		text-align: center;

     		white-space: nowrap;

     		color: #fff;

     		line-height: 38px;

     		position: absolute;

     		top: 0;

     		right: 0;

     		height: 34px;

     		color: #555;

     		line-height: 34px;

     		border-left: 1px solid #ccc;

     	}



     .popup .dont-show-label {

     	font-size: 11px;

     	position: relative;

     	margin: 15px 0px -21px 0px;

     }



     	.popup .dont-show-label span {

     		font-weight: normal;

     		padding-left: 2px;

     	}



     /* @end */



     /* @group Buttons yes no */



     .popup .buttons-yes-no {

          padding: 20px 0px 0px 0px;

     }



          .popup .buttons-yes-no .button:first-child {

               margin-right: 20px;

          }



     /* @end */



     /* @group Form contact */



     .popup .form-contact {



     }



          .popup .form-contact .error {

               border-color: red;

          }



     /* @end */



/* @end */



/* @group Product info */



.product-info {

}



	.popup-gallery {

		padding-bottom: 30px !important;

	}



	/* Product info - Image */



	.product-info .product-image {

		margin: 0px 0px 10px 0px;


		background: #fff;

		border-radius:         6px;

		-moz-border-radius:    6px;

		-webkit-border-radius: 6px;

		text-align: center;

	}



		.product-info .product-image a {

			display: block;

		}



		.product-info .product-image img {

			display: block;

			cursor: pointer;

			margin: 0px auto;

		}





	/* Product info - thumbnails */



	.product-info .thumbnails {

	}



		.product-info .thumbnails ul {

			list-style: none;

			margin: 0px 0px 0px -20px;

			position: relative;

			padding: 0px;

		}



			.product-info .thumbnails ul li {

			}



				.product-info .thumbnails li p {

					margin: 0px;

					padding: 0px 0px 20px 20px;

				}



				.product-info .thumbnails li img,

				.product-info .thumbnails-carousel img {

				/*	border: 1px solid #ddd; */

					display: block;

					border-radius:         6px;

					-moz-border-radius:    6px;

					-webkit-border-radius: 6px;

					margin: 0px auto;

					padding: 2px;

					background: #fff;

				}



	/* Product info - thumbnails carousel */



	.overflow-thumbnails-carousel .owl-controls {

		display: none;

	}



	.tags_product {

		margin: 0px 0px 20px 0px;

	}



	/* Product center */



	.product-center {

		padding-bottom: 30px;

	}



	.product-center .product-title {

		color: #555;

		    font-size: 2em;

		    font-weight: 600;

		    margin-bottom: 0.3571em;

	}



	.product-center .review {

		padding-bottom: 18px;

		position: relative;

		margin-top: -4px;

	}



		.product-center .review .rating i {

			font-size: 16px;

		}



	.product-center .description {

		padding-bottom: 15px;

		line-height: 1.7;

	}



	.product-center .price {

		padding: 0px;

		margin: 0px;

		font-size: 14px;

		font-weight: normal;

		line-height: 1.6;

		border-bottom: 1px solid #ebebeb;

		padding-bottom: 22px;

		color: #777;

	}



		.product-center .price .price-new {

			color: #9ac93d;

			font-weight: 600;

			font-size: 2.5714em;

		}



		.product-center .price .price-old {

			display: inline-block;

			color: #a7a7a7;

			font-size: 2em;

			vertical-align: top;

			font-weight: 600;

			text-decoration: line-through;

			margin-left: 15px;

			margin-top: 6px;

		}





		.product-center .options h2 {

			line-height: 1.4;

			font-weight: 700;

			font-size: 1.1429em;

			color: #313131;

			text-transform: uppercase;

			text-decoration: none;

			margin-bottom: 15px;

		}



	.product-center .add-to-cart {

		border-bottom: 1px solid #ebebeb;

		padding: 30px 0px 30px 0;

	}



		.product-center .add-to-cart p {

			display: none;

		}



		.product-center .add-to-cart .quantity {

			float: left;

			position: relative;

			padding-right: 38px;

		}



			.product-center .add-to-cart .quantity input {

				font-size: 14px;

				line-height: 1.42857;

				color: rgb(85, 85, 85);

				background-color: rgb(255, 255, 255);

				background-image: none;

				box-shadow: rgba(0, 0, 0, 0.0745098) 0px 1px 1px inset;

				padding: 6px 12px;

				border-width: 1px;

				border-style: solid;

				border-color: rgb(204, 204, 204);

				border-image: initial;

				border-radius: 4px;

				transition: border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;

				text-align: center;

				width: 2.5em;

				height: 2.7143em;

				padding-left: 0px;

				padding-right: 0px;

				vertical-align: middle;

				display: inline-block;

				border-radius: 3px !important;

			}



			.product-center .add-to-cart .quantity #q_up {

				display: block;

				position: absolute;

				top: 1px;

				right: 18px;

				text-align: center;

				display: block;

				padding: 0 0 0 1px;

				border-radius: 3px;

				margin-bottom: 5px;

				border: 1px solid #ccc;

				font-size: 9px;

				font-weight: normal;

				width: 15px;

				height: 16px;

				line-height: 14px;

			}



			.product-center .add-to-cart .quantity #q_down {

				display: block;

				position: absolute;

				top: 22px;

				right: 18px;

				text-align: center;

				display: block;

				padding: 0 0 0 1px;

				border-radius: 3px;

				border: 1px solid #ccc;

				font-size: 9px;

				font-weight: normal;

				width: 15px;

				height: 16px;

				line-height: 16px;

			}



			.product-center .add-to-cart .button {

				height: 2.7143em;

				padding: 0 2.1429em;

				text-shadow: none;

				color: #fff;

				border: 1px solid transparent;

				white-space: nowrap;

				font-size: 14px;

				line-height: 1.42857;

				border-radius: 4px;

			}



		.product-center .share {

			padding-top: 25px;

		}



		.product-center .minimum {

			padding-top: 20px;

		}



	.product-center .radio-type-button {

	     display: inline-block;

	     vertical-align: top;

	     width: auto;

	     margin: 10px 7px 5px 0px;

	     padding: 0px;

	}



		.product-center .radio-type-button label {

			margin: 0px;

			padding: 0px;

		}



	     .product-center .radio-type-button input {

	          visibility: hidden;

	          position: absolute;

	     }



	     .product-center .radio-type-button span {

	          display: block;

	          border-radius: 4px;

	          -webkit-border-radius: 4px;

	          -moz-border-radius: 4px;

	          border: 1px solid transparent;

	     }



	          .product-center .radio-type-button span:hover {

	               border: 1px solid #cecece;

	          }



	          .product-center .radio-type-button span.active {

	               border: 1px solid #000;

	          }



	     .product-center .radio-type-button img {

	          display: block;

	          border-radius: 4px;

	          -webkit-border-radius: 4px;

	          -moz-border-radius: 4px;

	          box-shadow: 1px 1px 0 rgba(0, 0, 0, .35);

	          -webkit-box-shadow: 1px 1px 0 rgba(0, 0, 0, .35);

	          -moz-box-shadow: 1px 1px 0 rgba(0, 0, 0, .35);

	     }



	.product-center .radio-type-button2 {

	     display: inline-block;

	     vertical-align: top;

	     width: auto;

	     margin: 10px 7px 5px 0px;

	     padding: 0px;

	}



		.product-center .radio-type-button2 label {

			padding: 0px;

			margin: 0px;

		}



	     .product-center .radio-type-button2 input {

	          visibility: hidden;

	          position: absolute;

	     }



	     .product-center .radio-type-button2 span {

	          background: #fff;

	          border: 1px solid #ccc;

	          border-radius: 4px;

	          -webkit-border-radius: 4px;

	          -moz-border-radius: 4px;

	          height: 30px;

	          min-width: 30px;

	          display: block;

	          text-align: center;

	          padding: 4px 7px;

	     }



	          .product-center .radio-type-button2 span:hover {

	               background: #9ac93d;

	               color: #fff;

	               border-color: #9ac93d;

	          }



	          .product-center .radio-type-button2 span.active {

	              background: #9ac93d;

	              color: #fff;

	              border-color: #9ac93d;

	          }



	.prev-next-products {

	    float: right;

	    padding: 0px;

	    margin: 0px;

	    margin-top: -8px;

	    position: relative;

	}



		.prev-next-products .product-nav {

		    display: inline-block;

		    vertical-align: middle;

		    position: relative;

		}



		.prev-next-products a {

		    color: #555;

		    display: inline-block;

		    font-size: 22px;

		    padding: 0px 7px 0px 8px;

		    line-height: 58px;

		}



		.prev-next-products .product-nav.product-prev .product-pop {

		    right: auto;

		    left: 0;

		    margin-left: -17.5px;

		}



		.prev-next-products .product-nav .product-pop {

		    border-top: 3px solid #08c;

		    position: absolute;

		    left: 0;

		    top: 100%;

		    padding: 10px;

		    background-color: #fff;

		    box-shadow: 0 1px 2px rgba(0,0,0,0.2);

		    z-index: 1;

		    visibility: hidden;

		    opacity: 0;

		    transition: all 0.2s;

		    text-align: center;

		    width: 100px;

		    border-radius: 4px;

		}



			.prev-next-products .product-nav:hover .product-pop {

				visibility: visible;

				opacity: 1;

			}



		.prev-next-products .product-nav .product-pop .product-name {

		    margin: 0;

		    font-weight: 600;

		    font-size: 11px;

		    color: #777;

		}



		.prev-next-products .product-nav .product-pop img {

		    margin-bottom: 10px;

		    display: block;

		}



		.prev-next-products .product-nav.product-next .product-pop {

		    left: auto;

		    right: 0;

		    margin-right: -17.5px;

		}



		.prev-next-products .product-nav .product-pop:before {

		    content: "";

		    width: 5px;

		    height: 2px;

		    border: 5px solid transparent;

		    border-bottom-color: #08c;

		    display: block;

		    position: absolute;

		    top: -13px;

		    left: 0;

		}



			.prev-next-products .product-nav.product-prev .product-pop:before {

			    left: 32px;

			    right: auto;

			}



			.prev-next-products .product-nav.product-next .product-pop:before {

			    right: 32px;

			    left: auto;

			}



	.product-center .button-product-question {

		margin-top: 20px;

		padding-top: 8px !important;

	}



	.product-center .button-enquiry {

		padding-top: 8px !important;

	}



	.product-center .button.review-link {

		padding-top: 8px !important;

	}



	/* @group Ratings */



	.rating i {

		margin: 0px 1px 0px 2px;

		font-size: 14px;

		color: #dedede;

	}



		.rating i.active {

			 color: #ffc600;

		}



		.set-rating i {

			cursor: pointer;

			padding-top: 7px;

			padding-right: 5px;

			margin-right: -6px;

		}



	/* @end */



#mfilter-content-container .product-list {

	position: absolute;

	width: 100%;

	max-height: 100px;

	overflow: hidden;

	opacity: 0;

	z-index: -10;

	margin-bottom: 10px;

}



	#mfilter-content-container .product-list.active {

		position: relative;

		visibility: visible;

		max-height: none;

		overflow: visible;

		opacity: 1;

		z-index: 0;

	}



 #mfilter-content-container .product-grid {

	display: none;

}



	#mfilter-content-container .product-grid.active {

		display: block;

	}



	#mfilter-content-container > span {

		background: none !important;

	}



		#mfilter-content-container > span:before {

			content: '';

			position: absolute;

			width: 100%;

			height: 100%;

			background: #fff;

			filter: alpha(opacity=40);

			filter: progid:DXImageTransform.Microsoft.Alpha(opacity=40);

			opacity: 0.4;

			-moz-opacity: 0.40;

			left: 0;

			top: 0;

		}



		#mfilter-content-container > span > img {

			top: -90px !important;

			position: relative;

			z-index: 20;

		}



/* @group jQuery countdown */



.is-countdown {

	background: rgba(255,255,255,0.90);

	margin-top: -50px;

	left: 0;

	right: 0;

	padding: 0px 10px;

	position: absolute;

}



.countdown-holding span {

	color: #888;

}



.countdown-row {

	clear: both;

	width: 100%;

	padding: 0px;

	text-align: center;

}



.countdown-show1 .countdown-section {

	width: 98%;

}



.countdown-show2 .countdown-section {

	width: 48%;

}



.countdown-show3 .countdown-section {

	width: 32.5%;

}



.countdown-show4 .countdown-section {

	width: 24.5%;

}



.countdown-show5 .countdown-section {

	width: 19.5%;

}



.countdown-show6 .countdown-section {

	width: 16.25%;

}



.countdown-show7 .countdown-section {

	width: 14%;

}



/*

.countdown-section {

	display: block;

	float: left;

	font-size: 75%;

	text-align: center;

}



.countdown-amount {

    font-size: 200%;

}



.countdown-period {

    display: block;

}



.countdown-descr {

	display: block;

	width: 100%;

}

*/

/* @end */



/* @group Pagination */



div.pagination-results {

	clear:both;

	padding:0px 0px 0px 0px;

	margin:0px 0px 10px 0px;

	position: relative;

	overflow:auto;

	font-size: 13px;

}



	div.pagination-results .text-right {

		padding:6px 0px 10px 10px;

	}



	div.pagination-results .text-left {

		padding:0px 10px 0px 0px;

	}



	div.pagination-results ul {

		padding:0px;

		margin: 0px;

		list-style: none;

	}



		div.pagination-results ul li {

			display:inline-block;

			text-align:center;

			margin: 0px 7px 10px 0px;

		}



	@media (max-width: 767px) {

		div.pagination-results .text-right,

		div.pagination-results .text-left {

			text-align: center;

			padding-left: 0;

			padding-right: 0;

		}



		div.pagination-results ul li {

			margin: 0px 4px 10px 4px;

		}

	}



#mfilter-content-container div.pagination-results {

	text-align: center;

}



#mfilter-content-container div.pagination-results .limit {

	display: inline-block;

	vertical-align: top;

	padding-top: 6px;

	padding-bottom: 14px;

}



#mfilter-content-container div.pagination-results .limit select {

	border: 1px solid #ccc;

	background: #fff;

	height: 26px;

	margin: 0px 4px;

	padding: 0px;

}



#mfilter-content-container div.pagination-results .text-left {

	padding: 6px 0px 14px 0px;

	text-align: center;

	width: auto;

	display: inline-block;

	vertical-align: top;

	float: none;

	position: relative;

	margin-right: -7px;

}



#mfilter-content-container div.pagination-results .text-right {

	display: none;

}



/* @end */



/* @group List Box */



.list-box {

	list-style: none;

	margin: 0px;

	padding: 0px;

}



/* @end */



/* @group Error form */



span.error {

	padding: 5px 0px;

	display: block;

	color: red;

}



	.form span.error {

		display: inline-block;

		padding-left: 20px;

	}



	.product-info span.error {

		padding-top: 0px;

	}



/* @end */



/* @group Help */



.help {

	font-size: 10px;

	display: block;

}



/* @end */



/* @group Table form */



table.form {



}



	table.form td {

		padding: 5px 13px 0px 0px;

	}



		table.form td input,

		table.form td select,

		table.form td textarea {

			margin-left: 7px;

		}



/* @end */



/* @group Category page */



img {

	max-width: 100%;

}



.category-info {

	padding: 0px 0px 0px 0px;

	position: relative;

	margin: 0px 0px 0px 0px;

  /*  margin: 0px -20px 0px 0px;*/

}



	.category-info .image {

		padding: 0px 20px 25px 0px;

		float: left;

		width: auto;

		max-width: 100%;

	}



	     .category-info .image img {

	     }



	.category-info > p {

		padding: 2px 20px 25px 0px;

	}



.refine_search {

	margin-top: 7px !important;

	margin-bottom: 20px !important;

	padding: 0px !important;

}



.category-list {



}



.category-list-text-only {

	margin-bottom: 20px;

}



	.category-list .row > div {

		margin-bottom: 26px;

		text-align: center;

	}



		.category-list-text-only .row > div {

			margin-bottom: 6px;

			text-align: left;

		}



		.category-list img {

			display: block;

			margin-bottom: 15px;

			margin-left: auto;

			margin-right: auto;

			border-radius:         6px;

			-moz-border-radius:    6px;

			padding: 2px;

			border: 1px solid #ddd;

			-webkit-border-radius: 6px;

		}



.product-filter {

	padding: 0px;

	margin: 0px 0px 14px 0px;

}



	.product-filter .sort {

		padding: 0px 0px 0px 0px;

		float: left;

		width: auto;

		font-size: 13px;

	}



		.product-filter .sort select {

			margin: 0px 0px 0px 5px;

			width: auto;

			padding: 0px;

			position: relative;

			height: 26px;

			border: 1px solid #ccc;

			background: #fff;

		}



	.product-filter .pagination {

		float: right;

		clear: none;

		margin: 0px 0px -5px 0px;

		max-width: 200px;

	}



	.product-filter .limit {

		padding: 0px 0px 0px 15px;

		float: right;

		width: auto;

		font-size: 13px;

	}



		.product-filter .limit select {

			margin: 0px 4px 0px 5px;

			width: auto;

			padding: 0px;

			position: relative;

			height: 26px;

			border: 1px solid #ccc;

			background: #fff;

		}



	.product-filter .product-compare {

		float: left;

		width: auto;

		font-size: 13px;

		padding: 2px 0px 0px 15px;

	}



	.product-filter .options {

		float: left;

		width: auto;

		padding: 0px 0px 0px 12px;

	}



		.product-filter .options .button-group {

			float: left;

			width: auto;

		}



			.product-filter .options .button-group button {

				border: 1px solid #ccc;

				border-radius: 3px;

				color: #ccc;

				display: inline-block;

				font-family: "Elusive-Icons";

				width: 26px;

				height: 26px;

				line-height: 24px;

				margin-left: 3px;

				text-decoration: none;

				text-align: center;

				-webkit-transition: all 0.25s ease 0s;

				-moz-transition: all 0.25s ease 0s;

				transition: all 0.25s ease 0s;

				background: transparent;

				vertical-align: top;

				padding: 0px;

			}



				.product-filter .options .button-group button:hover,

				.product-filter .options .button-group .active {

					background: #08c;

					color: #fff;

					border-color: #08c;

				}



				#grid:before {

				    content: "\f20b";

				    font-size: 14px;

				}



				#list:before {

				    content: "\f20a";

				    font-size: 14px;

				}



	@media (max-width: 767px) {

		.product-filter .pagination {

			clear: both;

			float: none;

			display: block;

			padding-top: 10px;

			margin-left: -5px;

			max-width: none;

		}



		.product-filter .product-compare {

			display: none;

		}



		.product-filter .limit {

			float: left;

		}

	}



/* @end */



/* @group Box */



.box {

	margin-bottom: 15px;

	background: #fbfbfb;

	border: 1px solid #ddd;

	border-radius: 6px;

	-webkit-border-radius: 6px;

	-moz-border-radius: 6px;

}



	.box .box-heading {

		color: #777;

		background: #f5f5f5;

		border-bottom: 1px solid #ddd;

		font-size: 0.9286em;

		font-weight: 700;

		line-height: 1.4;

		padding: 0.7143em 1.0714em;

		margin: 0;

		text-transform: uppercase;

		position: relative;

		-webkit-transition: all 0.25s ease 0s;

		-moz-transition: all 0.25s ease 0s;

		transition: all 0.25s ease 0s;

		border-radius: 6px 6px 0 0;

		-webkit-border-radius: 6px 6px 0 0;

		-moz-border-radius: 6px 6px 0 0;

	}



		.box .box-heading .toggle {

			color: #ccc;

			display: inline-block;

			width: 1.8571em;

			height: 1.8571em;

			line-height: 1.7572em;

			background: #fff;

			border: 1px solid #ccc;

			border-radius: 3px;

			position: absolute;

			right: 1.0714em;

			top: 1px;

			bottom: 0;

			margin: auto;

			font-family: "FontAwesome";

			text-align: center;

			-webkit-transition: all 0.25s ease 0s;

			transition: all 0.25s ease 0s;

			z-index: 10;

			cursor: pointer;

		}



			.box .box-heading .toggle:after {

				content: "\f0d8";

			}



				.box .box-heading .toggle.collapsed:after {

					content: "\f0d7";

				}



			.box .box-heading .toggle:hover {

				background: #08c;

				border-color: #08c;

				color: #fff;

			}



	.box .box-content {

		padding: 13px;

	}



	.box-category ul {

		list-style: none;

		padding: 0px;

		margin: 0px;

		line-height: 2.6;

		font-size: 0.9286em;

	}



		.box-category ul ul {

			padding-left: 13px;

		}



		.box-category ul li .head a {

		}



			.box-category ul li .head .plus {

				display: none;

			}



				.box-category ul li .head .collapsed .plus {

					display: block;

				}



				.box-category ul li .head .collapsed .minus {

					display: none;

				}



	.box-category .panel {

		padding: 0px;

		margin: 0px;

		background: none;

		border: none;

		box-shadow: none;

		-webkit-box-shadow: none;

		-moz-box-shadow: none;

	}



		.box .box-category {

			padding: 9px 13px;

		}



			.box .box-category .active {

				color: #08c;

			}



/* @end */



/* @end */



/* @group Product list */



.product-list .item {

    width: 100%;

    padding: 0px 0px 20px 0px;

}



	.product-list .product-image-area {

	    width: 20%;

	    float: left;

	}

	.product-image-area {

	    position: relative;

	    overflow: hidden;

	    z-index: 0;

	}



	.product-image-area a.product-image {

	    overflow: hidden;

	}



	.product-list .details-area {

	    width: 80%;

	    float: left;

	    padding: 0 20px;

	}



	.product-name {

	    margin: 10px 0;

	    font-size: 1em;

	    font-weight: normal;

	}



	.product-list .details-area .product-name {

	    font-size: 18px;

	    line-height: 1;

	}



	.product-list .details-area .short-desc {

	    font-size: 14px;

	    line-height: 1.5;

	    color: #777;

	}



	.product-list .details-area .action-area {

	    margin-top: 15px;

	}



	.product-list .rating-wrap {

		margin: 0px;

		display: block;

		height: 22px;

		margin-left: -7px;

		margin-top: 3px;

	}



.product-list .product-image {

	margin: 0px;

}



.product-list .product-image .product-image-hover {

    position: absolute;

    left: 0;

    right: 0;

    top: 0;

    bottom: 0;

    margin: auto;

    opacity: 0;

}



	.product-list .product-image:hover .product-image-hover {

		opacity: 1;

	}



.product-list .product-btn.btn-wishlist,

.product-list .product-btn.btn-quickview {

	opacity: 1;

	visibility: visible;

	width: 32px;

	height: 32px;

	display: inline-block;

	text-align: center;

	border-radius: 6px;

	-webkit-border-radius: 6px;

	-moz-border-radius: 6px;

	margin: 0px 1px;

	padding: 0px;

	left: auto;

	transform: none;

	-ms-transform: none;

	-webkit-transform: none;

	font-size: 16px;

	line-height: 30px;

	vertical-align: top;

}



.product-list .btn-add-cart {

	font-size: 14px;

	padding: 0 10px 0 7px;

	display: inline-block;

	height: 32px;

	line-height: 30px;

	border-radius: 5px;

	border: 1px solid #ccc;

	margin: 0px 1px;

	vertical-align: top;

/*	border-color: #08c;

	    color: #fff;

	    background-color: #08c;    */



	background-color: #9ac93d;

	border-color: #9ac93d;

	color:#fff;

}





a.quickviewlink.quickview-icon {

	position: static;

	padding: 0;

	visibility: visible;

	opacity: 1;

	color: #08c;

	background-color: transparent;

	font-size: 17px;

	display: inline-block;

	height: 32px;

	width: 32px;

	line-height: 30px;

	border: 1px solid #08c;

	border-radius: 5px;

	text-align: center;

	margin: 0px 1px;

}



	a.quickviewlink.quickview-icon:hover {

		background: #08c;

		color: #fff;

	}



.product-list .quickview {

	display: inline-block;

	vertical-align: top;

}



/* @end */



/* @group Category banner */



.category-banner {

    background-color: transparent;

}



	.full-width-image-banner {

	    height: 375px;

	    position: relative;

	}



		.full-width-image-banner .content {

		    margin-top: -36px;

		}



		.full-width-image-banner h2 {

		    margin: 0;

		    font-size: 45px;

		    line-height: 1.1;

		}



		.full-width-image-banner p {

		    margin: 0;

		    font-size: 16px;

		}



	.full-width-image-banner:after {

	    content: "";

	    display: block;

	    position: absolute;

	    width: 100%;

	    height: 100%;

	    left: 0;

	    top: 0;

	    background-color: #393733;

	    opacity: 0.65;

	    filter: alpha(opacity=65);

	}



	@media (max-width: 640px) {

		.full-width-image-banner {

		    height: 200px;

		}



		.full-width-image-banner p {

			display: none;

		}



		.full-width-image-banner .content {

		    margin-top: -16px;

		}



		.full-width-image-banner h2 {

		    margin: 0;

		    font-size: 30px;

		    line-height: 1.1;

		}

	}



/* @end */



/* @group Popup */



.mfp-bg {

	background: url(https://cdnjs.cloudflare.com/ajax/libs/fancybox/2.1.7/images/fancybox/fancybox_overlay.png) !important;

}



.mfp-with-zoom.mfp-ready.mfp-bg {

	opacity: 1 !important;

}



/* @end */



/* @group Shopping cart */



.checkout-cart .center-column h2 {

    padding: 20px 0px 14px 0px;

    margin: 0px;

    font-weight: 700;

    color: #313131;

    font-size: 16px;

    text-transform: uppercase;

    line-height: 1;

}



/* @end */



/* @group Revolution slider */



/*--------------------------------------

-	Revolution Slider 4.1 Captions -

author:		themepunch

email:     	info@themepunch.com

website:   	http://www.themepunch.com



/-------------------------------------

------ Used for index.html slider

----------------------------------------*/



@media (min-width: 1200px) {

	#revslider-container {

		height:376;

	}

}



#revslider-container {

	width:100%;

	position:relative;

	padding:0;

	overflow:hidden;

	background: #e6e6e3;

	margin-bottom: 20px;

}



#revslider {

	width:100%;

	position:relative;



}



#revslider  >ul >li{

	list-style:none;

	position:absolute;

	visibility:hidden;

}





/*************************

	-	CAPTIONS	-

**************************/



.tp-static-layers	{

	position:absolute;

	z-index:505;

	top:0px;

	left:0px;

}



.tp-hide-revslider,.tp-caption.tp-hidden-caption	{

	visibility:hidden !important;

	display:none !important;

}





.tp-caption {

	z-index:1;

	white-space:nowrap;

}



.tp-caption-demo .tp-caption	{

	position:relative !important;

	display:inline-block;

	margin-bottom:10px;

	margin-right:20px !important;

}



/*Custom*/

.tp-caption.rev-title,

.tp-caption.rev-subtitle,

.tp-caption.rev-stext,

.tp-caption.rev-price {

	position:absolute;

	font-family: "Open Sans", Verdana, sans-serif;

	font-weight: 700;

	color:#fff;

	line-height: normal;

	white-space:nowrap;

}



.tp-caption.rev-title {

	font-weight: 800;

	font-size: 63px;

}



.tp-caption.rev-title.small {

	font-weight: 600;

	font-size:60px;

	color:#08c;

}



.tp-caption.rev-title.small span {

	font-weight: 800;

}



.tp-caption.rev-subtitle {

    font-weight: 300;

    font-size: 24px;

    text-align: center;

}



.tp-caption.rev-subtitle.dark {

	color:#777;

}



.tp-caption.rev-subtitle.dark > span {

	color:#535353;

}



.tp-caption.rev-subtitle > span {

	font-weight: 400;

}



.tp-caption.rev-subtitle.large {

	font-size:33px;

	color:#fff;

	font-weight: 300;

}



.tp-caption.rev-subtitle.subtitle2 {

	font-size:22px;

	font-weight: 300;

}



.tp-caption.rev-subtitle.upper {

	font-size:33px;

	text-transform: uppercase;

	font-weight: 700;

	color:#fff;

}



.tp-caption.rev-text {

	font-weight: 300;

    font-size: 20px;

    color:#fff;

    text-align: center;

}



.tp-caption.rev-text.small {

	font-size:13px;

	font-weight: 300;

	color:#000;

}



.tp-caption.rev-text.small  strong {

	font-weight: bold;

}



.tp-caption.rev-stext {

	font-size:10px;

	color:#777;

	line-height: normal;

	font-weight: 300;

}



.tp-caption.rev-price {

	font-size:26px;

	color:#000;

	line-height: normal;

	font-weight: 800;

}



.tp-caption.rev-btn .slide-btn {

	display:inline-block;

	font-size:17px;

	line-height: 20px;

	padding:2px 25px;

	font-weight: 300;

	color:#08c;

	background-color: transparent;

	border-radius: 0;

}



.tp-caption.rev-btn .slide-btn.light {

	color:#fff;

	font-size:10px;

	padding:9px;

	font-weight: normal;

	border-left:1px solid #fff;

}



.tp-caption.rev-btn .slide-btn.light:hover {

	color:#fff;

}



.tp-caption.rev-btn .slide-btn:hover {

	background-color: transparent;

	color:#08c;

}



/* media queries to overwrite btn padding/font-sizes/widths*/

@media (max-width: 991px) {



	.tp-caption.rev-btn .slide-btn {

		font-size:11px;

		line-height: 18px;

		padding:5px 15px;

	}

}



@media (max-width: 768px) {

	.tp-caption.rev-btn .slide-btn {

		font-size:8px;

		line-height: 16px;

		padding:2px 10px;

		border-radius: 3px;

	}

}



@media (max-width: 480px) {

	.tp-caption.rev-btn .slide-btn {

		font-size:6px;

		line-height: 12px;

		padding:2px 8px;

		border-radius: 2px;

	}





}





.tp_inner_padding	{

	box-sizing:border-box;

	-webkit-box-sizing:border-box;

	-moz-box-sizing:border-box;

	max-height:none !important;

}





/******************************

	-	BUTTONS	-

*******************************/







@media only screen and (min-width: 768px) and (max-width: 959px) {



	.tp-caption.rev-btn .btn-lg,

	.tp-caption.rev-btn .btn-group-lg > .btn {

		padding:7px 15px;

		font-size:14px;

		line-height:1.5;

	}



	.tp-caption.rev-btn .btn.min-width {

		min-width:130px;

	}

 }







@media only screen and (min-width: 480px) and (max-width: 767px) {

	.tp-caption.rev-btn .btn-lg,

	.tp-caption.rev-btn .btn-group-lg > .btn {

		padding:5px 12px;

		font-size:12px;

		line-height:1.5;

	}



	.tp-caption.rev-btn .btn.min-width {

		min-width:100px;

	}



}



@media only screen and (min-width: 0px) and (max-width: 479px) {

	.tp-caption.rev-btn .btn-lg,

	.tp-caption.rev-btn .btn-group-lg > .btn {

		padding:4px 10px;

		font-size:9px;

		line-height:1.5;

	}



	.tp-caption.rev-btn .btn.min-width {

		min-width:85px;

	}

}











/****************************************************************



	-	SET THE ANIMATION EVEN MORE SMOOTHER ON ANDROID   -



******************************************************************/



/*

.tp-simpleresponsive	{

	-webkit-perspective: 1500px;

	-moz-perspective: 1500px;

	-o-perspective: 1500px;

	-ms-perspective: 1500px;

	perspective: 1500px;

}

*/





/**********************************************

	-	FULLSCREEN AND FULLWIDHT CONTAINERS	-

**********************************************/



.fullscreen-container {

		width:100%;

		position:relative;

		padding:0;

}





.fullwidthbanner-container{

	width:100%;

	position:relative;

	padding:0;

	overflow:hidden;

}



.fullwidthbanner-container .fullwidthbanner{

	width:100%;

	position:relative;

}







/************************************************

	  - SOME CAPTION MODIFICATION AT START  -

*************************************************/

.tp-simpleresponsive .caption,

.tp-simpleresponsive .tp-caption {

	/*-ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=0)";		-moz-opacity: 0;	-khtml-opacity: 0;	opacity: 0; */

	position:absolute;visibility: hidden;

	-webkit-font-smoothing: antialiased !important;

}





.tp-simpleresponsive img	{

	max-width:none;

}







/******************************

	-	IE8 HACKS	-

*******************************/

.noFilterClass {

	filter:none !important;

}





/******************************

	-	SHADOWS		-

******************************/

.tp-bannershadow  {

		position:absolute;

		margin-left:auto;

		margin-right:auto;

		-moz-user-select: none;

        -khtml-user-select: none;

        -webkit-user-select: none;

        -o-user-select: none;

	}



.tp-bannershadow.tp-shadow1 {

	background:url(../images/revslider/shadow1.png) no-repeat;

	background-size:100% 100%; width:890px; height:60px; bottom:-60px;

}



.tp-bannershadow.tp-shadow2 {

	background:url(../images/revslider/shadow2.png) no-repeat;

	background-size:100% 100%; width:890px; height:60px;bottom:-60px;

}



.tp-bannershadow.tp-shadow3 {	background:url(../images/revslider/shadow3.png) no-repeat;

	background-size:100% 100%; width:890px; height:60px;bottom:-60px;

}





/********************************

	-	FULLSCREEN VIDEO	-

*********************************/

.caption.fullscreenvideo {	left:0px; top:0px; position:absolute;width:100%;height:100%;}

.caption.fullscreenvideo iframe,

.caption.fullscreenvideo video	{ width:100% !important; height:100% !important; display: none}



.tp-caption.fullscreenvideo	{	left:0px; top:0px; position:absolute;width:100%;height:100%;}





.tp-caption.fullscreenvideo iframe,

.tp-caption.fullscreenvideo iframe video{ width:100% !important; height:100% !important; display: none;}





.fullcoveredvideo video,

.fullscreenvideo video	{	background: #000;}



.fullcoveredvideo .tp-poster {	background-position: center center;

	background-size: cover;width:100%;height:100%;top:0px;left:0px;

}



.html5vid.videoisplaying .tp-poster	{	display: none}



.tp-video-play-button	{

	background:#000;

	background:rgba(0,0,0,0.3);

	padding:5px;

	border-radius:5px;-moz-border-radius:5px;-webkit-border-radius:5px;

	position: absolute;

	top: 50%;

	left: 50%;

	font-size: 40px;

	color: #FFF;

	z-index: 3;

	margin-top: -27px;

	margin-left: -28px;

	text-align: center;

	cursor: pointer;

}



.html5vid .tp-revstop	{	width:6px;height:20px;

	border-left:5px solid #fff; border-right:5px solid #fff;

	 position: relative;margin:10px 20px;

}



.html5vid .tp-revstop	{

	display:none;

}

.html5vid.videoisplaying .revicon-right-dir	{ display:none }

.html5vid.videoisplaying .tp-revstop	{	display:block}



.html5vid.videoisplaying .tp-video-play-button	{	display:none}

.html5vid:hover .tp-video-play-button { display:block}



.fullcoveredvideo .tp-video-play-button	{	display:none !important}





/********************************

	-	FULLSCREEN VIDEO ENDS	-

*********************************/





/********************************

	-	DOTTED OVERLAYS	-

*********************************/

.tp-dottedoverlay {	background-repeat:repeat;width:100%;height:100%;

	position:absolute;top:0px;left:0px;z-index:1;

}



.tp-dottedoverlay.twoxtwo				{	background:url(../images/revslider/gridtile.png)}

.tp-dottedoverlay.twoxtwowhite			{	background:url(../images/revslider/gridtile_white.png)}

.tp-dottedoverlay.threexthree			{	background:url(../images/revslider/gridtile_3x3.png)}

.tp-dottedoverlay.threexthreewhite		{	background:url(../images/revslider/gridtile_3x3_white.png)}

/********************************

	-	DOTTED OVERLAYS ENDS	-

*********************************/





/************************

	-	NAVIGATION	-

*************************/



/** BULLETS **/



.tpclear		{	clear:both;}





.tp-bullets									{	z-index:1000; position:absolute;

												-ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=100)";

												-moz-opacity: 1;

												-khtml-opacity: 1;

												opacity: 1;

												-webkit-transition: opacity 0.2s ease-out; -moz-transition: opacity 0.2s ease-out; -o-transition: opacity 0.2s ease-out; -ms-transition: opacity 0.2s ease-out;-webkit-transform: translateZ(5px);

											}

.tp-bullets.hidebullets					{

												-ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=0)";

												-moz-opacity: 0;

												-khtml-opacity: 0;

												opacity: 0;

											}





.tp-bullets.simplebullets.navbar						{ 	border:1px solid #666; border-bottom:1px solid #444; background:url(../images/revslider/boxed_bgtile.png); height:40px; padding:0px 10px; -webkit-border-radius: 5px; -moz-border-radius: 5px; border-radius: 5px ;}



.tp-bullets.simplebullets.navbar-old					{ 	 background:url(../images/revslider/navigdots_bgtile.png); height:35px; padding:0px 10px; -webkit-border-radius: 5px; -moz-border-radius: 5px; border-radius: 5px ;}





.tp-bullets.simplebullets.round .bullet					{	cursor:pointer; position:relative;	background:url(../images/revslider/bullet.png) no-Repeat top left;	width:20px;	height:20px;  margin-right:0px; float:left; margin-top:0px; margin-left:3px;}

.tp-bullets.simplebullets.round .bullet.last			{	margin-right:3px;}



.tp-bullets.simplebullets.round-old .bullet				{	cursor:pointer; position:relative;	background:url(../images/revslider/bullets.png) no-Repeat bottom left;	width:23px;	height:23px;  margin-right:0px; float:left; margin-top:0px;}

.tp-bullets.simplebullets.round-old .bullet.last		{	margin-right:0px;}





/**	SQUARE BULLETS **/

.tp-bullets.simplebullets.square .bullet				{	cursor:pointer; position:relative;	background:url(../images/revslider/bullets2.png) no-Repeat bottom left;	width:19px;	height:19px;  margin-right:0px; float:left; margin-top:0px;}

.tp-bullets.simplebullets.square .bullet.last			{	margin-right:0px;}





/**	SQUARE BULLETS **/

.tp-bullets.simplebullets.square-old .bullet			{	cursor:pointer; position:relative;	background:url(../images/revslider/bullets2.png) no-Repeat bottom left;	width:19px;	height:19px;  margin-right:0px; float:left; margin-top:0px;}

.tp-bullets.simplebullets.square-old .bullet.last		{	margin-right:0px;}





/** navbar NAVIGATION VERSION **/

.tp-bullets.simplebullets.navbar .bullet			{	cursor:pointer; position:relative;	background:url(../images/revslider/bullet_boxed.png) no-Repeat top left;	width:18px;	height:19px;   margin-right:5px; float:left; margin-top:0px;}



.tp-bullets.simplebullets.navbar .bullet.first		{	margin-left:0px !important;}

.tp-bullets.simplebullets.navbar .bullet.last		{	margin-right:0px !important;}







/** navbar NAVIGATION VERSION **/

.tp-bullets.simplebullets.navbar-old .bullet			{	cursor:pointer; position:relative;	background:url(../images/revslider/navigdots.png) no-Repeat bottom left;	width:15px;	height:15px;  margin-left:5px !important; margin-right:5px !important;float:left; margin-top:10px;}

.tp-bullets.simplebullets.navbar-old .bullet.first		{	margin-left:0px !important;}

.tp-bullets.simplebullets.navbar-old .bullet.last		{	margin-right:0px !important;}





.tp-bullets.simplebullets .bullet:hover,

.tp-bullets.simplebullets .bullet.selected				{	background-position:top left; }



.tp-bullets.simplebullets.round .bullet:hover,

.tp-bullets.simplebullets.round .bullet.selected,

.tp-bullets.simplebullets.navbar .bullet:hover,

.tp-bullets.simplebullets.navbar .bullet.selected		{	background-position:bottom left; }







/*************************************

	-	TP ARROWS 	-

**************************************/

.tparrows												{	-ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=100)";

															-moz-opacity: 1;

															-khtml-opacity: 1;

															opacity: 1;

															-webkit-transition: opacity 0.2s ease-out; -moz-transition: opacity 0.2s ease-out; -o-transition: opacity 0.2s ease-out; -ms-transition: opacity 0.2s ease-out;

															-webkit-transform: translateZ(5000px);

															-webkit-transform-style: flat;

															-webkit-backface-visibility: hidden;

															z-index:600;

															position: relative;



														}

.tparrows.hidearrows									{

															-ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=0)";

															-moz-opacity: 0;

															-khtml-opacity: 0;

															opacity: 0;

														}

.tp-leftarrow											{	z-index:100;cursor:pointer; position:relative;	background:url(../images/revslider/large_left.png) no-Repeat top left;	width:40px;	height:40px;   }

.tp-rightarrow											{	z-index:100;cursor:pointer; position:relative;	background:url(../images/revslider/large_right.png) no-Repeat top left;	width:40px;	height:40px;   }





.tp-leftarrow.round										{	z-index:100;cursor:pointer; position:relative;	background:url(../images/revslider/small_left.png) no-Repeat top left;	width:19px;	height:14px;  margin-right:0px; float:left; margin-top:0px;	}

.tp-rightarrow.round									{	z-index:100;cursor:pointer; position:relative;	background:url(../images/revslider/small_right.png) no-Repeat top left;	width:19px;	height:14px;  margin-right:0px; float:left;	margin-top:0px;}





.tp-leftarrow.round-old									{	z-index:100;cursor:pointer; position:relative;	background:url(../images/revslider/arrow_left.png) no-Repeat top left;	width:26px;	height:26px;  margin-right:0px; float:left; margin-top:0px;	}

.tp-rightarrow.round-old								{	z-index:100;cursor:pointer; position:relative;	background:url(../images/revslider/arrow_right.png) no-Repeat top left;	width:26px;	height:26px;  margin-right:0px; float:left;	margin-top:0px;}





.tp-leftarrow.navbar									{	z-index:100;cursor:pointer; position:relative;	background:url(../images/revslider/small_left_boxed.png) no-Repeat top left;	width:20px;	height:15px;   float:left;	margin-right:6px; margin-top:12px;}

.tp-rightarrow.navbar									{	z-index:100;cursor:pointer; position:relative;	background:url(../images/revslider/small_right_boxed.png) no-Repeat top left;	width:20px;	height:15px;   float:left;	margin-left:6px; margin-top:12px;}





.tp-leftarrow.navbar-old								{	z-index:100;cursor:pointer; position:relative;	background:url(../images/revslider/arrowleft.png) no-Repeat top left;		width:9px;	height:16px;   float:left;	margin-right:6px; margin-top:10px;}

.tp-rightarrow.navbar-old								{	z-index:100;cursor:pointer; position:relative;	background:url(../images/revslider/arrowright.png) no-Repeat top left;	width:9px;	height:16px;   float:left;	margin-left:6px; margin-top:10px;}



.tp-leftarrow.navbar-old.thumbswitharrow				{	margin-right:10px; }

.tp-rightarrow.navbar-old.thumbswitharrow				{	margin-left:0px; }



.tp-leftarrow.square									{	z-index:100;cursor:pointer; position:relative;	background:url(../images/revslider/arrow_left2.png) no-Repeat top left;	width:12px;	height:17px;   float:left;	margin-right:0px; margin-top:0px;}

.tp-rightarrow.square									{	z-index:100;cursor:pointer; position:relative;	background:url(../images/revslider/arrow_right2.png) no-Repeat top left;	width:12px;	height:17px;   float:left;	margin-left:0px; margin-top:0px;}





.tp-leftarrow.square-old								{	z-index:100;cursor:pointer; position:relative;	background:url(../images/revslider/arrow_left2.png) no-Repeat top left;	width:12px;	height:17px;   float:left;	margin-right:0px; margin-top:0px;}

.tp-rightarrow.square-old								{	z-index:100;cursor:pointer; position:relative;	background:url(../images/revslider/arrow_right2.png) no-Repeat top left;	width:12px;	height:17px;   float:left;	margin-left:0px; margin-top:0px;}





.tp-leftarrow.default									{	z-index:100;cursor:pointer; position:relative;	background:url(../images/revslider/large_left.png) no-Repeat 0 0;	width:40px;	height:40px;



														}

.tp-rightarrow.default									{	z-index:100;cursor:pointer; position:relative;	background:url(../images/revslider/large_right.png) no-Repeat 0 0;	width:40px;	height:40px;



														}









.tp-leftarrow:hover,

.tp-rightarrow:hover 									{	background-position:bottom left; }













/****************************************************************************************************

	-	TP THUMBS 	-

*****************************************************************************************************



 - tp-thumbs & tp-mask Width is the width of the basic Thumb Container (500px basic settings)



 - .bullet width & height is the dimension of a simple Thumbnail (basic 100px x 50px)



 *****************************************************************************************************/





.tp-bullets.tp-thumbs						{	z-index:1000; position:absolute; padding:3px;background-color:#fff;

												width:500px;height:50px; 			/* THE DIMENSIONS OF THE THUMB CONTAINER */

												margin-top:-50px;

											}





.fullwidthbanner-container .tp-thumbs		{  padding:3px;}



.tp-bullets.tp-thumbs .tp-mask				{	width:500px; height:50px;  			/* THE DIMENSIONS OF THE THUMB CONTAINER */

												overflow:hidden; position:relative;}





.tp-bullets.tp-thumbs .tp-mask .tp-thumbcontainer	{	width:5000px; position:absolute;}



.tp-bullets.tp-thumbs .bullet				{   width:100px; height:50px; 			/* THE DIMENSION OF A SINGLE THUMB */

												cursor:pointer; overflow:hidden;background:none;margin:0;float:left;

												-ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=50)";

												/*filter: alpha(opacity=50);	*/

												-moz-opacity: 0.5;

												-khtml-opacity: 0.5;

												opacity: 0.5;



												-webkit-transition: all 0.2s ease-out; -moz-transition: all 0.2s ease-out; -o-transition: all 0.2s ease-out; -ms-transition: all 0.2s ease-out;

											}





.tp-bullets.tp-thumbs .bullet:hover,

.tp-bullets.tp-thumbs .bullet.selected		{ 	-ms-filter: "progid:DXImageTransform.Microsoft.Alpha(Opacity=100)";



												-moz-opacity: 1;

												-khtml-opacity: 1;

												opacity: 1;

											}

.tp-thumbs img								{	width:100%; }





/************************************

		-	TP BANNER TIMER		-

*************************************/

.tp-bannertimer								{	width:100%; height:7px; background:rgba(203, 198, 278, 0.6);position:absolute; z-index:200;top:0px;}

.tp-bannertimer.tp-bottom					{	bottom:0px;height:7px; top:auto;}









/***************************************

	-	RESPONSIVE SETTINGS 	-

****************************************/









    @media only screen and (min-width: 0px) and (max-width: 479px) {

				.responsive .tp-bullets	{	display:none}

				.responsive .tparrows	{	display:none;}

	}











/*********************************************



	-	BASIC SETTINGS FOR THE BANNER	-



***********************************************/



 .tp-simpleresponsive img {

		-moz-user-select: none;

        -khtml-user-select: none;

        -webkit-user-select: none;

        -o-user-select: none;

}







.tp-simpleresponsive a{	text-decoration:none;}



.tp-simpleresponsive ul {

	list-style:none;

	padding:0;

	margin:0;

}



.tp-simpleresponsive >ul >li{

	list-stye:none;

	position:absolute;

	visibility:hidden;

}

/*  CAPTION SLIDELINK   **/

.caption.slidelink a div,

.tp-caption.slidelink a div {	width:3000px; height:1500px;  background:url(../images/revslider/coloredbg.png) repeat;}



.tp-caption.slidelink a span	{	background:url(../images/revslider/coloredbg.png) repeat;}







/*****************************************

	-	NAVIGATION FANCY EXAMPLES	-

*****************************************/



.tparrows .tp-arr-imgholder								{ display: none}

.tparrows .tp-arr-titleholder							{ display: none}







/*****************************************

	-	NAVIGATION FANCY EXAMPLES	-

*****************************************/



/* NAVIGATION PREVIEW 1 */

.tparrows.preview1 							{	width:100px;height:100px;-webkit-transform-style: preserve-3d; -webkit-perspective: 1000; -moz-perspective: 1000; -webkit-backface-visibility: hidden; -moz-backface-visibility: hidden;background: transparent;}

.tparrows.preview1:after					{	position:absolute; left:0px;top:0px; font-family: "revicons"; color:#fff; font-size:30px; width:100px;height:100px;text-align: center; background:#fff;background:rgba(0,0,0,0.15);z-index:2;line-height:100px; -webkit-transition: background 0.3s, color 0.3s; -moz-transition: background 0.3s, color 0.3s; transition: background 0.3s, color 0.3s;}

.tp-rightarrow.preview1:after				{	content: '\e825';  }

.tp-leftarrow.preview1:after				{	content: '\e824';  }



.tparrows.preview1:hover:after 				{	background:rgba(255,255,255,1); color:#aaa; }



.tparrows.preview1 .tp-arr-imgholder 		{	background-size:cover; background-position:center center; display:block;width:100%;height:100%;position:absolute;top:0px;

												-webkit-transition: -webkit-transform 0.3s;

												transition: transform 0.3s;

												-webkit-backface-visibility: hidden;

												backface-visibility: hidden;

											}

/*.tparrows.preview1 .tp-arr-iwrapper			{	  -webkit-transition: all 0.3s;transition: all 0.3s;

												-ms-filter:"progid:DXImageTransform.Microsoft.Alpha(Opacity=0)";filter: alpha(opacity=0);-moz-opacity: 0.0;-khtml-opacity: 0.0;opacity: 0.0;}

.tparrows.preview1:hover .tp-arr-iwrapper	{	  -ms-filter:"progid:DXImageTransform.Microsoft.Alpha(Opacity=100)";filter: alpha(opacity=100);-moz-opacity: 1;-khtml-opacity: 1;opacity: 1;}*/





.tp-rightarrow.preview1 .tp-arr-imgholder	{	right:100%;

												-webkit-transform: rotateY(-90deg);

												transform: rotateY(-90deg);

												-webkit-transform-origin: 100% 50%;

												transform-origin: 100% 50%;





											}

.tp-leftarrow.preview1 .tp-arr-imgholder	{	left:100%;

												-webkit-transform: rotateY(90deg);

												transform: rotateY(-90deg);

												-webkit-transform-origin: 0% 50%;

												transform-origin: 0% 50%;





											}





.tparrows.preview1:hover .tp-arr-imgholder	{	-webkit-transform: rotateY(0deg);

												transform: rotateY(0deg);

											}





	@media only screen and (min-width: 768px) and (max-width: 979px) {

		.tparrows.preview1,

		.tparrows.preview1:after	{	width:80px; height:80px;line-height:80px; font-size:24px;}



	}



    @media only screen and (min-width: 480px) and (max-width: 767px) {

		.tparrows.preview1,

		.tparrows.preview1:after	{	width:60px; height:60px;line-height:60px;font-size:20px;}



	}







    @media only screen and (min-width: 0px) and (max-width: 479px) {

		.tparrows.preview1,

		.tparrows.preview1:after	{	width:40px; height:40px;line-height:40px; font-size:12px;}

    }



/* PREVIEW 1 BULLETS */



.tp-bullets.preview1 						{ 	height: 21px; }

.tp-bullets.preview1 .bullet 				{	cursor: pointer;

											    position: relative !important;

											    background: rgba(0, 0, 0, 0.15) !important;

											    /*-webkit-border-radius: 10px;

											    border-radius: 10px;*/

											    -webkit-box-shadow: none;

											    -moz-box-shadow: none;

											    box-shadow: none;

											    width: 5px !important;

											    height: 5px !important;

											    border: 8px solid rgba(0, 0, 0, 0) !important;

											    display: inline-block;

											    margin-right: 5px !important;

											    margin-bottom: 0px !important;

											    -webkit-transition: background-color 0.2s, border-color 0.2s;

											    -moz-transition: background-color 0.2s, border-color 0.2s;

											    -o-transition: background-color 0.2s, border-color 0.2s;

											    -ms-transition: background-color 0.2s, border-color 0.2s;

											    transition: background-color 0.2s, border-color 0.2s;

											    float:none !important;

											    box-sizing:content-box;

												-moz-box-sizing:content-box;

												-webkit-box-sizing:content-box;

}

.tp-bullets.preview1 .bullet.last 			{	margin-right: 0px; }

.tp-bullets.preview1 .bullet:hover,

.tp-bullets.preview1 .bullet.selected 		{	-webkit-box-shadow: none;

											    -moz-box-shadow: none;

											    box-shadow: none;

												background: #aaa !important;

												width: 5px !important;

											    height: 5px !important;

											    border: 8px solid rgba(255, 255, 255, 1) !important;

}









/* NAVIGATION PREVIEW 2 */

.tparrows.preview2 							{	min-width:60px; min-height:60px; background:#fff; ;



												border-radius:30px;-moz-border-radius:30px;-webkit-border-radius:30px;

												overflow:hidden;

												-webkit-transition: -webkit-transform 1.3s;

												-webkit-transition: width 0.3s, background-color 0.3s, opacity 0.3s;

												transition: width 0.3s, background-color 0.3s, opacity 0.3s;

												backface-visibility: hidden;

}

.tparrows.preview2:after					{	position:absolute; top:50%; font-family: "revicons"; color:#aaa; font-size:25px; margin-top: -18px; -webkit-transition: color 0.3s; -moz-transition: color 0.3s; transition: color 0.3s; }

.tp-rightarrow.preview2:after				{	content: '\e81e';  right:18px; }

.tp-leftarrow.preview2:after				{	content: '\e81f';  left:18px; }





.tparrows.preview2 .tp-arr-titleholder 		{	background-size:cover; background-position:center center; display:block;width:auto;position:absolute;top:0px;

												-webkit-transition: -webkit-transform 0.3s;

												transition: transform 0.3s;

												-webkit-backface-visibility: hidden;

												backface-visibility: hidden;

												white-space: nowrap;

												color: #000;

												text-transform: uppercase;

												white-space: nowrap;

												letter-spacing: 1px;

												font-weight: 400;

												font-size: 14px;

												line-height: 60px;

												padding:0px 10px;

												box-sizing:border-box;

												-moz-box-sizing:border-box;

												-webkit-box-sizing:border-box;

											}



.tp-rightarrow.preview2 .tp-arr-titleholder	{	 right:50px;

												-webkit-transform: translateX(-100%);

												transform: translateX(-100%);

											}

.tp-leftarrow.preview2 .tp-arr-titleholder	{	left:50px;

												-webkit-transform: translateX(100%);

												transform: translateX(100%);

											}



.tparrows.preview2.hovered					{	width:300px}

.tparrows.preview2:hover					{	background:#fff;}

.tparrows.preview2:hover:after				{	color:#000}

.tparrows.preview2:hover .tp-arr-titleholder{	-webkit-transform: translateX(0px);

													transform: translateX(0px); }



/* PREVIEW 2 BULLETS */



.tp-bullets.preview2 						{ 	height: 17px; }

.tp-bullets.preview2 .bullet 				{	cursor: pointer;

											    position: relative !important;

											    background: rgba(0, 0, 0, 0.5) !important;

											    -webkit-border-radius: 10px;

											    border-radius: 10px;

											    -webkit-box-shadow: none;

											    -moz-box-shadow: none;

											    box-shadow: none;

											    width: 6px !important;

											    height: 6px !important;

											    border: 5px solid rgba(0, 0, 0, 0) !important;

											    display: inline-block;

											    margin-right: 2px !important;

											    margin-bottom: 0px !important;

											    -webkit-transition: background-color 0.2s, border-color 0.2s;

											    -moz-transition: background-color 0.2s, border-color 0.2s;

											    -o-transition: background-color 0.2s, border-color 0.2s;

											    -ms-transition: background-color 0.2s, border-color 0.2s;

											    transition: background-color 0.2s, border-color 0.2s;

											    float:none !important;

											    box-sizing:content-box;

												-moz-box-sizing:content-box;

												-webkit-box-sizing:content-box;

}

.tp-bullets.preview2 .bullet.last 			{	margin-right: 0px; }

.tp-bullets.preview2 .bullet:hover,

.tp-bullets.preview2 .bullet.selected 		{	-webkit-box-shadow: none;

											    -moz-box-shadow: none;

											    box-shadow: none;

												background: rgba(255, 255, 255, 1) !important;

												width: 6px !important;

											    height: 6px !important;

											    border: 5px solid rgba(0, 0, 0, 1) !important;

}







	@media only screen and (min-width: 768px) and (max-width: 979px) {

		.tparrows.preview2 {	min-width:40px; min-height:40px; width:40px;height:40px;

								border-radius:20px;-moz-border-radius:20px;-webkit-border-radius:20px;

							}

		.tparrows.preview2:after					{	position:absolute; top:50%; font-family: "revicons"; font-size:20px; margin-top: -12px;}

		.tp-rightarrow.preview2:after				{	content: '\e81e';  right:11px;}

		.tp-leftarrow.preview2:after				{	content: '\e81f';  left:11px;}

		.tparrows.preview2 .tp-arr-titleholder		{	font-size:12px; line-height:40px; letter-spacing: 0px;}

		.tp-rightarrow.preview2 .tp-arr-titleholder	{	right:35px;}

		.tp-leftarrow.preview2 .tp-arr-titleholder	{	left:35px;}

	}



    @media only screen and (min-width: 480px) and (max-width: 767px) {

   		 .tparrows.preview2 						{	min-width:30px; min-height:30px; width:30px;height:30px;

														border-radius:15px;-moz-border-radius:15px;-webkit-border-radius:15px;

													}

		.tparrows.preview2:after					{	position:absolute; top:50%; font-family: "revicons"; font-size:14px; margin-top: -12px;}

		.tp-rightarrow.preview2:after				{	content: '\e81e';  right:8px;}

		.tp-leftarrow.preview2:after				{	content: '\e81f';  left:8px;}

		.tparrows.preview2 .tp-arr-titleholder		{	font-size:10px; line-height:30px; letter-spacing: 0px;}

		.tp-rightarrow.preview2 .tp-arr-titleholder	{	right:25px;}

		.tp-leftarrow.preview2 .tp-arr-titleholder	{	left:25px;}





	}



    @media only screen and (min-width: 0px) and (max-width: 479px) {

		.tparrows.preview2 							{	min-width:30px; min-height:30px; width:30px;height:30px;

														border-radius:15px;-moz-border-radius:15px;-webkit-border-radius:15px;

													}

		.tparrows.preview2:after					{	position:absolute; top:50%; font-family: "revicons"; font-size:14px; margin-top: -12px;}

		.tp-rightarrow.preview2:after				{	content: '\e81e';  right:8px;}

		.tp-leftarrow.preview2:after				{	content: '\e81f';  left:8px;}

		.tparrows.preview2 .tp-arr-titleholder		{	display:none;visibility:none;}

		.tparrows.preview2:hover					{	width:30px !important; height:30px !important}

    }







/* NAVIGATION PREVIEW 3 */

.tparrows.preview3 							{	width:70px; height:70px; background:#fff; background:rgba(255,255,255,1); -webkit-transform-style: flat; }

.tparrows.preview3:after					{	position:absolute;  line-height: 70px;text-align: center; font-family: "revicons"; color:#aaa; font-size:30px; top:0px;left:0px;;background:#fff; z-index:100; width:70px;height:70px; -webkit-transition: color 0.3s; -moz-transition: color 0.3s; transition: color 0.3s;}

.tparrows.preview3:hover:after					{	color:#000; }

.tp-rightarrow.preview3:after				{	content: '\e825';  }

.tp-leftarrow.preview3:after				{	content: '\e824';  }





.tparrows.preview3 .tp-arr-iwrapper			{

												  -webkit-transform: scale(0,1);

												  transform: scale(0,1);

												  -webkit-transform-origin: 100% 50%;

												  transform-origin: 100% 50%;

												  -webkit-transition: -webkit-transform 0.2s;

												  transition: transform 0.2s;

												  z-index:0;position: absolute; background: #000; background: rgba(0,0,0,0.75);

												  display: table;min-height:90px;top:-10px;}



.tp-leftarrow.preview3 .tp-arr-iwrapper		{	 -webkit-transform: scale(0,1);

												  transform: scale(0,1);

												  -webkit-transform-origin: 0% 50%;

												  transform-origin: 0% 50%;

											}



.tparrows.preview3 .tp-arr-imgholder 		{	display:block;background-size:cover; background-position:center center; display:table-cell;min-width:90px;height:90px;

												position:relative;top:0px; }



.tp-rightarrow.preview3 .tp-arr-iwrapper	{	right:0px;padding-right:70px;}

.tp-leftarrow.preview3 .tp-arr-iwrapper		{	left:0px; direction: rtl;padding-left:70px;}

.tparrows.preview3 .tp-arr-titleholder		{	display:table-cell; padding:30px;font-size:16px; color:#fff;white-space: nowrap; position: relative; clear:right;vertical-align: middle;}



.tparrows.preview3:hover .tp-arr-iwrapper	{

												-webkit-transform: scale(1,1);

												  transform: scale(1,1);



											}



/* PREVIEW 3 BULLETS */

.tp-bullets.preview3 						{ 	height: 17px; }

.tp-bullets.preview3 .bullet 				{	cursor: pointer;

											    position: relative !important;

											    background: rgba(0, 0, 0, 0.5) !important;

											    -webkit-border-radius: 10px;

											    border-radius: 10px;

											    -webkit-box-shadow: none;

											    -moz-box-shadow: none;

											    box-shadow: none;

											    width: 6px !important;

											    height: 6px !important;

											    border: 5px solid rgba(0, 0, 0, 0) !important;

											    display: inline-block;

											    margin-right: 2px !important;

											    margin-bottom: 0px !important;

											    -webkit-transition: background-color 0.2s, border-color 0.2s;

											    -moz-transition: background-color 0.2s, border-color 0.2s;

											    -o-transition: background-color 0.2s, border-color 0.2s;

											    -ms-transition: background-color 0.2s, border-color 0.2s;

											    transition: background-color 0.2s, border-color 0.2s;

											    float:none !important;

											    box-sizing:content-box;

												-moz-box-sizing:content-box;

												-webkit-box-sizing:content-box;

}

.tp-bullets.preview3 .bullet.last 			{	margin-right: 0px; }

.tp-bullets.preview3 .bullet:hover,

.tp-bullets.preview3 .bullet.selected 		{	-webkit-box-shadow: none;

											    -moz-box-shadow: none;

											    box-shadow: none;

												background: rgba(255, 255, 255, 1) !important;

												width: 6px !important;

											    height: 6px !important;

											    border: 5px solid rgba(0, 0, 0, 1) !important;

}





	@media only screen and (min-width: 768px) and (max-width: 979px) {

		.tparrows.preview3:after,

		.tparrows.preview3 							{	width:50px; height:50px; line-height:50px;font-size:20px;}

		.tparrows.preview3 .tp-arr-iwrapper			{	min-height:70px;}

		.tparrows.preview3 .tp-arr-imgholder 		{	min-width:70px;height:70px;}

		.tp-rightarrow.preview3 .tp-arr-iwrapper	{	padding-right:50px;}

		.tp-leftarrow.preview3 .tp-arr-iwrapper		{	padding-left:50px;}

		.tparrows.preview3 .tp-arr-titleholder		{	padding:10px;font-size:16px; }







	}



    @media only screen  and (max-width: 767px) {



		.tparrows.preview3:after,

		.tparrows.preview3 							{	width:50px; height:50px; line-height:50px;font-size:20px;}

		.tparrows.preview3 .tp-arr-iwrapper			{	min-height:70px;}

	}











/* NAVIGATION PREVIEW 4 */

.tparrows.preview4 							{	width:30px; height:110px;  background:transparent;-webkit-transform-style: preserve-3d; -webkit-perspective: 1000; -moz-perspective: 1000;}

.tparrows.preview4:after					{	position:absolute;  line-height: 110px;text-align: center; font-family: "revicons"; color:#fff; font-size:20px; top:0px;left:0px;z-index:0; width:30px;height:110px; background: #000; background: rgba(0,0,0,0.25);

												-webkit-transition: all 0.2s ease-in-out;

											    -moz-transition: all 0.2s ease-in-out;

											    -o-transition: all 0.2s ease-in-out;

											    transition: all 0.2s ease-in-out;

												   -ms-filter:"progid:DXImageTransform.Microsoft.Alpha(Opacity=100)";filter: alpha(opacity=100);-moz-opacity: 1;-khtml-opacity: 1;opacity: 1;



											}



.tp-rightarrow.preview4:after				{	content: '\e825';  }

.tp-leftarrow.preview4:after				{	content: '\e824';  }





.tparrows.preview4 .tp-arr-allwrapper		{	visibility:hidden;width:180px;position: absolute;z-index: 1;min-height:120px;top:0px;left:-150px; overflow: hidden;-webkit-perspective: 1000px;-webkit-transform-style: flat;}



.tp-leftarrow.preview4 .tp-arr-allwrapper	{	left:0px;}

.tparrows.preview4 .tp-arr-iwrapper			{	position: relative;}



.tparrows.preview4 .tp-arr-imgholder 		{	display:block;background-size:cover; background-position:center center;width:180px;height:110px;

												position:relative;top:0px;



												-webkit-backface-visibility: hidden;

												backface-visibility: hidden;







											}





.tparrows.preview4 .tp-arr-imgholder2 		{	display:block;background-size:cover; background-position:center center; width:180px;height:110px;

												position:absolute;top:0px; left:180px;

												-webkit-backface-visibility: hidden;

												backface-visibility: hidden;



											}



.tp-leftarrow.preview4 .tp-arr-imgholder2 	{	left:-180px;}









.tparrows.preview4 .tp-arr-titleholder		{	display:block; font-size:12px; line-height:25px; padding:0px 10px;text-align:left;color:#fff; position: relative;

												background: #000;

												color: #FFF;

												text-transform: uppercase;

												white-space: nowrap;

												letter-spacing: 1px;

												font-weight: 700;

												font-size: 11px;

												line-height: 2.75;

												-webkit-transition: all 0.3s;

												transition: all 0.3s;

												-webkit-transform: rotateX(-90deg);

												transform: rotateX(-90deg);

												-webkit-transform-origin: 50% 0;

												transform-origin: 50% 0;

												-webkit-backface-visibility: hidden;

												backface-visibility: hidden;

												  -ms-filter:"progid:DXImageTransform.Microsoft.Alpha(Opacity=0)";filter: alpha(opacity=0);-moz-opacity: 0.0;-khtml-opacity: 0.0;opacity: 0.0;





}







.tparrows.preview4:after				{	transform-origin: 100% 100%; -webkit-transform-origin: 100% 100%;}

.tp-leftarrow.preview4:after			{	transform-origin: 0% 0%; -webkit-transform-origin: 0% 0%;}









@media only screen and (min-width: 768px)  {

		.tparrows.preview4:hover:after				{	-webkit-transform: rotateY(-90deg); transform:rotateY(-90deg);}

		.tp-leftarrow.preview4:hover:after			{	-webkit-transform: rotateY(90deg); transform:rotateY(90deg);}





		.tparrows.preview4:hover .tp-arr-titleholder	{	-webkit-transition-delay: 0.4s;

															transition-delay: 0.4s;

															-webkit-transform: rotateX(0deg);

															transform: rotateX(0deg);

															-ms-filter:"progid:DXImageTransform.Microsoft.Alpha(Opacity=100)";filter: alpha(opacity=100);-moz-opacity: 1;-khtml-opacity: 1;opacity: 1;



														}

}



/* PREVIEW 4 BULLETS */



.tp-bullets.preview4 						{ 	height: 17px; }

.tp-bullets.preview4 .bullet 				{	cursor: pointer;

											    position: relative !important;

											    background: rgba(0, 0, 0, 0.5) !important;

											    -webkit-border-radius: 10px;

											    border-radius: 10px;

											    -webkit-box-shadow: none;

											    -moz-box-shadow: none;

											    box-shadow: none;

											    width: 6px !important;

											    height: 6px !important;

											    border: 5px solid rgba(0, 0, 0, 0) !important;

											    display: inline-block;

											    margin-right: 2px !important;

											    margin-bottom: 0px !important;

											    -webkit-transition: background-color 0.2s, border-color 0.2s;

											    -moz-transition: background-color 0.2s, border-color 0.2s;

											    -o-transition: background-color 0.2s, border-color 0.2s;

											    -ms-transition: background-color 0.2s, border-color 0.2s;

											    transition: background-color 0.2s, border-color 0.2s;

											    float:none !important;

											    box-sizing:content-box;

												-moz-box-sizing:content-box;

												-webkit-box-sizing:content-box;

}

.tp-bullets.preview4 .bullet.last 			{	margin-right: 0px; }

.tp-bullets.preview4 .bullet:hover,

.tp-bullets.preview4 .bullet.selected 		{	-webkit-box-shadow: none;

											    -moz-box-shadow: none;

											    box-shadow: none;

												background: rgba(255, 255, 255, 1) !important;

												width: 6px !important;

											    height: 6px !important;

											    border: 5px solid rgba(0, 0, 0, 1) !important;

}





    @media only screen  and (max-width: 767px) {

   		 .tparrows.preview4 						{	width:20px; height:80px;}

   		 .tparrows.preview4:after					{	width:20px; height:80px; line-height:80px; font-size:14px;}



   		 .tparrows.preview1 .tp-arr-allwrapper,

   		 .tparrows.preview2 .tp-arr-allwrapper,

   		 .tparrows.preview3 .tp-arr-allwrapper,

   		 .tparrows.preview4 .tp-arr-allwrapper		{	display: none !important}

    }







/******************************

	-	LOADER FORMS	-

********************************/



.tp-loader 	{

				top:50%; left:50%;

				z-index:10000;

				position:absolute;





			}



.tp-loader.spinner0 {

  width: 40px;

  height: 40px;

  background:url(../images/revslider/loader.gif) no-repeat center center;

  background-color: #fff;

  box-shadow: 0px 0px 20px 0px rgba(0,0,0,0.15);

  -webkit-box-shadow: 0px 0px 20px 0px rgba(0,0,0,0.15);

  margin-top:-20px;

  margin-left:-20px;

  -webkit-animation: tp-rotateplane 1.2s infinite ease-in-out;

  animation: tp-rotateplane 1.2s infinite ease-in-out;

  border-radius: 3px;

	-moz-border-radius: 3px;

	-webkit-border-radius: 3px;

}





.tp-loader.spinner1 {

  width: 40px;

  height: 40px;

  background-color: #fff;

  box-shadow: 0px 0px 20px 0px rgba(0,0,0,0.15);

  -webkit-box-shadow: 0px 0px 20px 0px rgba(0,0,0,0.15);

  margin-top:-20px;

  margin-left:-20px;

  -webkit-animation: tp-rotateplane 1.2s infinite ease-in-out;

  animation: tp-rotateplane 1.2s infinite ease-in-out;

  border-radius: 3px;

	-moz-border-radius: 3px;

	-webkit-border-radius: 3px;

}







.tp-loader.spinner5 	{	background:url(../images/revslider/loader.gif) no-repeat 10px 10px;

							background-color:#fff;

							margin:-22px -22px;

							width:44px;height:44px;

							border-radius: 3px;

							-moz-border-radius: 3px;

							-webkit-border-radius: 3px;

						}





@-webkit-keyframes tp-rotateplane {

  0% { -webkit-transform: perspective(120px) }

  50% { -webkit-transform: perspective(120px) rotateY(180deg) }

  100% { -webkit-transform: perspective(120px) rotateY(180deg)  rotateX(180deg) }

}



@keyframes tp-rotateplane {

  0% {

    transform: perspective(120px) rotateX(0deg) rotateY(0deg);

    -webkit-transform: perspective(120px) rotateX(0deg) rotateY(0deg)

  } 50% {

    transform: perspective(120px) rotateX(-180.1deg) rotateY(0deg);

    -webkit-transform: perspective(120px) rotateX(-180.1deg) rotateY(0deg)

  } 100% {

    transform: perspective(120px) rotateX(-180deg) rotateY(-179.9deg);

    -webkit-transform: perspective(120px) rotateX(-180deg) rotateY(-179.9deg);

  }

}





.tp-loader.spinner2 {

  width: 40px;

  height: 40px;

  margin-top:-20px;margin-left:-20px;

  background-color: #ff0000;

   box-shadow: 0px 0px 20px 0px rgba(0,0,0,0.15);

  -webkit-box-shadow: 0px 0px 20px 0px rgba(0,0,0,0.15);

  border-radius: 100%;

  -webkit-animation: tp-scaleout 1.0s infinite ease-in-out;

  animation: tp-scaleout 1.0s infinite ease-in-out;

}



@-webkit-keyframes tp-scaleout {

  0% { -webkit-transform: scale(0.0) }

  100% {

    -webkit-transform: scale(1.0);

    opacity: 0;

  }

}



@keyframes tp-scaleout {

  0% {

    transform: scale(0.0);

    -webkit-transform: scale(0.0);

  } 100% {

    transform: scale(1.0);

    -webkit-transform: scale(1.0);

    opacity: 0;

  }

}









.tp-loader.spinner3 {

  margin: -9px 0px 0px -35px;

  width: 70px;

  text-align: center;



}



.tp-loader.spinner3 .bounce1,

.tp-loader.spinner3 .bounce2,

.tp-loader.spinner3 .bounce3 {

  width: 18px;

  height: 18px;

  background-color: #fff;

  box-shadow: 0px 0px 20px 0px rgba(0,0,0,0.15);

  -webkit-box-shadow: 0px 0px 20px 0px rgba(0,0,0,0.15);

  border-radius: 100%;

  display: inline-block;

  -webkit-animation: tp-bouncedelay 1.4s infinite ease-in-out;

  animation: tp-bouncedelay 1.4s infinite ease-in-out;

  /* Prevent first frame from flickering when animation starts */

  -webkit-animation-fill-mode: both;

  animation-fill-mode: both;

}



.tp-loader.spinner3 .bounce1 {

  -webkit-animation-delay: -0.32s;

  animation-delay: -0.32s;

}



.tp-loader.spinner3 .bounce2 {

  -webkit-animation-delay: -0.16s;

  animation-delay: -0.16s;

}



@-webkit-keyframes tp-bouncedelay {

  0%, 80%, 100% { -webkit-transform: scale(0.0) }

  40% { -webkit-transform: scale(1.0) }

}



@keyframes tp-bouncedelay {

  0%, 80%, 100% {

    transform: scale(0.0);

    -webkit-transform: scale(0.0);

  } 40% {

    transform: scale(1.0);

    -webkit-transform: scale(1.0);

  }

}









.tp-loader.spinner4 {

  margin: -20px 0px 0px -20px;

  width: 40px;

  height: 40px;

  text-align: center;

  -webkit-animation: tp-rotate 2.0s infinite linear;

  animation: tp-rotate 2.0s infinite linear;

}



.tp-loader.spinner4 .dot1,

.tp-loader.spinner4 .dot2 {

  width: 60%;

  height: 60%;

  display: inline-block;

  position: absolute;

  top: 0;

  background-color: #fff;

  border-radius: 100%;

  -webkit-animation: tp-bounce 2.0s infinite ease-in-out;

  animation: tp-bounce 2.0s infinite ease-in-out;

  box-shadow: 0px 0px 20px 0px rgba(0,0,0,0.15);

  -webkit-box-shadow: 0px 0px 20px 0px rgba(0,0,0,0.15);

}



.tp-loader.spinner4 .dot2 {

  top: auto;

  bottom: 0px;

  -webkit-animation-delay: -1.0s;

  animation-delay: -1.0s;

}



@-webkit-keyframes tp-rotate { 100% { -webkit-transform: rotate(360deg) }}

@keyframes tp-rotate { 100% { transform: rotate(360deg); -webkit-transform: rotate(360deg) }}



@-webkit-keyframes tp-bounce {

  0%, 100% { -webkit-transform: scale(0.0) }

  50% { -webkit-transform: scale(1.0) }

}



@keyframes tp-bounce {

  0%, 100% {

    transform: scale(0.0);

    -webkit-transform: scale(0.0);

  } 50% {

    transform: scale(1.0);

    -webkit-transform: scale(1.0);

  }

}







.tp-transparentimg {	content:"url(../images/revslider/transparent.png)"}

.tp-3d				{	-webkit-transform-style: preserve-3d;

						 -webkit-transform-origin: 50% 50%;

					}







.tp-caption img {

background: transparent;

-ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorstr=#00FFFFFF,endColorstr=#00FFFFFF)";

filter: progid:DXImageTransform.Microsoft.gradient(startColorstr=#00FFFFFF,endColorstr=#00FFFFFF);

zoom: 1;

}





@font-face {

  font-family: 'revicons';

  src: url('../fonts/revicons90c6.html?5510888');

  src: url('../fonts/revicons90c6.html?5510888#iefix') format('embedded-opentype'),

       url('../fonts/revicons90c6-2.html?5510888') format('woff'),

       url('../fonts/revicons90c6-3.html?5510888') format('truetype'),

       url('../fonts/revicons90c6-4.html?5510888#revicons') format('svg');

  font-weight: normal;

  font-style: normal;

}

/* Chrome hack: SVG is rendered more smooth in Windozze. 100% magic, uncomment if you need it. */

/* Note, that will break hinting! In other OS-es font will be not as sharp as it could be */

/*

@media screen and (-webkit-min-device-pixel-ratio:0) {

  @font-face {

    font-family: 'revicons';

    src: url('../font/revicons.svg?5510888#revicons') format('svg');

  }

}

*/



 [class^="revicon-"]:before, [class*=" revicon-"]:before {

  font-family: "revicons";

  font-style: normal;

  font-weight: normal;

  speak: none;



  display: inline-block;

  text-decoration: inherit;

  width: 1em;

  margin-right: .2em;

  text-align: center;

  /* opacity: .8; */



  /* For safety - reset parent styles, that can break glyph codes*/

  font-variant: normal;

  text-transform: none;



  /* fix buttons height, for twitter bootstrap */

  line-height: 1em;



  /* Animation center compensation - margins should be symmetric */

  /* remove if not needed */

  margin-left: .2em;



  /* you can be more comfortable with increased icons size */

  /* font-size: 120%; */



  /* Uncomment for 3D effect */

  /* text-shadow: 1px 1px 1px rgba(127, 127, 127, 0.3); */

}



.revicon-search-1:before { content: '\e802'; } /* 'î ‚' */

.revicon-pencil-1:before { content: '\e831'; } /* 'î ±' */

.revicon-picture-1:before { content: '\e803'; } /* 'î ƒ' */

.revicon-cancel:before { content: '\e80a'; } /* 'î Š' */

.revicon-info-circled:before { content: '\e80f'; } /* '' */

.revicon-trash:before { content: '\e801'; } /* '' */

.revicon-left-dir:before { content: '\e817'; } /* 'î —' */

.revicon-right-dir:before { content: '\e818'; } /* 'î ˜' */

.revicon-down-open:before { content: '\e83b'; } /* 'î »' */

.revicon-left-open:before { content: '\e819'; } /* 'î ™' */

.revicon-right-open:before { content: '\e81a'; } /* 'î š' */

.revicon-angle-left:before { content: '\e820'; } /* 'î  ' */

.revicon-angle-right:before { content: '\e81d'; } /* '' */

.revicon-left-big:before { content: '\e81f'; } /* 'î Ÿ' */

.revicon-right-big:before { content: '\e81e'; } /* 'î ž' */

.revicon-magic:before { content: '\e807'; } /* 'î ‡' */

.revicon-picture:before { content: '\e800'; } /* 'î €' */

.revicon-export:before { content: '\e80b'; } /* 'î ‹' */

.revicon-cog:before { content: '\e832'; } /* 'î ²' */

.revicon-login:before { content: '\e833'; } /* 'î ³' */

.revicon-logout:before { content: '\e834'; } /* 'î ´' */

.revicon-video:before { content: '\e805'; } /* 'î …' */

.revicon-arrow-combo:before { content: '\e827'; } /* 'î §' */

.revicon-left-open-1:before { content: '\e82a'; } /* 'î ª' */

.revicon-right-open-1:before { content: '\e82b'; } /* 'î «' */

.revicon-left-open-mini:before { content: '\e822'; } /* 'î ¢' */

.revicon-right-open-mini:before { content: '\e823'; } /* 'î £' */

.revicon-left-open-big:before { content: '\e824'; } /* 'î ¤' */

.revicon-right-open-big:before { content: '\e825'; } /* 'î ¥' */

.revicon-left:before { content: '\e836'; } /* 'î ¶' */

.revicon-right:before { content: '\e826'; } /* 'î ¦' */

.revicon-ccw:before { content: '\e808'; } /* 'î ˆ' */

.revicon-arrows-ccw:before { content: '\e806'; } /* 'î †' */

.revicon-palette:before { content: '\e829'; } /* 'î ©' */

.revicon-list-add:before { content: '\e80c'; } /* '' */

.revicon-doc:before { content: '\e809'; } /* 'î ‰' */

.revicon-left-open-outline:before { content: '\e82e'; } /* 'î ®' */

.revicon-left-open-2:before { content: '\e82c'; } /* 'î ¬' */

.revicon-right-open-outline:before { content: '\e82f'; } /* 'î ¯' */

.revicon-right-open-2:before { content: '\e82d'; } /* 'î ­' */

.revicon-equalizer:before { content: '\e83a'; } /* 'î º' */

.revicon-layers-alt:before { content: '\e804'; } /* 'î „' */

.revicon-popup:before { content: '\e828'; } /* 'î ¨' */





/********************* Custom Navigation Styles For Revslider

========================================================== */



#main-content .tp-leftarrow,

#main-content .tp-rightarrow {

    background: transparent !important;

    border-radius: 0 !important;

    font-family: "FontAwesome";

    font-size: 2.8571em !important;

    text-align: center;

    line-height: 1;

    margin-top: -25px !important;

    top: 50%;

    width: 50px !important;

    height: 50px !important;

	color:#9ac93d !important;

	transition:background-position 0.25s;

	-webkit-transition:background-position 0.25s;

	-moz-transition:background-position 0.25s;

	-ms-transition:background-position 0.25s;

	-o-transition:background-position 0.25s;

	position: absolute;

}



#main-content .tp-leftarrow  {

	left:0 !important;

}



#main-content .tp-rightarrow {

	right:0 !important;

}



#main-content .tp-leftarrow:before,

#main-content .tp-rightarrow:before {

    text-shadow: 0 0 3px #fff;

    font-size: 1.5em;

    line-height: 50px;

    display: block;

}



#main-content .tp-leftarrow:before {

    content: "\f104";

}



#main-content .tp-rightarrow:before {

    content: "\f105";

}





@media (max-width: 767px) {



	#main-content .tp-leftarrow,

	#main-content .tp-rightarrow {

		display:none !important;

	}



}



/* @end */



/* @group Write review */



#form-review h2 {

    font-size: 1.4em;

    font-weight: 400;

    line-height: 24px;

    margin: 0 0 10px;

}



/* @end */



/* @group Fixed header */



.fixed-header {

	position: fixed;

	top: -100px;

	left: 0;

	right: 0;

	z-index: 999;

	transition: all 0.2s ease-in;

	-webkit-transition: all 0.2s ease-in;

	-moz-transition: all 0.2s ease-in;

}



	.fixed-header .sub-menu {

		display: none;

	}



		.fixed-header.active .sub-menu {

			display: block;

		}



	.fixed-header.active {

		top: 0;

	}



/* @end */



/* @group Blog */



/* @group Blog list default */



ul.blog-list-default {

     list-style: none;

     padding: 0px;

     margin: 0px;

     position: relative;

}



     ul.blog-list-default li {

          padding: 21px 0px 20px 0px;

     }



          ul.blog-list-default li:first-child {

               padding-top: 0px;

          }



          ul.blog-list-default li:last-child {

               padding-bottom: 0px;

          }



          ul.blog-list-default li:before {

               content: '';

               position: absolute;

               left: 0;

               right: 0;

               height: 1px;

               background: rgba(0, 0, 0, .1);

               margin-top: -21px;

          }



               ul.blog-list-default li:first-child:before {

                    display: none;

               }



          ul.blog-list-default li .thumb-holder {

               float: left;

               width: auto;

               margin-right: 20px;

          }



               ul.blog-list-default li .thumb-holder img {

                    display: block;

               }



         ul.blog-list-default li  .media-body {

         	display: inline;

         }



          ul.blog-list-default li .date-published {

               padding: 4px 0px 3px 0px;

               font-size: 11px;

               font-weight: bold;

          }



          ul.blog-list-default li h5 {

               padding: 0px;

               margin: 0px;

               font-size: 15px;

               line-height: 18px;

          }



/* @end */



/* @group Tagcloud */



.blog-tags .box-content {

     border-bottom: none !important;

}



.blog-tags .tagcloud {

     line-height: 15px;

     position: relative;

     margin: 0px 0px -10px 0px;

}



     .blog-tags .tagcloud a {

          display: inline-block;

          background: #0083c1;

          font-size: 9px;

          line-height: 15px;

          color: #fff;

          font-weight: bold;

          text-transform: uppercase;

          border-radius: 20px;

          -webkit-border-radius: 20px;

          -moz-border-radius: 20px;

          margin: 0px 7px 9px 0px;

          padding: 1px 10px 1px 10px;

     }



          .blog-tags .tagcloud a:hover {

               background: #333;

          }



/* @end */



/* @group News */



.news {

     position: relative;

     margin-bottom: -30px;

}



     .news .media {

          position: relative;

          margin-bottom: 30px;

     }



     .news .thumb-holder {

          overflow: hidden;

     }



          .news .thumb-holder img {

               display: block;

               width: 100%;

          }



     .news .media-body {

          position: absolute;

          z-index: 2;

          top: 0;

          left: 0;

          right: 0;

          bottom: 0;

          cursor: pointer;

          width: auto;

     }



          .news .media-body:before {

               content: "";

               background: url('../img/bg-news.png') bottom left repeat-x;

               opacity: 0.6;

               top: 0;

               left: 0;

               bottom: 0;

               right: 0;

               position: absolute;

               z-index: -1;

               transition: all 0.2s ease-in;

               -webkit-transition: all 0.2s ease-in;

               -moz-transition: all 0.2s ease-in;

          }



               .news .media-body:hover:before {

                    opacity: 0.7;

               }



          .news .media-body .tags {

               position: absolute;

               top: 18px;

               left: 20px;

               right: 10px;

               margin: 0px;

               padding: 0px;

               line-height: 1.6;

          }



               .news .media-body .tags a {

                    display: inline-block;

                    background: #0083c1;

                    font-size: 9px;

                    line-height: 15px;

                    color: #fff;

                    font-weight: bold;

                    text-transform: uppercase;

                    border-radius: 20px;

                    -webkit-border-radius: 20px;

                    -moz-border-radius: 20px;

                    margin: 0px 7px 9px 0px;

                    padding: 1px 10px 1px 10px;

               }



                    .news .media-body .tags a:hover {

                         background: #333;

                    }



          .news .media-body .bottom {

               position: absolute;

               bottom: 0;

               left: 0;

               right: 0;

               text-align: center;

               transition: all 0.2s ease-in;

               -webkit-transition: all 0.2s ease-in;

               -moz-transition: all 0.2s ease-in;

          }



               .news.v1 .media-body .bottom {

                    color: #fff;

               }



               .news .media-body:hover .bottom {

                    bottom: 10px;

               }



               .news .media-body .date-published {

                    display: inline-block;

                    font-size: 12px;

                    font-weight: bold;

                    border-bottom: 1px solid rgba(255, 255, 255, .2);

                    padding-bottom: 9px;

                    padding-top: 25px;

               }



               .news .media-body h5 {

                    padding: 12px 20px 34px 20px;

                    margin: 0px;

                    font-size: 18px;

                    line-height: 23px;

                    text-transform: none;

                    font-weight: 500 !important;

                    color: #fff;

               }



/* @end */



/* @group News V2 */



.news.v2 .media {

     padding-bottom: 53px;

}



.news.v2 .media .thumb-holder img {

     -webkit-transform: scale(1,1);

     -webkit-transition-timing-function: ease-out;

     -webkit-transition-duration: 250ms;

     -moz-transform: scale(1,1);

     -moz-transition-timing-function: ease-out;

     -moz-transition-duration: 250ms;

     transform: scale(1,1);

     transition-timing-function: ease-out;

     transition-duration: 250ms;

}



     .news.v2 .media:hover .thumb-holder img {

          -webkit-transform: scale(1.04,1.04);

          -webkit-transition-timing-function: ease-out;

          -webkit-transition-duration: 250ms;

          -moz-transform: scale(1.04,1.04);

          -moz-transition-timing-function: ease-out;

          -moz-transition-duration: 250ms;

          transform: scale(1.04,1.04);

          transition-timing-function: ease-out;

          transition-duration: 250ms;

     }



.news.v2 .media-body:before {

     display: none !important;

}



.news.v2  .media-body .bottom {

     background: #fff;

     border: 1px solid #e6e6e6;

     border-top: none;

     color: #1349b2;

     bottom: 0 !important;

}



     .news.v2  .media-body .bottom h5 {

     }



     .news.v2 .media-body .date-published {

          border-color: rgba(0, 0, 0, .2);

     }



     .news.v2 .media-body h5 {

          padding-bottom: 33px;

     }



          .news.v2 .media-body h5 a {

               line-height: 23px;

          }



/* @end */



/* @end */



/* @group Align right */



.align-right {

	float: right;

}



@media (max-width: 991px) {

	.align-right {

		float: none;

	}

}



/* @end */



/* @group Quick checkout */



.quickcheckout-checkout #content h1 {

	display: none;

}



.quickcheckout-heading {

	border: 1px solid #ddd;

	border-bottom: none;

	border-radius: 5px 5px 0 0;

	-webkit-border-radius: 5px 5px 0 0;

	-moz-border-radius: 5px 5px 0 0;

}



body .quickcheckout-content {

	border-radius: 0 0 5px 5px;

	-webkit-border-radius: 0 0 5px 5px;

	-moz-border-radius: 0 0 5px 5px;

	margin-bottom: 30px;

	background: #fff;

}



	body #terms .quickcheckout-content,

	body #voucher .quickcheckout-content {

		background: none;

	}



.or {

	padding: 0px 0 20px 0;

}



.quickcheckout-content label {

	padding-top: 6px;

}



#terms .quickcheckout-content {

	padding: 0px;

	border: none;

	padding-bottom: 0px;

	padding-top: 10px;

	margin-bottom: -30px;

}



#button-payment-method {

	margin-left: 10px;

}



.quickcheckout-content table {

	margin-bottom: 0;

}



.quickcheckout-content table tr:first-child td {

	border-top: none;

}



.quickcheckoutright .quickcheckout-content input[type="radio"],

.quickcheckoutright .quickcheckout-content input[type="checkbox"] {

	margin-left: auto;

	margin-right: auto;

	display: block;

	margin-top: 9px;

}



.quickcheckout-content textarea {

	margin-top: 5px;

}



#quickcheckoutconfirm {

	padding-bottom: 40px !important;

}



/* @end */



/* @group Header 2 */



#header.header2 #header-top .container,

#header.header2 #header-inner .container {

	position: static;

	display: block;

}



.header2 ul.megamenu {

	position: static;

	padding-left: 23px;

}



.header2 .container-megamenu,

.header2 .container-megamenu .container {

	position: static;

}



#header.header2 #header-inner .container .header-center {

	width: 800px;

}



.header2 .megamenu-wrapper {

	position: static;

}



#header.header2 #header-inner > .container {

 	position: relative;

}



.header2 ul.megamenu > li {

	margin: 0px 1px !important;

	border-radius: 5px;

	-webkit-border-radius: 5px;

	-moz-border-radius: 5px;

}



	.header2 ul.megamenu > li > a {

		padding: 9px 12px 8px;

		height: 37px;

	}



	.common-home .header2 ul.megamenu > li:first-child,

	.header2 ul.megamenu > li:hover {

		background: #3b3b3b;

	}



	.body-header-type-3 ul.megamenu > li > a:hover,

	.body-header-type-3 ul.megamenu > li.active > a,

	.body-header-type-3 ul.megamenu > li.home > a,

	.body-header-type-3 ul.megamenu > li:hover > a {

		color: #fff;

	}



.header2 ul.megamenu .megamenu-label {

	top: -6px;

	right: 7px;

}



.header2 .separator {

	display: none;

}



@media (max-width: 991px) {

	.header2 .header-center  {

		display: none !important;

	}



	.header2 .header-right {

		width: 100%;

	}

}



.common-home.body-header-type-3 #footer > .container {

	display: none;

}



.common-home.body-header-type-3 .main-content {

	padding-bottom: 0;

}



.common-home.body-header-type-3 #footer-bottom {

	position: fixed;

	bottom: 0;

	left: 0;

	right: 0;

	z-index: 99;

	padding: 0 !important;

	background: rgba(255,255,255,0.85) !important;

}



.body-header-type-3 .tp-caption.rev-text,

.body-header-type-4 .tp-caption.rev-text {

	font-weight: 300;

    font-size: 24px;

    color:#fff;

    text-align: center;

}



.body-header-type-3 .tp-caption.rev-text.small,

.body-header-type-4 .tp-caption.rev-text.small {

	font-size:19px;

	font-weight: 600;

	color: #fff;

}



@media (max-width: 991px) {

	.body-header-type-3.common-home .footer-left > * {

		text-align: center;

	}



	.body-header-type-3.common-home .footer-center,

	.body-header-type-3.common-home .footer-right,

	.body-header-type-3.common-home #footer .logo {

		display: none;

	}

}



.body-header-type-3 .megamenu-wrapper {

	background: #1e1e1e;

}



@media (max-width: 991px) {

	.body-header-type-3 #header #header-inner .container .header-right {

		position: absolute;

		right: 20px;

		top: 0;

	}

}



/* @end */



/* @group Header type 4 */



.body-header-type-4 .container-megamenu {

	margin-bottom: 15px;

}



.body-header-type-4 .megamenu-wrapper {

	background: none;

}



.body-header-type-4 ul.megamenu:before,

.body-header-type-4 ul.megamenu:after{

  display: table;

  content: " ";

}

.body-header-type-4 ul.megamenu:after {

  clear: both;

}



.body-header-type-4 ul.megamenu {

	background: #f0f0ed;

	border-radius: 6px;

	-webkit-border-radius: 6px;

	-moz-border-radius: 6px;

}



.body-header-type-4 ul.megamenu > li {

	margin: 0px 2px 0px 0px;

}



.body-header-type-4 ul.megamenu > li.pull-right {

	margin: 0px 0px 0px 2px;

}



.body-header-type-4 ul.megamenu > li > a {

	height: 40px;

	padding: 11px 13px 9px 13px;

	color: #9ac93d;

}



	.body-header-type-4 ul.megamenu > li.home > a,

	.body-header-type-4 ul.megamenu > li:hover > a {

		background: #9ac93d;

		border-radius: 6px;

		-webkit-border-radius: 6px;

		-moz-border-radius: 6px;

		color: #fff;

	}



	.body-header-type-4 ul.megamenu > li:hover > a{

		border-radius: 6px 6px 0 0;

		-webkit-border-radius: 6px 6px 0 0;

		-moz-border-radius: 6px 6px 0 0;

	}



.body-header-type-4 ul.megamenu .megamenu-label {

	top: -4px;

	right: 13px;

}



	.body-header-type-4 .fixed-header ul.megamenu .megamenu-label {

		top: 0;

	}



.body-header-type-4 #header.header3 ul.megamenu .menu {

	background: none;

}



/* @end */



/* @group Index4 */



.parallax-info .btn-default,

.parallax-info .btn,

.parallax-info .button {

	background: none !important;

}



.post-slider.type2 .post-image img {

	width: 100%;

}



@media (max-width: 767px) {

	.post-slider.type2 > div:last-of-type {

		padding-top: 15px;

	}

}



/* @end */



/* @group Index3 */



.index3-slide-btn {

	display:inline-block;

	font-size:14px;

	line-height: 20px;

	padding:7.5px 25px;

	font-weight: 600;

	background-color: #fefefe;

	border-radius: 5px;

	color: #777 !important;

}



.index3-slide-btn:hover {

	background-color: rgba(250, 250, 250, 0.9);

	color:#000;

}



/* @end */



/* @group Header type 5 */



.header4 .megamenu-wrapper {

	background: #9ac93d;

}



	.header4 .megamenu-wrapper ul.megamenu li {

		margin: 0px 2px 0px 0px;

	}



	.header4 .megamenu-wrapper ul.megamenu > li.home > a,

	.header4 .megamenu-wrapper ul.megamenu > li > a:hover {

		background: #fff;

		color: #9ac93d;

	}



	.header4 .megamenu-wrapper ul.megamenu > li > a {

		padding-left: 21px;

		height: 40px;

		padding-top: 11px;

		padding-right: 21px;

	}



/* @end */



/* @group Skin5 */



.skin5 .main-content {

	background: #fff;

	padding: 15px;

}



	@media (max-width: 991px) {

		.skin5 .main-content {

			padding: 15px 0;

		}

	}



	.skin5 .main-content .container {

		width: auto !important;

	}



.common-home.skin5 .main-content {

	padding: 0px;

	background: none;

}



.skin5 .mfilter-heading,

.skin5 .mfilter-content > ul > li,

.skin5 a.quickview-icon,

.skin5 .product-filter .options .button-group button,

.skin5 .nav-tabs > li > a,

.skin5 .product-list .btn-add-cart,

.skin5 .product-list .product-btn.btn-wishlist,

.skin5 .product-list .product-btn.btn-quickview,

.skin5 .product-info .thumbnails li img,

.skin5 .product-info .thumbnails-carousel img,

.skin5 .btn-default,

.skin5 .btn,

.skin5 .button,

.skin5 select,

.skin5 input,

.skin5 textarea,

.skin5 .product-info .product-image,

.skin5 .well,

.skin5 .box,

.skin5 .box .box-heading,

.skin5 table.attribute,

.skin5 table.list,

.skin5 .wishlist-product table,

.skin5 .wishlist-info table,

.skin5 .compare-info,

.skin5 .cart-info table,

.skin5 .checkout-product table,

.skin5 .table,

.skin5 .center-column .panel-heading,

.skin5 .quickcheckout-heading,

body.skin5 .quickcheckout-content,

.skin5 .mfilter-heading .mfilter-head-icon,

.skin5 .box .box-heading .toggle,

.skin5 ul.megamenu li .sub-menu .content,

.skin5 .popup,

.skin5 .posts .post .post-media,

.skin5 .posts .button-more,

.skin5 #header .currency-switcher li > ul,

.skin5 #header .view-switcher li > ul,

.skin5 #scroll-top,

.skin5 .product-center .single-add-to-wishlist a:before,

.skin5 .product-center .add-to-cart .quantity #q_up,

.skin5 .product-center .add-to-cart .quantity #q_down,

.skin5 .product-center .add-to-cart .quantity input,

.skin5 .alert,

.skin5 ul.product_list_widget li .product-image img,

.skin5 .widget ul.product_list_widget li .product-image img,

.skin5 ul.product_list_widget li .product-image,

.skin5 .widget ul.product_list_widget li .product-image,

.skin5 ul.megamenu li .sub-menu .content .hover-menu .menu ul ul,

.skin5 #mini-cart .mini-cart-info table td.image img,

.skin5 .product-image,

.skin5 .product-image img,

.skin5 .product-action .product-btn,

.skin5 .prev-next-products .product-nav .product-pop,

.skin5 .post .tags a,

.skin5 .pagination > li > a,

.skin5 .pagination > li > span {

	border-radius: 0px !important;

	-webkit-border-radius: 0px !important;

	-moz-border-radius: 0px !important;

}



/* @end */



/* @group Skin5 products */



.skin5-products .box {

	padding: 0px;

	border: none;

	margin: 0px;

	background: none;

}



	.skin5-products .box .box-content {

		padding: 0px;

	}



/* @end */



/* @group Skin 6 */



.body-full-width .container {

	width: auto !important;

}



	.common-home.body-full-width .main-content .container {

		padding: 0px;

	}



	.skin6 #footer-bottom > .container {

		width: 100% !important;

	}



	.skin6.common-home .main-content {

		padding-bottom: 0;

	}



/* @end */



/* @group Header type 6 */



.header55 {

	background: url(../images/page_header.jpg) top center repeat;

	min-height: 175px;

}



	.common-home .header55 {

		background: none !important;

		position: absolute !important;

		top: 0;

		left: 0;

		right: 0;

		z-index: 99;

	}



		.header55 .logo {

			text-align: center;

			padding-top: 19px;

			display: block;

			margin: 0px !important;

		}



			.header55 .logo img {

				position: relative;

				z-index: 999;

			}



	.header55 .left {

		position: absolute;

		width: 60%;

		left: 15px;

		top: 30px;

	}



	.header55 .megamenu-wrapper {

		background: none;

	}



	.header55 ul.megamenu > li {

		margin: 0px 5px 0px 0px;

	}



	.header55 ul.megamenu > li > a {

		height: 32px;

		padding: 7px 11px 0px 11px;

		border-radius: 6px;

		-webkit-border-radius: 6px;

		-moz-border-radius: 6px;

	}



		.header55 ul.megamenu > li > a:hover,

		.header55 ul.megamenu > li.active > a,

		.header55 ul.megamenu > li.home > a,

		.header55 ul.megamenu > li:hover > a {

			background: #fff;

			color: #777;

		}



			.header55 ul.megamenu > li.with-sub-menu:hover > a {

				border-radius: 6px 6px 0 0;

				-webkit-border-radius: 6px 6px 0 0;

				-moz-border-radius: 6px 6px 0 0;

			}



			.header55 ul.megamenu li .sub-menu .content {

				border-top: none;

			}



			.header55 ul.megamenu .megamenu-label {

				top: -5px;

			}



			.header55#header .mobile-toggle {

				left: 5px;

				top: -3px;

			}



	.header55 > .right {

		position: absolute;

		right: 30px;

		top: 30px;

		width: 40%;

		left: auto;

		text-align: right;

	}



		.header55 #mini-cart.minicart-inline {

			background: #fff !important;

			top: 0 !important;

			right: 0 !important;

		}



		.header55 #mini-cart.minicart-inline .cart-items {

			color: #777 !important;

		}



		.header55 #mini-cart .minicart-icon {

			color: #777;

		}



		.header55 .separator {

			display: none;

		}



		.header55#header .currency-switcher > li > a,

		.header55#header .view-switcher > li > a {

			background: #fff;

			border-radius: 6px;

			-webkit-border-radius: 6px;

			-moz-border-radius: 6px;

			color: #777;

			margin-top: -1px;

			margin-right: 0;

			margin-left: 0;

		}



			.header55#header .currency-switcher > li:hover > a,

			.header55#header .view-switcher > li:hover > a  {

				border-radius: 6px 6px 0 0;

				-webkit-border-radius: 6px 6px 0 0;

				-moz-border-radius: 6px 6px 0 0;

			}



			.header55#header .currency-switcher li > ul,

			.header55#header .view-switcher li > ul {

				min-width: 120px;

				text-align: left;

				background: #fff;

			}



				.header55#header .currency-switcher li > ul a,

				.header55#header .view-switcher li > ul a {

					color: #777;

					background: none !important;

				}



					.header55#header .currency-switcher li > ul a:hover,

					.header55#header .view-switcher li > ul a:hover {

						background: #fafafa !important;

					}



		.header55#header .currency-switcher,

		.header55#header .view-switcher {

			margin-left: 6px;

		}



		@media (max-width: 991px) {

			.header55#header .currency-switcher,

			.header55#header .view-switcher {

				display: none;

			}

		}



/* @end */



/* @group Row no margin */



.row.no-margin {

	margin: 0px;

}



	.row.no-margin > div {

		padding: 0px;

	}



	.row.no-margin .banner,

	.row.no-margin .banner img,

	.row.no-margin .banner a:after {

		border-radius: 0 !important;

		-webkit-border-radius: 0 !important;

		-moz-border-radius: 0 !important;

	}



/* @end */



/* @group Skin7 */



.skin7 .mfilter-heading,

.skin7 .mfilter-content > ul > li,

.skin7 a.quickview-icon,

.skin7 .product-filter .options .button-group button,

.skin7 .nav-tabs > li > a,

.skin7 .product-list .btn-add-cart,

.skin7 .product-list .product-btn.btn-wishlist,

.skin7 .product-list .product-btn.btn-quickview,

.skin7 .product-info .thumbnails li img,

.skin7 .product-info .thumbnails-carousel img,

.skin7 .btn-default,

.skin7 .btn,

.skin7 .button,

.skin7 select,

.skin7 input,

.skin7 textarea,

.skin7 .product-info .product-image,

.skin7 .well,

.skin7 .box,

.skin7 .box .box-heading,

.skin7 table.attribute,

.skin7 table.list,

.skin7 .wishlist-product table,

.skin7 .wishlist-info table,

.skin7 .compare-info,

.skin7 .cart-info table,

.skin7 .checkout-product table,

.skin7 .table,

.skin7 .center-column .panel-heading,

.skin7 .quickcheckout-heading,

body.skin7 .quickcheckout-content,

.skin7 .mfilter-heading .mfilter-head-icon,

.skin7 .box .box-heading .toggle,

.skin7 ul.megamenu li .sub-menu .content,

.skin7 .popup,

.skin7 .banner, .skin7 .banner img, .skin7 .banner a:after,

.skin7 .posts .post .post-media,

.skin7 .posts .button-more,

.skin7 #header .currency-switcher li > ul,

.skin7 #header .view-switcher li > ul,

.skin7 #scroll-top,

.skin7 .product-center .single-add-to-wishlist a:before,

.skin7 .product-center .add-to-cart .quantity #q_up,

.skin7 .product-center .add-to-cart .quantity #q_down,

.skin7 .product-center .add-to-cart .quantity input,

.skin7 .alert,

.skin7 ul.product_list_widget li .product-image img,

.skin7 .widget ul.product_list_widget li .product-image img,

.skin7 ul.product_list_widget li .product-image,

.skin7 .widget ul.product_list_widget li .product-image,

.skin7 ul.megamenu li .sub-menu .content .hover-menu .menu ul ul,

.skin7 #mini-cart .mini-cart-info table td.image img,

.skin7 .product-image,

.skin7 .product-image img,

.skin7 .product-action .product-btn,

.skin7 .prev-next-products .product-nav .product-pop,

.skin7 .post .tags a,

.skin7 .pagination > li > a,

.skin7 .pagination > li > span {

	border-radius: 0px !important;

	-webkit-border-radius: 0px !important;

	-moz-border-radius: 0px !important;

}



.skin7.common-home .row {

	margin: 0px -4px;

}



	.skin7.common-home .row > div {

		padding: 0px 4px;

	}



/* @end */



/* @group Header type 7 */



#header.header6 {

	position: relative;

	z-index: 999;

}



.header6 ul.megamenu,

.header6 .container-megamenu .container,

.header6 .container-megamenu,

.header6 .megamenu-wrapper {

	position: static !important;

}



.header6 .horizontal {

	display: inline-block;

	vertical-align: middle;

}



	@media (max-width: 991px) {

		.header6 .horizontal {

			display: none;

		}

	}



	.header6.fixed-header .horizontal {

		display: block;

	}



		.header6.fixed-header .horizontal ul.megamenu {

			position: relative !important;

		}



	.header6 .megamenu-wrapper {

		background: #fff;

	}



	.header6 ul.megamenu > li {

		margin: 0px 2px 0px 0px;

	}



	.header6 ul.megamenu > li > a {

		color: #65829d;

		height: 37px;

		padding: 9px 12px 8px;

	}



	.header6 ul.megamenu > li > a:hover,

	.header6 ul.megamenu > li.active > a,

	.header6 ul.megamenu > li.home > a,

	.header6 ul.megamenu > li:hover > a {

		background: #65829d;

		color: #fff;

	}



	.header6 ul.megamenu .megamenu-label {

		top: -6px;

	}



/* @end */



/* @group Header type 8 */



.header7 .megamenu-wrapper {

	background: #fff;

}



	#header.header7 .menu {

		text-align: left !important;

	}



	.header7 ul.megamenu > li > a {

		color: #828385;

	}



		.header7 ul.megamenu > li > a:hover,

		.header7 ul.megamenu > li.active > a,

		.header7 ul.megamenu > li.home > a,

		.header7 ul.megamenu > li:hover > a {

			color: #e13b3f;

		}



.skin8 .mfilter-heading,

.skin8 .mfilter-content > ul > li,

.skin8 a.quickview-icon,

.skin8 .product-filter .options .button-group button,

.skin8 .nav-tabs > li > a,

.skin8 .product-list .btn-add-cart,

.skin8 .product-list .product-btn.btn-wishlist,

.skin8 .product-list .product-btn.btn-quickview,

.skin8 .product-info .thumbnails li img,

.skin8 .product-info .thumbnails-carousel img,

.skin8 .btn-default,

.skin8 .btn,

.skin8 .button,

.skin8 select,

.skin8 input,

.skin8 textarea,

.skin8 .product-info .product-image,

.skin8 .well,

.skin8 .box,

.skin8 .box .box-heading,

.skin8 table.attribute,

.skin8 table.list,

.skin8 .wishlist-product table,

.skin8 .wishlist-info table,

.skin8 .compare-info,

.skin8 .cart-info table,

.skin8 .checkout-product table,

.skin8 .table,

.skin8 .center-column .panel-heading,

.skin8 .quickcheckout-heading,

body.skin8 .quickcheckout-content,

.skin8 .mfilter-heading .mfilter-head-icon,

.skin8 .box .box-heading .toggle,

.skin8 ul.megamenu li .sub-menu .content,

.skin8 .popup,

.skin8 .banner, .skin8 .banner img, .skin8 .banner a:after,

.skin8 .posts .post .post-media,

.skin8 .posts .button-more,

.skin8 #header .currency-switcher li > ul,

.skin8 #header .view-switcher li > ul,

.skin8 #scroll-top,

.skin8 .product-center .single-add-to-wishlist a:before,

.skin8 .product-center .add-to-cart .quantity #q_up,

.skin8 .product-center .add-to-cart .quantity #q_down,

.skin8 .product-center .add-to-cart .quantity input,

.skin8 .alert,

.skin8 ul.product_list_widget li .product-image img,

.skin8 .widget ul.product_list_widget li .product-image img,

.skin8 ul.product_list_widget li .product-image,

.skin8 .widget ul.product_list_widget li .product-image,

.skin8 ul.megamenu li .sub-menu .content .hover-menu .menu ul ul,

.skin8 #mini-cart .mini-cart-info table td.image img,

.skin8 .product-image,

.skin8 .product-image img,

.skin8 .product-action .product-btn,

.skin8 .prev-next-products .product-nav .product-pop,

.skin8 .post .tags a,

.skin8 .pagination > li > a,

.skin8 .pagination > li > span {

	border-radius: 0px !important;

	-webkit-border-radius: 0px !important;

	-moz-border-radius: 0px !important;

}



.skin8 .page-top {

	background: #f7f7f7;

	color: #777;

}



	.skin8 .breadcrumb > li > a,

	.skin8 .breadcrumb > .active {

		color: #777;

	}



	.skin8 .breadcrumb > li + li:before {

		color: #777;

	}



/* @end */



/* @group Skin9 */



.skin9 .mfilter-heading,

.skin9 .mfilter-content > ul > li,

.skin9 a.quickview-icon,

.skin9 .product-filter .options .button-group button,

.skin9 .nav-tabs > li > a,

.skin9 .product-list .btn-add-cart,

.skin9 .product-list .product-btn.btn-wishlist,

.skin9 .product-list .product-btn.btn-quickview,

.skin9 .product-info .thumbnails li img,

.skin9 .product-info .thumbnails-carousel img,

.skin9 .btn-default,

.skin9 .btn,

.skin9 .button,

.skin9 select,

.skin9 input,

.skin9 textarea,

.skin9 .product-info .product-image,

.skin9 .well,

.skin9 .box,

.skin9 .box .box-heading,

.skin9 table.attribute,

.skin9 table.list,

.skin9 .wishlist-product table,

.skin9 .wishlist-info table,

.skin9 .compare-info,

.skin9 .cart-info table,

.skin9 .checkout-product table,

.skin9 .table,

.skin9 .center-column .panel-heading,

.skin9 .quickcheckout-heading,

body.skin9 .quickcheckout-content,

.skin9 .mfilter-heading .mfilter-head-icon,

.skin9 .box .box-heading .toggle,

.skin9 ul.megamenu li .sub-menu .content,

.skin9 .popup,

.skin9 .banner, .skin9 .banner img, .skin9 .banner a:after,

.skin9 .posts .post .post-media,

.skin9 .posts .button-more,

.skin9 #header .currency-switcher li > ul,

.skin9 #header .view-switcher li > ul,

.skin9 #scroll-top,

.skin9 .product-center .single-add-to-wishlist a:before,

.skin9 .product-center .add-to-cart .quantity #q_up,

.skin9 .product-center .add-to-cart .quantity #q_down,

.skin9 .product-center .add-to-cart .quantity input,

.skin9 .alert,

.skin9 ul.product_list_widget li .product-image img,

.skin9 .widget ul.product_list_widget li .product-image img,

.skin9 ul.product_list_widget li .product-image,

.skin9 .widget ul.product_list_widget li .product-image,

.skin9 ul.megamenu li .sub-menu .content .hover-menu .menu ul ul,

.skin9 #mini-cart .mini-cart-info table td.image img,

.skin9 .product-image,

.skin9 .product-image img,

.skin9 .product-action .product-btn,

.skin9 .prev-next-products .product-nav .product-pop,

.skin9 .post .tags a,

.skin9 .pagination > li > a,

.skin9 .pagination > li > span {

	border-radius: 0px !important;

	-webkit-border-radius: 0px !important;

	-moz-border-radius: 0px !important;

}



.skin9 .main-content {

	background: #fff;

	padding: 15px;

	margin-bottom: 15px;

}



	.skin9 .main-content .container {

		width: auto !important;

		padding-left: 0;

		padding-right: 0;

	}



.common-home.skin9 .main-content {

	padding: 0px;

	background: none;

}



/* @end */



/* @group Header type 9 */



.skin9 .page-top {

	background: #fff;

	margin-bottom: 10px;

}



	.skin9 .breadcrumb > li > a,

	.skin9 .breadcrumb > .active,

	.skin9 .breadcrumb > li + li:before {

		color: #999;

	}



.header8 .menu-container {

	background: #fff;

	padding: 0px 15px;

	border-bottom: 1px solid #eeeeee;

}



	@media (max-width: 991px) {

		.header8 .menu-container {

			display: none;

		}

	}



	.header8 .vertical {

		padding: 0px !important;

		margin: 0px 0px -1px 0px !important;

		width: 100% !important;

		position: relative;

		border: none;

		background: none;

	}



		.header8 .vertical #menuHeading {

			display: block !important;

		}



			.header8 .vertical .megamenuToogle-wrapper .container {

				height: 40px;

				color: #fff;

				cursor: pointer;

				background: #303030;

				font-size: 0.8571em;

				font-weight: 700;

				line-height: 20px;

				padding: 10px 15px !important;

				margin: 0;

				text-transform: uppercase;

				position: relative;

				-webkit-transition: all 0.25s ease 0s;

				transition: all 0.25s ease 0s;

				border-radius: 0;

				-webkit-border-radius: 0;

				-moz-border-radius: 0;

			}



		.header8 .vertical .container {

			display: block !important;

			width: auto !important;

		}



		.header8 .vertical .megamenu-wrapper {

			position: absolute !important;

			left: 0;

			right: 0;

			background: #fff !important;

			border-bottom: 5px solid #303030;

			box-shadow: 0 0 20px rgba(0, 0, 0, .4);

			-webkit-box-shadow: 0 0 20px rgba(0, 0, 0, .4);

			-moz-box-shadow: 0 0 20px rgba(0, 0, 0, .4);

			display: none !important;

		}



			.common-home .fixed-header.header8 .vertical .megamenu-wrapper {

				display: none !important;

			}



			.common-home .fixed-header.header8 .vertical:hover .megamenu-wrapper {

				display: block !important;

			}



			.common-home .header8 .vertical .megamenu-wrapper,

			.header8 .vertical:hover .megamenu-wrapper {

				display: block !important;

			}



.header8 .megamenu-wrapper {

	background: none;

}



	.header8 .megamenu-wrapper .container {

		padding: 0px !important;

		width: auto !important;

		display: block !important;

	}



	.header8 ul.megamenu > li {

		margin: 0px 20px 0px 0px;

	}



	.header8 ul.megamenu > li > a {

		color: #777;

		height: 39px;

		padding: 10px 0px 0px 6px;

	}



		.header8 ul.megamenu > li > a:hover,

		.header8 ul.megamenu > li.active > a,

		.header8 ul.megamenu > li.home > a,

		.header8 ul.megamenu > li:hover > a {

			color: #d0205e;

		}



/* @end */



/* @group Skin9 slider */



.skin9 .camera_slider {

	margin: 0px;

	padding-left: 25.8%;

	padding-right: 17px;

	background: #fff;

}



	@media (max-width: 991px) {

		.skin9 .camera_slider {

			padding-left: 0;

			padding-right: 0;

		}

	}



/* @end */



/* @group Skin9 box */



.skin9 .carousel-wrapper  {

	background: #fff;

	margin: 15px 0px 0px 0px;

	padding: 30px 15px;

}



	.skin9 .center-column .carousel-wrapper {

		padding: 0px;

	}



	.skin9.common-home .box {

		padding: 0px;

		margin: 0px;

		border: none;

		background: none;

	}



		.skin9.common-home .box .box-content {

			padding: 0px;

			margin: 0px;

			border: none;

			background: none;

		}



/* @end */



/* @group Header 10 */



.header_10 {

	position: absolute !important;

	top: 0;

	width: 256px;

	left: 0;

	margin-left: -256px;

	bottom: 0;

	background: #383734;

	z-index: 99;

	padding: 10px;

	text-align: center;

}



	@media (max-width: 991px) {

		body #wrapper .header_10 {

			width: 100%;

			margin-left: 0;

			bottom: auto;

			right: auto;

			position: relative !important;

		}



		body.common-home #wrapper .header_10 {

			position: absolute !important;

		}

	}



	.common-home .header_10 {

		background: rgba(0,0,0,0.4);

	}



	.with-fixed .header_10 {

		position: fixed !important;

		margin-left: 0;

	}



body.body-header-type-10 {

	padding-left: 256px;

}



	@media (max-width: 991px) {

		body.body-header-type-10 {

			padding-left: 0;

		}

	}



.header_10 .separator,

.header_10 .mobile-toggle {

	display: none;

}



@media (max-width: 991px) {

	.header_10 .mobile-toggle {

		display: block;

		position: absolute;

		color: #fff;

		top: 36px;

		left: 20px;

	}

}



body.body-header-type-10.common-home .main-content {

	min-height: 0px;

	padding-bottom: 0;

}



body.body-header-type-10.common-home #footer {

	display: none;

}



	.header_10 .accordion-menu {

		padding: 0px;

		margin: 0px 2px 4px 2px;

		list-style: none;

	}





		@media (max-width: 991px) {

			.header_10 .accordion-menu {

				display: none;

			}

		}



		.header_10 .accordion-menu > li > a {

			background-color: #101010;

			color: #fff;

			text-align: center;

			height: 26px;

			padding: 0 10px 0 10px;

			border: 1px solid #101010;

			border-radius: 3px;

			-moz-border-radius: 3px;

			-webkit-border-radius: 3px;

		    white-space: nowrap;

		    text-overflow: ellipsis;

		    font-size: 11px;

		    text-transform: uppercase;

		    line-height: 24px;

		    margin: 0px;

		}



			.header_10 .accordion-menu li > a i {

				margin-left: 4px;

			}



			.header_10 .accordion-menu > li:hover ul {

				display: block;

			}



			.header_10 .accordion-menu > li ul {

				position: absolute;

				background: #fff;

				border-radius: 6px;

				-webkit-border-radius: 6px;

				-moz-border-radius: 6px;

				color: #777;

				z-index: 99;

				padding: 5px 0;

				margin: 0px;

				text-align: left;

				min-width: 120px;

			}



				.header_10 .accordion-menu > li ul a {

					text-decoration: none;

					display: block;

					padding: 0 10px;

					background-color: transparent;

					border: 0;

					border-radius: 0;

					font-size: 11px;

					color: #777;

					line-height: 1.5;

					text-transform: uppercase;

				}



					.header_10 .accordion-menu > li ul a:hover {

						background: #dadada;

					}



	.header_10 #mini-cart.minicart-inline .cart-items {

		text-transform: uppercase;

	}



		.header_10 #mini-cart.dropdown .dropdown-menu {

			left: 0;

			right: auto;

		}



		.header_10 #mini-cart.dropdown .dropdown-menu:before {

			left: 17px;

			right: auto;

		}



		@media (max-width: 991px) {

			.header_10 form {

				display: none;

			}



			.header_10 #mini-cart {

				position: absolute;

				top: 32px;

				right: 20px;

			}



			.header_10 #mini-cart.dropdown .dropdown-menu {

				left: auto;

				right: 0;

			}



			.header_10 #mini-cart.dropdown .dropdown-menu:before {

				left: auto;

				right: 17px;

			}

		}



	.header_10 .logo {

		padding-top: 30px;

	}



		@media (max-width: 991px) {

			.header_10 .logo {

				padding-bottom: 5px;

				padding-top: 5px;

			}

		}



	.header_10 .container {

		width: auto !important;

	}



	.header_10 .megamenu-wrapper {

		background: none;

		text-align: left;

		padding-top: 28px;

	}





		@media (max-width: 991px) {

			.header_10 .megamenu-wrapper {

				display: none;

			}

		}



		.header_10 .megamenu-wrapper .container {

			padding-left: 10px;

			padding-right: 10px;

		}



		.header_10 ul.megamenu > li {

			float: none;

			width: 100%;

		}



			.header_10 ul.megamenu > li > a {

				height: 42px;

				border-top: 1px solid #575757;

				padding: 11px 5px 7px 5px;

			}



				.header_10 ul.megamenu > li.with-sub-menu  > a:before {

					position: absolute;

				    top: 0;

				    bottom: 0;

				    right: 5px;

				    width: 30px;

				    height: 30px;

				    line-height: 30px;

				    margin: auto;

				    text-align: center;

				    content: "";

				    display: inline-block;

				    width: 0;

				    height: 0;

				    border-top: 4px solid transparent;

				    border-bottom: 4px solid transparent;

				    border-left: 5px solid #fff;

				    margin-left: 5px;

				    margin-right: 0;

				}



				.header_10 ul.megamenu > li:hover > a {

					color: #fff;

					background: #3b3b3b;

				}



				.header_10 ul.megamenu > li:first-child > a {

					border: none;

				}



				.header_10 ul.megamenu > li.with-sub-menu > a strong:after {

					display: none;

				}



				.header_10 .horizontal ul.megamenu > li > .sub-menu {

					max-width: 900px;

					left: 100%;

					right: auto;

					margin-top: -42px;

				}



				.header_10 ul.megamenu li .sub-menu .content {

					border-top: none;

					border-left: 5px solid #9ac93d;

					border-radius: 0px 5px 5px 0px;

					-webkit-border-radius: 0px 5px 5px 0px;

					-moz-border-radius: 0px 5px 5px 0px;

				}



				.header_10 ul.megamenu .megamenu-label {

					display: inline-block;

					position: relative;

					margin-left: 15px;

				}



					.header_10 ul.megamenu ul .megamenu-label {

						margin-left: 9px;

					}



					.header_10 ul.megamenu .megamenu-label span:before {

						transform:rotate(90deg);

						-webkit-transform:rotate(90deg);

						-moz-transform:rotate(90deg);

						-o-transform:rotate(90deg);

						margin-left: -7px;

						top: auto;

						margin-top: 2px;

						bottom: auto;

					}



						.header_10 ul.megamenu ul .megamenu-label span:before {

							margin-left: 0;

						}



	.header_10 .search-toggle {

		display: none;

	}



		@media (max-width: 991px) {

			.header_10 .search-toggle {

				display: block;

				color: #fff;

				position: absolute;

				top: 36px;

				left: 50px;

			}

		}



	.header_10 .search_form {

		padding: 20px 10px 0px 10px;

		position: relative;

	}



		.header_10 .search-query {

			display: block;

			width: 100%;

			border: 0;

			height: 38px;

			background-color: #fff;

			padding: 10px 15px;

			color: #999;

			font-family: Arial;

			width: 100%;

			margin: 0;

			font-size: 13px;

			line-height: 20px;

			border-radius: 5px;

		}



		.header_10 .button-search {

			background: none;

			border: none;

			position: absolute;

			top: 25px;

			right: 17px;

		}



	@media (max-width: 991px) {

		.header_10 .search_form {

			display: none;

		}

	}



	.header_10 .top-links {

		padding: 0px 10px;

		margin: 20px 0px 0px 0px;

		list-style: none;

		text-align: left;

	}



		@media (max-width: 991px) {

			.header_10 .top-links {

				display: none;

			}

		}



		.header_10 .top-links li {

			font-size: 11px;

			text-transform: uppercase;

			line-height: 19px;

			display: block;

			padding: 0;

			border: 0;

			padding: 10px 5px;

			border-top: 1px solid #575757;

		}



			.header_10 .top-links li:first-child {

				border: none;

			}



			.header_10 .top-links li a {

				color: #fff;

			}



				.header_10 .top-links li a:hover {

					text-decoration: underline;

				}



	.header_10 .custom-block {

		position: absolute;

		width: 100%;

		bottom: 0;

		left: 0;

		padding: 20px 10px;

	}



		.header_10 .social-icons a {

			background: url(../images/social-icons-sprite.png) 0 0 no-repeat;

			width: 30px;

			height: 30px;

			background-color: #000;

			display: inline-block;

			text-indent: -9999px;

			border-radius: 3px;

			-webkit-border-radius: 3px;

			-moz-border-radius: 3px;

			margin-left: 10px;

			line-height: 30px;

			background-color: #9e9e9e;

		    border-radius: 50%;

		}



			.header_10 .icon1-class:hover {

				background-color: #3c599b;

			}



			.header_10 .icon2-class:hover {

				background-color: #1ca8e3;

			}



			.header_10 .icon3-class:hover {

				background-color: #4b76b5;

			}



		.header_10 address {

			display: block;

			text-align: center;

			font-size: 12px;

			color: #777;

			margin-bottom: 0;

		}



		@media (max-width: 991px) {

			.header_10 .custom-block {

				display: none;

			}

		}



.body-header-type-10 .page-top {

	background: #fff;

}



	.body-header-type-10 .breadcrumb > li > a,

	.body-header-type-10 .breadcrumb > .active,

	.body-header-type-10 .breadcrumb > li + li:before {

		color: #000;

	}



	.body-header-type-10 #footer {

		background: #d7dae0;

		color: #828385;

	}



	.body-header-type-10 #footer a,

	.body-header-type-10 #footer a:hover {

		color: #828385;

	}



	.body-header-type-10 #footer .widget-title {

		color: #000000;

	}



	.body-header-type-10 #footer #footer-bottom {

		background: #e1e3e8;

		color: #777;

	}



.index10-slide-btn {

	display: inline-block;

	    font-size: 16px;

	    line-height: 20px;

	    padding: 9px 25px;

	    font-weight: normal;

	    color: #777 !important;

	    background-color: #fefefe;

	    border-radius: 5px;

}



.body-header-type-10 .container {

	max-width: 100%;

}



/* @end */



/* @group Header type 11 */



.body-header-type-11 .megamenu-wrapper {

	background: #fff;

	padding-bottom: 10px;

}



	.body-header-type-11 .fixed-header .megamenu-wrapper {

		padding-bottom: 0;

	}



	.header10 ul.megamenu {

		text-align: center;

	}



	.header10.fixed-header ul.megamenu {

		text-align: left;

	}



	.header10 ul.megamenu > li {

		display: inline-block !important;

		float: none !important;

		margin: 0px !important;

		margin-right: 3px !important;

		text-align: left;

	}



	.header10 ul.megamenu > li > a {

		color: #333;

		padding: 9px 14px;

		font-size: 0.8571em;

	    font-weight: bold;

	    line-height: 20px;

	    text-transform: uppercase;

	    border-radius: 5px;

	    -webkit-border-radius: 5px;

	    -moz-border-radius: 5px;

	    height: 38px;

	}



	.header10 ul.megamenu > li > a:hover,

	.header10 ul.megamenu > li.active > a,

	.header10 ul.megamenu > li.home > a,

	.header10 ul.megamenu > li:hover > a {

		color: #fff;

		background: #7aa93c;

	}



		.header10 ul.megamenu > li.with-sub-menu:hover > a {

			border-radius: 5px 5px 0px 0px;

			-webkit-border-radius: 5px 5px 0px 0px;

			-moz-border-radius: 5px 5px 0px 0px;

		}



		.header10 ul.megamenu .megamenu-label {

			right: 10px;

			top: -7px;

		}



			.header10.fixed-header ul.megamenu .megamenu-label {

				top: -1px;

			}



	.header10#header .currency-switcher li > ul,

	.header10#header .view-switcher li > ul {

		background: #f7f7f7;

	}



		.header10#header .currency-switcher li > ul li:hover a,

		.header10#header .view-switcher li > ul li:hover a {

			background: #fafafa;

		}



/* @end */



/* @group Header type 12 */



.header11 .megamenu-wrapper {

	background: #393f4f;

}



	.header11 ul.megamenu > li > a:hover,

	.header11 ul.megamenu > li.active > a,

	.header11 ul.megamenu > li.home > a,

	.header11 ul.megamenu > li:hover > a {

		color: #ee3d43;

	}



	.header11#header .currency-switcher li > ul,

	.header11#header .view-switcher li > ul {

		background: #ee3d43;

	}



		.header11#header .currency-switcher li ul li:hover a,

		.header11#header .view-switcher li ul li:hover a {

			background: #d92b34;

		}



.skin12 .banner,

.skin12 .banner img,

.skin12 .banner a:after {

	border-radius: 0 !important;

	-webkit-border-radius: 0 !important;

	-moz-border-radius: 0 !important;

}



/* @end */



/* @group Index 12 slider */



.index12-slider .col-sm-9 {

	width: 72.34%;

}



.index12-slider .camera_slider {

	margin-bottom: 0;

}



@media (max-width: 767px) {

	.index12-slider .camera_slider {

		margin-bottom: 10px;

	}

}



.index12-slider .col-sm-3 {

	width: 27%;

}



@media (max-width: 767px) {



	.index12-slider .col-sm-9 {

		width: 100%;

	}



	.index12-slider .col-sm-3 {

		width: 100%;

	}

}



/* @end */



/* @group Header type 13 */



.header12 .megamenu-wrapper {

	background: #54555e;

	border-bottom: 4px solid #3f4048;

	margin-bottom: 16px;

}



	.header12 ul.megamenu > li {

		margin: 0px 2px 0px 0px;

	}



		.header12 ul.megamenu .megamenu-label {

			top: -7px;

			right: 10px;

		}



		.header12.fixed-header ul.megamenu .megamenu-label {

			top: 0;

		}



		.header12 ul.megamenu > li.pull-right {

			margin: 0px 0px 0px 2px;

		}



		.header12 ul.megamenu > li > a {

			padding: 17px 20px;

			height: 54px;

		}



		.header12 ul.megamenu > li > a:hover,

		.header12 ul.megamenu > li.active > a,

		.header12 ul.megamenu > li.home > a,

		.header12 ul.megamenu > li:hover > a {

			background: #000;

			color: #fff;

			position: relative;

			margin-bottom: -4px;

			height: 58px;

			border-bottom: 4px solid #000;

		}



/* @end */



/* @group Skin13 */



.skin13 .mfilter-heading,

.skin13 .mfilter-content > ul > li,

.skin13 a.quickview-icon,

.skin13 .product-filter .options .button-group button,

.skin13 .nav-tabs > li > a,

.skin13 .product-list .btn-add-cart,

.skin13 .product-list .product-btn.btn-wishlist,

.skin13 .product-list .product-btn.btn-quickview,

.skin13 .product-info .thumbnails li img,

.skin13 .product-info .thumbnails-carousel img,

.skin13 .btn-default,

.skin13 .btn,

.skin13 .button,

.skin13 select,

.skin13 input,

.skin13 textarea,

.skin13 .product-info .product-image,

.skin13 .well,

.skin13 .box,

.skin13 .box .box-heading,

.skin13 table.attribute,

.skin13 table.list,

.skin13 .wishlist-product table,

.skin13 .wishlist-info table,

.skin13 .compare-info,

.skin13 .cart-info table,

.skin13 .checkout-product table,

.skin13 .table,

.skin13 .center-column .panel-heading,

.skin13 .quickcheckout-heading,

body.skin13 .quickcheckout-content,

.skin13 .mfilter-heading .mfilter-head-icon,

.skin13 .box .box-heading .toggle,

.skin13 ul.megamenu li .sub-menu .content,

.skin13 .popup,

.skin13 .banner, .skin13 .banner img, .skin13 .banner a:after,

.skin13 .posts .post .post-media,

.skin13 .posts .button-more,

.skin13 #header .currency-switcher li > ul,

.skin13 #header .view-switcher li > ul,

.skin13 #scroll-top,

.skin13 .product-center .single-add-to-wishlist a:before,

.skin13 .product-center .add-to-cart .quantity #q_up,

.skin13 .product-center .add-to-cart .quantity #q_down,

.skin13 .product-center .add-to-cart .quantity input,

.skin13 .alert,

.skin13 ul.product_list_widget li .product-image img,

.skin13 .widget ul.product_list_widget li .product-image img,

.skin13 ul.product_list_widget li .product-image,

.skin13 .widget ul.product_list_widget li .product-image,

.skin13 ul.megamenu li .sub-menu .content .hover-menu .menu ul ul,

.skin13 #mini-cart .mini-cart-info table td.image img,

.skin13 .product-image,

.skin13 .product-image img,

.skin13 .product-action .product-btn,

.skin13 .prev-next-products .product-nav .product-pop,

.skin13 .pagination > li > a,

.skin13 .pagination > li > span {

	border-radius: 0px !important;

	-webkit-border-radius: 0px !important;

	-moz-border-radius: 0px !important;

}



.skin13 #header .currency-switcher li > ul,

.skin13 #header .view-switcher li > ul {

	background: #fff;

}



	.skin13 #header .currency-switcher li > ul li:hover a,

	.skin13 #header .view-switcher li > ul li:hover a {

		color: #777 !important;

	}



.skin13 .page-top {

	background: none;

	margin: 0px;

}



	.skin13 .breadcrumb > li > a,

	.skin13 .breadcrumb > .active,

	.skin13 .breadcrumb > li + li:before {

		color: #777;

	}



/* @end */



/* @group Index3 */



.index13-slide-btn {

	display:inline-block;

	font-size:14px;

	line-height: 20px;

	padding:7.5px 25px;

	font-weight: 600;

	background-color: #fefefe !important;

	color: #777 !important;

}



	.index13-slide-btn:hover {

		background-color: rgba(250, 250, 250, 0.9);

		color:#000;

	}



/* @end */



/* @group Header type 14 */



.common-home.body-header-type-14 .main-content {

	padding-bottom: 0;

	min-height: 0px;

}



.common-home.body-header-type-14 #footer > .container {

	display: none;

}



.body-header-type-14 #footer #footer-bottom {

	background: #fff;

}



.body-header-type-14.common-home #header.header2 {

	position: relative;

	background: #fff;

}



#header.header13 .currency-switcher li > ul,

#header.header13 .view-switcher li > ul {

	min-width: 100px;

}



#header.header13 .currency-switcher li:hover > a,

#header.header13 .view-switcher li:hover > a {

	background: #fafafa !important;

}



.common-home .header13 ul.megamenu > li:first-child,

.header13 ul.megamenu > li:hover {

	background: #9ac93d;

}



.header13 ul.megamenu > li > a {

	color: #9ac93d;

}



	.common-home .header13 ul.megamenu > li:first-child > a,

	.header13 ul.megamenu > li:hover > a {

		color: #fff;

	}



		.header13 ul.megamenu > li.with-sub-menu:hover {

			border-radius: 5px 5px 0px 0px;

			-webkit-border-radius: 5px 5px 0px 0px;

			-moz-border-radius: 5px 5px 0px 0px;

		}



.header13 .megamenu-wrapper {

	background: #fff;

}



	.common-home .header13.fixed-header ul.megamenu > li:first-child,

	.header13.fixed-header ul.megamenu > li:hover {

		background: none;

	}



	.common-home .header13.fixed-header ul.megamenu > li:first-child > a,

	.header13.fixed-header ul.megamenu > li:hover > a {

		color: #9ac93d;

	}



/* @end */



.btn-dark {

 	background: #333;

}



.btn-white {

	background-color: #fff;

	color: #333;

}



/* @group Header type 15 */



.body-header-type-15 .container-megamenu {

	margin-bottom: 15px;

}



.body-header-type-15 .megamenu-wrapper {

	background: none;

}



.body-header-type-15 ul.megamenu:before,

.body-header-type-15 ul.megamenu:after{

  display: table;

  content: " ";

}

.body-header-type-15 ul.megamenu:after {

  clear: both;

}



.body-header-type-15 ul.megamenu {

	background: #f0f0ed;

	border-radius: 6px;

	-webkit-border-radius: 6px;

	-moz-border-radius: 6px;

}



.body-header-type-15 ul.megamenu > li {

	margin: 0px 2px 0px 0px;

}



.body-header-type-15 ul.megamenu > li.pull-right {

	margin: 0px 0px 0px 2px;

}



.body-header-type-15 ul.megamenu > li > a {

	height: 40px;

	padding: 11px 13px 9px 13px;

	color: #9ac93d;

}



	.body-header-type-15 ul.megamenu > li.home > a,

	.body-header-type-15 ul.megamenu > li:hover > a {

		background: #9ac93d;

		border-radius: 6px;

		-webkit-border-radius: 6px;

		-moz-border-radius: 6px;

		color: #fff;

	}



	.body-header-type-15 ul.megamenu > li:hover > a{

		border-radius: 6px 6px 0 0;

		-webkit-border-radius: 6px 6px 0 0;

		-moz-border-radius: 6px 6px 0 0;

	}



.body-header-type-15 ul.megamenu .megamenu-label {

	top: -4px;

	right: 13px;

}



	.body-header-type-15 .fixed-header ul.megamenu .megamenu-label {

		top: 0;

	}



.body-header-type-15 #header.header3 ul.megamenu .menu {

	background: none;

}



.tp-caption .index15-slide-btn {

	display:inline-block;

	font-size:16px;

	line-height: 30px;

	padding:8px 20px;

	font-weight: 600;

	color:#fff;

	background-color: #08c;

	border-radius: 7px;

	opacity:1;

	min-width: 170px;

	text-transform: uppercase;

	text-align: center;

}



.tp-caption .index15-slide-btn:hover {

	opacity:0.9;

	color:#fff;

}



.body-header-type-15 .overflow-menu {

	position: relative;

	display: block !important;

}



	.body-header-type-15 .overflow-menu .container {

		padding: 0px !important;

		width: auto !important;

		display: block !important;

	}



	.body-header-type-15 .overflow-menu #mini-cart {

		position: absolute;

		top: 0;

		right: 0;

		margin: 0px;

		height: 40px;

		z-index: 1000;

		background: #08c !important;

		padding: 7px 0;

	}



		.body-header-type-15 .overflow-menu #mini-cart .minicart-icon {

			color: #fff !important;

		}



		.body-header-type-15 .overflow-menu #mini-cart .cart-head {

			text-transform: uppercase;

			color: #fff;

			font-size: 12px;

		}



	@media (max-width: 991px) {

		.body-header-type-15 .overflow-menu #mini-cart {

			top: -70px;

		}

	}



	@media (max-width: 767px) {

		.body-header-type-15 .overflow-menu #mini-cart {

			top: -60px !important;

		}

	}



	@media (max-width: 480px) {

		.body-header-type-15 #header.header3 #mini-cart .cart-items {

			color: #fff;

		}

	}



/* @end */



/* @group Header type 16 */



.header15 .megamenu-wrapper {

	background: none;

}



	.header15.fixed-header .megamenu-wrapper {

		background: #f3f5f4;

	}



.header15 ul.megamenu > li > a {

	color: #796848;

}



.header15 ul.megamenu > li > a:hover,

.header15 ul.megamenu > li.active > a,

.header15 ul.megamenu > li.home > a,

.header15 ul.megamenu > li:hover > a {

	color: #39333f;

}



.skin16 .mfilter-heading,

.skin16 .mfilter-content > ul > li,

.skin16 a.quickview-icon,

.skin16 .product-filter .options .button-group button,

.skin16 .nav-tabs > li > a,

.skin16 .product-list .btn-add-cart,

.skin16 .product-list .product-btn.btn-wishlist,

.skin16 .product-list .product-btn.btn-quickview,

.skin16 .product-info .thumbnails li img,

.skin16 .product-info .thumbnails-carousel img,

.skin16 .btn-default,

.skin16 .btn,

.skin16 .button,

.skin16 select,

.skin16 input,

.skin16 textarea,

.skin16 .product-info .product-image,

.skin16 .well,

.skin16 .box,

.skin16 .box .box-heading,

.skin16 table.attribute,

.skin16 table.list,

.skin16 .wishlist-product table,

.skin16 .wishlist-info table,

.skin16 .compare-info,

.skin16 .cart-info table,

.skin16 .checkout-product table,

.skin16 .table,

.skin16 .center-column .panel-heading,

.skin16 .quickcheckout-heading,

body.skin16 .quickcheckout-content,

.skin16 .mfilter-heading .mfilter-head-icon,

.skin16 .box .box-heading .toggle,

.skin16 ul.megamenu li .sub-menu .content,

.skin16 .popup,

.skin16 .banner, .skin16 .banner img, .skin16 .banner a:after,

.skin16 .posts .post .post-media,

.skin16 .posts .button-more,

.skin16 #header .currency-switcher li > ul,

.skin16 #header .view-switcher li > ul,

.skin16 #scroll-top,

.skin16 .product-center .single-add-to-wishlist a:before,

.skin16 .product-center .add-to-cart .quantity #q_up,

.skin16 .product-center .add-to-cart .quantity #q_down,

.skin16 .product-center .add-to-cart .quantity input,

.skin16 .alert,

.skin16 ul.product_list_widget li .product-image img,

.skin16 .widget ul.product_list_widget li .product-image img,

.skin16 ul.product_list_widget li .product-image,

.skin16 .widget ul.product_list_widget li .product-image,

.skin16 ul.megamenu li .sub-menu .content .hover-menu .menu ul ul,

.skin16 #mini-cart .mini-cart-info table td.image img,

.skin16 .product-image,

.skin16 .product-image img,

.skin16 .product-action .product-btn,

.skin16 .prev-next-products .product-nav .product-pop,

.skin16 .post .tags a,

.skin16 .pagination > li > a,

.skin16 .pagination > li > span {

	border-radius: 0px !important;

	-webkit-border-radius: 0px !important;

	-moz-border-radius: 0px !important;

}



.skin16 .main-content {

	padding-bottom: 25px;

}



.skin16.common-home .main-content {

	padding-bottom: 0;

}



.skin16 .footer-wrapper {

	background: #e7e8e9;

	padding: 45px 30px 10px 30px;

}



@media (max-width: 767px) {

	.skin16 .footer-wrapper {

		padding-left: 20px;

		padding-right: 20px;

		padding-top: 30px;

		padding-bottom: 0;

	}

}



/* @end */



/* @group Slider 16 */



.slider16 .rev-subtitle {

    font-size: 18px;

    color: #666;

    text-align: left;

    margin: 0;

    font-family: Georgia,  sans-serif !important;

}



.slider16 .rev-title {

	font-size: 44px;

	color: #141414;

	margin: 0;

	font-family: Georgia,  sans-serif !important;

}



.slider16 .rev-hr {

	display: inline-block;

	width: 50%;

	border-top: 1px solid #151515;

	background: none;

	margin: 8px 0;

	text-align: right;

}



.slider16 .rev-link {

	display: block;

	text-align: right;

}



	.slider16 .rev-link a {

		display: inline-block;

		font-size: 16px;

		font-weight: 700;

		text-transform: uppercase;

		color: #2b262f;

		font-family: Georgia !important;

	}



/* @end */



/* @group Header type 17 */



.fixed-header17 .megamenu-wrapper {

	background: #5c616e;

}



	.fixed-header17 ul.megamenu > li > a:hover,

	.fixed-header17 ul.megamenu > li.active > a,

	.fixed-header17 ul.megamenu > li.home > a,

	.fixed-header17 ul.megamenu > li:hover > a {

		color: #fff;

	}



.header17 {

	background: #5c616e !important;

}



	.header17 > .container {

		position: relative;

	}



		.common-home .header17 > .container {

			width: auto;

			padding-left: 45px;

			padding-right: 30px;

			border-bottom: 1px solid rgba(255,255,255,.25);

		}



			@media (max-width: 991px) {

				.common-home .header17 > .container {

					padding-left: 15px;

					padding-right: 15px;

				}

			}



	.common-home .header17 {

		background: none !important;

		position: absolute !important;

		top: 0;

		left: 0;

		right: 0;

		z-index: 99;

	}



		.header17 .logo {

			padding-top: 27px;

			padding-bottom: 27px;

			display: block;

			margin: 0px !important;

			float: left;

		}



			.header17 .logo img {

				position: relative;

			}



	.header17 .left {

		float: left;

		padding-left: 24px;

		padding-top: 36px;

		padding-bottom: 36px;

	}



		@media (max-width: 991px) {

			.header17 .left {

				padding-top: 38px;

			}

		}



	.header17 .megamenu-wrapper {

		background: none;

	}



	.header17 ul.megamenu,

	.header17 .container-megamenu,

	.header17 .container-megamenu .container,

	.header17 .megamenu-wrapper {

		position: static;

	}



	.header17 ul.megamenu > li {

		margin: 0px 0px 0px 0px;

	}



	.header17 ul.megamenu > li > a {

		height: 32px;

		padding: 7px 11px 0px 11px;

		border-radius: 6px;

		-webkit-border-radius: 6px;

		-moz-border-radius: 6px;

	}



		.header17 ul.megamenu > li > a:hover,

		.header17 ul.megamenu > li.active > a,

		.header17 ul.megamenu > li.home > a,

		.header17 ul.megamenu > li:hover > a {

			color: #fff;

		}



			.header17 ul.megamenu .megamenu-label {

				top: -5px;

			}



			.header17#header .mobile-toggle {

				left: 5px;

				top: -3px;

			}



	.header17 .container > div > .right {

		float: right;

		padding-top: 37px;

		padding-bottom: 35px;

	}



		.header17 #mini-cart.minicart-inline {

			background: #fff !important;

			top: 0 !important;

			right: 0 !important;

		}



		.header17 #mini-cart.minicart-inline .cart-items {

			color: #101010 !important;

		}



		.header17 #mini-cart .minicart-icon {

			color: #101010;

		}



		.header17 .separator {

			display: none;

		}



		.header17#header .currency-switcher > li > a,

		.header17#header .view-switcher > li > a {

			background: #fff;

			border-radius: 6px;

			-webkit-border-radius: 6px;

			-moz-border-radius: 6px;

			color: #101010;

			margin-top: -1px;

			margin-right: 0;

			margin-left: 0;

		}



			.header17#header .currency-switcher > li:hover > a,

			.header17#header .view-switcher > li:hover > a  {

				border-radius: 6px 6px 0 0;

				-webkit-border-radius: 6px 6px 0 0;

				-moz-border-radius: 6px 6px 0 0;

				background: #fff !important;

			}



			.header17#header .currency-switcher li > ul,

			.header17#header .view-switcher li > ul {

				min-width: 120px;

				text-align: left;

				background: #fff !important;

			}



				.header17#header .currency-switcher li > ul a,

				.header17#header .view-switcher li > ul a {

					color: #101010;

					background: none !important;

				}



					.header17#header .currency-switcher li > ul a:hover,

					.header17#header .view-switcher li > ul a:hover {

						background: #fafafa !important;

					}



		.header17#header .currency-switcher,

		.header17#header .view-switcher {

			margin-left: 6px;

		}



		@media (max-width: 991px) {

			.header17#header .currency-switcher,

			.header17#header .view-switcher {

				display: none;

			}

		}



		#header.header17 .searchform-popup .search-toggle {

			display: block;

		}



		@media (max-width: 480px) {

			#header.header17 .mobile-toggle {

				position: static;

			}



			#header.header17 .searchform-popup {

				position: relative;

				top: auto;

				left: auto;

				right: auto !important;

				bottom: auto;

			}



			#header.header17 #mini-cart {

				position: relative;

			}

		}



.skin17 .banner,

.skin17 .banner img,

.skin17 .banner a:after {

	border-radius: 0 !important;

	-webkit-border-radius: 0 !important;

	-moz-border-radius: 0 !important;

}



.skin17.common-home .product-action {

	display: none;

}



.skin17 .slider-title .line {

	display: none;

}



.skin17 .carousel-wrapper .owl-controls {

	display: none;

}



.slide17-btn {

	display: inline-block;

	font-size: 16px;

	line-height: 23px;

	font-weight: 600;

	padding: 9.5px 33.5px;

	font-weight: 600;

	color: #333 !important;

	background-color: #fefefe;

	border-radius: 5px;

}



	.slide17-btn:hover {

		background: rgba(255, 255, 255, .9);

	}



.slide17-link {

	color: #fff !important;

	font-size: 16px;

	line-height: 1;

}



	.slide17-link:hover {

		text-decoration: underline !important;

	}



/* @end */



/* @group Skin17 */



.skin17-2 .mfilter-heading,

.skin17-2 .mfilter-content > ul > li,

.skin17-2 a.quickview-icon,

.skin17-2 .product-filter .options .button-group button,

.skin17-2 .nav-tabs > li > a,

.skin17-2 .product-list .btn-add-cart,

.skin17-2 .product-list .product-btn.btn-wishlist,

.skin17-2 .product-list .product-btn.btn-quickview,

.skin17-2 .product-info .thumbnails li img,

.skin17-2 .product-info .thumbnails-carousel img,

.skin17-2 .btn-default,

.skin17-2 .btn,

.skin17-2 .button,

.skin17-2 select,

.skin17-2 input,

.skin17-2 textarea,

.skin17-2 .product-info .product-image,

.skin17-2 .well,

.skin17-2 .box,

.skin17-2 .box .box-heading,

.skin17-2 table.attribute,

.skin17-2 table.list,

.skin17-2 .wishlist-product table,

.skin17-2 .wishlist-info table,

.skin17-2 .compare-info,

.skin17-2 .cart-info table,

.skin17-2 .checkout-product table,

.skin17-2 .table,

.skin17-2 .center-column .panel-heading,

.skin17-2 .quickcheckout-heading,

body.skin17-2 .quickcheckout-content,

.skin17-2 .mfilter-heading .mfilter-head-icon,

.skin17-2 .box .box-heading .toggle,

.skin17-2 ul.megamenu li .sub-menu .content,

.skin17-2 .popup,

.skin17-2 .banner, .skin17-2 .banner img, .skin17-2 .banner a:after,

.skin17-2 .posts .post .post-media,

.skin17-2 .posts .button-more,

.skin17-2 #header .currency-switcher li > ul,

.skin17-2 #header .view-switcher li > ul,

.skin17-2 #scroll-top,

.skin17-2 .product-center .single-add-to-wishlist a:before,

.skin17-2 .product-center .add-to-cart .quantity #q_up,

.skin17-2 .product-center .add-to-cart .quantity #q_down,

.skin17-2 .product-center .add-to-cart .quantity input,

.skin17-2 .alert,

.skin17-2 ul.product_list_widget li .product-image img,

.skin17-2 .widget ul.product_list_widget li .product-image img,

.skin17-2 ul.product_list_widget li .product-image,

.skin17-2 .widget ul.product_list_widget li .product-image,

.skin17-2 ul.megamenu li .sub-menu .content .hover-menu .menu ul ul,

.skin17-2 #mini-cart .mini-cart-info table td.image img,

.skin17-2 .prev-next-products .product-nav .product-pop,

.skin17-2 .product-image,

.skin17-2 .product-image img,

.skin17-2 .product-action .product-btn,

.skin17-2 .prev-next-products .product-nav .product-pop,

.skin17-2 .post .tags a,

.skin17-2 .pagination > li > a,

.skin17-2 .pagination > li > span {

	border-radius: 0px !important;

	-webkit-border-radius: 0px !important;

	-moz-border-radius: 0px !important;

}



.header18#header #header-top {

	background: #f9f7f7;

	z-index: 1000;

}



.header18#header {

	background: #f9f9f9;

}



.common-home .header18#header {

	position: absolute;

	z-index: 99;

	left: 0;

	right: 0;

	background: rgba(249,249,249, 0.75);

}



	@media (max-width: 991px) {

		.common-home .header18#header {

			position: relative;

			background: #f9f9f9;

		}

	}



.header18#header #header-inner .container .header-left {

	text-align: center;

	display: block;

	padding: 0px;

}



	.header18#header #header-inner .container .header-left h1 {

		position: absolute;

		left: 40%;

		right: 40%;

		padding: 32px 0px;

		z-index: 1000;

	}



.header18#header #header-inner .container {

	min-height: 0;

}



.header18 .megamenu-wrapper {

	background: none;

	padding: 34px 0px;

}



.header18.fixed-header .megamenu-wrapper {

	background: #f9f9f9;

	padding: 0px;

}



.header18 ul.megamenu > li > a {

	color: #2c3232;

}



	.header18 ul.megamenu > li > a:hover,

	.header18 ul.megamenu > li.active > a,

	.header18 ul.megamenu > li.home > a,

	.header18 ul.megamenu > li:hover > a {

		color: #b74173;

	}



.header18 ul.megamenu > li {

	margin-right: 35px;

}



.header18 ul.megamenu > li.pull-right {

	margin-left: 35px;

}



#header.header18 .currency-switcher a,

.header18#header .view-switcher a,

.header18#header .top-links a,

.header18#header {

	color: #777;

}



.header18#header .currency-switcher li > ul,

.header18#header .view-switcher li > ul {

	background: #b74173;

}



	.header18#header .currency-switcher li > ul a,

	.header18#header .view-switcher li > ul a {

		color: #fff;

	}



#header.header18 #header-top .currency-switcher > li:hover > a,

#header.header18 #header-top .view-switcher > li:hover > a {

	background: #b74173;

}



#header.header18 .currency-switcher li ul li:hover a,

#header.header18 .view-switcher li ul li:hover a {

	background: #ce5691;

}



.header18#header .searchform-popup .search-toggle {

	color: #777;

	display: block;

	width: auto;

}



.header18#header .searchform-popup {

	padding-top: 3px;

	height: 30px;

	vertical-align: top;

	padding-right: 4px;

}



.header18 #mini-cart.minicart-inline {

	background: none !important;

}



.header18 #mini-cart.minicart-inline .cart-head {

	padding: 0px;

}



.header18 #mini-cart .minicart-icon,

.header18 #mini-cart.minicart-inline .cart-items {

	color: #b74173;

	font-size: 11px;

	text-transform: uppercase;

}



.header18 #mini-cart.minicart-inline .dropdown-menu {

	border-color: #b74173;

	border-radius: 0;

	-webkit-border-radius: 0;

	-moz-border-radius: 0;

}



.header18 #mini-cart .dropdown-cart-content {

	border-radius: 0;

	-webkit-border-radius: 0;

	-moz-border-radius: 0;

}



.header18 #mini-cart.dropdown.minicart-inline .dropdown-menu:before {

	border-bottom-color: #b74173;

}



@media (max-width: 991px) {

	.header18#header #header-inner .container .header-left h1 {

		position: relative;

		left: auto;

		right: auto;

		z-index: 1;

	}



	.header18#header .mobile-toggle {

		color: #b74173;

		padding-top: 2px;

		vertical-align: top;

		font-size: 14px;

		padding-right: 5px;

		position: relative !important;

		left: auto !important;

		top: auto !important;

		right: auto !important;

		bottom: auto !important;

	}



	.header18#header .searchform-popup {

		padding-top: 2px;

		position: relative !important;

		left: auto !important;

		top: auto !important;

		right: auto !important;

		bottom: auto !important;

	}



	.header18 .overflow-currency-language {

		display: none !important;

	}



	.header18#header #header-inner .container .header-left h1 {

		padding: 15px 0px 30px 0px;

		margin: 0px!important;

	}



	.header18#header #header-top {

		margin: 0px -7px;

	}

}



.header18 .overflow-currency-language {

	display: inline-block;

}



@media (max-width: 480px) {

	.header18#header #mini-cart .cart-items {

		color: #777;

	}



	.header18#header #mini-cart {

		position: relative !important;

		left: auto !important;

		top: 1px !important;

		right: auto !important;

		bottom: auto !important;

	}



	.header18#header #header-inner .container {

		padding: 0px;

	}

}



.skin17-2 #footer #footer-bottom {

	background: none;

}



.skin17-2 #footer {

	  background: url(../../../../../image/catalog/magic/bg.jpg) bottom  repeat-x;

	color: #fff;

}





.skin17-2 #footer a,

.skin17-2 #footer a:hover {

	color: #fff;

}





.skin17-2 #footer .newsletter-widget .input-box input[type="text"],

.skin17-2 .newsletter-widget .input-box  input[type="email"] {

	background: none;

	max-width: none;

}



.skin17-2 .newsletter-widget input[type="submit"] {

	background: none !important;

	border: 1px solid #ccc !important;

	color: #777;

}



.skin17-2 #footer .info-boxes-container {

	background: none;

	border: none;

	padding: 0px;

	margin: 0px -10px;

}



.skin17-2 #footer .info-box-container {

	border-color: #515656;

	color: #fff;

}



.skin17-2 #footer  .info-box-icon {

	color: #fff;

}



.skin17-2 #footer  .info-box-content .info-box-title {

	color: #fff;

}



@media (max-width: 767px) {

	.skin17-2 #footer .info-box {

		text-align: left;

	}



	.skin17-2 #footer .info-boxes-container {

		margin: 0px -5px;

	}



}



.skin17-2 .product-grid > .row > div .product-action {

	position: absolute;

	left: 0;

	right: 0;

	text-align: center;

	opacity: 0;

	transition: all 0.2s ease-in;

	-webkit-transition: all 0.2s ease-in;

	-moz-transition: all 0.2s ease-in;

}



	.skin17-2 .product-grid > .row > div:hover .product-action {

		opacity: 1;

	}



	.skin17-2 .product-grid > .row > div .product-action .product-btn.btn-wishlist {

		margin: 0;

		background-color: #e6e6e6;

		color: #000;

		border: 0;

		font-size: 13px;

		right: -4px;

		visibility: visible;

		opacity: 1;

		filter: alpha(opacity=100);

		width: 40px;

		height: 40px;

		line-height: 40px;

		transform: none;

		-webkit-transform: none;

		-moz-transform: none;

		border-radius: 0;

		-webkit-border-radius: 0;

		-moz-border-radius: 0;

	}



	.skin17-2 .product-grid > .row > div .product-action .product-btn.btn-quickview {

		margin: 0;

		background-color: #e6e6e6;

		color: #000;

		border: 0;

		font-size: 13px;

		left: -4px;

		visibility: visible;

		opacity: 1;

		filter: alpha(opacity=100);

		width: 40px;

		height: 40px;

		line-height: 40px;

		transform: none;

		-webkit-transform: none;

		-moz-transform: none;

		border-radius: 0;

		-webkit-border-radius: 0;

		-moz-border-radius: 0;

	}



	.skin17-2 .product-grid > .row > div .product-action .product-btn.btn-add-cart {

		height: 40px;

		border: none;

		border-radius: 0px;

		-webkit-border-radius: 0px;

		-moz-border-radius: 0px;

		margin: 0px;

		background: #9ac93d;

		color: #fff;

		vertical-align: top;

		padding: 0 20px 0 15px;

		font-size: 13px;

		line-height: 40px;

		text-transform: uppercase;

		font-weight: 600;

	}



		@media (max-width: 991px) {

			.skin17-2 .product-grid > .row > div .product-action .product-btn.btn-add-cart {

				width: 40px;

				text-align: center;

				padding: 0px 13px;

			}



			.skin17-2 .product-grid > .row > div .product-action .product-btn.btn-add-cart.button-enquiry {

				display: none;

			}



			.skin17-2 .product-grid > .row > div .product-action .product-btn.btn-add-cart span {

				display: none;

			}

		}



.skin17-2 .product-grid > .row > div {

	border-right: 1px solid #e3e4e4;

	border-top: 1px solid transparent;

	border-bottom: 1px solid transparent;

	position: relative;

	margin-top: -1px;

	transition: all 0.2s ease-in;

	-webkit-transition: all 0.2s ease-in;

	-moz-transition: all 0.2s ease-in;

	padding-bottom: 0 !important;

}



	.skin17-2 .product-grid > .row > div:hover {

		border-top: 1px solid #e3e4e4;

		border-bottom: 1px solid #e3e4e4;

		box-shadow:0 0 40px rgba(0,0,0,0.1);

		-webkit-box-shadow:0 0 40px rgba(0,0,0,0.1);

		-moz-box-shadow:0 0 40px rgba(0,0,0,0.1);

	}



	.skin17-2 .product-grid > .row > div:last-child {

		border-right: none;

	}



.skin17-2 .product-grid .product {

	padding-bottom: 30px !important;

	padding-top: 50px;

	border-top: 1px solid #e3e4e4;

	margin-top: -1px;

	transition: all 0.2s ease-in;

	-webkit-transition: all 0.2s ease-in;

	-moz-transition: all 0.2s ease-in;

}



	.skin17-2 .product-grid > .row > div:hover .product {

		padding-top: 10px;

		padding-bottom: 70px !important;

	}



	.skin17-2 .product-grid .row:first-child .product {

		border-top: none;

	}



	@media (max-width: 767px) {

		.skin17-2 .product-grid .row > div:nth-child(odd) {

			clear: both;

		}

		.skin17-2 .product-grid .row:first-child .product {

			border-top: 1px solid #e3e4e4;

		}

		.skin17-2 .product-grid .row:first-child > div:first-child .product,

		.skin17-2 .product-grid .row:first-child > div:nth-child(2) .product {

			border-top: none;

		}



		.skin17-2 .product-grid .row > div:nth-child(2n) {

			border-right: none;

		}

	}



#mfilter-content-container .product-grid {

	padding-bottom: 0px;

}



.skin17-2 #mfilter-content-container .product-grid {

	padding-bottom: 30px;

}



.skin17-2 .product-grid .product .product-image {

	border: none;

	padding: 0px;

	-webkit-border-radius: 0;

	-moz-border-radius: 0;

	border-radius: 0;

}



	.skin17-2 .product-grid .product .product-image img,

	.skin17-2 .product-grid .product .onhot,

	.skin17-2 .product-grid .product .onsale,

	.skin17-2 .product-image,

	.skin17-2 .product-image img {

		-webkit-border-radius: 0;

		-moz-border-radius: 0;

		border-radius: 0;

	}

/*

.skin17-2.common-home .slider-title {

	display: none;

}   */



.skin17-2 .carousel-wrapper > div {

	margin-bottom: -3px !important;

}



.skin17-2.common-home .main-content {

	padding-bottom: 0;

}



.skin17-brands > div {

	padding-top: 10px;

	border-right: 1px solid #e3e3e3;

	text-align: center;

}



	.skin17-brands > div:last-child {

		border-right: none;

	}



	@media (max-width: 767px) {

		.skin17-brands > div:nth-last-child(2),

		.skin17-brands > div:last-child {

			border-top: 1px solid #e3e3e3;

		}

	}



.skin17-button {

	color: #fff !important;

	background: #b74173;

	font-size: 15px;

	font-weight: 600;

	text-transform: uppercase;

	display: block;

	padding: 10px 35px 10px 35px;

}



/* @end */



@media (max-width: 767px) {

	.tp-caption.rev-subtitle.subtitle2 {

		font-size: 17px;

		line-height: 1.3;

	}

}



@media (max-width: 480px) {

	.tp-caption.rev-subtitle.subtitle2 {

		font-size: 12px;

		line-height: 1.3;

	}

}



@media (max-width: 767px) {

	.tp-caption.index3_text_1 {

		font-size: 15px !important;

		line-height: 1.3 !important;

	}

}



@media (max-width: 480px) {

	.tp-caption.index3_text_1 {

		font-size: 10px !important;

		line-height: 1.3 !important;

	}

}



/* @group Header type 19 */



.skin18 .mfilter-heading,

.skin18 .mfilter-content > ul > li,

.skin18 a.quickview-icon,

.skin18 .product-filter .options .button-group button,

.skin18 .nav-tabs > li > a,

.skin18 .product-list .btn-add-cart,

.skin18 .product-list .product-btn.btn-wishlist,

.skin18 .product-list .product-btn.btn-quickview,

.skin18 .product-info .thumbnails li img,

.skin18 .product-info .thumbnails-carousel img,

.skin18 .btn-default,

.skin18 .btn,

.skin18 .button,

.skin18 select,

.skin18 input,

.skin18 textarea,

.skin18 .product-info .product-image,

.skin18 .well,

.skin18 .box,

.skin18 .box .box-heading,

.skin18 table.attribute,

.skin18 table.list,

.skin18 .wishlist-product table,

.skin18 .wishlist-info table,

.skin18 .compare-info,

.skin18 .cart-info table,

.skin18 .checkout-product table,

.skin18 .table,

.skin18 .center-column .panel-heading,

.skin18 .quickcheckout-heading,

body.skin18 .quickcheckout-content,

.skin18 .mfilter-heading .mfilter-head-icon,

.skin18 .box .box-heading .toggle,

.skin18 ul.megamenu li .sub-menu .content,

.skin18 .popup,

.skin18 .banner, .skin18 .banner img, .skin18 .banner a:after,

.skin18 .posts .post .post-media,

.skin18 .posts .button-more,

.skin18 #header .currency-switcher li > ul,

.skin18 #header .view-switcher li > ul,

.skin18 #scroll-top,

.skin18 .product-center .single-add-to-wishlist a:before,

.skin18 .product-center .add-to-cart .quantity #q_up,

.skin18 .product-center .add-to-cart .quantity #q_down,

.skin18 .product-center .add-to-cart .quantity input,

.skin18 .alert,

.skin18 ul.product_list_widget li .product-image img,

.skin18 .widget ul.product_list_widget li .product-image img,

.skin18 ul.product_list_widget li .product-image,

.skin18 .widget ul.product_list_widget li .product-image,

.skin18 ul.megamenu li .sub-menu .content .hover-menu .menu ul ul,

.skin18 #mini-cart .mini-cart-info table td.image img,

.skin18 .prev-next-products .product-nav .product-pop,

.skin18 .product-image,

.skin18 .product-image img,

.skin18 .product-action .product-btn,

.skin18 .prev-next-products .product-nav .product-pop,

.skin18 .post .tags a,

.skin18 #mini-cart.dropdown .dropdown-menu,

.skin18 #mini-cart .dropdown-cart-content,

.skin18 .product-image .onhot,

.skin18 .product-image .onsale,

.skin18 .pagination > li > a,

.skin18 .pagination > li > span {

	border-radius: 0px !important;

	-webkit-border-radius: 0px !important;

	-moz-border-radius: 0px !important;

}



#header.header19 {

	position: relative;

	z-index: 999;

	background: #fff;

}



	.common-home #header.header19 {

		background: none;

		position: absolute;

		left: 0;

		right: 0;

	}



.header19 ul.megamenu,

.header19 .container-megamenu .container,

.header19 .container-megamenu,

.header19 .megamenu-wrapper {

	position: static !important;

}



.header19 .horizontal {

	display: inline-block;

	vertical-align: middle;

	text-align: left;

}



	@media (max-width: 991px) {

		.header19 .horizontal {

			display: none;

		}

	}



	.header19.fixed-header .horizontal {

		display: block;

		float: right;

	}



		.header19.fixed-header .horizontal ul.megamenu {

			position: static !important;

		}



	.header19 .megamenu-wrapper {

		background: none;

	}



	.header19 ul.megamenu > li {

		margin: 0px 4px 0px 0px;

	}



	.header19 ul.megamenu > li > a {

		color: #3d3734;

		height: 30px;

		padding: 6px 15px 6px;

	}



	.header19 ul.megamenu > li > a:hover,

	.header19 ul.megamenu > li.active > a,

	.header19 ul.megamenu > li.home > a,

	.header19 ul.megamenu > li:hover > a {

		background: #3d3734;

		color: #fff;

	}



	.header19 ul.megamenu .megamenu-label {

		top: -6px;

		right: 15px;

	}



		.header19 ul.megamenu ul .megamenu-label {

			right: auto;

		}



#header.header19 .searchform {

	display: none;

}



#header.header19 .searchform-popup .search-toggle {

	display: inline-block;

	color: #ea6a4a;

}



#header.header19 .searchform-popup {

    display: inline-block;

    vertical-align: middle;

}



.header19#header #header-top {

	background: #3d3734;

}



.header19#header #header-top .currency-switcher > li > a,

.header19#header #header-top .view-switcher > li > a {

	background: none !important;

}



.header19#header .header-right {

	position: static !important;

}



.skin18 .product-image {

	padding: 0px;

	border: none;

	background: none;

}



.skin18 .popup-gallery .product-image {

	padding: 2px;

	border: 1px solid #ddd;

	background: #fff;

}



.skin18 #footer #footer-bottom {

	background: #f1f1f1;

	border-top: 1px solid #dddbdd;

	position: relative;

}



	.skin18 #footer #footer-bottom:before {

		content: '';

		position: absolute;

		top: 0;

		left: 0;

		right: 0;

		height: 1px;

		background: #ecebec;

	}



.skin18 #footer {

	background: #fbfbfb;

	color: #777777;

}



.skin18 #footer .widget-title {

	color: #000;

}



.skin18 #footer a,

.skin18 #footer a:hover {

	color: #777777;

}



.skin18 #footer .widget .links li > i,

.skin18 .widget.contact-info li i {

	color: #777777 !important;

}



.skin18 #footer .newsletter-widget .input-box input[type="text"],

.skin18 .newsletter-widget .input-box  input[type="email"] {

	background: none;

	max-width: none;

}



.skin18 .newsletter-widget input[type="submit"] {

	background: none !important;

	border: 1px solid #ccc !important;

	color: #777;

}



.skin18 .btn-add-cart {

	background: #fff;

}



.header19 #mini-cart.minicart-inline .cart-head {

	padding: 0px;

	min-width: 1px !important;

}



	body #wrapper .header19 #mini-cart.minicart-inline {

		background: none !important;

	}



.header19 #mini-cart.minicart-inline .cart-items {

	color: #ea6a4a;

	text-transform: uppercase;

}



.header19 #mini-cart .minicart-icon {

	color: #ea6a4a;

}



.header19#header .mobile-toggle {

	color: #ea6a4a;

	vertical-align: top;

	padding-top: 1px;

}



@media (max-width: 480px) {

	.header19#header .mobile-toggle {

		left: 7px;

	}



	.header19#header .searchform-popup {

		left: 36px;

		top: 7px;

	}



	.header19#header #mini-cart .cart-head {

		padding: 0px;

	}



	.header19#header #mini-cart .cart-items {

		color: #ea6a4a;

	}

}



.header19#header #header-inner .container .header-left,

.header19#header #header-inner .container .header-right {

	padding: 26px 0px;

}



.header19.fixed-header {

	background: #fff;

	padding: 6px 0px;

	box-shadow: 0 1px 2px rgba(0,0,0,0.1);

	-webkit-box-shadow: 0 1px 2px rgba(0,0,0,0.1);

	-moz-box-shadow: 0 1px 2px rgba(0,0,0,0.1);

}



.skin18 .main-content {

	min-height: 0px;

}



.skin18.common-home .product-action {

	display: none;

}



.skin18 .home-products-carousel .owl-controls,

.skin18 .brands-carousel-index18 .owl-controls {

	display: none;

}



.skin18 .slider-title {

	text-align: center;

}



.skin18 .slider-title .line,

.skin18 .title-group .line {

	background: #d8d8d8;

	width: 100%;

	bottom: 0.8em;

}



.skin18 .slider-title .inline-title {

	padding-left: 20px !important;

	padding-right: 20px !important;

	color: #3d3734;

	font-size: 19px;

	font-weight: 600;

}



.header19.fixed-header h1.logo {

	float: left;

	font-size: 10px;

	line-height: 1;

}



	.header19.fixed-header h1.logo img {

		max-height: 30px;

	}



.header19.fixed-header #mini-cart.minicart-inline {

	float: right;

	margin-top: 1px;

}



.header19.fixed-header #mini-cart .minicart-icon {

	font-size: 31px;

	padding-right: 9px;

}



.fixed-header.header19 #mini-cart.minicart-inline .cart-items {

	position: absolute;

}



.fixed-header.header19 #mini-cart.minicart-inline .dropdown-menu {

	margin-top: 13px;

}



.fixed-header.header19 #mini-cart.minicart-inline .cart-items {

	color: #fff;

	margin: 0px 9px 0px 0px;

	font-size: 12px;

	font-weight: 600;

	line-height: 3;

}



	.fixed-header.header19 #mini-cart.minicart-inline .cart-items .hidden-xs {

		display: none !important;

	}



@media (max-width: 767px) {

	.header19 #mini-cart.dropdown .dropdown-menu:before {

		right: 12px !important;

	}

}



/* @end */



/* @group Banenr 18 */



.banner-content-18{padding:292px 0 98px}

.banner-content-18 em{font-size:26.26px;margin-left:5px;margin-bottom:7px}

.banner-content-18 .text-content h2{font-size:79.12px;letter-spacing:-4px}

.banner-content-18 .text-content p{margin:0}

.banner-content-18 .text-content p span{font-size:23.64px;padding-left:5px;line-height:2}

.banner-content-18 .text-content p a{font-size:16px;padding:10px 35px;margin-left:5px;margin-top:7px;margin-bottom:125px}



.filter-title-type-2{font-size:19px;margin:0;font-weight:300;margin-bottom:22px;display:table;width:100%}

.filter-title-type-2 span{display:table-cell;position:relative}

.filter-title-type-2 span.title-line:after{content:"";width:100%;border-top:1px solid #d8d8d8;display:block;position:absolute;top:50%;margin-top:-1px}



.skin18.common-home .banner-content-18 .owl-controls {

	display: block;

}



@media (max-width: 767px) {

	.skin18.common-home .banner-content-18 .owl-controls {

		display: none;

	}

}



.banner-content-18 .owl-controls .owl-nav {

	top: 50%;

	left: -55px;

	right: -55px;

}



.banner-content-18 .owl-controls .owl-prev,

.banner-content-18 .owl-controls .owl-next {

	font-size: 28px;

	color: #3d3734 !important;

	position: absolute;

	margin-top: -30px;

}



.banner-content-18 .owl-controls .owl-next {

	right: 0;

}



/* @end */



.account-login .well {

	min-height: 453px;

}



.buttons {

	padding-bottom: 20px;

}



.buttons:before,

.buttons:after {

  display: table;

  content: " ";

}

.buttons:after {

  clear: both;

}



/* @group Fixed header type 1 */



.header1.fixed-header h1.logo {

	float: left;

	font-size: 10px;

	line-height: 1;

	position: relative;

	z-index: 9999;

	padding: 8px 40px 8px 0px;

	min-width: 0px;

}



	.header1.fixed-header h1.logo img {

		max-height: 30px;

	}



.common-home.body-header-type-1 .header1.fixed-header {

	display: none;

}



.header1.fixed-header {

	background: #950707;

}



.header1.fixed-header #mini-cart {

	float: right;

	position: relative;

	margin: 0px;

	z-index: 9999;

	padding: 4px 0px 4px 30px;

}



.header1.fixed-header #mini-cart .minicart-icon {

	font-size: 31px;

	line-height: 36px;

}



.header1.fixed-header #mini-cart.dropdown .dropdown-menu {

	margin-top: 7px;

}



/* @end */



/* @group Fixed header type 3 */



.header1.fixed-header.type2 {

	background: #1e1e1e;

}



.header1.fixed-header.type2 #mini-cart.minicart-inline {

	background: none !important;

}



.header1.fixed-header.type2 #mini-cart.minicart-inline .cart-head {

	padding: 0px;

	margin: 0px;

	height: auto;

}



.header1.fixed-header.type2 #mini-cart.minicart-inline .cart-items {

	position: absolute;

	font-size: 15px;

	margin: 0px;

	top: 8px;

	color: #000;

}



.header1.fixed-header.type2 #mini-cart.minicart-inline .cart-items .hidden-xs {

	display: none !important;

}



/* @end */



/* @group Fixed header type 3 */



.header1.fixed-header.type3 {

	background: #fff;

	box-shadow: 0 1px 2px rgba(0,0,0,0.1);

	-webkit-box-shadow: 0 1px 2px rgba(0,0,0,0.1);

	-moz-box-shadow: 0 1px 2px rgba(0,0,0,0.1);

}



.header1.fixed-header.type3 .container-megamenu {

	margin: 0px;

}



.header1.fixed-header.type3 ul.megamenu {

	background: none;

	padding-top: 3px;

}



.header1.fixed-header.type3 #mini-cart .minicart-icon {

	color: #9ac93d;

}



.header1.fixed-header.type3 #mini-cart .cart-items {

	color: #fff;

}



/* @end */



/* @group Fixed header type 6 */



.header1.fixed-header.type6 {

	background: #1e1e1e;

}



.header1.fixed-header.type6 .megamenu-wrapper {

	background: none;

}



.header1.fixed-header.type6 ul.megamenu > li > a:hover,

.header1.fixed-header.type6 ul.megamenu > li.active > a,

.header1.fixed-header.type6 ul.megamenu > li.home > a,

.header1.fixed-header.type6 ul.megamenu > li:hover > a {

	color: #fff;

}



.header1.fixed-header.type6 #mini-cart.minicart-inline {

	background: none !important;

}



.header1.fixed-header.type6 #mini-cart.minicart-inline .cart-head {

	padding: 0px;

	margin: 0px;

	height: auto;

}



.header1.fixed-header.type6 #mini-cart.minicart-inline .cart-items {

	position: absolute;

	font-size: 15px;

	margin: 0px;

	top: 8px;

	color: #000;

}



.header1.fixed-header.type6 #mini-cart.minicart-inline .cart-items .hidden-xs {

	display: none !important;

}



/* @end */



/* @group Fixed header type 7 */



.header1.fixed-header.type7 {

	background: #fff;

	box-shadow: 0 1px 2px rgba(0,0,0,0.1);

	-webkit-box-shadow: 0 1px 2px rgba(0,0,0,0.1);

	-moz-box-shadow: 0 1px 2px rgba(0,0,0,0.1);

}



.header1.fixed-header.type7 .megamenu-wrapper {

	background: none;

	padding-top: 5px;

}



.header1.fixed-header.type7 #mini-cart .minicart-icon {

	color: #65829d;

}



.header1.fixed-header.type7 #mini-cart .cart-items {

	color: #fff;

}



/* @end */



/* @group Fixed header type 8 */



.header1.fixed-header.type8 {

	background: #fff;

	box-shadow: 0 1px 2px rgba(0,0,0,0.1);

	-webkit-box-shadow: 0 1px 2px rgba(0,0,0,0.1);

	-moz-box-shadow: 0 1px 2px rgba(0,0,0,0.1);

}



.header1.fixed-header.type8 #mini-cart .minicart-icon {

	color: #e13b3f;

}



.header1.fixed-header.type8 #mini-cart .cart-items {

	color: #fff;

}



/* @end */



/* @group Fixed header type  11 */



.header1.fixed-header.type11 {

	background: #fff;

	box-shadow: 0 1px 2px rgba(0,0,0,0.1);

	-webkit-box-shadow: 0 1px 2px rgba(0,0,0,0.1);

	-moz-box-shadow: 0 1px 2px rgba(0,0,0,0.1);

}



.header1.fixed-header.type11 #mini-cart .minicart-icon {

	color: #7aa93c;

}



.header1.fixed-header.type11 .megamenu-wrapper {

	background: none;

	padding-top: 4px;

}



.header1.fixed-header.type11 #mini-cart .cart-items {

	color: #fff;

}



/* @end */



/* @group Fixed header type  11 */



.header1.fixed-header.type12 {

	background: #393f4f;

}



.header1.fixed-header.type12 .megamenu-wrapper {

	background: none;

}



/* @end */



/* @group Fixed header type 14 */



.header1.fixed-header.type14 {

	background: #fff;

	box-shadow: 0 1px 2px rgba(0,0,0,0.1);

	-webkit-box-shadow: 0 1px 2px rgba(0,0,0,0.1);

	-moz-box-shadow: 0 1px 2px rgba(0,0,0,0.1);

}



.header1.fixed-header.type14 .megamenu-wrapper {

	background: none;

}



.header1.fixed-header.type14 #mini-cart.minicart-inline {

	background: none !important;

}



.header1.fixed-header.type14 #mini-cart.minicart-inline .cart-head {

	padding: 0px;

	margin: 0px;

	height: auto;

}



.header1.fixed-header.type14 #mini-cart .minicart-icon {

	color: #9ac93d;

}



.header1.fixed-header.type14 #mini-cart.minicart-inline .cart-items {

	position: absolute;

	font-size: 15px;

	margin: 0px;

	top: 8px;

	color: #fff;

}



.header1.fixed-header.type14 #mini-cart.minicart-inline .cart-items .hidden-xs {

	display: none !important;

}



/* @end */



/* @group Fixed header type  15 */



.header1.fixed-header.type15 {

	background: #f3f5f4;

	box-shadow: 0 1px 2px rgba(0,0,0,0.1);

	-webkit-box-shadow: 0 1px 2px rgba(0,0,0,0.1);

	-moz-box-shadow: 0 1px 2px rgba(0,0,0,0.1);

}



.header1.fixed-header.type15 #mini-cart .minicart-icon {

	color: #39333f;

}



.header1.fixed-header.type15 .megamenu-wrapper {

	background: none;

}



.header1.fixed-header.type15 #mini-cart .cart-items {

	color: #fff;

}



/* @end */



/* @group Fixed header type 16 */



.header1.fixed-header.type16 {

	background: #5c616e;

}



.header1.fixed-header.type16 .megamenu-wrapper {

	background: none;

}



.header1.fixed-header.type16 ul.megamenu > li > a:hover,

.header1.fixed-header.type16 ul.megamenu > li.active > a,

.header1.fixed-header.type16 ul.megamenu > li.home > a,

.header1.fixed-header.type16 ul.megamenu > li:hover > a {

	color: #fff;

}



.header1.fixed-header.type16 #mini-cart.minicart-inline {

	background: none !important;

}



.header1.fixed-header.type16 #mini-cart.minicart-inline .cart-head {

	padding: 0px;

	margin: 0px;

	height: auto;

}



.header1.fixed-header.type16 #mini-cart .minicart-icon {

	color: #000;

}



.header1.fixed-header.type16 #mini-cart.minicart-inline .cart-items {

	position: absolute;

	font-size: 15px;

	margin: 0px;

	top: 8px;

	color: #fff;

}



.header1.fixed-header.type16 #mini-cart.minicart-inline .cart-items .hidden-xs {

	display: none !important;

}



/* @end */



/* @group Fixed header type 16 */



.header1.fixed-header.type17 {

	background: #f9f9f9;

}



.header1.fixed-header.type17 .megamenu-wrapper {

	background: none;

}



.header1.fixed-header.type17 #mini-cart.minicart-inline {

	background: none !important;

}



.header1.fixed-header.type17 #mini-cart.minicart-inline .cart-head {

	padding: 0px;

	margin: 0px;

	height: auto;

}



.header1.fixed-header.type17 #mini-cart .minicart-icon {

	color: #b74173;

}



.header1.fixed-header.type17 #mini-cart.minicart-inline .cart-items {

	position: absolute;

	font-size: 15px;

	margin: 0px;

	top: 8px;

	color: #fff;

}



.header1.fixed-header.type17 #mini-cart.minicart-inline .cart-items .hidden-xs {

	display: none !important;

}



/* @end */



/* @group Wide width */



@media (min-width: 767px) {

	.wide-width .container {

	    width: 100%;

	    padding: 0px 100px;

	}



	.wide-width .container .container {

		padding: 0px !important;

	}

}



@media (min-width: 767px) and (max-width: 1199px) {

	.wide-width .container {

	    padding: 0px 50px;

	}

}



/* @end */



/* @group Skin 19 */



@media (min-width: 767px) {

	.skin19 .wide-width .container {

	    padding: 0px 100px 0px 180px;

	}

}



@media (min-width: 767px) and (max-width: 1199px) {

	.skin19 .wide-width .container {

	    padding: 0px 50px 0px 130px;

	}

}



.skin19 .product-grid .product-image,

.skin19 .carousel-wrapper .product-image,

.skin19 ul.product_list_widget li .product-image,

.skin19 .widget ul.product_list_widget li .product-image {

	border-radius: 0px;

	-webkit-border-radius: 0px;

	-moz-border-radius: 0px;

	padding: 0px;

	border: none;

}



.skin19 .product-grid .product-image img,

.skin19 .carousel-wrapper .product-image img,

.skin19 ul.product_list_widget li .product-image img,

.skin19 .widget ul.product_list_widget li .product-image img {

	border-radius: 0px;

	-webkit-border-radius: 0px;

	-moz-border-radius: 0px;

}



.skin19 .product-list .product-image {

	border-radius: 0px;

	-webkit-border-radius: 0px;

	-moz-border-radius: 0px;

	padding: 0px;

	border: none;

}



.skin19 .product-list .product-image img {

	border-radius: 0px;

	-webkit-border-radius: 0px;

	-moz-border-radius: 0px;

}



/* @end */



/* @group Header type 20 */



.header20 {

	background: #fff;

	padding: 25px 0px;

	position: relative;

	z-index: 999;

}



.header20.active.with-fixed {

	background: #000 !important;

	position: fixed !important;

	top: 0;

	left: 0;

	right: 0;

}



.common-home .header20 {

	position: absolute;

	top: 0;

	left: 0;

	right: 0;

	background: none;

}



.common-home .header20-before {

	display: none;

}



.header20 .logo {

	float: left;

}



	.header20.active.with-fixed .logo img {

		display: none;

	}



	.header20.active.with-fixed .logo .hide {

		display: block !important;

	}



.header20 .cart-area {

	float: right;

}



.header20 .top-links-area {

	display: inline-block;

	vertical-align: top;

	position: relative;

}



	.header20 .top-links-area .top-links-icon {

		display: none;

	}



	.header20 .top-links-area .links {

		display: inline-block;

		vertical-align: top;

		padding: 14px 31px 0px 0px;

		margin: 0px;

	}



		.header20 .top-links-area .links li {

			display: inline-block;

			vertical-align: top;

			padding: 0 14px;

			font-size: 11px;

			font-weight: 700;

		}



			.header20 .top-links-area .links li:first-child {

				padding-left: 0;

			}



			.header20 .top-links-area .links li:last-child {

				padding-right: 0;

			}



			.header20 .top-links-area .links li a {

				color: #000;

				text-transform: uppercase;

				transition: all 0.2s ease-in;

				-webkit-transition: all 0.2s ease-in;

				-moz-transition: all 0.2s ease-in;

			}



				.header20 .top-links-area .links li a:hover {

					text-decoration: underline;

				}



				.header20.active.with-fixed .top-links-area .links li a  {

					color: #fff;

				}



	@media (max-width: 1580px) {

		.header20 .top-links-area .links {

			position: absolute;

			left: -11px;

			top: 100%;

			text-align: left;

			padding: 10px 0;

			background-color: #fff;

			border: 1px solid #ddd;

			border-radius: 5px;

			display: none;

			z-index: 999;

		}



			.header20 .top-links-area .links:hover,

			.header20 .top-links-area .top-links-icon:hover + .links {

				display: block;

			}



			.header20 .top-links-area .links li {

			    display: block;

			    padding: 0 10px !important;

			    font-weight: 400;

			    font-size: 11px;

			    line-height: 19px;

			}



				.header20 .top-links-area .links li a {

					color: #000 !important;

				}



		.header20 .top-links-area .top-links-icon {

			display: inline-block;

			margin: 13px 27px -2px 0px;

			vertical-align: top;

			padding-bottom: 5px;

			position: relative;

		}



			.header20 .top-links-area .top-links-icon a {

				font-size: 11px;

				color: #000;

				text-transform: uppercase;

				transition: all 0.2s ease-in;

				-webkit-transition: all 0.2s ease-in;

				-moz-transition: all 0.2s ease-in;

			}



				.header20.active.with-fixed .top-links-area .top-links-icon > a {

					color: #fff;

				}



				.header20 .top-links-area .top-links-icon a i {

					margin-left: 4px;

				}

	}



	.header20 .top-links-area .custom-block {

		display: inline-block;

		vertical-align: top;

		padding: 14px 29px 0px 0px;

	}



		.header20 .top-links-area .custom-block a {

			font-size: 17px;

			padding: 0;

			margin: 0 8px 0px 9px;

			color: #000;

			transition: all 0.2s ease-in;

			-webkit-transition: all 0.2s ease-in;

			-moz-transition: all 0.2s ease-in;

		}



			.header20.active.with-fixed .top-links-area .custom-block a {

				color: #fff;

			}



.header20 .mobile-toggle {

	display: none;

}



.header20 .searchform-popup {

	display: inline-block;

	vertical-align: top;

	position: relative;

	padding: 5px 0px 5px 0px;

	margin: 0px 28px 0px 0px;

}



	.header20 .searchform-popup .search-toggle {

		display: none;

	}



	.header20 .searchform-popup input {

		font-size: 12px;

		font-weight: 700;

		min-width: 200px;

		font-family: Arial;

		color: #000;

		border-radius: 20px;

		-webkit-border-radius: 20px;

		-moz-border-radius: 20px;

		border: 1px solid #000;

		height: 38px;

		padding: 10px 15px;

		background: none;

	}



		.header20.active.with-fixed .searchform-popup input {

			color: #fff;

			border: 1px solid #fff;

		}



		.header20 .searchform-popup input::-webkit-input-placeholder { /* Chrome/Opera/Safari */

		  color: #000;

		}

		.header20 .searchform-popup input::-moz-placeholder { /* Firefox 19+ */

		  color: #000;

		}

		.header20 .searchform-popup input:-ms-input-placeholder { /* IE 10+ */

		  color: #000;

		}

		.header20 .searchform-popup input:-moz-placeholder { /* Firefox 18- */

		  color: #000;

		}



			.header20.active.with-fixed .searchform-popup input::-webkit-input-placeholder { /* Chrome/Opera/Safari */

			  color: #fff;

			}

			.header20.active.with-fixed .searchform-popup input::-moz-placeholder { /* Firefox 19+ */

			  color: #fff;

			}

			.header20.active.with-fixed .searchform-popup input:-ms-input-placeholder { /* IE 10+ */

			  color: #fff;

			}

			.header20.active.with-fixed .searchform-popup input:-moz-placeholder { /* Firefox 18- */

			  color: #fff;

			}



	.header20 .searchform-popup .btn {

		width: 40px;

		height: 42px;

		color: #000;

		background-color: transparent;

		font-size: 14px;

		position: absolute;

		right: 0;

		top: 0;

		border-radius: 0 20px 20px 0;

		outline: none;

		padding: 6px 1px 0px 0px;

	}



		.header20.active.with-fixed .searchform-popup .btn {

			color: #fff;

		}



	@media (max-width: 1100px) {

		.header20 .searchform-popup input,

		.header20 .searchform-popup .btn {

			display: none;

		}



		.header20 .searchform-popup {

			margin: 0px;

			padding: 13px 10px 0px 0px;

		}



		.header20 .searchform-popup .search-toggle {

			display: block;

			color: #000;

		}



			.header20.active.with-fixed .searchform-popup .search-toggle {

				color: #fff;

			}

	}



.header20 .switcher-area {

	display: inline-block;

	vertical-align: top;

	padding: 10px 0px 0px 0px;

}



	.header20 .switcher-area .separator {

		display: none;

	}



	.header20 .switcher-area .accordion-menu {

		padding: 0px;

		margin: 0px 0px 0px 5px;

		display: inline-block;

		vertical-align: top;

	}



		.header20 .switcher-area .accordion-menu > li > a {

			padding: 0 10px 0 10px;

			margin: 0px;

			box-shadow: 1px 2px 1px rgba(0,0,0,0.3);

			background: #fff;

			border-radius: 3px;

			-webkit-border-radius: 3px;

			-moz-border-radius: 3px;

			color: #000;

			height: 26px;

			font-size: 11px;

			line-height: 24px;

			font-weight: 700;

			text-transform: uppercase;

		}



			.header20 .switcher-area .accordion-menu > li > a i {

				margin-left: 7px;

			}



			.header20 .switcher-area .accordion-menu > li > a img {

				display: inline-block;

				vertical-align: top;

				margin: 7px 4px 0px 0px;

			}



		.header20 .switcher-area .accordion-menu > li ul {

			display: none;

			position: absolute;

			background-color: #fff !important;

			border: 1px solid #ccc;

			border-radius: 3px;

			box-shadow: 0 0 2px rgba(0,0,0,0.1);

			margin: 0px;

			padding: 4px 0px;

			min-width: 100%;

		}



			.header20 .switcher-area .accordion-menu > li:hover ul {

				display: block;

			}



			.header20 .switcher-area .accordion-menu > li ul li {

				display: block;

				padding: 0 9px;

				line-height: 17px;

				white-space: nowrap;

			}



				.header20 .switcher-area .accordion-menu > li ul li:hover {

					background: #ccc;

				}



				.header20 .switcher-area .accordion-menu > li ul li a {

					padding: 0;

					line-height: 17px;

					color: #777;

					background: none !important;

					font-size: 11px;

					text-transform: uppercase;

				}



					.header20 .switcher-area .accordion-menu > li ul li:hover a {

						color: #fff;

					}



					.header20 .switcher-area .accordion-menu > li ul li a img {

						display: inline-block;

						margin: 3px 5px 0 0;

						vertical-align: top;

					}



	.header20 .switcher-area #mini-cart.minicart-inline {

		box-shadow: 1px 2px 1px rgba(0,0,0,0.3) !important;

		background: #fff !important;

		border-radius: 3px !important;

		-webkit-border-radius: 3px !important;

		-moz-border-radius: 3px !important;

		margin: 1px 0px 0px 5px;

		height: 26px;

	}



		.header20 .switcher-area #mini-cart.minicart-inline .minicart-icon {

			color: #000;

		}



		.header20 .switcher-area #mini-cart.minicart-inline .cart-items {

			color: #000;

			font-size: 11px;

			text-transform: uppercase;

		}



	@media (max-width: 991px) {

		.header20 .top-links-area {

			display: none;

		}



		.header20 .currency_language_form {

			display: none;

		}



		.header20 .mobile-toggle {

			display: inline-block;

			vertical-align: top;

			color: #000;

			margin: 13px 15px 0px 0px;

		}



			.header20.active.with-fixed .mobile-toggle {

				color: #fff;

			}

	}



/* @end */



/* @group Skin19 footer */



.skin19-footer .row {

	display: flex;

	margin: 0px;

}



.skin19-footer .row > div {

	border-left: 1px solid #0f0f0f;

	padding: 10px 50px;

}



	.skin19-footer .row > div.col-sm-2 {

		width: 20%;

	}



	.skin19-footer .row > div:first-child {

		border-left: none;

		padding-left: 0;

	}



.skin19-footer .block {

	line-height: 1.5;

}



	.skin19-footer .block .block-title {

		margin: 5px 0 30px 0;

		line-height: 1.2;

		font-size: 14px;

		font-weight: 700;

		color: #fff;

		text-transform: uppercase;

	}



	.skin19-footer .block ul.links {

		margin: -5px 0px 0px 0px;

		padding: 0px;

		position: relative;

		font-size: 14px;

	}



		.skin19-footer .block ul.links li {

			padding: 10px 0;

			line-height: 1;

		}



			#footer .skin19-footer .block a {

				color: #777;

			}



	.skin19-footer .block .rside-form {

		max-width: 281px;

		position: relative;

	}



		.skin19-footer .block .rside-form input {

			height: 60px;

			width: 100%;

			border: 1px solid #999;

			color: #777;

			line-height: 58px;

			padding: 0px 30px;

			border-radius: 30px;

			-webkit-border-radius: 30px;

			-moz-border-radius: 30px;

			background: none;

			font-size: 14px;

		}



		.skin19-footer .block .rside-form .subscribe {

			position: absolute;

			top: 0;

			right: 0;

			height: 58px;

			background: none;

			border: none;

			font-size: 12px;

			line-height: 58px;

			color: #fff;

			font-weight: bold;

			padding: 0px 25px 0px 25px;

		}



@media (max-width: 1400px) {

	.skin19-footer .row > div {

		border: none;

		padding-left: 10px;

		padding-right: 10px;

	}

}



@media (max-width: 767px) {

	.skin19-footer .row {

		display: block;

	}



		.skin19-footer .row > div {

			width: 100% !important;

			padding-left: 0;

			padding-right: 0;

			padding-bottom: 25px;

		}

}



.skin19 #footer {

	background: #000;

}



.skin19 #footer #footer-bottom {

	background: #000;

}



.footer-home19-logo {

	padding-bottom: 15px;

}



/* @end */



/* @group Skin 19 category list */



.skin19 .main-content {

	min-height: 1000px;

}



@media (max-width: 767px) {

	.skin19 .main-content {

		min-height: 400px;

	}

}



.skin19-category-list {

	position: absolute;

	background: #000;

	width: 80px;

	left: 0;

	top: 0;

	bottom: 0;

}



	.common-home .skin19-category-list {

		display: none;

	}



	.skin19-category-list ul {

		position: absolute;

		top: 142px;

		left: 0;

		padding-top: 76px;

		z-index: 99;

		margin: 0px;

	}



		.skin19-category-list ul li a {

			color: #fff;

			width: auto;

			line-height: 78px;

			display: inline-block;

			white-space: nowrap;

			position: relative;

			transition: all .3s;

			-webkit-transition: all .3s;

			-moz-transition: all .3s;

		}



			.skin19-category-list ul li a > em{font-size:25px;width:80px;display:inline-block;text-align:center;vertical-align:middle}

			.skin19-category-list ul li a > em > img{vertical-align:middle;max-width:80px}

			.skin19-category-list ul li a > span{display:inline-block;vertical-align:middle;opacity:0;visibility:hidden;width:0;transition:all .3s;font-size:16px;font-weight:600;position:relative;overflow:hidden}

			.skin19-category-list ul li a:after{content:"";width:16px;height:16px;position:absolute;display:block;right:-15px;top:50%;margin-top:-8px;border:8px solid transparent;transition:all .3s}

			.skin19-category-list ul li a:hover, .skin19-category-list ul li a.active{background-color:#00d59d}

			.skin19-category-list ul li a:hover > span{opacity:1;visibility:visible;width:auto;padding-right:50px}

			.skin19-category-list ul li a:hover:after,.skin19-category-list ul li a.active:after{border-left-color:#00d59d}



@media (max-width: 767px) {

	.skin19-category-list {

		position: relative !important;

		height: auto !important;

		width: 100% !important;

	}



	.skin19-category-list:before,

	.skin19-category-list:after {

		  display: table;

		  content: " ";

	}



	.skin19-category-list:after {

		clear: both;

	}



	.skin19-category-list ul {

		position: relative !important;

		top: 0 !important;

		bottom: 0 !important;

		left: 0 !important;

		right: 0 !important;

		padding: 0px !important;

	}



	.skin19-category-list ul li {

		float: left;

	}



	.skin19-category-list ul li a > span,

	.skin19-category-list ul li a:after {

		display: none !important;

	}

}



/* @end */



/* @group Skin19 slider */



.skin19 .tp-caption.marginleft {

	left: 180px !important;

	right: 180px !important;

}



@media (max-width: 1199px) {

	.skin19 .tp-caption.marginleft {

		left: 130px !important;

		right: 130px !important;

	}

}



@media (max-width: 767px) {

	.skin19 .tp-caption.marginleft {

		left: 15px !important;

		right: 15px !important;

	}

}



.home19-slider-button {

	color: #000 !important;

	font-size: 14px;

	font-weight: 700;

	border: 2px solid #000;

	padding: 0 34px;

	display: inline-block;

	line-height: 53px;

	border-radius: 8px;

	text-decoration: none;

}



	.home19-slider-button:hover {

		background: #000;

		color: #fff !important;

	}



.skin19 .tp-bullets {

	left: 180px !important;

	right: 180px !important;

	bottom: 8% !important;

}



@media (max-width: 1199px) {

	.skin19 .tp-bullets {

		left: 130px !important;

		right: 130px !important;

	}

}



@media (max-width: 767px) {

	.skin19 .tp-bullets {

		left: 15px !important;

		right: 15px !important;

	}

}



.skin19 .tp-bullets.simplebullets.round .bullet {

	margin-left: 0;

	margin-right: 14px;

	width: 12px;

	height: 12px;

	border: 2px solid #000;

	background: none;

	border-radius: 100px;

	-webkit-border-radius: 100px;

	-moz-border-radius: 100px;

}



.skin19 .tp-bullets.simplebullets.round .bullet.selected {

	background: #000;

}



/* @end */



/* @group Skin19 category */



.skin19-category {

	padding-top: 70px;

}



.skin19-category:last-child {

	margin-bottom: 104px;

}



@media (max-width: 767px) {

	.skin19-category:last-child {

		margin-bottom: 40px;

	}

}



@media (max-width: 1199px) {

	.skin19-category {

		padding-top: 46px;

	}

}





.skin19-category .category_link {

	float: right;

	display: block;

    position: relative;

    z-index: 2;

    height: 40px;

    border: 2px solid #000;

    color: #000;

    border-radius: 5px;

    line-height: 36px;

    text-align: center;

    text-decoration: none;

    text-transform: uppercase;

    font-weight: 600;

   	padding: 0px 24px 0px 24px;

   	transition: all 0.2s ease-in;

   	-webkit-transition: all 0.2s ease-in;

   	-moz-transition: all 0.2s ease-in;

   	font-size: 13px;

   	margin-left: -200px;

   	margin-top: 33px;

}



	.skin19-category .category_link:hover {

		background: #000;

		color: #fff;

	}



.skin19-category .title {

	padding: 0px 0px 10px 0px;

	margin: 0px;

}



	.skin19-category .title p {

		padding: 0px;

		margin: 0px;

		line-height: 100px;

		font-size: 26px;

		color: #000;

		font-weight: 300;

		cursor: pointer;

		display: inline-block;

	}



		@media (max-width: 767px) {

			.skin19-category .title p {

				font-size: 22px;

			}

		}



		.skin19-category .title.with_submenu p:after {

			content: "\f107";

			display: inline-block;

			font: normal normal normal 14px/1 FontAwesome;

			font-size: inherit;

			text-rendering: auto;

			-webkit-font-smoothing: antialiased;

			-moz-osx-font-smoothing: grayscale;

			font-size: 20px;

			margin-left: 18px;

		}



			.skin19-category .title.with_submenu p.active:after {

				content: "\f106";

			}



	.skin19-category .title .submenu {

		position: absolute;

		background: #fff;

		z-index: 9;

		left: -15px;

		right: -15px;

		border: 1px solid #bebebe;

		border-radius: 5px;

		padding: 50px 0;

		display: none;

	}



		.skin19-category .title p.active + .submenu {

			display: block;

		}



		.skin19-category .title .submenu:before {

			content: "";

			border: 8px solid transparent;

			width: 16px;

			height: 16px;

			display: block;

			border-bottom-color: #bebebe;

			position: absolute;

			top: -16px;

			left: 90px;

		}



		.skin19-category .title .submenu:after {

			content: "";

			border: 7px solid transparent;

			width: 14px;

			height: 14px;

			display: block;

			border-bottom-color: #fff;

			position: absolute;

			top: -13px;

			left: 91px;

		}



		.skin19-category .title .submenu .row {

			display: flex;

			margin: 0px;

		}



			.skin19-category .title .submenu .row > div {

				padding: 30px 4% 30px 4%;

				margin: 10px 0;

				border-left: 1px solid #bebebe;

			}



				.skin19-category .title .submenu .row > div:first-child {

					border-left: none;

				}



			.skin19-category .title .submenu .row > div ul {

				padding: 0px;

				margin: 0px;

				list-style: none;

			}



			.skin19-category .title .submenu li {

				line-height: 1;

			}



			.skin19-category .title .submenu a {

				color: #000;

				font-size: 16px;

				line-height: 2.5;

				text-transform: uppercase;

				font-weight: 700;

			}



				.skin19-category .title .submenu a:hover {

					text-decoration: underline;

				}



				.skin19-category .title .submenu ul ul a {

					text-transform: none;

					font-weight: normal;

				}



	@media (max-width: 1199px) {

		.skin19-category .title .submenu {

			padding: 10px 0px;

		}



		.skin19-category .title .submenu .row > div {

			padding: 10px 2%;

		}



		.skin19-category .title .submenu a {

			font-size: 11px;

		}

	}



	@media (max-width: 767px) {

		.skin19-category .title .submenu {

			left: 0;

			right: 0;

		}



		.skin19-category .title .submenu .row {

			display: block;

		}



			.skin19-category .title .submenu .row > div {

				border: none;

			}



		.skin19-category .title .submenu {

			padding: 10px 5px;

		}



		.skin19-category .title .submenu .row > div {

			padding: 10px 15px;

			float: left;

			width: 50%;

		}



		.skin19-category .title .submenu a {

			font-size: 14px;

		}

	}



.skin19-category .product-image {

	margin: 0px;

	padding: 0px;

	border: none;

	border-radius: 0;

	-webkit-border-radius: 0;

	-moz-border-radius: 0;

}



	.skin19-category .product-image img {

		border-radius: 0;

		-webkit-border-radius: 0;

		-moz-border-radius: 0;

		display: block;

	}



	.skin19-category  .product-image-area:before{content:"";display:block;background:#000;width:100%;height:100%;position:absolute;left:0;top:0;z-index:1;opacity:0;visibility:hidden;transition:all .3s}

	.skin19-category  .item-area:hover .product-image-area:before{opacity:.7;visibility:visible}



	.skin19-category a.quickview-icon{position:absolute;top:50%;margin-top:-18px;text-align:center;width:100%;background:none;text-transform:uppercase;color: #fff;

	}

		.skin19-category a.quickview-icon:hover {

			color: rgba(255, 255, 255, .85);

			text-decoration: underline;

		}

	.skin19-category a.quickview-icon span{margin-left:8px;font-weight:600}



	.skin19-category .item-area:hover a.quickview-icon {

		opacity: 1;

		visibility: visible;

	}



	.skin19-category .actions {

		padding: 0 15px;

		position: absolute;

		width: 100%;

		bottom: 15px;

		left: 0;

		text-align: left;

		visibility: hidden;

		opacity: 0;

		transition: opacity .2s;

		z-index: 3;

	}



		.skin19-category .item-area:hover .actions {

			opacity: 1;

			visibility: visible;

		}



		.skin19-category .actions a{

			background-color:transparent;

			color:#fff;

			width:50px;

			height:50px;

			line-height:48px;

			font-size:18px;

			margin:0 1px;

			display: inline-block;

			border: 1px solid #fff;

			border-radius: 5px;

			-webkit-border-radius: 5px;

			-moz-border-radius: 5px;

			text-align: center;

		}



			.skin19-category .actions a span {

				display: none;

			}



	.skin19-category .product-label {

		position: absolute;

		font-size: 14px;

		font-weight: 700;

		color: #fff;

		line-height: 1;

		top: 10px;

		z-index: 3;

		right: 10px;

	}



		.skin19-category .product-label span {

			position: relative;

			padding: 7px 10px;

			font-size: 12px;

			font-weight: 600;

			text-transform: uppercase;

			border-radius: 4px;

		}



			.skin19-category .product-label span.sale-product-icon {

			    background-color: #e27c7c;

			    display: block;

			    text-align: center;

			}



			.skin19-category .product-label span.new-product-icon {

			    background-color: #62b959;

			    display: block;

			    text-align: center;

			}



	.skin19-category .details-area {

		padding: 15px 0;

	}



	.skin19-category .product-name {

		margin: 0px 0px 3px 0px;

		padding: 0px;

		line-height: 1.35;

	}



		.skin19-category .product-name a {

			font-size: 14px;

			font-weight: 600;

			color: #000;

			letter-spacing: 0;

		}



	.skin19-category .price-box {

		margin: 10px 0 2px;

	}



		.skin19-category .price-box .price {

			font-size: 30px;

			font-weight: 300;

			line-height: 1;

			margin: 0px;

		}



		.skin19-category .price-box .old-price,

		.skin19-category .price-box .special-price {

			padding: 0px;

			margin: 0px;

			display: inline-block;

			vertical-align: top;

		}



			.skin19-category .price-box .old-price .price {

				color: #999;

				font-size: 20px;

				text-decoration: line-through;

				vertical-align: middle;

				line-height: 30px;

				margin-right: 7px;

			}



.skin19-category .owl-dot {

	width: 8px;

	height: 8px;

	background: #fff !important;

	border: 1px solid #000 !important;

}



	.skin19-category .owl-dot.active {

		background: #000 !important;

	}



.skin19-category .additional-content {



}



	.skin19-category .additional-content img {

		margin-top: 53px;

	}



/* @end */



/* @group Skin 20 */



.skin20 .product-grid .product-image,

.skin20 .carousel-wrapper .product-image,

.skin20 ul.product_list_widget li .product-image,

.skin20 .widget ul.product_list_widget li .product-image {

	border-radius: 0px;

	-webkit-border-radius: 0px;

	-moz-border-radius: 0px;

	padding: 0px;

	border: none;

}



.skin20 .product-grid .product-image img,

.skin20 .carousel-wrapper .product-image img,

.skin20 ul.product_list_widget li .product-image img,

.skin20 .widget ul.product_list_widget li .product-image img {

	border-radius: 0px;

	-webkit-border-radius: 0px;

	-moz-border-radius: 0px;

}



.skin20 .product-list .product-image {

	border-radius: 0px;

	-webkit-border-radius: 0px;

	-moz-border-radius: 0px;

	padding: 0px;

	border: none;

}



.skin20 .product-list .product-image img {

	border-radius: 0px;

	-webkit-border-radius: 0px;

	-moz-border-radius: 0px;

}



.skin20 .mfilter-heading,

.skin20 .mfilter-content > ul > li,

.skin20 a.quickview-icon,

.skin20 .product-filter .options .button-group button,

.skin20 .nav-tabs > li > a,

.skin20 .product-list .btn-add-cart,

.skin20 .product-list .product-btn.btn-wishlist,

.skin20 .product-list .product-btn.btn-quickview,

.skin20 .product-info .thumbnails li img,

.skin20 .product-info .thumbnails-carousel img,

.skin20 .btn-default,

.skin20 .btn,

.skin20 .button,

.skin20 select,

.skin20 input,

.skin20 textarea,

.skin20 .product-info .product-image,

.skin20 .well,

.skin20 .box,

.skin20 .box .box-heading,

.skin20 table.attribute,

.skin20 table.list,

.skin20 .wishlist-product table,

.skin20 .wishlist-info table,

.skin20 .compare-info,

.skin20 .cart-info table,

.skin20 .checkout-product table,

.skin20 .table,

.skin20 .center-column .panel-heading,

.skin20 .quickcheckout-heading,

body.skin20 .quickcheckout-content,

.skin20 .mfilter-heading .mfilter-head-icon,

.skin20 .box .box-heading .toggle,

.skin20 ul.megamenu li .sub-menu .content,

.skin20 .popup,

.skin20 .banner, .skin20 .banner img, .skin20 .banner a:after,

.skin20 .posts .post .post-media,

.skin20 .posts .button-more,

.skin20 #header .currency-switcher li > ul,

.skin20 #header .view-switcher li > ul,

.skin20 #scroll-top,

.skin20 .product-center .single-add-to-wishlist a:before,

.skin20 .product-center .add-to-cart .quantity #q_up,

.skin20 .product-center .add-to-cart .quantity #q_down,

.skin20 .product-center .add-to-cart .quantity input,

.skin20 .alert,

.skin20 ul.product_list_widget li .product-image img,

.skin20 .widget ul.product_list_widget li .product-image img,

.skin20 ul.product_list_widget li .product-image,

.skin20 .widget ul.product_list_widget li .product-image,

.skin20 ul.megamenu li .sub-menu .content .hover-menu .menu ul ul,

.skin20 #mini-cart .mini-cart-info table td.image img,

.skin20 .prev-next-products .product-nav .product-pop,

.skin20 .product-image,

.skin20 .product-image img,

.skin20 .product-action .product-btn,

.skin20 .prev-next-products .product-nav .product-pop,

.skin20 .post .tags a,

.skin20 #mini-cart.dropdown .dropdown-menu,

.skin20 #mini-cart .dropdown-cart-content,

.skin20 .product-image .onhot,

.skin20 .product-image .onsale,

.skin20 .pagination > li > a,

.skin20 .pagination > li > span {

	border-radius: 0px !important;

	-webkit-border-radius: 0px !important;

	-moz-border-radius: 0px !important;

}



.skin20 #footer,

.skin20 #footer #footer-bottom {

	background: #000;

}



.skin20 #footer #footer-bottom address {

	border-top: 1px solid #4d4d4d;

	color: #fff;

	font-size: 13px;

	padding: 24px 0px 10px 0px;

}



.skin20 #footer > .container {

	padding-top: 90px;

	padding-bottom: 50px;

}



.skin20 #footer .block {

	line-height: 1.5;

	border: 0;

	margin: 0;

	background-color: transparent;

	float: none;

	width: auto;

}



.skin20 #footer .block .block-title {

	margin: 5px 0 20px;

	line-height: 1.2;

	font-size: 16px;

	font-weight: 700;

	color: #fff;

}



.skin20 #footer .block .block-title strong {

	font-weight: 400;

	    padding: 0;

	    font-size: 16px;

	    line-height: inherit;

	    color: #fff;

	    text-transform: none;

	    -webkit-font-smoothing: subpixel-antialiased;

	    -moz-osx-font-smoothing: auto;

}



.skin20 #footer .block .block-content {

	color: #a3a3a3;

}



.skin20 #footer .block ul.links {

	padding: 0px;

	margin: -5px 0px -10px 0px;

	position: relative;

	list-style: none;

}



.skin20 #footer .block ul.links li {

	position: relative;

	padding: 10px 0;

	line-height: 1;

	display: block;

}



.skin20 #footer .block a {

	color: #a3a3a3;

}



.skin20 #footer .block .block-content p {

	line-height: 1.5;

	margin: 0px 0px 15px 0px;

}



@media (max-width: 767px) {

	.skin20 #footer > .container {

		padding-top: 40px;

		padding-bottom: 10px;

	}

}



.skin20 #footer .block .email {

	background: #fff;

	border: 1px solid #ccc;

	height: 26px;

	color: #a3a3a3;

	font-size: 13px;

	background: transparent;

	border-radius: 0;

	padding: 20px;

	display: block;

	width: 100%;

	max-width: 300px;

}



.skin20 #footer .block .subscribe {

    font-size: 12px;

    font-weight: 700;

    line-height: 38px;

    text-transform: uppercase;

    background-color: #fff;

    color: #000;

    padding: 0;

    letter-spacing: 3px;

    transition: all 0.3s;

    box-shadow: 3px 3px 0 rgba(255,255,255,0.5);

    margin: 20px 0 0 0;

    display: block;

    width: 100%;

    border: none;

    max-width: 300px;

}



.skin20 #footer .block .subscribe:hover {

	opacity: 0.9;

}



.skin20.common-home .main-content {

	padding-bottom: 0;

}



.skin20 .tp-bullets.tp-thumbs .bullet {

	opacity: 1;

	border: 3px solid transparent;

	-moz-background-clip: content;     /* Firefox 3.6 */

	-webkit-background-clip: content;  /* Safari 4? Chrome 6? */

	background-clip: content-box;

}



.skin20 .tp-bullets.tp-thumbs .bullet.selected {

	border: 3px solid rgba(255, 255, 255, .5);

}



.skin20 .tp-bullets.tp-thumbs {

	padding: 3px;

	background: none;

}



/* @end */



/* @group Header Type 21 */



@font-face {

  font-family: 'ecommerce';

  src: url('../fonts/ecommerce90c6.html?5510888');

  src: url('../fonts/ecommerce90c6.html?5510888#iefix') format('embedded-opentype'),

       url('../fonts/ecommerce90c6-2.html?5510888') format('woff'),

       url('../fonts/ecommerce90c6-3.html?5510888') format('truetype'),

       url('../fonts/ecommerce90c6-4.html?5510888#revicons') format('svg');

  font-weight: normal;

  font-style: normal;

}



@font-face {

  font-family: 'icomoon';

  src: url('../fonts/icomoon90c6.html?5510888');

  src: url('../fonts/icomoon90c6.html?5510888#iefix') format('embedded-opentype'),

       url('../fonts/icomoon90c6-2.html?5510888') format('woff'),

       url('../fonts/icomoon90c6-3.html?5510888') format('truetype'),

       url('../fonts/icomoon90c6-4.html?5510888#revicons') format('svg');

  font-weight: normal;

  font-style: normal;

}



.header21 {

	background: #000;

	padding: 25px 0px;

	position: relative;

	z-index: 999;

}



@media (max-width: 767px) {

	.header21 {

		padding: 15px 0px;

	}

}



.header21.active.with-fixed {

	position: fixed !important;

	top: 0;

	left: 0;

	right: 0;

	background: #000;

}



.common-home .header21 {

	position: absolute;

	top: 0;

	left: 0;

	right: 0;

	background: none;

}



.common-home .header21-before {

	display: none;

}



.header21 .logo {

	float: left;

}



.header21 .cart-area {

	float: right;

}



.header21 .top-links-area {

	display: inline-block;

	vertical-align: top;

	position: relative;

}



	.header21 .top-links-area .top-links-icon {

		display: none;

	}



	.header21 .top-links-area .links {

		display: inline-block;

		vertical-align: top;

		padding: 14px 21px 0px 0px;

		margin: 0px;

	}



		.header21 .top-links-area .links li {

			display: inline-block;

			vertical-align: top;

			padding: 0 10px;

			font-size: 11px;

			font-weight: 700;

		}



			.header21 .top-links-area .links li:first-child {

				padding-left: 0;

			}



			.header21 .top-links-area .links li:last-child {

				padding-right: 0;

			}



			.header21 .top-links-area .links li a {

				color: #fff;

				text-transform: uppercase;

				font-weight: 600;

				font-size: 11px;

				letter-spacing: 2px;

				text-transform: uppercase;

				transition: all 0.2s ease-in;

				-webkit-transition: all 0.2s ease-in;

				-moz-transition: all 0.2s ease-in;

				-webkit-font-smoothing: subpixel-antialiased;

				-moz-osx-font-smoothing: auto;

			}



				.header21 .top-links-area .links li a:hover {

					text-decoration: underline;

				}



	@media (max-width: 1480px) {

		.header21 .top-links-area .links {

			position: absolute;

			left: -11px;

			top: 100%;

			text-align: left;

			padding: 10px 0;

			background-color: #fff;

			border: 1px solid #ddd;

			display: none;

			z-index: 999;

		}



			.header21 .top-links-area .links:hover,

			.header21 .top-links-area .top-links-icon:hover + .links {

				display: block;

			}



			.header21 .top-links-area .links li {

			    display: block;

			    padding: 0 10px !important;

			    font-weight: 400;

			    font-size: 11px;

			    line-height: 19px;

			}



				.header21 .top-links-area .links li a {

					color: #777 !important;

					letter-spacing: 0.5px;

					white-space: nowrap;

					font-weight: normal;

				}



		.header21 .top-links-area .top-links-icon {

			display: inline-block;

			margin: 13px 20px -2px 0px;

			vertical-align: top;

			padding-bottom: 5px;

			position: relative;

		}



			.header21 .top-links-area .top-links-icon a {

				font-size: 11px;

				-webkit-font-smoothing: subpixel-antialiased;

				-moz-osx-font-smoothing: auto;

				color: #fff;

				letter-spacing: 2px;

				text-transform: uppercase;

				transition: all 0.2s ease-in;

				-webkit-transition: all 0.2s ease-in;

				-moz-transition: all 0.2s ease-in;

			}



				.header21 .top-links-area .top-links-icon a i {

					margin-left: 4px;

				}

	}



.header21 .mobile-toggle {

	display: none;

}



.header21 .searchform-popup {

	display: inline-block;

	vertical-align: top;

	position: relative;

	padding: 15px 39px 0 33px;

	margin: 0px 0px 0px 0px;

}



	.header21 .searchform-popup .search-toggle {

		color: #fff;

		font-size: 20px;

	}



		.header21 .searchform-popup .search-toggle i:before {

			font-family: 'icomoon' !important;

			speak: none;

			font-style: normal;

			font-weight: normal;

			font-variant: normal;

			text-transform: none;

			line-height: 1;

			-webkit-font-smoothing: antialiased;

			-moz-osx-font-smoothing: grayscale;

			content: "\e900";

		}



.header21 .switcher-area {

	display: inline-block;

	vertical-align: top;

	padding: 13px 0px 0px 0px;

}



	.header21 .switcher-area .separator {

		display: none;

	}



	.header21 .switcher-area .accordion-menu {

		padding: 0px;

		margin: 0px 20px 0px 0px;

		display: inline-block;

		vertical-align: top;

	}



		.header21 .switcher-area .accordion-menu > li > a {

			padding: 0;

			margin: 0px;

			color: #fff;

			height: 26px;

			font-size: 11px;

			line-height: 24px;

			font-weight: 600;

			-webkit-font-smoothing: subpixel-antialiased;

			-moz-osx-font-smoothing: auto;

			letter-spacing: 2px;

			text-transform: uppercase;

			background: none;

		}



			.header21 .switcher-area .accordion-menu > li > a i {

				margin-left: 7px;

			}



				.header21 .switcher-area .accordion-menu > li > a i:before {

					content: "\f107";

				}



			.header21 .switcher-area .accordion-menu > li > a img {

				display: inline-block;

				vertical-align: top;

				margin: 7px 4px 0px 0px;

			}



		.header21 .switcher-area .accordion-menu > li ul {

			display: none;

			position: absolute;

			background-color: #fff !important;

			border: 1px solid #ccc;

			box-shadow: 0 0 2px rgba(0,0,0,0.1);

			margin: 0px;

			padding: 4px 0px;

			min-width: 100%;

		}



			.header21 .switcher-area .accordion-menu > li:hover ul {

				display: block;

			}



			.header21 .switcher-area .accordion-menu > li ul li {

				display: block;

				padding: 0 9px;

				line-height: 17px;

				white-space: nowrap;

			}



				.header21 .switcher-area .accordion-menu > li ul li:hover {

					background: #ccc;

				}



				.header21 .switcher-area .accordion-menu > li ul li a {

					padding: 0;

					line-height: 17px;

					color: #777;

					background: none !important;

					font-size: 11px;

					text-transform: uppercase;

				}



					.header21 .switcher-area .accordion-menu > li ul li:hover a {

						color: #fff;

					}



					.header21 .switcher-area .accordion-menu > li ul li a img {

						display: inline-block;

						margin: 3px 5px 0 0;

						vertical-align: top;

					}



	.header21 #mini-cart {

		display: inline-block;

		position: relative;

		top: auto;

		left: auto;

		right: auto;

		bottom: auto;

		margin: 12px 0px 0px 0px;

		padding: 0px 0px 10px 0px;

		vertical-align: top;

		height: auto;

	}



		.header21 #mini-cart .cart-head {

			min-width: 1px;

		}



		.header21 #mini-cart .minicart-icon {

			font-size: 25px;

		}



		.header21 .minicart-icon:before {

			font-family: 'ecommerce' !important;

			content: "\61" !important;

		}



		.header21 #mini-cart .cart-items {

			background: #fff;

			border-radius: 100px;

			-webkit-border-radius: 100px;

			-moz-border-radius: 100px;

			width: 15px;

			height: 15px;

			position: absolute;

			top: auto;

			left: auto;

			right: -5px;

			bottom: -6px;

			font-weight: 400;

			font-size: 10px;

			line-height: 15px;

		}



		.header21 #mini-cart.dropdown .dropdown-menu {

			margin: 0px -13px;

		}



	.header21 .container-megamenu {

		display: inline-block;

		vertical-align: top;

		padding-top: 1px !important;

		-webkit-font-smoothing: subpixel-antialiased;

		-moz-osx-font-smoothing: auto;

	}



		.header21 ul.megamenu,

		.header21 .container-megamenu,

		.header21 .container-megamenu .container,

		.header21 .megamenu-wrapper {

			position: static;

		}



		.header21 .container-megamenu .megamenu-wrapper {

			background: none;

		}



		.header21 ul.megamenu > li {

			margin-right: 18px;

		}



		.header21 ul.megamenu > li > a {

			letter-spacing: 2px;

			color: #fff !important;

			font-size: 11px;

		}



		.header21 ul.megamenu > li > a strong {

			font-weight: 600;

		}



		.header21 ul.megamenu > li.with-sub-menu > a strong:after {

			display: none;

		}



		.header21 .horizontal ul.megamenu > li > .sub-menu {

			left: auto !important;

			right: auto !important;

			margin: -7px -13px 0px -13px;

		}



		.header21 ul.megamenu li .sub-menu .content .hover-menu a {

			font-size: 11px;

		}



	@media (max-width: 991px) {

		.header21 .top-links-area {

			display: none;

		}



		.header21 .currency_language_form {

			display: none;

		}



		.header21 .mobile-toggle {

			display: inline-block;

			vertical-align: top;

			color: #fff;

			margin: 13px 5px 0px 0px;

		}



		.header21 .searchform-popup .search-toggle {

			font-size: 14px;

		}



		.header21 #mini-cart .minicart-icon {

			font-size: 18px;

		}



		.header21 .searchform-popup {

			padding: 14px 19px 0 13px;

		}

	}



.slider20-button {

    font-size: 12px;

    font-weight: 700;

    line-height: 1;

    text-transform: uppercase;

    background-color: #fff;

    color: #000 !important;

    padding: 20px 45px;

    letter-spacing: 3px;

    transition: all .3s;

    box-shadow: 3px 3px 0 rgba(255,255,255,0.5);

    margin: 20px 0;

    display: inline-block;

}



.slider20-button:hover {

	opacity: 0.85;

}



/* @end */



/* @group Full width image */



.full-width-image{text-align:center;padding:200px 0;background-size:cover}

.full-width-image > h3{margin: 0 0 5px;line-height: 1.35;font-size:90px;color:#fff;font-weight:600;letter-spacing:-5px}

.full-width-image > a{display:inline-block;font-size:12px;font-weight:600;line-height:1;text-transform:uppercase;background-color:#fff;color:#000;padding:20px 45px;letter-spacing:3px;transition:all .3s;box-shadow:3px 3px 0 rgba(255,255,255,0.5);margin:20px 0}

.full-width-image > a:hover{text-decoration:none;opacity:.85}



@media (max-width: 767px) {

	.full-width-image{padding:100px 0}

	.full-width-image > h3{font-size:35px;letter-spacing:-1px}

	.full-width-image > a {

	    font-size: 8px;

	    padding: 10px 20px;

	    margin: 10px 0;

	}

}



/* @end */



/* @group Skin 20 home products */



@media (min-width: 767px) {

	.skin20-products {

		padding-left: 30px;

		padding-right: 30px;

	}

}



.skin20-products .product-image {

	border-radius: 0px;

	-webkit-border-radius: 0px;

	-moz-border-radius: 0px;

	padding: 0px;

	border: none;

}



.skin20-products .product-image img {

	border-radius: 0px;

	-webkit-border-radius: 0px;

	-moz-border-radius: 0px;

}



.skin20-products {

	padding-top: 90px;

	padding-bottom: 51px;

}



.skin20-products .title-box {

	background: none;

	font-size: 40px;

	font-weight: 700;

	line-height: 1;

	text-align: center;

	color: #000;

	text-transform: uppercase;

	padding: 0px 0px 70px 0px;

	-webkit-font-smoothing: subpixel-antialiased;

	-moz-osx-font-smoothing: auto;

}



.skin20-products .owl-dots {

	margin-top: 34px;

}



.skin20-products .owl-dot {

	background: #fff !important;

	border: 2px solid #000 !important;

	opacity: 1 !important;

}



.skin20-products .owl-dot.active {

	background: #000 !important;

}



@media (max-width: 767px) {

	.skin20-products {

		padding-top: 40px;

	}



	.skin20-products .title-box {

		font-size: 25px;

		padding: 0px 0px 40px 0px;

	}

}



/* @end */



/* @group Skin 20 products tabs */



.index20-products-tabs {

	display: flex;

	-webkit-font-smoothing: subpixel-antialiased;

	-moz-osx-font-smoothing: auto;

}



.index20-products-tabs .category-list {

	border-right: 1px solid #dcdcdc;

	padding-top: 70px;

	padding-bottom: 70px;

}



.index20-products-tabs .category-list .description {

	font-size: 20px;

	font-weight: 600;

	color: gray;

	margin-bottom: 10px;

}



.index20-products-tabs .category-list ul {

	list-style: none;

	padding: 0px;

	margin: 0px;

}



.index20-products-tabs .category-list ul li {

	padding: 10px 0;

	line-height: 20px;

}



.index20-products-tabs .category-list ul li a {

	display: block;

	text-transform: uppercase;

	color: #000;

	font-weight: 700;

	font-size: 12px;

	position: relative;

	padding-left: 20px;

	background: url(../images/tab.html) 0 4px no-repeat;

}



.index20-products-tabs .category-list ul li.active a {

	background: url(../images/tab-active.html) 0 4px no-repeat;

}



.index20-products-tabs .category-detail {

	padding-left: 100px;

	padding-top: 70px;

	padding-bottom: 70px;

}



@media (max-width: 1200px) {

	.index20-products-tabs .category-detail {

		padding-left: 50px;

	}

}



.index20-products-tabs .tab-content {

	padding: 0px;

	background: none;

	border-radius: 0;

	margin: 0px;

	border: none;

	box-shadow: none;

}



.index20-products-tabs .tab-content .product-action {

	display: none;

}



.index20-products-tabs .tab-content .rating-wrap {

	display: none;

}



.index20-products-tabs .products .product {

	margin: 10px 0px 0px 0px;

}



.index20-products-tabs .products .hidden-product {

	display: none;

}



.index20-products-tabs .products .row {

	margin: 0px -5px;

}



.index20-products-tabs .products .row > div {

	padding-left: 5px;

	padding-right: 5px;

}



.index20-products-tabs .products .row > div:nth-child(5n+1) {

	clear: both;

}



@media (max-width: 767px) {

	.index20-products-tabs .products .row > div {

		clear: none !important;

	}



	.index20-products-tabs .products .row > div:nth-child(2n+1) {

		clear: both !important;

	}

}



.index20-products-tabs .product-image {

	margin: 0px 0px 11px 0px;

}



.index20-products-tabs .product h3 {

	margin: 0px 0px 11px 0px;

	font-size: 12px;

	font-weight: 600;

	text-transform: uppercase;

}



.index20-products-tabs .product h3 a {

	color: #000;

}



.index20-products-tabs .price {

	padding: 0px;

	margin: 0px 0px 15px 0px;

	font-size: 18px;

}



@media (max-width: 767px) {

	.index20-products-tabs .category-list {

		padding-bottom: 20px;

		padding-top: 50px;

	}



	.index20-products-tabs {

		display: block;

	}



	.index20-products-tabs .category-list {

		border: none;

	}



	.index20-products-tabs .category-detail {

		padding-left: 10px;

		padding-top: 0;

		padding-bottom: 50px;

	}



	.index20-products-tabs .category-list ul li {

		display: inline-block;

		margin-right: 30px;

	}

}



.skin20-load-more-products {

	display: inline-block;

    font-size: 12px;

    font-weight: 600;

    line-height: 1;

    text-transform: uppercase;

    background-color: #000;

    color: #fff !important;

    padding: 20px 45px;

    letter-spacing: 3px;

    transition: all .3s;

    box-shadow: 3px 3px 0 rgba(0,0,0,0.5);

    margin: 30px auto;

}



.skin20-load-more-products:hover {

	opacity: 0.9;

}





@media (max-width: 767px) {

	.skin20-load-more-products {

	    font-size: 8px;

	    padding: 10px 20px;

	}

}



.skin20-loader-products {

	background: url(../images/loader.gif) 50% center no-repeat;

	height: 112px;

	display: none;

}



.skin20-loader-products.active {

	display: block;

}



@media (max-width: 767px) {

	.skin20-loader-products {

		height: 88px;

	}

}



/* @end */



/* @group Skin20 parallax */



.skin20-parallax {

	padding-left: 50%;

	padding-right: 5%;

	padding-bottom: 97px;

	padding-top: 95px;

}



.skin20-parallax h3 {

	padding: 0px 0px 20px 0px;

	margin: 0px;

	color: #fff;

	font-size: 60px;

	line-height: 1.35;

	font-weight: 600;

	letter-spacing: -4px;

}



.skin20-parallax p {

	padding: 0px 0px 35px 0px;

	margin: 0px;

}



.skin20-parallax .button-parallax {

	font-size: 12px;

    font-weight: 600;

    line-height: 1;

    text-transform: uppercase;

    background-color: #fff;

    color: #000;

    padding: 20px 45px;

    letter-spacing: 3px;

    transition: all .3s;

    box-shadow: 3px 3px 0 rgba(255,255,255,0.5);

    margin: 0;

    display: inline-block;

}



.skin20-parallax .button-parallax:hover {

	opacity: 0.85;

}



.background-size-cover > div {

	background-size: cover;

}



@media (max-width: 1100px) {

	.skin20-parallax h3 {

		font-size: 40px;

	}

}



@media (max-width: 767px) {

	.skin20-parallax h3 {

		font-size: 30px;

		padding-bottom: 10px;

	}



	.skin20-parallax .button-parallax {

	    font-size: 8px;

	    padding: 10px 20px;

	}



	.skin20-parallax p {

		padding-bottom: 20px;

	}



	.skin20-parallax {

		padding-left: 35%;

		padding-top: 30px;

		padding-bottom: 30px;

	}

}



/* @end */



/* @group Vertical product tabs */



@media (min-width: 767px) {

	.vertical-tabs .nav-tabs {

		width: 150px;

		float: left;

		bottom: 0;

		right: -1px;

		text-align: right;

		border: none;

		position: relative;

	}



	.vertical-tabs .nav-tabs > li {

		float: none;

		margin: 0px 0px 1px 0px !important;

		padding: 0 !important;

	}



	.vertical-tabs .nav-tabs > li > a {

		display: block;

		margin: 0px;

		border-top: 1px solid #eee !important;

		border-left: 3px solid #eee;

		border-right: none;

		border-bottom: 1px solid #eee;

		border-radius: 5px 0 0 5px;

		-webkit-border-radius: 5px 0 0 5px;

		-moz-border-radius: 5px 0 0 5px;

		padding: 9px 15px !important;

		line-height: 1;

		font-size: 14px;

	}



	.vertical-tabs .nav-tabs > li > a:hover,

	.vertical-tabs .nav-tabs > li > a:focus {

		padding: 9px 15px !important;

	}



	.vertical-tabs .nav-tabs > li.active > a {

		border-top: 1px solid #eee !important;

		border-left: 3px solid #08c;

		border-right: none;

		border-bottom: 1px solid #eee;

	}



	.vertical-tabs .tab-content {

		margin-left: 150px;

		border-top: 1px solid #eee;

		border-radius: 0 4px 4px 4px;

		-webkit-border-radius: 0 4px 4px 4px;

		-moz-border-radius: 0 4px 4px 4px;

	}

}



/* @end */



/* @group Accordion product tabs */



.accordion-product-tab {

	padding: 44px 0px 68px 0px;

}



.accordion-product-tab .panel {

	margin: 0px;

	padding: 0px;

	box-shadow: none;

	-webkit-box-shadow: none;

	-moz-box-shadow: none;

}



.accordion-product-tab .panel-heading {

	margin: 5px 0px 0px 0px;

	padding: 0px;

	border: none;

	background: none;

}



.accordion-product-tab .panel-heading a {

	background: #08c;

	color: #fff;

	display: block;

	position: relative;

	padding: 12px 20px 12px 10px;

	font-size: 15px;

	min-height: 20px;

	border: 0;

	border-left: 3px solid #08c;

	border-radius: 5px;

	font-weight: 400;

	text-transform: none;

	transition: all 0.2s ease-in;

	-webkit-transition: all 0.2s ease-in;

	-moz-transition: all 0.2s ease-in;

}



.accordion-product-tab .panel-heading a.collapsed {

	background: #f4f4f4;

	color: #08c;

}



.accordion-product-tab .panel-heading a:after {

	content: "\f0d7";

	position: absolute;

	top: 15px;

	right: 18px;

	font: normal normal normal 14px/1 FontAwesome;

	font-size: inherit;

	text-rendering: auto;

	-webkit-font-smoothing: antialiased;

	-moz-osx-font-smoothing: grayscale;

}



.accordion-product-tab .panel-heading a.collapsed:after {

	content: "\f0da";

}



.accordion-product-tab .panel-body {

	margin: 0px;

	background: none;

	border: none;

	padding: 20px 15px 0px 15px;

}



/* @end */



/* @group Sticky tabs */



.sticky-tabs {



}



.sticky-tabs .tab-content {

	padding: 0px;

}



.sticky-tabs .tab-content > div {

	display: block;

	visibility: visible;

	position: relative;

	opacity: 1;

	top: auto;

	border-bottom: 1px solid #eee;

	padding: 30px 15px 10px 15px;

}



.sticky-tabs .tab-content > div:last-child {

	border-bottom: none;

}



.sticky-nav-tabs {

	position: fixed;

	top: 46px;

	left: 0;

	right: 0;

	padding: 10px 0;

	z-index: 99;

	background-color: #fff;

	box-shadow: 0 1px 2px rgba(0,0,0,0.1);

	display: none;

}



@media (max-width: 1159px) {

	.sticky-nav-tabs {

		top: 0 !important;

	}

}



@media (max-width: 767px) {

	.sticky-nav-tabs {

		display: none !important;

	}

}



.sticky-nav-tabs .nav {

	margin: 0px -10px;

	position: relative;

}



.sticky-nav-tabs .nav li {

	display: inline-block;

	padding: 0px 10px;

}



.sticky-nav-tabs .nav li a {

	padding: 0px;

	background: none;

	border: none;

	font-size: 13px;

}



/* @end */



/* @group Sticky product */



.sticky-product{

	position:fixed;

	top:0;

	left:0;

	width:100%;

	z-index:100;

	background-color:#fff;

	box-shadow:0 3px 5px rgba(0,0,0,0.08);

	padding:15px 0 15px;

	display: none;

	z-index: 99;

}



@media (max-width: 767px) {

	.sticky-product {

		display: none !important;

	}

}



@media (max-width: 1159px) {

	.sticky-product {

		top: 0 !important;

	}

}



.sticky-product > .container{

	position:relative

}



.sticky-product .sticky-image,

.sticky-product .sticky-detail{

	display:inline-block;

	vertical-align:middle;

	margin-right:15px

}



.sticky-product .sticky-image img {

	max-width: 50px;

}



.sticky-product .sticky-detail .product-name-area,

.sticky-product .ratings,

.sticky-product .sticky-detail .availability{

	display:inline-block;

	vertical-align:top;

	margin:0;

	margin-right:15px

}



.sticky-product .sticky-detail .product-name-area .product-name,

.sticky-product .ratings,

.sticky-product .sticky-detail .availability{

	line-height:25px;

}



.sticky-product .sticky-detail .product-name-area .product-name {

	margin: 0px;

	padding: 0px 0px 5px 0px;

	color: #777;

	font-size:16px;

	font-weight:600

}



.sticky-product .sticky-detail .availability span{

	font-size:14px;

	font-weight:400

}



.sticky-product .price-box {

	padding: 2px 0px 5px 0px;

}



.sticky-product .price-box p {

	padding: 0px 5px 0px 0px;

	margin: 0px;

	display: inline-block;

	vertical-align: middle;

}



.sticky-product .price-box .price {

	margin: 0px;

}



.sticky-product .price-box .old-price .price {

    color: #999;

    text-decoration: line-through;

    font-size: 14px;

    vertical-align: middle;

}



.sticky-product .add-to-cart{

	position:absolute;

	right:0;

	top:50%;

	margin-top:-19px

}



.sticky-product .add-to-cart button {

	display: inline-block;

	height: 38px;

	width: 160px;

	min-width: 110px;

	vertical-align: middle;

}



.sticky-product .add-to-cart button i {

	margin-right: 10px;

}



/* @end */







/* @group 1. MegaMenu Horizontal

------------------*/



#menu {

	position: relative;

	overflow: visible;

}



	#menu .background-menu {

		position: absolute;

		top: 0;

		left: 0;

		right: 0;

		bottom: 0;

		z-index: -1;

	}



	.megaMenuToggle {

		display: none !important;

	}



	.container-megamenu,

	.container-megamenu .container {

		padding-top: 0px !important;

		padding-bottom: 0px !important;

		min-height: 1px !important;

		z-index: 999;

		position: relative;

    width: auto;

	}



  .container .container {

    padding-left: 0;

    padding-right: 0;

  }



		.container-megamenu.vertical {

			z-index: 998;

		}



		.container-megamenu.container .container {

			width: auto !important;

			display: block !important;

		}



	.megamenu-wrapper {

		position: relative;

		z-index: 25;

		/*background: #9AC93D;*/

        border-top: 1px solid #cacaca;

	}



		.header2 .megamenu-wrapper {

			background: none;

		}



		ul.megamenu {

			margin: 0px;

			padding: 0px;

			list-style: none;

			position: relative;

			z-index: 0;

			opacity: 1;

		}



			ul.megamenu > li {

				float: left;

				width: auto;

			/*	margin-right: 26px;*/

			}



				ul.megamenu > li:first-child {

					background: none;

				}



				ul.megamenu > li.pull-right {

					float: right;

					margin-right: 0;

					margin-left: 26px;

				}



				ul.megamenu > li .close-menu,

				ul.megamenu > li .open-menu {

					display: none;

				}



				/* @group Search */



				ul.megamenu > li.search {

					background: none;

				}



					#top ul.megamenu > li.search .search_form, ul.megamenu > li.search .search_form {

						padding: 0px;

						margin: 8px;

					}



						#top ul.megamenu > li.search .search_form input, ul.megamenu > li.search .search_form input {

							height: 29px;

							min-height: 29px;

							border: none;

						}



						ul.megamenu > li.search .button-search2 {

							top: 6px;

							right: 8px;

						}



				/* @end */



				ul.megamenu > li > a {

					font-size: 1em;

					font-weight: bold;

					line-height: 2em;

					padding: 0.5em 0.5em 0.5em 1em;

					text-transform: uppercase;

					display: block;

					height: 46px;

					color: #84ac34;

					position: relative;

				}



					ul.megamenu > li > a strong {

						font-weight: bold;

					}



					ul.megamenu > li.with-sub-menu > a strong:after {

						content: "\f107";

						display: inline-block;

						font: normal normal normal 14px/1 FontAwesome;

						font-size: inherit;

						text-rendering: auto;

						-webkit-font-smoothing: antialiased;

						-moz-osx-font-smoothing: grayscale;

						transform: translate(0, 0);

						margin-left: 5px;

					}



					ul.megamenu .megamenu-label {

					     position: absolute;

					     top: -1px;

					     right: 0;

					     height: 13px;

					     padding: 3px 2px 1px;

					     font-size: 9px;

					     line-height: 1;

					     font-family: Arial;

					     color: #fff;

					     border-radius: 2px;

					     -webkit-border-radius: 2px;

					     -moz-border-radius: 2px;

					}



						ul.megamenu .megamenu-label span:before {

							display: inline-block;

							font-family: "Elusive-Icons";

							font-size: 5px;

							position: absolute;

							width: 4px;

							height: 6px;

							margin: auto;

							content: "\f126";

							left: -4px;

							text-align: right;

							top: 0;

							bottom: 0;

							content: "\f125";

							left: 2px;

							bottom: -3px;

							top: auto;

							width: auto;

							height: auto;

						}



					     ul.megamenu ul .megamenu-label {

					          display: inline-block;

					          position: relative;

					          top: -1px !important;

					          margin-left: 9px;

					          left: 0 !important;

					          right: 0 !important;

					     }



					     	ul.megamenu ul .megamenu-label span:before {

					     		left: -3px;

					     		top: 5px;

					     		bottom: auto;

					     		-ms-transform: rotate(90deg); /* IE 9 */

					     		-webkit-transform: rotate(90deg); /* Chrome, Safari, Opera */

					     		transform: rotate(90deg);

					     	}



					ul.megamenu > li > a:hover,

					ul.megamenu > li.active > a,

					ul.megamenu > li.home > a,

					ul.megamenu > li:hover > a {

						color: #99cee8;

					}



					ul.megamenu > li > a > .fa-home {

						display: block;

						font-size: 16px;

						margin-top: 1px;

					}



					ul.megamenu > li > a img {

						margin-right: 10px;

						height: 27px;

						vertical-align: middle;

					}



					/* @group Description */



					ul.megamenu > li > a.description {

						font-size: 14px;

						padding: 10px 20px 11px 21px;

						line-height: 1;

					}



						ul.megamenu > li > a.description strong {

							font-size: 14px;

						}



						ul.megamenu > li > a.description img {

							float: left;

						}



						ul.megamenu > li > a.description .description {

							font-size: 11px;

							opacity: 0.9;

						}



						ul.megamenu > li > a.description .description-left {

							float: left;

							width: auto;

						}



					/* @end */



					/* @group Submenu */



					ul.megamenu > li > .sub-menu {

						position: absolute;

						z-index: -20;

						visibility: hidden;

						right: 0;

					}



						ul.megamenu > li.active > .sub-menu {

							z-index: 20;

							right: auto;

							visibility: visible;

						}



						ul.megamenu > li > .sub-menu > .content {

							display: none;

						}



							ul.megamenu > li.active > .sub-menu > .content {

								display: block;

							}



							ul.megamenu > li > .sub-menu > .content > .arrow {

								display: none;

							}



						/* @group Transitions */



						/* @group Transition fade */



						ul.megamenu.fade > li > .sub-menu > .content {

							display: block;

							opacity: 0;

							filter: alpha(opacity=0);

							visibility: hidden;

							-webkit-transition: all 0.2s ease-out;

							-moz-transition: all 0.2s ease-out;

							-o-transition: all 0.2s ease-out;

							-ms-transition: all 0.2s ease-out;

							transition: all 0.2s ease-out;

						}



							ul.megamenu.fade > li.active > .sub-menu > .content {

								display: block;

								opacity: 1;

								filter: alpha(opacity=100);

								visibility: visible;

							}



						/* @end */



						/* @group Transition shift up */



						ul.megamenu.shift-up > li > .sub-menu > .content {

							display: block;

							opacity: 0;

							filter: alpha(opacity=0);

							visibility: hidden;

							-webkit-transition: all 0.2s ease-out;

							-moz-transition: all 0.2s ease-out;

							-o-transition: all 0.2s ease-out;

							-ms-transition: all 0.2s ease-out;

							transition: all 0.2s ease-out;

							margin-top: 25px;

						}

							ul.megamenu.shift-up > li.active > .sub-menu > .content {

								margin-top: 0px;

								display: block;

								opacity: 1;

								filter: alpha(opacity=100);

								visibility: visible;

							}



						/* @end */



						/* @group Transition shift down */



						ul.megamenu.shift-down > li > .sub-menu > .content {

							display: block;

							opacity: 0;

							filter: alpha(opacity=0);

							visibility: hidden;

							-webkit-transition: all 0.2s ease-out;

							-moz-transition: all 0.2s ease-out;

							-o-transition: all 0.2s ease-out;

							-ms-transition: all 0.2s ease-out;

							transition: all 0.2s ease-out;

							margin-top: -25px;

						}

							ul.megamenu.shift-down > li.active > .sub-menu > .content {

								margin-top: 0px;

								display: block;

								opacity: 1;

								filter: alpha(opacity=100);

								visibility: visible;

							}



					     /* @end */



						/* @group Transition shift left */



						ul.megamenu.shift-left > li > .sub-menu > .content {

							display: block;

							opacity: 0;

							filter: alpha(opacity=0);

							visibility: hidden;

							-webkit-transition: all 0.2s ease-out;

							-moz-transition: all 0.2s ease-out;

							-o-transition: all 0.2s ease-out;

							-ms-transition: all 0.2s ease-out;

							transition: all 0.2s ease-out;

							left: 30px;

						}

							ul.megamenu.shift-left > li.active > .sub-menu > .content {

								left: 0px;

								display: block;

								opacity: 1;

								filter: alpha(opacity=100);

								visibility: visible;

							}



						/* @end */



						/* @group Transition shift right */



						ul.megamenu.shift-right > li > .sub-menu > .content {

							display: block;

							opacity: 0;

							filter: alpha(opacity=0);

							visibility: hidden;

							-webkit-transition: all 0.2s ease-out;

							-moz-transition: all 0.2s ease-out;

							-o-transition: all 0.2s ease-out;

							-ms-transition: all 0.2s ease-out;

							transition: all 0.2s ease-out;

							left: -30px;

						}

							ul.megamenu.shift-right > li.active > .sub-menu > .content {

								left: 0px;

								display: block;

								opacity: 1;

								filter: alpha(opacity=100);

								visibility: visible;

							}



						/* @end */



						/* @group Transition flipping */



						ul.megamenu.flipping > li > .sub-menu > .content {

							display: block;

							filter: alpha(opacity=0);

							visibility: hidden;

							opacity: 0;

							-webkit-transform-origin: 50% 0%;

							-o-transform-origin: 50% 0%;

							transform-origin: 50% 0%;

							-webkit-transform: perspective(350px) rotateX(-90deg);

							-o-transform: perspective(350px) rotateX(-90deg);

							transform: perspective(350px) rotateX(-90deg);

							-webkit-transition: all 0.2s ease-out;

							-moz-transition: all 0.2s ease-out;

							-o-transition: all 0.2s ease-out;

							-ms-transition: all 0.2s ease-out;

							transition: all 0.2s ease-out;

						}



							ul.megamenu.flipping > li.active > .sub-menu > .content {

								display: block;

								opacity: 1;

								filter: alpha(opacity=100);

								visibility: visible;

								-webkit-transform: perspective(350px) rotateX(0deg);

								-o-transform: perspective(350px) rotateX(0deg);

								transform: perspective(350px) rotateX(0deg);

								-webkit-transition:0.2s linear 0s;

								-o-transition:0.2s linear 0s;

								transition:0.2s linear 0s;

							}



						/* @end */



						/* @group Transition slide */



						ul.megamenu.slide > li > .sub-menu > .content {

							display: block;

							opacity:0;

							filter: alpha(opacity=0);

							visibility: hidden;

							-webkit-transform-origin: top;

							-moz-transform-origin: top;

							-o-transform-origin: top;

							-ms-transform-origin: top;

							transform-origin: top;



							-webkit-animation-fill-mode: forwards;

							-moz-animation-fill-mode: forwards;

							-ms-animation-fill-mode: forwards;

							-o-animation-fill-mode: forwards;

							animation-fill-mode: forwards;



							-webkit-transform: scale(1, 0);

							-moz-transform: scale(1, 0);

							-o-transform: scale(1, 0);

							-ms-transform: scale(1, 0);

							transform: scale(1, 0);



							-webkit-transition: all 0.2s ease-out;

							-moz-transition: all 0.2s ease-out;

							-o-transition: all 0.2s ease-out;

							-ms-transition: all 0.2s ease-out;

							transition: all 0.2s ease-out;

						}



							ul.megamenu.slide > li.active > .sub-menu > .content {

								-webkit-transform: scale(1, 1);

								-moz-transform: scale(1, 1);

								-o-transform: scale(1, 1);

								-ms-transform: scale(1, 1);

								transform: scale(1, 1);

								opacity:1 !important;

								filter: alpha(opacity=100) !important;

								visibility: visible !important;

							}



						/* @end */



						/* @end */



						.horizontal ul.megamenu > li > .sub-menu {

							max-width: 100%;

						}



						ul.megamenu li .sub-menu .content {

							padding: 20px;

							background: #fff;

							border-top: 1px solid #9ac93d;

							border-radius: 0px;

							-webkit-border-radius: 0px ;

							-moz-border-radius: 0px ;

							box-shadow: 0 10px 25px rgba(0, 0, 0, 0.15);

							-webkit-box-shadow: 0 10px 25px rgba(0, 0, 0, 0.15);

							-moz-box-shadow: 0 10px 25px rgba(0, 0, 0, 0.15);

							box-sizing: content-box !important;

							-moz-box-sizing: content-box !important;

							-webkit-box-sizing: content-box !important;

						}



							ul.megamenu li.type2 .sub-menu .content {

								background: #b70505;

								border: none !important;

							}



							ul.megamenu .sub-menu .content > .row {

								padding-top: 11px;

							}



							ul.megamenu .sub-menu .content > .border {

								padding-top: 7px;

							}



								ul.megamenu .sub-menu .content > .row:first-of-type {

									padding: 0px;

								}



							/* @group Product */



							ul.megamenu li .product {

								text-align: center;

								position: relative;

							}



								ul.megamenu li .product .image {

									padding: 0px;

								}



									ul.megamenu li .product .image img {

										max-width: 100%;

									}



								ul.megamenu li .product .name {

									padding: 7px 0px 8px 0px;

								}



								ul.megamenu li .product .price {

									font-size: 1.4286em;

									color: #444;

									font-weight: 600;

								}



							/* @end */



                              /* @group Products */



                              .products-carousel-overflow {

                                   overflow: hidden;

                                   margin: -2px;

                                   padding: 2px;

                                   position: relative;

                              }



                                   .products-carousel-overflow .box-heading {

                                        float: left;

                                        margin: 5px 15px 10px 0px;

                                        padding: 0px;

                                        font-size: 18px;

                                        line-height: 20px;

                                        font-weight: 400;

                                        position: relative;

                                        z-index: 1;

                                   }



                                   .products-carousel-overflow .strip-line {

                                        background: url(../img/patterns/heading/01.html) 0px 50% repeat-x;

                                        height: 35px;

                                        overflow: hidden;

                                   }



                                   .products-carousel-overflow > .prev,

                                   .products-carousel-overflow > .next {

                                   	float: right;

                                   	margin: 2px 0px 0px 5px;

                                   	width: 28px;

                                   	height: 28px;

                                   	border-radius:         2px;

                                   	-moz-border-radius:    2px;

                                   	-webkit-border-radius: 2px;

                                   	background: #43c6bc; /* Old browsers */

                                   	background: -moz-linear-gradient(top, #43c6bc 0%, #59d4cc 0%, #43c6bc 99%); /* FF3.6+ */

                                   	background: -webkit-gradient(linear, left top, left bottom, color-stop(0%,#43c6bc), color-stop(0%,#59d4cc), color-stop(99%,#43c6bc)); /* Chrome,Safari4+ */

                                   	background: -webkit-linear-gradient(top, #43c6bc 0%,#59d4cc 0%,#43c6bc 99%); /* Chrome10+,Safari5.1+ */

                                   	background: -o-linear-gradient(top, #43c6bc 0%,#59d4cc 0%,#43c6bc 99%); /* Opera 11.10+ */

                                   	background: -ms-linear-gradient(top, #43c6bc 0%,#59d4cc 0%,#43c6bc 99%); /* IE10+ */

                                   	background: linear-gradient(to bottom, #43c6bc 0%,#59d4cc 0%,#43c6bc 99%); /* W3C */

                                   	cursor: pointer;

                                   	position: relative;

                                   	z-index: 1;

                                   }



                                   	.products-carousel-overflow > .prev {

                                   		margin-left: 15px;

                                   	}



                                   	.products-carousel-overflow > .prev span,

                                   	.products-carousel-overflow > .next span {

                                   		display: block;

                                   		width: 8px;

                                   		height: 14px;

                                   		margin: 8px auto 0px auto;

                                   		background: url(../img/left.html) no-repeat;

                                   	}



                                   		.products-carousel-overflow > .next span {

                                   			background: url(../img/right.html) no-repeat;

                                   		}



                                   .products-carousel-overflow .clear {

                                        clear: left;

                                        width: 100%;

                                        height: 16px;

                                   }



                              /* @end */



                              /* @group Manufacturer */



							ul.manufacturer {

								list-style: none;

								margin: -10px 0px 0px 0px !important;

								padding: 0px;

								position: relative;

							}



								ul.manufacturer li {

									display: inline-block;

									margin: 10px 5px 0px 0px;

								}



									ul.manufacturer li a {

										display: block;

										font-size: 14px;

										padding: 2px 8px;

										border: 1px solid #e6e6e6;

										border-radius:         2px;

										-moz-border-radius:    2px;

										-webkit-border-radius: 2px;

									}



							/* @end */



							/* @group Open Categories */



							ul.megamenu li .sub-menu .content .open-categories,

							ul.megamenu li .sub-menu .content .close-categories {

								display: none;

							}



							/* @end */



							/* @group Static Menu */



							ul.megamenu li .sub-menu .content .static-menu a.main-menu {

								font-size: 1em;

								line-height: 24px;

								font-weight: 600;

								text-transform: uppercase;

								display: block;

								position: relative;

								margin-top: -5px;

							}



								ul.megamenu li .sub-menu .content .static-menu a.main-menu:hover {

									text-decoration: underline;

								}



							ul.megamenu li .sub-menu .content .static-menu .left-categories-image-right {

							     float: left;

							     width: 54%;

							     padding-right: 6%;

							}



							ul.megamenu li .sub-menu .content .static-menu .right-categories-image-right {

							     float: left;

							     width: 40%;

							     text-align: right;

							     padding-top: 5px;

							}



							ul.megamenu li .sub-menu .content .static-menu .left-categories-image-left {

							     float: left;

							     width: 40%;

							     padding-right: 4%;

							     padding-top: 5px;

							}



							ul.megamenu li .sub-menu .content .static-menu .right-categories-image-left {

							     float: left;

							     width: 56%;

							}



							ul.megamenu li .sub-menu .content .static-menu .menu ul {

								list-style: none;

								margin: 0px;

								padding: 0px;

							}



								ul.megamenu li .sub-menu .content .static-menu > .menu > ul > li {

									padding-top: 20px;

								}



									ul.megamenu li .sub-menu .content .static-menu > .menu > ul > li:first-child {

										padding-top: 0px;

									}



								ul.megamenu li .sub-menu .content .static-menu .menu ul ul {

									padding: 3px 0px 0px 0px;

									position: relative;

									margin-bottom: -7px;

								}



								     ul.megamenu li .sub-menu .content .static-menu .menu ul .categories-image-right ul a {

								          display: block;

								     }



									ul.megamenu li .sub-menu .content .static-menu .menu ul ul li a {

										display: block;

										    font-size: 0.9em;

										    line-height: 20px;

										    padding: 1px 0;

										    color: #777777;

										    font-weight: 400;

										    margin: 0 ;

									}



										ul.megamenu li .sub-menu .content .static-menu .menu ul ul li a:hover {

											text-decoration: underline;

										}



							/* @end */



							/* @group Hover Menu */



							ul.megamenu li .sub-menu .content .hover-menu a.main-menu {

								display: block;

							}



							ul.megamenu li .sub-menu .content .hover-menu .menu ul {

								list-style: none;

								margin: -15px;

								padding: 0px;

								position: relative;

							}



								ul.megamenu li .sub-menu .content .hover-menu .menu ul ul {

									display: none;

									margin: -38px 0px 0px 0px;

									min-width: 170px;

									padding: 5px;

									position: absolute;

									z-index: 10;

									left: 100%;

									background: #fff;

									border-radius: 6px;

									-webkit-border-radius: 6px;

									-moz-border-radius: 6px;

									box-shadow: 0 10px 25px rgba(0, 0, 0, 0.15);

									-webkit-box-shadow: 0 10px 25px rgba(0, 0, 0, 0.15);

									-moz-box-shadow: 0 10px 25px rgba(0, 0, 0, 0.15);

								}



									ul.megamenu li.type2 .sub-menu .content .hover-menu .menu ul ul {

										background: #b70505;

										min-width: 160px;

									}



									ul.megamenu li .sub-menu .content .hover-menu .menu ul ul.active {

										display: block;

									}



									ul.megamenu li .sub-menu .content .hover-menu .menu ul ul li {

										position: relative;

									}



								ul.megamenu li .sub-menu .content .hover-menu a {

									font-weight: 400;

									padding: 6px 14px 6px 7px;

									font-size: 0.9em;

									line-height: 20px;

									color: #777;

									border-bottom: 1px solid rgba(255, 255, 255, 0.2);

									white-space: nowrap;

									display: block;

								}



									ul.megamenu li.type2 .sub-menu .content .hover-menu a {

										color: #fff;

									}



										ul.megamenu li.type2 .sub-menu .content .hover-menu li:last-of-type > a {

											border: none;

										}



									ul.megamenu li .sub-menu .content .hover-menu a:hover {

										background: #f4f4f4;

									}



										ul.megamenu li.type2 .sub-menu .content .hover-menu a:hover {

											background: rgba(255, 255, 255, .1);

										}



						     /* @end */



					/* @end */



/* @end */



	/* @group 2. MegaMenu Mobile Heading */



	.megaMenuToggle {

		display: none !important;

		cursor: pointer;

	}



		.megamenuToogle-wrapper {

			position: relative;

			z-index: 26;

			background: #006fa4;

		}



			.vertical .megamenuToogle-wrapper {

				background: #f5f5f5;

				border-radius: 6px 6px 0px 0px;

				-moz-border-radius: 6px 6px 0px 0px;

				-webkit-border-radius: 6px 6px 0px 0px;

			}



			.megamenuToogle-wrapper .container {

				color: #fff;

				font-size: 16px;

				padding: 10px 20px 9px 14px !important;

			}



				.vertical .megamenuToogle-wrapper .container {

					background-color: #f5f5f5;

					color: #777;

					font-size: 13px;

					font-weight: 700;

					line-height: 1;

					padding: 14px 15px !important;

					border-radius: 5px 5px 0 0;

					margin: 0;

					border-bottom: 1px solid #ddd;

				}



				.megamenuToogle-wrapper .container > div {

					display: none;

				}



	/* @end */



	/* @group 3. MegaMenu Vertical */



	.vertical {

		border: 1px solid #ddd;

		background: #fbfbfb;

		border-radius: 6px;

		-webkit-border-radius: 6px;

		-moz-border-radius: 6px;

	}



	.vertical #menuHeading {

	}



		.vertical .megamenuToogle-wrapper {

			z-index: 24;

		}



		.vertical .megamenu-wrapper {

			display: block !important;

			background: none !important;

			position: relative;

			z-index: 23;

		}



			.vertical ul.megamenu > li {

				display: block;

				float: none !important;

				width: auto;

				background: none;

				border-top: 1px solid #ddd;

				/* JH position: relative; */

				margin: 0px 10px;

			}



				.vertical ul.megamenu > li:first-child {

					border: none;

				}



				.vertical ul.megamenu > li.home,

				.vertical ul.megamenu > li.search {

					display: none;

				}



				.vertical ul.megamenu > li > a {

					color: #777;

					text-shadow: none;

					background: none !important;

					height: auto !important;

					margin: 0px -10px;

					display: block;

					/*padding: 10px 15px 11px 15px;*/

					padding: 5px 20px 5px 15px;

					position: relative;

					font-size: 1em;

					font-weight: normal;

					text-transform: uppercase;

				}



					.vertical ul.megamenu > li.with-sub-menu > a strong:after {

						display: none;

					}



					.vertical ul.megamenu > li > a strong {

						font-weight: normal;

					}



				     .vertical ul.megamenu .megamenu-label {

				          display: inline-block;

				          position: relative;

				          top: 0;

				          margin-left: 10px;

				     }



				     	.vertical ul.megamenu .megamenu-label span:before {

				     		left: -4px;

				     		top: 4px;

				     		bottom: auto;

				     		-ms-transform: rotate(90deg); /* IE 9 */

				     		-webkit-transform: rotate(90deg); /* Chrome, Safari, Opera */

				     		transform: rotate(90deg);

				     	}



					.vertical ul.megamenu > li.active > a,

					.vertical ul.megamenu > li:hover > a {

						background: #d3d0d0 !important;

						color: #222;

					}



				.vertical ul.megamenu > li.click > a:before,

				.vertical ul.megamenu > li.hover > a:before {

					position: absolute;

					top: 0;

					bottom: 0;

					right: 12px;

					width: 30px;

					height: 30px;

					line-height: 30px;

					margin: auto;

					text-align: center;

					content: "";

					display: inline-block;

					width: 0;

					height: 0;

					border-top: 4px solid transparent;

					border-bottom: 4px solid transparent;

					border-left: 5px solid #b70505;

					margin-left: 5px;

					margin-right: 5px;

				}



					.vertical ul.megamenu > li:hover > a:before {

						border-left: 5px solid #fff;

					}



					@media (max-width: 991px) {

						.vertical ul.megamenu > li.click > a:before,

						.vertical ul.megamenu > li.hover > a:before {

							display: none;

						}

					}



				/* SubMenu */



				.vertical ul.megamenu > li > .sub-menu {

					left: 100%;

					padding-top: 0px;

					top: 0;

				}



					.vertical ul.megamenu > li > .sub-menu > .content {

						/* JH margin-left: 10px; */

						position: relative !important;

						border-top: 0;

						border-left: 5px solid #b70505;

						border-radius: 0px 6px 6px 6px;

						-webkit-border-radius: 0px 6px 6px 6px;

						-moz-border-radius: 0px 6px 6px 6px;

					}



/* @group 4. Responsive

------------------*/



@media (max-width: 767px) {



     /* @group Image category */



     .responsive ul.megamenu li .sub-menu .content .static-menu .categories-image-right,

     .responsive ul.megamenu li .sub-menu .content .static-menu .categories-image-top {

          display: none;

     }



          .responsive ul.megamenu li .sub-menu .content .static-menu .categories-image-right > div > ul {

               display: block !important;

          }



     .responsive ul.megamenu li .sub-menu .content .static-menu .left-categories-image-right {

          float: none;

          width: 100%;

          padding: 0px;

     }



     .responsive ul.megamenu li .sub-menu .content .static-menu .right-categories-image-right {

          display: none;

     }



     .responsive ul.megamenu li .sub-menu .content .static-menu .left-categories-image-left {

          display: none;

     }



     .responsive ul.megamenu li .sub-menu .content .static-menu .right-categories-image-left {

          float: none;

          width: 100%;

          padding: 0px;

     }



     /* @end */



     /* @group Submenu */



	.responsive ul.megamenu .sub-menu .content .border {

		display: none;

	}



	.responsive ul.megamenu .sub-menu .content .row {

		margin: 0px -20px;

		padding: 0px;

	}



		.responsive ul.megamenu .sub-menu .content .row > div {

			margin-top: 20px;

			border-top: 1px solid #e6e6e6;

			padding-top: 20px;

			padding-left: 20px;

			padding-right: 20px;

		}



			.responsive ul.megamenu .sub-menu .content .row:first-of-type > div:first-child {

				margin-top: 0px;

				border-top: none;

				padding-top: 0px;

			}



			.responsive ul.megamenu .sub-menu .content .row:first-of-type > div.mobile-disabled + .mobile-enabled {

				margin-top: 0px;

				border-top: none;

				padding-top: 0px;

			}



			.responsive ul.megamenu .sub-menu .content .row:first-of-type > div.mobile-enabled + .mobile-disabled + .mobile-enabled,

			.responsive ul.megamenu .sub-menu .content .row:first-of-type > div.mobile-enabled + .mobile-disabled  + .mobile-disabled + .mobile-enabled,

			.responsive ul.megamenu .sub-menu .content .row:first-of-type > div.mobile-enabled + .mobile-disabled  + .mobile-disabled + .mobile-disabled + .mobile-enabled,

			.responsive ul.megamenu .sub-menu .content .row:first-of-type > div.mobile-enabled + .mobile-disabled  + .mobile-disabled + .mobile-disabled + .mobile-disabled + .mobile-enabled  {

				margin-top: 20px;

				border-top: 1px solid #e6e6e6;

				padding-top: 20px;

			}



	/* @end */



	/* @group Open Categories */



	.responsive ul.megamenu li .menu > ul > li {

		position: relative;

	}



		.responsive ul.megamenu .menu > ul > li.active > .close-categories {

			display: block !important;

			position: absolute;

			top: 0;

			right: 0;

			height: 45px;

			cursor: pointer;

			color: #777;

		}



			.responsive ul.megamenu .menu > ul > li.active > .close-categories:before {

				content: "-";

				font-family: Arial;

				font-weight: 300;

				font-size: 36px;

				line-height: 46px;

				padding: 0px 18px;

			}



		.responsive ul.megamenu .menu > ul > li > .open-categories {

			display: block !important;

			position: absolute;

			top: 0;

			right: 0;

			height: 45px;

			cursor: pointer;

		}



			.responsive ul.megamenu .menu > ul > li.active > .open-categories {

				display: none !important;

			}



			.responsive ul.megamenu li .open-categories:before {

				content: "+";

				font-family: Arial;

				font-weight: 300;

				font-size: 24px;

				line-height: 50px;

				color: #777;

				padding: 0px 17px;

			}



			.responsive #main ul.megamenu li .menu > ul > li .visible,

			.responsive #main ul.megamenu li .menu > ul > li > ul {

				display: none;

			}



				.responsive #main ul.megamenu li .menu > ul > li.active .visible,

				.responsive #main ul.megamenu li .menu > ul > li.active > ul {

				}



	/* @end */



	/* @group Categories -> Hover Menu & Static Menu */



	.responsive ul.megamenu li .sub-menu .content .hover-menu .menu,

	.responsive ul.megamenu li .sub-menu .content .static-menu .menu {

		position: relative;

		margin: -20px;

		overflow: hidden;

	}



		.responsive ul.megamenu li .sub-menu .content .hover-menu .menu ul,

		.responsive ul.megamenu li .sub-menu .content .static-menu .menu ul {

			margin: 0px;

			padding: 0px;

		}



		.responsive ul.megamenu li .sub-menu .content .hover-menu .menu ul li,

		.responsive ul.megamenu li .sub-menu .content .static-menu .menu ul li {

			border-top: 1px solid #e5e5e5;

		}



			.responsive ul.megamenu li .sub-menu .content .static-menu .menu ul li:before {

				display: none;

			}



			.responsive ul.megamenu li .sub-menu .content .hover-menu .menu > ul:first-child > li:first-child,

			.responsive ul.megamenu li .sub-menu .content .static-menu .menu > ul:first-child > li:first-child {

				border-top: none;

			}



			.responsive ul.megamenu li .sub-menu .content .hover-menu .menu ul li a,

			.responsive ul.megamenu li .sub-menu .content .static-menu .menu ul li a {

				display: block;

				padding: 13px 20px 10px 20px;

				font-size: 14px;

				font-weight: 300;

				background: #fff;

				text-transform: none;

				margin: 0px;

			}



				.responsive ul.megamenu li .sub-menu .content .hover-menu .menu ul li ul li a,

				.responsive ul.megamenu li .sub-menu .content .static-menu .menu ul li ul li a {

					font-size: 12px;

				}



				.responsive ul.megamenu li .sub-menu .content .hover-menu .menu ul li a:hover,

				.responsive ul.megamenu li .sub-menu .content .static-menu .menu ul li a:hover,

				.responsive ul.megamenu li .sub-menu .content .hover-menu .menu ul li.active > a,

				.responsive ul.megamenu li .sub-menu .content .static-menu .menu ul li.active > a {

					background: #f7f7f7;

				}



				.responsive ul.megamenu li .sub-menu .content .hover-menu .menu ul li a:before,

				.responsive ul.megamenu li .sub-menu .content .static-menu .menu ul li a:before {

					display: none;

				}



			.responsive ul.megamenu li .sub-menu .content .hover-menu .menu ul ul,

			.responsive ul.megamenu li .sub-menu .content .static-menu .menu ul ul {

				margin: 0px !important;

				padding: 0px !important;

				display: none;

			}



				.responsive ul.megamenu li .sub-menu .content .hover-menu .menu ul ul li a,

				.responsive ul.megamenu li .sub-menu .content .static-menu .menu ul ul li a {

					padding-left: 40px;

				}



					.responsive ul.megamenu li .sub-menu .content .hover-menu .menu ul ul ul li a,

					.responsive ul.megamenu li .sub-menu .content .static-menu .menu ul ul ul li a {

						padding-left: 60px;

					}



			.responsive ul.megamenu .sub-menu .content .static-menu .row > div {

				padding: 0px 20px !important;

			}



			.responsive .static-menu .visible {

				padding: 0px !important;

			}



			.responsive ul.megamenu li .sub-menu .content .static-menu > .menu > ul > li {

				padding: 0px;

			}



	/* @end */

}



@media (max-width: 991px) {



	/* @group Submenu background image */



	.responsive ul.megamenu li .sub-menu .content {

		background-image: none !important;

	}



	/* @end */



	/* @group MegaMenu Vertical */



	.responsive .vertical #menuHeading {

	}



		.responsive .vertical ul.megamenu > li.click:before,

		.responsive .vertical ul.megamenu > li.hover:before {

			display: none;

		}



	/* @end */



	/* @group MegaMenu Horizontal */



	.responsive .megaMenuToggle {

		display: block !important;

	}



	.responsive .megamenu-wrapper {

		display: none;

		position: relative;

	}



		.responsive .horizontal .megamenu-wrapper {

			background: #fff !important;

			border: 1px solid #e6e6e6;

			margin-top: -2px;

		}



		.responsive ul.megamenu {

			background: none;

		}



		.responsive ul.megamenu > li {

			display: block;

			float: none !important;

			width: auto;

			background: none;

			border-top: 1px solid #e6e6e6;

			position: relative;

			margin: 0px;

		}



			.responsive ul.megamenu > li.home,

			ul.megamenu > li.search {

				display: none;

			}



			.responsive ul.megamenu > li > a {

				color: #777;

				text-shadow: none;

				background: none !important;

				margin: 0px;

				padding: 14px 0px 12px 0px !important;

				height: auto !important;

			}



				.responsive ul.megamenu > li:hover > a {

					color: #777;

				}



				.responsive ul.megamenu > li.with-sub-menu > a strong:after {

					display: none;

				}



			     .responsive ul.megamenu .megamenu-label {

			          display: inline-block;

			          position: relative;

			          top: 0px;

			          left: 10px;

			     }



					.responsive ul.megamenu .megamenu-label span:before {

							left: -3px;

							top: 5px;

							bottom: auto;

							-ms-transform: rotate(90deg); /* IE 9 */

							-webkit-transform: rotate(90deg); /* Chrome, Safari, Opera */

							transform: rotate(90deg);

					}



				.responsive ul.megamenu > li > .sub-menu > .content {

					padding: 20px;

				}



				.responsive ul.megamenu > li > .sub-menu > .content > .arrow {

					display: none;

				}



				.responsive ul.megamenu > li:hover,

				.responsive ul.megamenu > li.active {

				}



				.responsive ul.megamenu > li.with-sub-menu .open-menu {

					position: absolute;

					right: 0;

					top: 0;

					z-index: 10;

					padding: 12px 17px 10px 50px;

					display: block;

					cursor: pointer;

					height: 45px;

					color: #333;

				}



					.responsive ul.megamenu > li.active .open-menu {

						display: none;

					}



						.responsive ul.megamenu > li.with-sub-menu .open-menu:before {

							content: "+";

							font-family: Arial;

							font-weight: 300;

							font-size: 24px;

						}



				.responsive ul.megamenu > li.active .close-menu {

					display: block;

					position: absolute;

					z-index: 10;

					top: 0;

					right: 0;

					width: 85px;

					height: 45px;

					padding: 0px 3px 0px 40px;

					text-align: center;

					cursor: pointer;

					color: #333;



				}



					.responsive ul.megamenu > li.active .close-menu:before {

						content: "-";

						font-family: Arial;

						font-weight: 300;

						font-size: 36px;

						line-height: 1.3;

					}



			/* @group Submenu */



			.responsive ul.megamenu > li > .sub-menu {

				width: 100% !important;

				padding-top: 0px;

				position: relative;

				display: none;

				-webkit-transition: none !important;

				-moz-transition: none !important;

				transition: none !important;

				z-index: 2 !important;

				visibility: visible !important;

				left: 0 !important;

			}



				.responsive ul.megamenu li .sub-menu .content {

					box-shadow: none;

					-webkit-box-shadow: none;

					-moz-box-shadow: none;

					border: none;

					border-top: 1px solid #e6e6e6;

					border-radius: 0px;

					-moz-border-radius: 0x;

					-webkit-border-radius: 0px;

					display: block !important;

					visibility: visible !important;

					opacity: 1 !important;

					filter: alpha(opacity=100) !important;

					margin-top: 0px !important;

					left: 0px !important;

					margin-left: 0px !important;

					-webkit-transition: none !important;

					-moz-transition: none !important;

					transition: none !important;

					-webkit-transform: scale(1, 1) !important;

					-moz-transform: scale(1, 1) !important;

					-o-transform: scale(1, 1) !important;

					-ms-transform: scale(1, 1) !important;

					transform: scale(1, 1) !important;

				}



				/* @group Hover Menu */



				.responsive ul.megamenu li .sub-menu .content .hover-menu .menu ul ul {

					margin: 5px 10px;

					width: auto;

					padding: 0px;

					position: static;

					left: 0;

					background: none;

					border: none;

					border-radius:         0px;

					-moz-border-radius:    0px;

					-webkit-border-radius: 0px;

					box-shadow:            none;

					-moz-box-shadow:       none;

					-webkit-box-shadow:    none;

				}



					.responsive ul.megamenu li .sub-menu .content .hover-menu .menu ul ul:before {

						display: none;

					}



					.responsive ul.megamenu li .sub-menu .content .hover-menu .menu ul ul:after {

						display: none;

					}



					.responsive .visible {

					}



						.responsive .visible > div {

							margin: 0px !important;

							border: none !important;

							padding: 0px 0px 0px 10px !important;

						}



				/* @end */



			/* @end */



	/* @end */

}



@media (min-width: 992px) {

	.megamenu-wrapper {

		display: block !important;

	}

}



/* @end */





.categories-image-top {

	padding-bottom: 14px;

	margin-top: -3px;

	position: relative;.owl-nav .owl-next, .owl-nav .owl-prev {

                           align-items: center;

                           background-color: var(--fc-gray-200);

                           border: 1px solid var(--fc-gray-200);

                           border-radius: 50px;

                           color: var(--fc-gray-500);

                           cursor: pointer;

                           display: block;

                           display: inline-flex;

                           flex-shrink: 0;

                           font-size: 20px;

                           font-size: 24px;

                           height: 32px;

                           justify-content: center;

                           left: 97%;

                           padding: 0;

                           position: absolute;

                           top: 0;

                           transform: translateY(-50%);

                           transition: .3s ease-in-out;

                           width: 32px;

                       }

}




/*!
 * Bootstrap  v5.2.2 (https://getbootstrap.com/)
 * Copyright 2011-2022 The Bootstrap Authors
 * Copyright 2011-2022 Twitter, Inc.
 * Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)
 */:root{--bs-blue: #0d6efd;--bs-indigo: #6610f2;--bs-purple: #6f42c1;--bs-pink: #d63384;--bs-red: #dc3545;--bs-orange: #fd7e14;--bs-yellow: #ffc107;--bs-green: #198754;--bs-teal: #20c997;--bs-cyan: #0dcaf0;--bs-black: #000;--bs-white: #fff;--bs-gray: #6c757d;--bs-gray-dark: #343a40;--bs-gray-100: #f8f9fa;--bs-gray-200: #e9ecef;--bs-gray-300: #dee2e6;--bs-gray-400: #ced4da;--bs-gray-500: #adb5bd;--bs-gray-600: #6c757d;--bs-gray-700: #495057;--bs-gray-800: #343a40;--bs-gray-900: #212529;--bs-primary: #0d6efd;--bs-secondary: #6c757d;--bs-success: #198754;--bs-info: #0dcaf0;--bs-warning: #ffc107;--bs-danger: #dc3545;--bs-light: #f8f9fa;--bs-dark: #212529;--bs-primary-rgb: 13, 110, 253;--bs-secondary-rgb: 108, 117, 125;--bs-success-rgb: 25, 135, 84;--bs-info-rgb: 13, 202, 240;--bs-warning-rgb: 255, 193, 7;--bs-danger-rgb: 220, 53, 69;--bs-light-rgb: 248, 249, 250;--bs-dark-rgb: 33, 37, 41;--bs-white-rgb: 255, 255, 255;--bs-black-rgb: 0, 0, 0;--bs-body-color-rgb: 33, 37, 41;--bs-body-bg-rgb: 255, 255, 255;--bs-font-sans-serif: system-ui, -apple-system, "Segoe UI", Roboto, "Helvetica Neue", "Noto Sans", "Liberation Sans", Arial, sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji";--bs-font-monospace: SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace;--bs-gradient: linear-gradient(180deg, rgba(255, 255, 255, 0.15), rgba(255, 255, 255, 0));--bs-body-font-family: var(--bs-font-sans-serif);--bs-body-font-size:1rem;--bs-body-font-weight: 400;--bs-body-line-height: 1.5;--bs-body-color: #212529;--bs-body-bg: #fff;--bs-border-width: 1px;--bs-border-style: solid;--bs-border-color: #dee2e6;--bs-border-color-translucent: rgba(0, 0, 0, 0.175);--bs-border-radius: 0.375rem;--bs-border-radius-sm: 0.25rem;--bs-border-radius-lg: 0.5rem;--bs-border-radius-xl: 1rem;--bs-border-radius-2xl: 2rem;--bs-border-radius-pill: 50rem;--bs-link-color: #0d6efd;--bs-link-hover-color: #0a58ca;--bs-code-color: #d63384;--bs-highlight-bg: #fff3cd}*,*::before,*::after{box-sizing:border-box}@media(prefers-reduced-motion: no-preference){:root{scroll-behavior:smooth}}body{margin:0;font-family:var(--bs-body-font-family);font-size:var(--bs-body-font-size);font-weight:var(--bs-body-font-weight);line-height:var(--bs-body-line-height);color:var(--bs-body-color);text-align:var(--bs-body-text-align);background-color:var(--bs-body-bg);-webkit-text-size-adjust:100%;-webkit-tap-highlight-color:rgba(0,0,0,0)}hr{margin:1rem 0;color:inherit;border:0;border-top:1px solid;opacity:.25}h6,.h6,h5,.h5,h4,.h4,h3,.h3,h2,.h2,h1,.h1{margin-top:0;margin-bottom:.5rem;font-weight:500;line-height:1.2}h1,.h1{font-size:calc(1.375rem + 1.5vw)}@media(min-width: 1200px){h1,.h1{font-size:2.5rem}}h2,.h2{font-size:calc(1.325rem + 0.9vw)}@media(min-width: 1200px){h2,.h2{font-size:2rem}}h3,.h3{font-size:calc(1.3rem + 0.6vw)}@media(min-width: 1200px){h3,.h3{font-size:1.75rem}}h4,.h4{font-size:calc(1.275rem + 0.3vw)}@media(min-width: 1200px){h4,.h4{font-size:1.5rem}}h5,.h5{font-size:1.25rem}h6,.h6{font-size:1rem}p{margin-top:0;margin-bottom:1rem}abbr[title]{text-decoration:underline dotted;cursor:help;text-decoration-skip-ink:none}address{margin-bottom:1rem;font-style:normal;line-height:inherit}ol,ul{padding-left:2rem}ol,ul,dl{margin-top:0;margin-bottom:1rem}ol ol,ul ul,ol ul,ul ol{margin-bottom:0}dt{font-weight:700}dd{margin-bottom:.5rem;margin-left:0}blockquote{margin:0 0 1rem}b,strong{font-weight:bolder}small,.small{font-size:0.875em}mark,.mark{padding:.1875em;background-color:var(--bs-highlight-bg)}sub,sup{position:relative;font-size:0.75em;line-height:0;vertical-align:baseline}sub{bottom:-0.25em}sup{top:-0.5em}a{color:var(--bs-link-color);text-decoration:underline}a:hover{color:var(--bs-link-hover-color)}a:not([href]):not([class]),a:not([href]):not([class]):hover{color:inherit;text-decoration:none}pre,code,kbd,samp{font-family:var(--bs-font-monospace);font-size:1em}pre{display:block;margin-top:0;margin-bottom:1rem;overflow:auto;font-size:0.875em}pre code{font-size:inherit;color:inherit;word-break:normal}code{font-size:0.875em;color:var(--bs-code-color);word-wrap:break-word}a>code{color:inherit}kbd{padding:.1875rem .375rem;font-size:0.875em;color:var(--bs-body-bg);background-color:var(--bs-body-color);border-radius:.25rem}kbd kbd{padding:0;font-size:1em}figure{margin:0 0 1rem}img,svg{vertical-align:middle}table{caption-side:bottom;border-collapse:collapse}caption{padding-top:.5rem;padding-bottom:.5rem;color:#6c757d;text-align:left}th{text-align:inherit;text-align:-webkit-match-parent}thead,tbody,tfoot,tr,td,th{border-color:inherit;border-style:solid;border-width:0}label{display:inline-block}button{border-radius:0}button:focus:not(:focus-visible){outline:0}input,button,select,optgroup,textarea{margin:0;font-family:inherit;font-size:inherit;line-height:inherit}button,select{text-transform:none}[role=button]{cursor:pointer}select{word-wrap:normal}select:disabled{opacity:1}[list]:not([type=date]):not([type=datetime-local]):not([type=month]):not([type=week]):not([type=time])::-webkit-calendar-picker-indicator{display:none !important}button,[type=button],[type=reset],[type=submit]{-webkit-appearance:button}button:not(:disabled),[type=button]:not(:disabled),[type=reset]:not(:disabled),[type=submit]:not(:disabled){cursor:pointer}::-moz-focus-inner{padding:0;border-style:none}textarea{resize:vertical}fieldset{min-width:0;padding:0;margin:0;border:0}legend{float:left;width:100%;padding:0;margin-bottom:.5rem;font-size:calc(1.275rem + 0.3vw);line-height:inherit}@media(min-width: 1200px){legend{font-size:1.5rem}}legend+*{clear:left}::-webkit-datetime-edit-fields-wrapper,::-webkit-datetime-edit-text,::-webkit-datetime-edit-minute,::-webkit-datetime-edit-hour-field,::-webkit-datetime-edit-day-field,::-webkit-datetime-edit-month-field,::-webkit-datetime-edit-year-field{padding:0}::-webkit-inner-spin-button{height:auto}[type=search]{outline-offset:-2px;-webkit-appearance:textfield}::-webkit-search-decoration{-webkit-appearance:none}::-webkit-color-swatch-wrapper{padding:0}::file-selector-button{font:inherit;-webkit-appearance:button}output{display:inline-block}iframe{border:0}summary{display:list-item;cursor:pointer}progress{vertical-align:baseline}[hidden]{display:none !important}.lead{font-size:1.25rem;font-weight:300}.display-1{font-size:calc(1.625rem + 4.5vw);font-weight:300;line-height:1.2}@media(min-width: 1200px){.display-1{font-size:5rem}}.display-2{font-size:calc(1.575rem + 3.9vw);font-weight:300;line-height:1.2}@media(min-width: 1200px){.display-2{font-size:4.5rem}}.display-3{font-size:calc(1.525rem + 3.3vw);font-weight:300;line-height:1.2}@media(min-width: 1200px){.display-3{font-size:4rem}}.display-4{font-size:calc(1.475rem + 2.7vw);font-weight:300;line-height:1.2}@media(min-width: 1200px){.display-4{font-size:3.5rem}}.display-5{font-size:calc(1.425rem + 2.1vw);font-weight:300;line-height:1.2}@media(min-width: 1200px){.display-5{font-size:3rem}}.display-6{font-size:calc(1.375rem + 1.5vw);font-weight:300;line-height:1.2}@media(min-width: 1200px){.display-6{font-size:2.5rem}}.list-unstyled{padding-left:0;list-style:none}.list-inline{padding-left:0;list-style:none}.list-inline-item{display:inline-block}.list-inline-item:not(:last-child){margin-right:.5rem}.initialism{font-size:0.875em;text-transform:uppercase}.blockquote{margin-bottom:1rem;font-size:1.25rem}.blockquote>:last-child{margin-bottom:0}.blockquote-footer{margin-top:-1rem;margin-bottom:1rem;font-size:0.875em;color:#6c757d}.blockquote-footer::before{content:"— "}.img-fluid{max-width:100%;height:auto}.img-thumbnail{padding:.25rem;background-color:#fff;border:1px solid var(--bs-border-color);border-radius:.375rem;max-width:100%;height:auto}.figure{display:inline-block}.figure-img{margin-bottom:.5rem;line-height:1}.figure-caption{font-size:0.875em;color:#6c757d}.container,.container-fluid,.container-xxl,.container-xl,.container-lg,.container-md,.container-sm{--bs-gutter-x: 1.5rem;--bs-gutter-y: 0;width:100%;padding-right:calc(var(--bs-gutter-x)*.5);padding-left:calc(var(--bs-gutter-x)*.5);margin-right:auto;margin-left:auto}@media(min-width: 576px){.container-sm,.container{max-width:540px}}@media(min-width: 768px){.container-md,.container-sm,.container{max-width:720px}}@media(min-width: 992px){.container-lg,.container-md,.container-sm,.container{max-width:960px}}@media(min-width: 1200px){.container-xl,.container-lg,.container-md,.container-sm,.container{max-width:1140px}}@media(min-width: 1400px){.container-xxl,.container-xl,.container-lg,.container-md,.container-sm,.container{max-width:1320px}}.row{--bs-gutter-x: 1.5rem;--bs-gutter-y: 0;display:flex;flex-wrap:wrap;margin-top:calc(-1*var(--bs-gutter-y));margin-right:calc(-0.5*var(--bs-gutter-x));margin-left:calc(-0.5*var(--bs-gutter-x))}.row>*{flex-shrink:0;width:100%;max-width:100%;padding-right:calc(var(--bs-gutter-x)*.5);padding-left:calc(var(--bs-gutter-x)*.5);margin-top:var(--bs-gutter-y)}.col{flex:1 0 0%}.row-cols-auto>*{flex:0 0 auto;width:auto}.row-cols-1>*{flex:0 0 auto;width:100%}.row-cols-2>*{flex:0 0 auto;width:50%}.row-cols-3>*{flex:0 0 auto;width:33.3333333333%}.row-cols-4>*{flex:0 0 auto;width:25%}.row-cols-5>*{flex:0 0 auto;width:20%}.row-cols-6>*{flex:0 0 auto;width:16.6666666667%}.col-auto{flex:0 0 auto;width:auto}.col-1{flex:0 0 auto;width:8.33333333%}.col-2{flex:0 0 auto;width:16.66666667%}.col-3{flex:0 0 auto;width:25%}.col-4{flex:0 0 auto;width:33.33333333%}.col-5{flex:0 0 auto;width:41.66666667%}.col-6{flex:0 0 auto;width:50%}.col-7{flex:0 0 auto;width:58.33333333%}.col-8{flex:0 0 auto;width:66.66666667%}.col-9{flex:0 0 auto;width:75%}.col-10{flex:0 0 auto;width:83.33333333%}.col-11{flex:0 0 auto;width:91.66666667%}.col-12{flex:0 0 auto;width:100%}.offset-1{margin-left:8.33333333%}.offset-2{margin-left:16.66666667%}.offset-3{margin-left:25%}.offset-4{margin-left:33.33333333%}.offset-5{margin-left:41.66666667%}.offset-6{margin-left:50%}.offset-7{margin-left:58.33333333%}.offset-8{margin-left:66.66666667%}.offset-9{margin-left:75%}.offset-10{margin-left:83.33333333%}.offset-11{margin-left:91.66666667%}.g-0,.gx-0{--bs-gutter-x: 0}.g-0,.gy-0{--bs-gutter-y: 0}.g-1,.gx-1{--bs-gutter-x: 0.25rem}.g-1,.gy-1{--bs-gutter-y: 0.25rem}.g-2,.gx-2{--bs-gutter-x: 0.5rem}.g-2,.gy-2{--bs-gutter-y: 0.5rem}.g-3,.gx-3{--bs-gutter-x: 1rem}.g-3,.gy-3{--bs-gutter-y: 1rem}.g-4,.gx-4{--bs-gutter-x: 1.5rem}.g-4,.gy-4{--bs-gutter-y: 1.5rem}.g-5,.gx-5{--bs-gutter-x: 3rem}.g-5,.gy-5{--bs-gutter-y: 3rem}@media(min-width: 576px){.col-sm{flex:1 0 0%}.row-cols-sm-auto>*{flex:0 0 auto;width:auto}.row-cols-sm-1>*{flex:0 0 auto;width:100%}.row-cols-sm-2>*{flex:0 0 auto;width:50%}.row-cols-sm-3>*{flex:0 0 auto;width:33.3333333333%}.row-cols-sm-4>*{flex:0 0 auto;width:25%}.row-cols-sm-5>*{flex:0 0 auto;width:20%}.row-cols-sm-6>*{flex:0 0 auto;width:16.6666666667%}.col-sm-auto{flex:0 0 auto;width:auto}.col-sm-1{flex:0 0 auto;width:8.33333333%}.col-sm-2{flex:0 0 auto;width:16.66666667%}.col-sm-3{flex:0 0 auto;width:25%}.col-sm-4{flex:0 0 auto;width:33.33333333%}.col-sm-5{flex:0 0 auto;width:41.66666667%}.col-sm-6{flex:0 0 auto;width:50%}.col-sm-7{flex:0 0 auto;width:58.33333333%}.col-sm-8{flex:0 0 auto;width:66.66666667%}.col-sm-9{flex:0 0 auto;width:75%}.col-sm-10{flex:0 0 auto;width:83.33333333%}.col-sm-11{flex:0 0 auto;width:91.66666667%}.col-sm-12{flex:0 0 auto;width:100%}.offset-sm-0{margin-left:0}.offset-sm-1{margin-left:8.33333333%}.offset-sm-2{margin-left:16.66666667%}.offset-sm-3{margin-left:25%}.offset-sm-4{margin-left:33.33333333%}.offset-sm-5{margin-left:41.66666667%}.offset-sm-6{margin-left:50%}.offset-sm-7{margin-left:58.33333333%}.offset-sm-8{margin-left:66.66666667%}.offset-sm-9{margin-left:75%}.offset-sm-10{margin-left:83.33333333%}.offset-sm-11{margin-left:91.66666667%}.g-sm-0,.gx-sm-0{--bs-gutter-x: 0}.g-sm-0,.gy-sm-0{--bs-gutter-y: 0}.g-sm-1,.gx-sm-1{--bs-gutter-x: 0.25rem}.g-sm-1,.gy-sm-1{--bs-gutter-y: 0.25rem}.g-sm-2,.gx-sm-2{--bs-gutter-x: 0.5rem}.g-sm-2,.gy-sm-2{--bs-gutter-y: 0.5rem}.g-sm-3,.gx-sm-3{--bs-gutter-x: 1rem}.g-sm-3,.gy-sm-3{--bs-gutter-y: 1rem}.g-sm-4,.gx-sm-4{--bs-gutter-x: 1.5rem}.g-sm-4,.gy-sm-4{--bs-gutter-y: 1.5rem}.g-sm-5,.gx-sm-5{--bs-gutter-x: 3rem}.g-sm-5,.gy-sm-5{--bs-gutter-y: 3rem}}@media(min-width: 768px){.col-md{flex:1 0 0%}.row-cols-md-auto>*{flex:0 0 auto;width:auto}.row-cols-md-1>*{flex:0 0 auto;width:100%}.row-cols-md-2>*{flex:0 0 auto;width:50%}.row-cols-md-3>*{flex:0 0 auto;width:33.3333333333%}.row-cols-md-4>*{flex:0 0 auto;width:25%}.row-cols-md-5>*{flex:0 0 auto;width:20%}.row-cols-md-6>*{flex:0 0 auto;width:16.6666666667%}.col-md-auto{flex:0 0 auto;width:auto}.col-md-1{flex:0 0 auto;width:8.33333333%}.col-md-2{flex:0 0 auto;width:16.66666667%}.col-md-3{flex:0 0 auto;width:25%}.col-md-4{flex:0 0 auto;width:33.33333333%}.col-md-5{flex:0 0 auto;width:41.66666667%}.col-md-6{flex:0 0 auto;width:50%}.col-md-7{flex:0 0 auto;width:58.33333333%}.col-md-8{flex:0 0 auto;width:66.66666667%}.col-md-9{flex:0 0 auto;width:75%}.col-md-10{flex:0 0 auto;width:83.33333333%}.col-md-11{flex:0 0 auto;width:91.66666667%}.col-md-12{flex:0 0 auto;width:100%}.offset-md-0{margin-left:0}.offset-md-1{margin-left:8.33333333%}.offset-md-2{margin-left:16.66666667%}.offset-md-3{margin-left:25%}.offset-md-4{margin-left:33.33333333%}.offset-md-5{margin-left:41.66666667%}.offset-md-6{margin-left:50%}.offset-md-7{margin-left:58.33333333%}.offset-md-8{margin-left:66.66666667%}.offset-md-9{margin-left:75%}.offset-md-10{margin-left:83.33333333%}.offset-md-11{margin-left:91.66666667%}.g-md-0,.gx-md-0{--bs-gutter-x: 0}.g-md-0,.gy-md-0{--bs-gutter-y: 0}.g-md-1,.gx-md-1{--bs-gutter-x: 0.25rem}.g-md-1,.gy-md-1{--bs-gutter-y: 0.25rem}.g-md-2,.gx-md-2{--bs-gutter-x: 0.5rem}.g-md-2,.gy-md-2{--bs-gutter-y: 0.5rem}.g-md-3,.gx-md-3{--bs-gutter-x: 1rem}.g-md-3,.gy-md-3{--bs-gutter-y: 1rem}.g-md-4,.gx-md-4{--bs-gutter-x: 1.5rem}.g-md-4,.gy-md-4{--bs-gutter-y: 1.5rem}.g-md-5,.gx-md-5{--bs-gutter-x: 3rem}.g-md-5,.gy-md-5{--bs-gutter-y: 3rem}}@media(min-width: 992px){.col-lg{flex:1 0 0%}.row-cols-lg-auto>*{flex:0 0 auto;width:auto}.row-cols-lg-1>*{flex:0 0 auto;width:100%}.row-cols-lg-2>*{flex:0 0 auto;width:50%}.row-cols-lg-3>*{flex:0 0 auto;width:33.3333333333%}.row-cols-lg-4>*{flex:0 0 auto;width:25%}.row-cols-lg-5>*{flex:0 0 auto;width:20%}.row-cols-lg-6>*{flex:0 0 auto;width:16.6666666667%}.col-lg-auto{flex:0 0 auto;width:auto}.col-lg-1{flex:0 0 auto;width:8.33333333%}.col-lg-2{flex:0 0 auto;width:16.66666667%}.col-lg-3{flex:0 0 auto;width:25%}.col-lg-4{flex:0 0 auto;width:33.33333333%}.col-lg-5{flex:0 0 auto;width:41.66666667%}.col-lg-6{flex:0 0 auto;width:50%}.col-lg-7{flex:0 0 auto;width:58.33333333%}.col-lg-8{flex:0 0 auto;width:66.66666667%}.col-lg-9{flex:0 0 auto;width:75%}.col-lg-10{flex:0 0 auto;width:83.33333333%}.col-lg-11{flex:0 0 auto;width:91.66666667%}.col-lg-12{flex:0 0 auto;width:100%}.offset-lg-0{margin-left:0}.offset-lg-1{margin-left:8.33333333%}.offset-lg-2{margin-left:16.66666667%}.offset-lg-3{margin-left:25%}.offset-lg-4{margin-left:33.33333333%}.offset-lg-5{margin-left:41.66666667%}.offset-lg-6{margin-left:50%}.offset-lg-7{margin-left:58.33333333%}.offset-lg-8{margin-left:66.66666667%}.offset-lg-9{margin-left:75%}.offset-lg-10{margin-left:83.33333333%}.offset-lg-11{margin-left:91.66666667%}.g-lg-0,.gx-lg-0{--bs-gutter-x: 0}.g-lg-0,.gy-lg-0{--bs-gutter-y: 0}.g-lg-1,.gx-lg-1{--bs-gutter-x: 0.25rem}.g-lg-1,.gy-lg-1{--bs-gutter-y: 0.25rem}.g-lg-2,.gx-lg-2{--bs-gutter-x: 0.5rem}.g-lg-2,.gy-lg-2{--bs-gutter-y: 0.5rem}.g-lg-3,.gx-lg-3{--bs-gutter-x: 1rem}.g-lg-3,.gy-lg-3{--bs-gutter-y: 1rem}.g-lg-4,.gx-lg-4{--bs-gutter-x: 1.5rem}.g-lg-4,.gy-lg-4{--bs-gutter-y: 1.5rem}.g-lg-5,.gx-lg-5{--bs-gutter-x: 3rem}.g-lg-5,.gy-lg-5{--bs-gutter-y: 3rem}}@media(min-width: 1200px){.col-xl{flex:1 0 0%}.row-cols-xl-auto>*{flex:0 0 auto;width:auto}.row-cols-xl-1>*{flex:0 0 auto;width:100%}.row-cols-xl-2>*{flex:0 0 auto;width:50%}.row-cols-xl-3>*{flex:0 0 auto;width:33.3333333333%}.row-cols-xl-4>*{flex:0 0 auto;width:25%}.row-cols-xl-5>*{flex:0 0 auto;width:20%}.row-cols-xl-6>*{flex:0 0 auto;width:16.6666666667%}.col-xl-auto{flex:0 0 auto;width:auto}.col-xl-1{flex:0 0 auto;width:8.33333333%}.col-xl-2{flex:0 0 auto;width:16.66666667%}.col-xl-3{flex:0 0 auto;width:25%}.col-xl-4{flex:0 0 auto;width:33.33333333%}.col-xl-5{flex:0 0 auto;width:41.66666667%}.col-xl-6{flex:0 0 auto;width:50%}.col-xl-7{flex:0 0 auto;width:58.33333333%}.col-xl-8{flex:0 0 auto;width:66.66666667%}.col-xl-9{flex:0 0 auto;width:75%}.col-xl-10{flex:0 0 auto;width:83.33333333%}.col-xl-11{flex:0 0 auto;width:91.66666667%}.col-xl-12{flex:0 0 auto;width:100%}.offset-xl-0{margin-left:0}.offset-xl-1{margin-left:8.33333333%}.offset-xl-2{margin-left:16.66666667%}.offset-xl-3{margin-left:25%}.offset-xl-4{margin-left:33.33333333%}.offset-xl-5{margin-left:41.66666667%}.offset-xl-6{margin-left:50%}.offset-xl-7{margin-left:58.33333333%}.offset-xl-8{margin-left:66.66666667%}.offset-xl-9{margin-left:75%}.offset-xl-10{margin-left:83.33333333%}.offset-xl-11{margin-left:91.66666667%}.g-xl-0,.gx-xl-0{--bs-gutter-x: 0}.g-xl-0,.gy-xl-0{--bs-gutter-y: 0}.g-xl-1,.gx-xl-1{--bs-gutter-x: 0.25rem}.g-xl-1,.gy-xl-1{--bs-gutter-y: 0.25rem}.g-xl-2,.gx-xl-2{--bs-gutter-x: 0.5rem}.g-xl-2,.gy-xl-2{--bs-gutter-y: 0.5rem}.g-xl-3,.gx-xl-3{--bs-gutter-x: 1rem}.g-xl-3,.gy-xl-3{--bs-gutter-y: 1rem}.g-xl-4,.gx-xl-4{--bs-gutter-x: 1.5rem}.g-xl-4,.gy-xl-4{--bs-gutter-y: 1.5rem}.g-xl-5,.gx-xl-5{--bs-gutter-x: 3rem}.g-xl-5,.gy-xl-5{--bs-gutter-y: 3rem}}@media(min-width: 1400px){.col-xxl{flex:1 0 0%}.row-cols-xxl-auto>*{flex:0 0 auto;width:auto}.row-cols-xxl-1>*{flex:0 0 auto;width:100%}.row-cols-xxl-2>*{flex:0 0 auto;width:50%}.row-cols-xxl-3>*{flex:0 0 auto;width:33.3333333333%}.row-cols-xxl-4>*{flex:0 0 auto;width:25%}.row-cols-xxl-5>*{flex:0 0 auto;width:20%}.row-cols-xxl-6>*{flex:0 0 auto;width:16.6666666667%}.col-xxl-auto{flex:0 0 auto;width:auto}.col-xxl-1{flex:0 0 auto;width:8.33333333%}.col-xxl-2{flex:0 0 auto;width:16.66666667%}.col-xxl-3{flex:0 0 auto;width:25%}.col-xxl-4{flex:0 0 auto;width:33.33333333%}.col-xxl-5{flex:0 0 auto;width:41.66666667%}.col-xxl-6{flex:0 0 auto;width:50%}.col-xxl-7{flex:0 0 auto;width:58.33333333%}.col-xxl-8{flex:0 0 auto;width:66.66666667%}.col-xxl-9{flex:0 0 auto;width:75%}.col-xxl-10{flex:0 0 auto;width:83.33333333%}.col-xxl-11{flex:0 0 auto;width:91.66666667%}.col-xxl-12{flex:0 0 auto;width:100%}.offset-xxl-0{margin-left:0}.offset-xxl-1{margin-left:8.33333333%}.offset-xxl-2{margin-left:16.66666667%}.offset-xxl-3{margin-left:25%}.offset-xxl-4{margin-left:33.33333333%}.offset-xxl-5{margin-left:41.66666667%}.offset-xxl-6{margin-left:50%}.offset-xxl-7{margin-left:58.33333333%}.offset-xxl-8{margin-left:66.66666667%}.offset-xxl-9{margin-left:75%}.offset-xxl-10{margin-left:83.33333333%}.offset-xxl-11{margin-left:91.66666667%}.g-xxl-0,.gx-xxl-0{--bs-gutter-x: 0}.g-xxl-0,.gy-xxl-0{--bs-gutter-y: 0}.g-xxl-1,.gx-xxl-1{--bs-gutter-x: 0.25rem}.g-xxl-1,.gy-xxl-1{--bs-gutter-y: 0.25rem}.g-xxl-2,.gx-xxl-2{--bs-gutter-x: 0.5rem}.g-xxl-2,.gy-xxl-2{--bs-gutter-y: 0.5rem}.g-xxl-3,.gx-xxl-3{--bs-gutter-x: 1rem}.g-xxl-3,.gy-xxl-3{--bs-gutter-y: 1rem}.g-xxl-4,.gx-xxl-4{--bs-gutter-x: 1.5rem}.g-xxl-4,.gy-xxl-4{--bs-gutter-y: 1.5rem}.g-xxl-5,.gx-xxl-5{--bs-gutter-x: 3rem}.g-xxl-5,.gy-xxl-5{--bs-gutter-y: 3rem}}.table{--bs-table-color: var(--bs-body-color);--bs-table-bg: transparent;--bs-table-border-color: var(--bs-border-color);--bs-table-accent-bg: transparent;--bs-table-striped-color: var(--bs-body-color);--bs-table-striped-bg: rgba(0, 0, 0, 0.05);--bs-table-active-color: var(--bs-body-color);--bs-table-active-bg: rgba(0, 0, 0, 0.1);--bs-table-hover-color: var(--bs-body-color);--bs-table-hover-bg: rgba(0, 0, 0, 0.075);width:100%;margin-bottom:1rem;color:var(--bs-table-color);vertical-align:top;border-color:var(--bs-table-border-color)}.table>:not(caption)>*>*{padding:.5rem .5rem;background-color:var(--bs-table-bg);border-bottom-width:1px;box-shadow:inset 0 0 0 9999px var(--bs-table-accent-bg)}.table>tbody{vertical-align:inherit}.table>thead{vertical-align:bottom}.table-group-divider{border-top:2px solid currentcolor}.caption-top{caption-side:top}.table-sm>:not(caption)>*>*{padding:.25rem .25rem}.table-bordered>:not(caption)>*{border-width:1px 0}.table-bordered>:not(caption)>*>*{border-width:0 1px}.table-borderless>:not(caption)>*>*{border-bottom-width:0}.table-borderless>:not(:first-child){border-top-width:0}.table-striped>tbody>tr:nth-of-type(odd)>*{--bs-table-accent-bg: var(--bs-table-striped-bg);color:var(--bs-table-striped-color)}.table-striped-columns>:not(caption)>tr>:nth-child(even){--bs-table-accent-bg: var(--bs-table-striped-bg);color:var(--bs-table-striped-color)}.table-active{--bs-table-accent-bg: var(--bs-table-active-bg);color:var(--bs-table-active-color)}.table-hover>tbody>tr:hover>*{--bs-table-accent-bg: var(--bs-table-hover-bg);color:var(--bs-table-hover-color)}.table-primary{--bs-table-color: #000;--bs-table-bg: #cfe2ff;--bs-table-border-color: #bacbe6;--bs-table-striped-bg: #c5d7f2;--bs-table-striped-color: #000;--bs-table-active-bg: #bacbe6;--bs-table-active-color: #000;--bs-table-hover-bg: #bfd1ec;--bs-table-hover-color: #000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-secondary{--bs-table-color: #000;--bs-table-bg: #e2e3e5;--bs-table-border-color: #cbccce;--bs-table-striped-bg: #d7d8da;--bs-table-striped-color: #000;--bs-table-active-bg: #cbccce;--bs-table-active-color: #000;--bs-table-hover-bg: #d1d2d4;--bs-table-hover-color: #000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-success{--bs-table-color: #000;--bs-table-bg: #d1e7dd;--bs-table-border-color: #bcd0c7;--bs-table-striped-bg: #c7dbd2;--bs-table-striped-color: #000;--bs-table-active-bg: #bcd0c7;--bs-table-active-color: #000;--bs-table-hover-bg: #c1d6cc;--bs-table-hover-color: #000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-info{--bs-table-color: #000;--bs-table-bg: #cff4fc;--bs-table-border-color: #badce3;--bs-table-striped-bg: #c5e8ef;--bs-table-striped-color: #000;--bs-table-active-bg: #badce3;--bs-table-active-color: #000;--bs-table-hover-bg: #bfe2e9;--bs-table-hover-color: #000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-warning{--bs-table-color: #000;--bs-table-bg: #fff3cd;--bs-table-border-color: #e6dbb9;--bs-table-striped-bg: #f2e7c3;--bs-table-striped-color: #000;--bs-table-active-bg: #e6dbb9;--bs-table-active-color: #000;--bs-table-hover-bg: #ece1be;--bs-table-hover-color: #000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-danger{--bs-table-color: #000;--bs-table-bg: #f8d7da;--bs-table-border-color: #dfc2c4;--bs-table-striped-bg: #eccccf;--bs-table-striped-color: #000;--bs-table-active-bg: #dfc2c4;--bs-table-active-color: #000;--bs-table-hover-bg: #e5c7ca;--bs-table-hover-color: #000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-light{--bs-table-color: #000;--bs-table-bg: #f8f9fa;--bs-table-border-color: #dfe0e1;--bs-table-striped-bg: #ecedee;--bs-table-striped-color: #000;--bs-table-active-bg: #dfe0e1;--bs-table-active-color: #000;--bs-table-hover-bg: #e5e6e7;--bs-table-hover-color: #000;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-dark{--bs-table-color: #fff;--bs-table-bg: #212529;--bs-table-border-color: #373b3e;--bs-table-striped-bg: #2c3034;--bs-table-striped-color: #fff;--bs-table-active-bg: #373b3e;--bs-table-active-color: #fff;--bs-table-hover-bg: #323539;--bs-table-hover-color: #fff;color:var(--bs-table-color);border-color:var(--bs-table-border-color)}.table-responsive{overflow-x:auto;-webkit-overflow-scrolling:touch}@media(max-width: 575.98px){.table-responsive-sm{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media(max-width: 767.98px){.table-responsive-md{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media(max-width: 991.98px){.table-responsive-lg{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media(max-width: 1199.98px){.table-responsive-xl{overflow-x:auto;-webkit-overflow-scrolling:touch}}@media(max-width: 1399.98px){.table-responsive-xxl{overflow-x:auto;-webkit-overflow-scrolling:touch}}.form-label{margin-bottom:.5rem}.col-form-label{padding-top:calc(0.375rem + 1px);padding-bottom:calc(0.375rem + 1px);margin-bottom:0;font-size:inherit;line-height:1.5}.col-form-label-lg{padding-top:calc(0.5rem + 1px);padding-bottom:calc(0.5rem + 1px);font-size:1.25rem}.col-form-label-sm{padding-top:calc(0.25rem + 1px);padding-bottom:calc(0.25rem + 1px);font-size:0.875rem}.form-text{margin-top:.25rem;font-size:0.875em;color:#6c757d}.form-control{display:block;width:100%;padding:.375rem .75rem;font-size:1rem;font-weight:400;line-height:1.5;color:#212529;background-color:#fff;background-clip:padding-box;border:1px solid #ced4da;appearance:none;border-radius:.375rem;transition:border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media(prefers-reduced-motion: reduce){.form-control{transition:none}}.form-control[type=file]{overflow:hidden}.form-control[type=file]:not(:disabled):not([readonly]){cursor:pointer}.form-control:focus{color:#212529;background-color:#fff;border-color:#86b7fe;outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25)}.form-control::-webkit-date-and-time-value{height:1.5em}.form-control::placeholder{color:#6c757d;opacity:1}.form-control:disabled{background-color:#e9ecef;opacity:1}.form-control::file-selector-button{padding:.375rem .75rem;margin:-0.375rem -0.75rem;margin-inline-end:.75rem;color:#212529;background-color:#e9ecef;pointer-events:none;border-color:inherit;border-style:solid;border-width:0;border-inline-end-width:1px;border-radius:0;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media(prefers-reduced-motion: reduce){.form-control::file-selector-button{transition:none}}.form-control:hover:not(:disabled):not([readonly])::file-selector-button{background-color:#dde0e3}.form-control-plaintext{display:block;width:100%;padding:.375rem 0;margin-bottom:0;line-height:1.5;color:#212529;background-color:rgba(0,0,0,0);border:solid rgba(0,0,0,0);border-width:1px 0}.form-control-plaintext:focus{outline:0}.form-control-plaintext.form-control-sm,.form-control-plaintext.form-control-lg{padding-right:0;padding-left:0}.form-control-sm{min-height:calc(1.5em + 0.5rem + 2px);padding:.25rem .5rem;font-size:0.875rem;border-radius:.25rem}.form-control-sm::file-selector-button{padding:.25rem .5rem;margin:-0.25rem -0.5rem;margin-inline-end:.5rem}.form-control-lg{min-height:calc(1.5em + 1rem + 2px);padding:.5rem 1rem;font-size:1.25rem;border-radius:.5rem}.form-control-lg::file-selector-button{padding:.5rem 1rem;margin:-0.5rem -1rem;margin-inline-end:1rem}textarea.form-control{min-height:calc(1.5em + 0.75rem + 2px)}textarea.form-control-sm{min-height:calc(1.5em + 0.5rem + 2px)}textarea.form-control-lg{min-height:calc(1.5em + 1rem + 2px)}.form-control-color{width:3rem;height:calc(1.5em + 0.75rem + 2px);padding:.375rem}.form-control-color:not(:disabled):not([readonly]){cursor:pointer}.form-control-color::-moz-color-swatch{border:0 !important;border-radius:.375rem}.form-control-color::-webkit-color-swatch{border-radius:.375rem}.form-control-color.form-control-sm{height:calc(1.5em + 0.5rem + 2px)}.form-control-color.form-control-lg{height:calc(1.5em + 1rem + 2px)}.form-select{display:block;width:100%;padding:.375rem 2.25rem .375rem .75rem;-moz-padding-start:calc(0.75rem - 3px);font-size:1rem;font-weight:400;line-height:1.5;color:#212529;background-color:#fff;background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23343a40' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e");background-repeat:no-repeat;background-position:right .75rem center;background-size:16px 12px;border:1px solid #ced4da;border-radius:.375rem;transition:border-color .15s ease-in-out,box-shadow .15s ease-in-out;appearance:none}@media(prefers-reduced-motion: reduce){.form-select{transition:none}}.form-select:focus{border-color:#86b7fe;outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25)}.form-select[multiple],.form-select[size]:not([size="1"]){padding-right:.75rem;background-image:none}.form-select:disabled{background-color:#e9ecef}.form-select:-moz-focusring{color:rgba(0,0,0,0);text-shadow:0 0 0 #212529}.form-select-sm{padding-top:.25rem;padding-bottom:.25rem;padding-left:.5rem;font-size:0.875rem;border-radius:.25rem}.form-select-lg{padding-top:.5rem;padding-bottom:.5rem;padding-left:1rem;font-size:1.25rem;border-radius:.5rem}.form-check{display:block;min-height:1.5rem;padding-left:1.5em;margin-bottom:.125rem}.form-check .form-check-input{float:left;margin-left:-1.5em}.form-check-reverse{padding-right:1.5em;padding-left:0;text-align:right}.form-check-reverse .form-check-input{float:right;margin-right:-1.5em;margin-left:0}.form-check-input{width:1em;height:1em;margin-top:.25em;vertical-align:top;background-color:#fff;background-repeat:no-repeat;background-position:center;background-size:contain;border:1px solid rgba(0,0,0,.25);appearance:none;print-color-adjust:exact}.form-check-input[type=checkbox]{border-radius:.25em}.form-check-input[type=radio]{border-radius:50%}.form-check-input:active{filter:brightness(90%)}.form-check-input:focus{border-color:#86b7fe;outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25)}.form-check-input:checked{background-color:#0d6efd;border-color:#0d6efd}.form-check-input:checked[type=checkbox]{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='m6 10 3 3 6-6'/%3e%3c/svg%3e")}.form-check-input:checked[type=radio]{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='2' fill='%23fff'/%3e%3c/svg%3e")}.form-check-input[type=checkbox]:indeterminate{background-color:#0d6efd;border-color:#0d6efd;background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='M6 10h8'/%3e%3c/svg%3e")}.form-check-input:disabled{pointer-events:none;filter:none;opacity:.5}.form-check-input[disabled]~.form-check-label,.form-check-input:disabled~.form-check-label{cursor:default;opacity:.5}.form-switch{padding-left:2.5em}.form-switch .form-check-input{width:2em;margin-left:-2.5em;background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='rgba%280, 0, 0, 0.25%29'/%3e%3c/svg%3e");background-position:left center;border-radius:2em;transition:background-position .15s ease-in-out}@media(prefers-reduced-motion: reduce){.form-switch .form-check-input{transition:none}}.form-switch .form-check-input:focus{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%2386b7fe'/%3e%3c/svg%3e")}.form-switch .form-check-input:checked{background-position:right center;background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%23fff'/%3e%3c/svg%3e")}.form-switch.form-check-reverse{padding-right:2.5em;padding-left:0}.form-switch.form-check-reverse .form-check-input{margin-right:-2.5em;margin-left:0}.form-check-inline{display:inline-block;margin-right:1rem}.btn-check{position:absolute;clip:rect(0, 0, 0, 0);pointer-events:none}.btn-check[disabled]+.btn,.btn-check:disabled+.btn{pointer-events:none;filter:none;opacity:.65}.form-range{width:100%;height:1.5rem;padding:0;background-color:rgba(0,0,0,0);appearance:none}.form-range:focus{outline:0}.form-range:focus::-webkit-slider-thumb{box-shadow:0 0 0 1px #fff,0 0 0 .25rem rgba(13,110,253,.25)}.form-range:focus::-moz-range-thumb{box-shadow:0 0 0 1px #fff,0 0 0 .25rem rgba(13,110,253,.25)}.form-range::-moz-focus-outer{border:0}.form-range::-webkit-slider-thumb{width:1rem;height:1rem;margin-top:-0.25rem;background-color:#0d6efd;border:0;border-radius:1rem;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;appearance:none}@media(prefers-reduced-motion: reduce){.form-range::-webkit-slider-thumb{transition:none}}.form-range::-webkit-slider-thumb:active{background-color:#b6d4fe}.form-range::-webkit-slider-runnable-track{width:100%;height:.5rem;color:rgba(0,0,0,0);cursor:pointer;background-color:#dee2e6;border-color:rgba(0,0,0,0);border-radius:1rem}.form-range::-moz-range-thumb{width:1rem;height:1rem;background-color:#0d6efd;border:0;border-radius:1rem;transition:background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out;appearance:none}@media(prefers-reduced-motion: reduce){.form-range::-moz-range-thumb{transition:none}}.form-range::-moz-range-thumb:active{background-color:#b6d4fe}.form-range::-moz-range-track{width:100%;height:.5rem;color:rgba(0,0,0,0);cursor:pointer;background-color:#dee2e6;border-color:rgba(0,0,0,0);border-radius:1rem}.form-range:disabled{pointer-events:none}.form-range:disabled::-webkit-slider-thumb{background-color:#adb5bd}.form-range:disabled::-moz-range-thumb{background-color:#adb5bd}.form-floating{position:relative}.form-floating>.form-control,.form-floating>.form-control-plaintext,.form-floating>.form-select{height:calc(3.5rem + 2px);line-height:1.25}.form-floating>label{position:absolute;top:0;left:0;width:100%;height:100%;padding:1rem .75rem;overflow:hidden;text-align:start;text-overflow:ellipsis;white-space:nowrap;pointer-events:none;border:1px solid rgba(0,0,0,0);transform-origin:0 0;transition:opacity .1s ease-in-out,transform .1s ease-in-out}@media(prefers-reduced-motion: reduce){.form-floating>label{transition:none}}.form-floating>.form-control,.form-floating>.form-control-plaintext{padding:1rem .75rem}.form-floating>.form-control::placeholder,.form-floating>.form-control-plaintext::placeholder{color:rgba(0,0,0,0)}.form-floating>.form-control:focus,.form-floating>.form-control:not(:placeholder-shown),.form-floating>.form-control-plaintext:focus,.form-floating>.form-control-plaintext:not(:placeholder-shown){padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-control:-webkit-autofill,.form-floating>.form-control-plaintext:-webkit-autofill{padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-select{padding-top:1.625rem;padding-bottom:.625rem}.form-floating>.form-control:focus~label,.form-floating>.form-control:not(:placeholder-shown)~label,.form-floating>.form-control-plaintext~label,.form-floating>.form-select~label{opacity:.65;transform:scale(0.85) translateY(-0.5rem) translateX(0.15rem)}.form-floating>.form-control:-webkit-autofill~label{opacity:.65;transform:scale(0.85) translateY(-0.5rem) translateX(0.15rem)}.form-floating>.form-control-plaintext~label{border-width:1px 0}.input-group{position:relative;display:flex;flex-wrap:wrap;align-items:stretch;width:100%}.input-group>.form-control,.input-group>.form-select,.input-group>.form-floating{position:relative;flex:1 1 auto;width:1%;min-width:0}.input-group>.form-control:focus,.input-group>.form-select:focus,.input-group>.form-floating:focus-within{z-index:5}.input-group .btn{position:relative;z-index:2}.input-group .btn:focus{z-index:5}.input-group-text{display:flex;align-items:center;padding:.375rem .75rem;font-size:1rem;font-weight:400;line-height:1.5;color:#212529;text-align:center;white-space:nowrap;background-color:#e9ecef;border:1px solid #ced4da;border-radius:.375rem}.input-group-lg>.form-control,.input-group-lg>.form-select,.input-group-lg>.input-group-text,.input-group-lg>.btn{padding:.5rem 1rem;font-size:1.25rem;border-radius:.5rem}.input-group-sm>.form-control,.input-group-sm>.form-select,.input-group-sm>.input-group-text,.input-group-sm>.btn{padding:.25rem .5rem;font-size:0.875rem;border-radius:.25rem}.input-group-lg>.form-select,.input-group-sm>.form-select{padding-right:3rem}.input-group:not(.has-validation)>:not(:last-child):not(.dropdown-toggle):not(.dropdown-menu):not(.form-floating),.input-group:not(.has-validation)>.dropdown-toggle:nth-last-child(n+3),.input-group:not(.has-validation)>.form-floating:not(:last-child)>.form-control,.input-group:not(.has-validation)>.form-floating:not(:last-child)>.form-select{border-top-right-radius:0;border-bottom-right-radius:0}.input-group.has-validation>:nth-last-child(n+3):not(.dropdown-toggle):not(.dropdown-menu):not(.form-floating),.input-group.has-validation>.dropdown-toggle:nth-last-child(n+4),.input-group.has-validation>.form-floating:nth-last-child(n+3)>.form-control,.input-group.has-validation>.form-floating:nth-last-child(n+3)>.form-select{border-top-right-radius:0;border-bottom-right-radius:0}.input-group>:not(:first-child):not(.dropdown-menu):not(.valid-tooltip):not(.valid-feedback):not(.invalid-tooltip):not(.invalid-feedback){margin-left:-1px;border-top-left-radius:0;border-bottom-left-radius:0}.input-group>.form-floating:not(:first-child)>.form-control,.input-group>.form-floating:not(:first-child)>.form-select{border-top-left-radius:0;border-bottom-left-radius:0}.valid-feedback{display:none;width:100%;margin-top:.25rem;font-size:0.875em;color:#198754}.valid-tooltip{position:absolute;top:100%;z-index:5;display:none;max-width:100%;padding:.25rem .5rem;margin-top:.1rem;font-size:0.875rem;color:#fff;background-color:rgba(25,135,84,.9);border-radius:.375rem}.was-validated :valid~.valid-feedback,.was-validated :valid~.valid-tooltip,.is-valid~.valid-feedback,.is-valid~.valid-tooltip{display:block}.was-validated .form-control:valid,.form-control.is-valid{border-color:#198754;padding-right:calc(1.5em + 0.75rem);background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%23198754' d='M2.3 6.73.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e");background-repeat:no-repeat;background-position:right calc(0.375em + 0.1875rem) center;background-size:calc(0.75em + 0.375rem) calc(0.75em + 0.375rem)}.was-validated .form-control:valid:focus,.form-control.is-valid:focus{border-color:#198754;box-shadow:0 0 0 .25rem rgba(25,135,84,.25)}.was-validated textarea.form-control:valid,textarea.form-control.is-valid{padding-right:calc(1.5em + 0.75rem);background-position:top calc(0.375em + 0.1875rem) right calc(0.375em + 0.1875rem)}.was-validated .form-select:valid,.form-select.is-valid{border-color:#198754}.was-validated .form-select:valid:not([multiple]):not([size]),.was-validated .form-select:valid:not([multiple])[size="1"],.form-select.is-valid:not([multiple]):not([size]),.form-select.is-valid:not([multiple])[size="1"]{padding-right:4.125rem;background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23343a40' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e"),url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%23198754' d='M2.3 6.73.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e");background-position:right .75rem center,center right 2.25rem;background-size:16px 12px,calc(0.75em + 0.375rem) calc(0.75em + 0.375rem)}.was-validated .form-select:valid:focus,.form-select.is-valid:focus{border-color:#198754;box-shadow:0 0 0 .25rem rgba(25,135,84,.25)}.was-validated .form-control-color:valid,.form-control-color.is-valid{width:calc(3rem + calc(1.5em + 0.75rem))}.was-validated .form-check-input:valid,.form-check-input.is-valid{border-color:#198754}.was-validated .form-check-input:valid:checked,.form-check-input.is-valid:checked{background-color:#198754}.was-validated .form-check-input:valid:focus,.form-check-input.is-valid:focus{box-shadow:0 0 0 .25rem rgba(25,135,84,.25)}.was-validated .form-check-input:valid~.form-check-label,.form-check-input.is-valid~.form-check-label{color:#198754}.form-check-inline .form-check-input~.valid-feedback{margin-left:.5em}.was-validated .input-group>.form-control:not(:focus):valid,.input-group>.form-control:not(:focus).is-valid,.was-validated .input-group>.form-select:not(:focus):valid,.input-group>.form-select:not(:focus).is-valid,.was-validated .input-group>.form-floating:not(:focus-within):valid,.input-group>.form-floating:not(:focus-within).is-valid{z-index:3}.invalid-feedback{display:none;width:100%;margin-top:.25rem;font-size:0.875em;color:#dc3545}.invalid-tooltip{position:absolute;top:100%;z-index:5;display:none;max-width:100%;padding:.25rem .5rem;margin-top:.1rem;font-size:0.875rem;color:#fff;background-color:rgba(220,53,69,.9);border-radius:.375rem}.was-validated :invalid~.invalid-feedback,.was-validated :invalid~.invalid-tooltip,.is-invalid~.invalid-feedback,.is-invalid~.invalid-tooltip{display:block}.was-validated .form-control:invalid,.form-control.is-invalid{border-color:#dc3545;padding-right:calc(1.5em + 0.75rem);background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 12 12' width='12' height='12' fill='none' stroke='%23dc3545'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23dc3545' stroke='none'/%3e%3c/svg%3e");background-repeat:no-repeat;background-position:right calc(0.375em + 0.1875rem) center;background-size:calc(0.75em + 0.375rem) calc(0.75em + 0.375rem)}.was-validated .form-control:invalid:focus,.form-control.is-invalid:focus{border-color:#dc3545;box-shadow:0 0 0 .25rem rgba(220,53,69,.25)}.was-validated textarea.form-control:invalid,textarea.form-control.is-invalid{padding-right:calc(1.5em + 0.75rem);background-position:top calc(0.375em + 0.1875rem) right calc(0.375em + 0.1875rem)}.was-validated .form-select:invalid,.form-select.is-invalid{border-color:#dc3545}.was-validated .form-select:invalid:not([multiple]):not([size]),.was-validated .form-select:invalid:not([multiple])[size="1"],.form-select.is-invalid:not([multiple]):not([size]),.form-select.is-invalid:not([multiple])[size="1"]{padding-right:4.125rem;background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23343a40' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e"),url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 12 12' width='12' height='12' fill='none' stroke='%23dc3545'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23dc3545' stroke='none'/%3e%3c/svg%3e");background-position:right .75rem center,center right 2.25rem;background-size:16px 12px,calc(0.75em + 0.375rem) calc(0.75em + 0.375rem)}.was-validated .form-select:invalid:focus,.form-select.is-invalid:focus{border-color:#dc3545;box-shadow:0 0 0 .25rem rgba(220,53,69,.25)}.was-validated .form-control-color:invalid,.form-control-color.is-invalid{width:calc(3rem + calc(1.5em + 0.75rem))}.was-validated .form-check-input:invalid,.form-check-input.is-invalid{border-color:#dc3545}.was-validated .form-check-input:invalid:checked,.form-check-input.is-invalid:checked{background-color:#dc3545}.was-validated .form-check-input:invalid:focus,.form-check-input.is-invalid:focus{box-shadow:0 0 0 .25rem rgba(220,53,69,.25)}.was-validated .form-check-input:invalid~.form-check-label,.form-check-input.is-invalid~.form-check-label{color:#dc3545}.form-check-inline .form-check-input~.invalid-feedback{margin-left:.5em}.was-validated .input-group>.form-control:not(:focus):invalid,.input-group>.form-control:not(:focus).is-invalid,.was-validated .input-group>.form-select:not(:focus):invalid,.input-group>.form-select:not(:focus).is-invalid,.was-validated .input-group>.form-floating:not(:focus-within):invalid,.input-group>.form-floating:not(:focus-within).is-invalid{z-index:4}.btn{--bs-btn-padding-x: 0.75rem;--bs-btn-padding-y: 0.375rem;--bs-btn-font-family: ;--bs-btn-font-size:1rem;--bs-btn-font-weight: 400;--bs-btn-line-height: 1.5;--bs-btn-color: #212529;--bs-btn-bg: transparent;--bs-btn-border-width: 1px;--bs-btn-border-color: transparent;--bs-btn-border-radius: 0.375rem;--bs-btn-hover-border-color: transparent;--bs-btn-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.15), 0 1px 1px rgba(0, 0, 0, 0.075);--bs-btn-disabled-opacity: 0.65;--bs-btn-focus-box-shadow: 0 0 0 0.25rem rgba(var(--bs-btn-focus-shadow-rgb), .5);display:inline-block;padding:var(--bs-btn-padding-y) var(--bs-btn-padding-x);font-family:var(--bs-btn-font-family);font-size:var(--bs-btn-font-size);font-weight:var(--bs-btn-font-weight);line-height:var(--bs-btn-line-height);color:var(--bs-btn-color);text-align:center;text-decoration:none;vertical-align:middle;cursor:pointer;user-select:none;border:var(--bs-btn-border-width) solid var(--bs-btn-border-color);border-radius:var(--bs-btn-border-radius);background-color:var(--bs-btn-bg);transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media(prefers-reduced-motion: reduce){.btn{transition:none}}.btn:hover{color:var(--bs-btn-hover-color);background-color:var(--bs-btn-hover-bg);border-color:var(--bs-btn-hover-border-color)}.btn-check+.btn:hover{color:var(--bs-btn-color);background-color:var(--bs-btn-bg);border-color:var(--bs-btn-border-color)}.btn:focus-visible{color:var(--bs-btn-hover-color);background-color:var(--bs-btn-hover-bg);border-color:var(--bs-btn-hover-border-color);outline:0;box-shadow:var(--bs-btn-focus-box-shadow)}.btn-check:focus-visible+.btn{border-color:var(--bs-btn-hover-border-color);outline:0;box-shadow:var(--bs-btn-focus-box-shadow)}.btn-check:checked+.btn,:not(.btn-check)+.btn:active,.btn:first-child:active,.btn.active,.btn.show{color:var(--bs-btn-active-color);background-color:var(--bs-btn-active-bg);border-color:var(--bs-btn-active-border-color)}.btn-check:checked+.btn:focus-visible,:not(.btn-check)+.btn:active:focus-visible,.btn:first-child:active:focus-visible,.btn.active:focus-visible,.btn.show:focus-visible{box-shadow:var(--bs-btn-focus-box-shadow)}.btn:disabled,.btn.disabled,fieldset:disabled .btn{color:var(--bs-btn-disabled-color);pointer-events:none;background-color:var(--bs-btn-disabled-bg);border-color:var(--bs-btn-disabled-border-color);opacity:var(--bs-btn-disabled-opacity)}.btn-primary{--bs-btn-color: #fff;--bs-btn-bg: #0d6efd;--bs-btn-border-color: #0d6efd;--bs-btn-hover-color: #fff;--bs-btn-hover-bg: #0b5ed7;--bs-btn-hover-border-color: #0a58ca;--bs-btn-focus-shadow-rgb: 49, 132, 253;--bs-btn-active-color: #fff;--bs-btn-active-bg: #0a58ca;--bs-btn-active-border-color: #0a53be;--bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color: #fff;--bs-btn-disabled-bg: #0d6efd;--bs-btn-disabled-border-color: #0d6efd}.btn-secondary{--bs-btn-color: #fff;--bs-btn-bg: #6c757d;--bs-btn-border-color: #6c757d;--bs-btn-hover-color: #fff;--bs-btn-hover-bg: #5c636a;--bs-btn-hover-border-color: #565e64;--bs-btn-focus-shadow-rgb: 130, 138, 145;--bs-btn-active-color: #fff;--bs-btn-active-bg: #565e64;--bs-btn-active-border-color: #51585e;--bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color: #fff;--bs-btn-disabled-bg: #6c757d;--bs-btn-disabled-border-color: #6c757d}.btn-success{--bs-btn-color: #fff;--bs-btn-bg: #198754;--bs-btn-border-color: #198754;--bs-btn-hover-color: #fff;--bs-btn-hover-bg: #157347;--bs-btn-hover-border-color: #146c43;--bs-btn-focus-shadow-rgb: 60, 153, 110;--bs-btn-active-color: #fff;--bs-btn-active-bg: #146c43;--bs-btn-active-border-color: #13653f;--bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color: #fff;--bs-btn-disabled-bg: #198754;--bs-btn-disabled-border-color: #198754}.btn-info{--bs-btn-color: #000;--bs-btn-bg: #0dcaf0;--bs-btn-border-color: #0dcaf0;--bs-btn-hover-color: #000;--bs-btn-hover-bg: #31d2f2;--bs-btn-hover-border-color: #25cff2;--bs-btn-focus-shadow-rgb: 11, 172, 204;--bs-btn-active-color: #000;--bs-btn-active-bg: #3dd5f3;--bs-btn-active-border-color: #25cff2;--bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color: #000;--bs-btn-disabled-bg: #0dcaf0;--bs-btn-disabled-border-color: #0dcaf0}.btn-warning{--bs-btn-color: #000;--bs-btn-bg: #ffc107;--bs-btn-border-color: #ffc107;--bs-btn-hover-color: #000;--bs-btn-hover-bg: #ffca2c;--bs-btn-hover-border-color: #ffc720;--bs-btn-focus-shadow-rgb: 217, 164, 6;--bs-btn-active-color: #000;--bs-btn-active-bg: #ffcd39;--bs-btn-active-border-color: #ffc720;--bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color: #000;--bs-btn-disabled-bg: #ffc107;--bs-btn-disabled-border-color: #ffc107}.btn-danger{--bs-btn-color: #fff;--bs-btn-bg: #dc3545;--bs-btn-border-color: #dc3545;--bs-btn-hover-color: #fff;--bs-btn-hover-bg: #bb2d3b;--bs-btn-hover-border-color: #b02a37;--bs-btn-focus-shadow-rgb: 225, 83, 97;--bs-btn-active-color: #fff;--bs-btn-active-bg: #b02a37;--bs-btn-active-border-color: #a52834;--bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color: #fff;--bs-btn-disabled-bg: #dc3545;--bs-btn-disabled-border-color: #dc3545}.btn-light{--bs-btn-color: #000;--bs-btn-bg: #f8f9fa;--bs-btn-border-color: #f8f9fa;--bs-btn-hover-color: #000;--bs-btn-hover-bg: #d3d4d5;--bs-btn-hover-border-color: #c6c7c8;--bs-btn-focus-shadow-rgb: 211, 212, 213;--bs-btn-active-color: #000;--bs-btn-active-bg: #c6c7c8;--bs-btn-active-border-color: #babbbc;--bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color: #000;--bs-btn-disabled-bg: #f8f9fa;--bs-btn-disabled-border-color: #f8f9fa}.btn-dark{--bs-btn-color: #fff;--bs-btn-bg: #212529;--bs-btn-border-color: #212529;--bs-btn-hover-color: #fff;--bs-btn-hover-bg: #424649;--bs-btn-hover-border-color: #373b3e;--bs-btn-focus-shadow-rgb: 66, 70, 73;--bs-btn-active-color: #fff;--bs-btn-active-bg: #4d5154;--bs-btn-active-border-color: #373b3e;--bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color: #fff;--bs-btn-disabled-bg: #212529;--bs-btn-disabled-border-color: #212529}.btn-outline-primary{--bs-btn-color: #0d6efd;--bs-btn-border-color: #0d6efd;--bs-btn-hover-color: #fff;--bs-btn-hover-bg: #0d6efd;--bs-btn-hover-border-color: #0d6efd;--bs-btn-focus-shadow-rgb: 13, 110, 253;--bs-btn-active-color: #fff;--bs-btn-active-bg: #0d6efd;--bs-btn-active-border-color: #0d6efd;--bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color: #0d6efd;--bs-btn-disabled-bg: transparent;--bs-btn-disabled-border-color: #0d6efd;--bs-gradient: none}.btn-outline-secondary{--bs-btn-color: #6c757d;--bs-btn-border-color: #6c757d;--bs-btn-hover-color: #fff;--bs-btn-hover-bg: #6c757d;--bs-btn-hover-border-color: #6c757d;--bs-btn-focus-shadow-rgb: 108, 117, 125;--bs-btn-active-color: #fff;--bs-btn-active-bg: #6c757d;--bs-btn-active-border-color: #6c757d;--bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color: #6c757d;--bs-btn-disabled-bg: transparent;--bs-btn-disabled-border-color: #6c757d;--bs-gradient: none}.btn-outline-success{--bs-btn-color: #198754;--bs-btn-border-color: #198754;--bs-btn-hover-color: #fff;--bs-btn-hover-bg: #198754;--bs-btn-hover-border-color: #198754;--bs-btn-focus-shadow-rgb: 25, 135, 84;--bs-btn-active-color: #fff;--bs-btn-active-bg: #198754;--bs-btn-active-border-color: #198754;--bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color: #198754;--bs-btn-disabled-bg: transparent;--bs-btn-disabled-border-color: #198754;--bs-gradient: none}.btn-outline-info{--bs-btn-color: #0dcaf0;--bs-btn-border-color: #0dcaf0;--bs-btn-hover-color: #000;--bs-btn-hover-bg: #0dcaf0;--bs-btn-hover-border-color: #0dcaf0;--bs-btn-focus-shadow-rgb: 13, 202, 240;--bs-btn-active-color: #000;--bs-btn-active-bg: #0dcaf0;--bs-btn-active-border-color: #0dcaf0;--bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color: #0dcaf0;--bs-btn-disabled-bg: transparent;--bs-btn-disabled-border-color: #0dcaf0;--bs-gradient: none}.btn-outline-warning{--bs-btn-color: #ffc107;--bs-btn-border-color: #ffc107;--bs-btn-hover-color: #000;--bs-btn-hover-bg: #ffc107;--bs-btn-hover-border-color: #ffc107;--bs-btn-focus-shadow-rgb: 255, 193, 7;--bs-btn-active-color: #000;--bs-btn-active-bg: #ffc107;--bs-btn-active-border-color: #ffc107;--bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color: #ffc107;--bs-btn-disabled-bg: transparent;--bs-btn-disabled-border-color: #ffc107;--bs-gradient: none}.btn-outline-danger{--bs-btn-color: #dc3545;--bs-btn-border-color: #dc3545;--bs-btn-hover-color: #fff;--bs-btn-hover-bg: #dc3545;--bs-btn-hover-border-color: #dc3545;--bs-btn-focus-shadow-rgb: 220, 53, 69;--bs-btn-active-color: #fff;--bs-btn-active-bg: #dc3545;--bs-btn-active-border-color: #dc3545;--bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color: #dc3545;--bs-btn-disabled-bg: transparent;--bs-btn-disabled-border-color: #dc3545;--bs-gradient: none}.btn-outline-light{--bs-btn-color: #f8f9fa;--bs-btn-border-color: #f8f9fa;--bs-btn-hover-color: #000;--bs-btn-hover-bg: #f8f9fa;--bs-btn-hover-border-color: #f8f9fa;--bs-btn-focus-shadow-rgb: 248, 249, 250;--bs-btn-active-color: #000;--bs-btn-active-bg: #f8f9fa;--bs-btn-active-border-color: #f8f9fa;--bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color: #f8f9fa;--bs-btn-disabled-bg: transparent;--bs-btn-disabled-border-color: #f8f9fa;--bs-gradient: none}.btn-outline-dark{--bs-btn-color: #212529;--bs-btn-border-color: #212529;--bs-btn-hover-color: #fff;--bs-btn-hover-bg: #212529;--bs-btn-hover-border-color: #212529;--bs-btn-focus-shadow-rgb: 33, 37, 41;--bs-btn-active-color: #fff;--bs-btn-active-bg: #212529;--bs-btn-active-border-color: #212529;--bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);--bs-btn-disabled-color: #212529;--bs-btn-disabled-bg: transparent;--bs-btn-disabled-border-color: #212529;--bs-gradient: none}.btn-link{--bs-btn-font-weight: 400;--bs-btn-color: var(--bs-link-color);--bs-btn-bg: transparent;--bs-btn-border-color: transparent;--bs-btn-hover-color: var(--bs-link-hover-color);--bs-btn-hover-border-color: transparent;--bs-btn-active-color: var(--bs-link-hover-color);--bs-btn-active-border-color: transparent;--bs-btn-disabled-color: #6c757d;--bs-btn-disabled-border-color: transparent;--bs-btn-box-shadow: none;--bs-btn-focus-shadow-rgb: 49, 132, 253;text-decoration:underline}.btn-link:focus-visible{color:var(--bs-btn-color)}.btn-link:hover{color:var(--bs-btn-hover-color)}.btn-lg,.btn-group-lg>.btn{--bs-btn-padding-y: 0.5rem;--bs-btn-padding-x: 1rem;--bs-btn-font-size:1.25rem;--bs-btn-border-radius: 0.5rem}.btn-sm,.btn-group-sm>.btn{--bs-btn-padding-y: 0.25rem;--bs-btn-padding-x: 0.5rem;--bs-btn-font-size:0.875rem;--bs-btn-border-radius: 0.25rem}.fade{transition:opacity .15s linear}@media(prefers-reduced-motion: reduce){.fade{transition:none}}.fade:not(.show){opacity:0}.collapse:not(.show){display:none}.collapsing{height:0;overflow:hidden;transition:height .35s ease}@media(prefers-reduced-motion: reduce){.collapsing{transition:none}}.collapsing.collapse-horizontal{width:0;height:auto;transition:width .35s ease}@media(prefers-reduced-motion: reduce){.collapsing.collapse-horizontal{transition:none}}.dropup,.dropend,.dropdown,.dropstart,.dropup-center,.dropdown-center{position:relative}.dropdown-toggle{white-space:nowrap}.dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:.3em solid;border-right:.3em solid rgba(0,0,0,0);border-bottom:0;border-left:.3em solid rgba(0,0,0,0)}.dropdown-toggle:empty::after{margin-left:0}.dropdown-menu{--bs-dropdown-zindex: 1000;--bs-dropdown-min-width: 10rem;--bs-dropdown-padding-x: 0;--bs-dropdown-padding-y: 0.5rem;--bs-dropdown-spacer: 0.125rem;--bs-dropdown-font-size:1rem;--bs-dropdown-color: #212529;--bs-dropdown-bg: #fff;--bs-dropdown-border-color: var(--bs-border-color-translucent);--bs-dropdown-border-radius: 0.375rem;--bs-dropdown-border-width: 1px;--bs-dropdown-inner-border-radius: calc(0.375rem - 1px);--bs-dropdown-divider-bg: var(--bs-border-color-translucent);--bs-dropdown-divider-margin-y: 0.5rem;--bs-dropdown-box-shadow: 0 0.5rem 1rem rgba(0, 0, 0, 0.15);--bs-dropdown-link-color: #212529;--bs-dropdown-link-hover-color: #1e2125;--bs-dropdown-link-hover-bg: #e9ecef;--bs-dropdown-link-active-color: #fff;--bs-dropdown-link-active-bg: #0d6efd;--bs-dropdown-link-disabled-color: #adb5bd;--bs-dropdown-item-padding-x: 1rem;--bs-dropdown-item-padding-y: 0.25rem;--bs-dropdown-header-color: #6c757d;--bs-dropdown-header-padding-x: 1rem;--bs-dropdown-header-padding-y: 0.5rem;position:absolute;z-index:var(--bs-dropdown-zindex);display:none;min-width:var(--bs-dropdown-min-width);padding:var(--bs-dropdown-padding-y) var(--bs-dropdown-padding-x);margin:0;font-size:var(--bs-dropdown-font-size);color:var(--bs-dropdown-color);text-align:left;list-style:none;background-color:var(--bs-dropdown-bg);background-clip:padding-box;border:var(--bs-dropdown-border-width) solid var(--bs-dropdown-border-color);border-radius:var(--bs-dropdown-border-radius)}.dropdown-menu[data-bs-popper]{top:100%;left:0;margin-top:var(--bs-dropdown-spacer)}.dropdown-menu-start{--bs-position: start}.dropdown-menu-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-end{--bs-position: end}.dropdown-menu-end[data-bs-popper]{right:0;left:auto}@media(min-width: 576px){.dropdown-menu-sm-start{--bs-position: start}.dropdown-menu-sm-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-sm-end{--bs-position: end}.dropdown-menu-sm-end[data-bs-popper]{right:0;left:auto}}@media(min-width: 768px){.dropdown-menu-md-start{--bs-position: start}.dropdown-menu-md-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-md-end{--bs-position: end}.dropdown-menu-md-end[data-bs-popper]{right:0;left:auto}}@media(min-width: 992px){.dropdown-menu-lg-start{--bs-position: start}.dropdown-menu-lg-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-lg-end{--bs-position: end}.dropdown-menu-lg-end[data-bs-popper]{right:0;left:auto}}@media(min-width: 1200px){.dropdown-menu-xl-start{--bs-position: start}.dropdown-menu-xl-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-xl-end{--bs-position: end}.dropdown-menu-xl-end[data-bs-popper]{right:0;left:auto}}@media(min-width: 1400px){.dropdown-menu-xxl-start{--bs-position: start}.dropdown-menu-xxl-start[data-bs-popper]{right:auto;left:0}.dropdown-menu-xxl-end{--bs-position: end}.dropdown-menu-xxl-end[data-bs-popper]{right:0;left:auto}}.dropup .dropdown-menu[data-bs-popper]{top:auto;bottom:100%;margin-top:0;margin-bottom:var(--bs-dropdown-spacer)}.dropup .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:0;border-right:.3em solid rgba(0,0,0,0);border-bottom:.3em solid;border-left:.3em solid rgba(0,0,0,0)}.dropup .dropdown-toggle:empty::after{margin-left:0}.dropend .dropdown-menu[data-bs-popper]{top:0;right:auto;left:100%;margin-top:0;margin-left:var(--bs-dropdown-spacer)}.dropend .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:"";border-top:.3em solid rgba(0,0,0,0);border-right:0;border-bottom:.3em solid rgba(0,0,0,0);border-left:.3em solid}.dropend .dropdown-toggle:empty::after{margin-left:0}.dropend .dropdown-toggle::after{vertical-align:0}.dropstart .dropdown-menu[data-bs-popper]{top:0;right:100%;left:auto;margin-top:0;margin-right:var(--bs-dropdown-spacer)}.dropstart .dropdown-toggle::after{display:inline-block;margin-left:.255em;vertical-align:.255em;content:""}.dropstart .dropdown-toggle::after{display:none}.dropstart .dropdown-toggle::before{display:inline-block;margin-right:.255em;vertical-align:.255em;content:"";border-top:.3em solid rgba(0,0,0,0);border-right:.3em solid;border-bottom:.3em solid rgba(0,0,0,0)}.dropstart .dropdown-toggle:empty::after{margin-left:0}.dropstart .dropdown-toggle::before{vertical-align:0}.dropdown-divider{height:0;margin:var(--bs-dropdown-divider-margin-y) 0;overflow:hidden;border-top:1px solid var(--bs-dropdown-divider-bg);opacity:1}.dropdown-item{display:block;width:100%;padding:var(--bs-dropdown-item-padding-y) var(--bs-dropdown-item-padding-x);clear:both;font-weight:400;color:var(--bs-dropdown-link-color);text-align:inherit;text-decoration:none;white-space:nowrap;background-color:rgba(0,0,0,0);border:0}.dropdown-item:hover,.dropdown-item:focus{color:var(--bs-dropdown-link-hover-color);background-color:var(--bs-dropdown-link-hover-bg)}.dropdown-item.active,.dropdown-item:active{color:var(--bs-dropdown-link-active-color);text-decoration:none;background-color:var(--bs-dropdown-link-active-bg)}.dropdown-item.disabled,.dropdown-item:disabled{color:var(--bs-dropdown-link-disabled-color);pointer-events:none;background-color:rgba(0,0,0,0)}.dropdown-menu.show{display:block}.dropdown-header{display:block;padding:var(--bs-dropdown-header-padding-y) var(--bs-dropdown-header-padding-x);margin-bottom:0;font-size:0.875rem;color:var(--bs-dropdown-header-color);white-space:nowrap}.dropdown-item-text{display:block;padding:var(--bs-dropdown-item-padding-y) var(--bs-dropdown-item-padding-x);color:var(--bs-dropdown-link-color)}.dropdown-menu-dark{--bs-dropdown-color: #dee2e6;--bs-dropdown-bg: #343a40;--bs-dropdown-border-color: var(--bs-border-color-translucent);--bs-dropdown-box-shadow: ;--bs-dropdown-link-color: #dee2e6;--bs-dropdown-link-hover-color: #fff;--bs-dropdown-divider-bg: var(--bs-border-color-translucent);--bs-dropdown-link-hover-bg: rgba(255, 255, 255, 0.15);--bs-dropdown-link-active-color: #fff;--bs-dropdown-link-active-bg: #0d6efd;--bs-dropdown-link-disabled-color: #adb5bd;--bs-dropdown-header-color: #adb5bd}.btn-group,.btn-group-vertical{position:relative;display:inline-flex;vertical-align:middle}.btn-group>.btn,.btn-group-vertical>.btn{position:relative;flex:1 1 auto}.btn-group>.btn-check:checked+.btn,.btn-group>.btn-check:focus+.btn,.btn-group>.btn:hover,.btn-group>.btn:focus,.btn-group>.btn:active,.btn-group>.btn.active,.btn-group-vertical>.btn-check:checked+.btn,.btn-group-vertical>.btn-check:focus+.btn,.btn-group-vertical>.btn:hover,.btn-group-vertical>.btn:focus,.btn-group-vertical>.btn:active,.btn-group-vertical>.btn.active{z-index:1}.btn-toolbar{display:flex;flex-wrap:wrap;justify-content:flex-start}.btn-toolbar .input-group{width:auto}.btn-group{border-radius:.375rem}.btn-group>:not(.btn-check:first-child)+.btn,.btn-group>.btn-group:not(:first-child){margin-left:-1px}.btn-group>.btn:not(:last-child):not(.dropdown-toggle),.btn-group>.btn.dropdown-toggle-split:first-child,.btn-group>.btn-group:not(:last-child)>.btn{border-top-right-radius:0;border-bottom-right-radius:0}.btn-group>.btn:nth-child(n+3),.btn-group>:not(.btn-check)+.btn,.btn-group>.btn-group:not(:first-child)>.btn{border-top-left-radius:0;border-bottom-left-radius:0}.dropdown-toggle-split{padding-right:.5625rem;padding-left:.5625rem}.dropdown-toggle-split::after,.dropup .dropdown-toggle-split::after,.dropend .dropdown-toggle-split::after{margin-left:0}.dropstart .dropdown-toggle-split::before{margin-right:0}.btn-sm+.dropdown-toggle-split,.btn-group-sm>.btn+.dropdown-toggle-split{padding-right:.375rem;padding-left:.375rem}.btn-lg+.dropdown-toggle-split,.btn-group-lg>.btn+.dropdown-toggle-split{padding-right:.75rem;padding-left:.75rem}.btn-group-vertical{flex-direction:column;align-items:flex-start;justify-content:center}.btn-group-vertical>.btn,.btn-group-vertical>.btn-group{width:100%}.btn-group-vertical>.btn:not(:first-child),.btn-group-vertical>.btn-group:not(:first-child){margin-top:-1px}.btn-group-vertical>.btn:not(:last-child):not(.dropdown-toggle),.btn-group-vertical>.btn-group:not(:last-child)>.btn{border-bottom-right-radius:0;border-bottom-left-radius:0}.btn-group-vertical>.btn~.btn,.btn-group-vertical>.btn-group:not(:first-child)>.btn{border-top-left-radius:0;border-top-right-radius:0}.nav{--bs-nav-link-padding-x: 1rem;--bs-nav-link-padding-y: 0.5rem;--bs-nav-link-font-weight: ;--bs-nav-link-color: var(--bs-link-color);--bs-nav-link-hover-color: var(--bs-link-hover-color);--bs-nav-link-disabled-color: #6c757d;display:flex;flex-wrap:wrap;padding-left:0;margin-bottom:0;list-style:none}.nav-link{display:block;padding:var(--bs-nav-link-padding-y) var(--bs-nav-link-padding-x);font-size:var(--bs-nav-link-font-size);font-weight:var(--bs-nav-link-font-weight);color:var(--bs-nav-link-color);text-decoration:none;transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out}@media(prefers-reduced-motion: reduce){.nav-link{transition:none}}.nav-link:hover,.nav-link:focus{color:var(--bs-nav-link-hover-color)}.nav-link.disabled{color:var(--bs-nav-link-disabled-color);pointer-events:none;cursor:default}.nav-tabs{--bs-nav-tabs-border-width: 1px;--bs-nav-tabs-border-color: #dee2e6;--bs-nav-tabs-border-radius: 0.375rem;--bs-nav-tabs-link-hover-border-color: #e9ecef #e9ecef #dee2e6;--bs-nav-tabs-link-active-color: #495057;--bs-nav-tabs-link-active-bg: #fff;--bs-nav-tabs-link-active-border-color: #dee2e6 #dee2e6 #fff;border-bottom:var(--bs-nav-tabs-border-width) solid var(--bs-nav-tabs-border-color)}.nav-tabs .nav-link{margin-bottom:calc(-1*var(--bs-nav-tabs-border-width));background:none;border:var(--bs-nav-tabs-border-width) solid rgba(0,0,0,0);border-top-left-radius:var(--bs-nav-tabs-border-radius);border-top-right-radius:var(--bs-nav-tabs-border-radius)}.nav-tabs .nav-link:hover,.nav-tabs .nav-link:focus{isolation:isolate;border-color:var(--bs-nav-tabs-link-hover-border-color)}.nav-tabs .nav-link.disabled,.nav-tabs .nav-link:disabled{color:var(--bs-nav-link-disabled-color);background-color:rgba(0,0,0,0);border-color:rgba(0,0,0,0)}.nav-tabs .nav-link.active,.nav-tabs .nav-item.show .nav-link{color:var(--bs-nav-tabs-link-active-color);background-color:var(--bs-nav-tabs-link-active-bg);border-color:var(--bs-nav-tabs-link-active-border-color)}.nav-tabs .dropdown-menu{margin-top:calc(-1*var(--bs-nav-tabs-border-width));border-top-left-radius:0;border-top-right-radius:0}.nav-pills{--bs-nav-pills-border-radius: 0.375rem;--bs-nav-pills-link-active-color: #fff;--bs-nav-pills-link-active-bg: #0d6efd}.nav-pills .nav-link{background:none;border:0;border-radius:var(--bs-nav-pills-border-radius)}.nav-pills .nav-link:disabled{color:var(--bs-nav-link-disabled-color);background-color:rgba(0,0,0,0);border-color:rgba(0,0,0,0)}.nav-pills .nav-link.active,.nav-pills .show>.nav-link{color:var(--bs-nav-pills-link-active-color);background-color:var(--bs-nav-pills-link-active-bg)}.nav-fill>.nav-link,.nav-fill .nav-item{flex:1 1 auto;text-align:center}.nav-justified>.nav-link,.nav-justified .nav-item{flex-basis:0;flex-grow:1;text-align:center}.nav-fill .nav-item .nav-link,.nav-justified .nav-item .nav-link{width:100%}.tab-content>.tab-pane{display:none}.tab-content>.active{display:block}.navbar{--bs-navbar-padding-x: 0;--bs-navbar-padding-y: 0.5rem;--bs-navbar-color: rgba(0, 0, 0, 0.55);--bs-navbar-hover-color: rgba(0, 0, 0, 0.7);--bs-navbar-disabled-color: rgba(0, 0, 0, 0.3);--bs-navbar-active-color: rgba(0, 0, 0, 0.9);--bs-navbar-brand-padding-y: 0.3125rem;--bs-navbar-brand-margin-end: 1rem;--bs-navbar-brand-font-size: 1.25rem;--bs-navbar-brand-color: rgba(0, 0, 0, 0.9);--bs-navbar-brand-hover-color: rgba(0, 0, 0, 0.9);--bs-navbar-nav-link-padding-x: 0.5rem;--bs-navbar-toggler-padding-y: 0.25rem;--bs-navbar-toggler-padding-x: 0.75rem;--bs-navbar-toggler-font-size: 1.25rem;--bs-navbar-toggler-icon-bg: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%280, 0, 0, 0.55%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e");--bs-navbar-toggler-border-color: rgba(0, 0, 0, 0.1);--bs-navbar-toggler-border-radius: 0.375rem;--bs-navbar-toggler-focus-width: 0.25rem;--bs-navbar-toggler-transition: box-shadow 0.15s ease-in-out;position:relative;display:flex;flex-wrap:wrap;align-items:center;justify-content:space-between;padding:var(--bs-navbar-padding-y) var(--bs-navbar-padding-x)}.navbar>.container,.navbar>.container-fluid,.navbar>.container-sm,.navbar>.container-md,.navbar>.container-lg,.navbar>.container-xl,.navbar>.container-xxl{display:flex;flex-wrap:inherit;align-items:center;justify-content:space-between}.navbar-brand{padding-top:var(--bs-navbar-brand-padding-y);padding-bottom:var(--bs-navbar-brand-padding-y);margin-right:var(--bs-navbar-brand-margin-end);font-size:var(--bs-navbar-brand-font-size);color:var(--bs-navbar-brand-color);text-decoration:none;white-space:nowrap}.navbar-brand:hover,.navbar-brand:focus{color:var(--bs-navbar-brand-hover-color)}.navbar-nav{--bs-nav-link-padding-x: 0;--bs-nav-link-padding-y: 0.5rem;--bs-nav-link-font-weight: ;--bs-nav-link-color: var(--bs-navbar-color);--bs-nav-link-hover-color: var(--bs-navbar-hover-color);--bs-nav-link-disabled-color: var(--bs-navbar-disabled-color);display:flex;flex-direction:column;padding-left:0;margin-bottom:0;list-style:none}.navbar-nav .show>.nav-link,.navbar-nav .nav-link.active{color:var(--bs-navbar-active-color)}.navbar-nav .dropdown-menu{position:static}.navbar-text{padding-top:.5rem;padding-bottom:.5rem;color:var(--bs-navbar-color)}.navbar-text a,.navbar-text a:hover,.navbar-text a:focus{color:var(--bs-navbar-active-color)}.navbar-collapse{flex-basis:100%;flex-grow:1;align-items:center}.navbar-toggler{padding:var(--bs-navbar-toggler-padding-y) var(--bs-navbar-toggler-padding-x);font-size:var(--bs-navbar-toggler-font-size);line-height:1;color:var(--bs-navbar-color);background-color:rgba(0,0,0,0);border:var(--bs-border-width) solid var(--bs-navbar-toggler-border-color);border-radius:var(--bs-navbar-toggler-border-radius);transition:var(--bs-navbar-toggler-transition)}@media(prefers-reduced-motion: reduce){.navbar-toggler{transition:none}}.navbar-toggler:hover{text-decoration:none}.navbar-toggler:focus{text-decoration:none;outline:0;box-shadow:0 0 0 var(--bs-navbar-toggler-focus-width)}.navbar-toggler-icon{display:inline-block;width:1.5em;height:1.5em;vertical-align:middle;background-image:var(--bs-navbar-toggler-icon-bg);background-repeat:no-repeat;background-position:center;background-size:100%}.navbar-nav-scroll{max-height:var(--bs-scroll-height, 75vh);overflow-y:auto}@media(min-width: 576px){.navbar-expand-sm{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-sm .navbar-nav{flex-direction:row}.navbar-expand-sm .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-sm .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-sm .navbar-nav-scroll{overflow:visible}.navbar-expand-sm .navbar-collapse{display:flex !important;flex-basis:auto}.navbar-expand-sm .navbar-toggler{display:none}.navbar-expand-sm .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto !important;height:auto !important;visibility:visible !important;background-color:rgba(0,0,0,0) !important;border:0 !important;transform:none !important;transition:none}.navbar-expand-sm .offcanvas .offcanvas-header{display:none}.navbar-expand-sm .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media(min-width: 768px){.navbar-expand-md{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-md .navbar-nav{flex-direction:row}.navbar-expand-md .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-md .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-md .navbar-nav-scroll{overflow:visible}.navbar-expand-md .navbar-collapse{display:flex !important;flex-basis:auto}.navbar-expand-md .navbar-toggler{display:none}.navbar-expand-md .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto !important;height:auto !important;visibility:visible !important;background-color:rgba(0,0,0,0) !important;border:0 !important;transform:none !important;transition:none}.navbar-expand-md .offcanvas .offcanvas-header{display:none}.navbar-expand-md .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media(min-width: 992px){.navbar-expand-lg{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-lg .navbar-nav{flex-direction:row}.navbar-expand-lg .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-lg .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-lg .navbar-nav-scroll{overflow:visible}.navbar-expand-lg .navbar-collapse{display:flex !important;flex-basis:auto}.navbar-expand-lg .navbar-toggler{display:none}.navbar-expand-lg .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto !important;height:auto !important;visibility:visible !important;background-color:rgba(0,0,0,0) !important;border:0 !important;transform:none !important;transition:none}.navbar-expand-lg .offcanvas .offcanvas-header{display:none}.navbar-expand-lg .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media(min-width: 1200px){.navbar-expand-xl{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-xl .navbar-nav{flex-direction:row}.navbar-expand-xl .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-xl .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-xl .navbar-nav-scroll{overflow:visible}.navbar-expand-xl .navbar-collapse{display:flex !important;flex-basis:auto}.navbar-expand-xl .navbar-toggler{display:none}.navbar-expand-xl .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto !important;height:auto !important;visibility:visible !important;background-color:rgba(0,0,0,0) !important;border:0 !important;transform:none !important;transition:none}.navbar-expand-xl .offcanvas .offcanvas-header{display:none}.navbar-expand-xl .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}@media(min-width: 1400px){.navbar-expand-xxl{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand-xxl .navbar-nav{flex-direction:row}.navbar-expand-xxl .navbar-nav .dropdown-menu{position:absolute}.navbar-expand-xxl .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand-xxl .navbar-nav-scroll{overflow:visible}.navbar-expand-xxl .navbar-collapse{display:flex !important;flex-basis:auto}.navbar-expand-xxl .navbar-toggler{display:none}.navbar-expand-xxl .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto !important;height:auto !important;visibility:visible !important;background-color:rgba(0,0,0,0) !important;border:0 !important;transform:none !important;transition:none}.navbar-expand-xxl .offcanvas .offcanvas-header{display:none}.navbar-expand-xxl .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}}.navbar-expand{flex-wrap:nowrap;justify-content:flex-start}.navbar-expand .navbar-nav{flex-direction:row}.navbar-expand .navbar-nav .dropdown-menu{position:absolute}.navbar-expand .navbar-nav .nav-link{padding-right:var(--bs-navbar-nav-link-padding-x);padding-left:var(--bs-navbar-nav-link-padding-x)}.navbar-expand .navbar-nav-scroll{overflow:visible}.navbar-expand .navbar-collapse{display:flex !important;flex-basis:auto}.navbar-expand .navbar-toggler{display:none}.navbar-expand .offcanvas{position:static;z-index:auto;flex-grow:1;width:auto !important;height:auto !important;visibility:visible !important;background-color:rgba(0,0,0,0) !important;border:0 !important;transform:none !important;transition:none}.navbar-expand .offcanvas .offcanvas-header{display:none}.navbar-expand .offcanvas .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible}.navbar-dark{--bs-navbar-color: rgba(255, 255, 255, 0.55);--bs-navbar-hover-color: rgba(255, 255, 255, 0.75);--bs-navbar-disabled-color: rgba(255, 255, 255, 0.25);--bs-navbar-active-color: #fff;--bs-navbar-brand-color: #fff;--bs-navbar-brand-hover-color: #fff;--bs-navbar-toggler-border-color: rgba(255, 255, 255, 0.1);--bs-navbar-toggler-icon-bg: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%28255, 255, 255, 0.55%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e")}.card{--bs-card-spacer-y: 1rem;--bs-card-spacer-x: 1rem;--bs-card-title-spacer-y: 0.5rem;--bs-card-border-width: 1px;--bs-card-border-color: var(--bs-border-color-translucent);--bs-card-border-radius: 0.375rem;--bs-card-box-shadow: ;--bs-card-inner-border-radius: calc(0.375rem - 1px);--bs-card-cap-padding-y: 0.5rem;--bs-card-cap-padding-x: 1rem;--bs-card-cap-bg: rgba(0, 0, 0, 0.03);--bs-card-cap-color: ;--bs-card-height: ;--bs-card-color: ;--bs-card-bg: #fff;--bs-card-img-overlay-padding: 1rem;--bs-card-group-margin: 0.75rem;position:relative;display:flex;flex-direction:column;min-width:0;height:var(--bs-card-height);word-wrap:break-word;background-color:var(--bs-card-bg);background-clip:border-box;border:var(--bs-card-border-width) solid var(--bs-card-border-color);border-radius:var(--bs-card-border-radius)}.card>hr{margin-right:0;margin-left:0}.card>.list-group{border-top:inherit;border-bottom:inherit}.card>.list-group:first-child{border-top-width:0;border-top-left-radius:var(--bs-card-inner-border-radius);border-top-right-radius:var(--bs-card-inner-border-radius)}.card>.list-group:last-child{border-bottom-width:0;border-bottom-right-radius:var(--bs-card-inner-border-radius);border-bottom-left-radius:var(--bs-card-inner-border-radius)}.card>.card-header+.list-group,.card>.list-group+.card-footer{border-top:0}.card-body{flex:1 1 auto;padding:var(--bs-card-spacer-y) var(--bs-card-spacer-x);color:var(--bs-card-color)}.card-title{margin-bottom:var(--bs-card-title-spacer-y)}.card-subtitle{margin-top:calc(-0.5*var(--bs-card-title-spacer-y));margin-bottom:0}.card-text:last-child{margin-bottom:0}.card-link+.card-link{margin-left:var(--bs-card-spacer-x)}.card-header{padding:var(--bs-card-cap-padding-y) var(--bs-card-cap-padding-x);margin-bottom:0;color:var(--bs-card-cap-color);background-color:var(--bs-card-cap-bg);border-bottom:var(--bs-card-border-width) solid var(--bs-card-border-color)}.card-header:first-child{border-radius:var(--bs-card-inner-border-radius) var(--bs-card-inner-border-radius) 0 0}.card-footer{padding:var(--bs-card-cap-padding-y) var(--bs-card-cap-padding-x);color:var(--bs-card-cap-color);background-color:var(--bs-card-cap-bg);border-top:var(--bs-card-border-width) solid var(--bs-card-border-color)}.card-footer:last-child{border-radius:0 0 var(--bs-card-inner-border-radius) var(--bs-card-inner-border-radius)}.card-header-tabs{margin-right:calc(-0.5*var(--bs-card-cap-padding-x));margin-bottom:calc(-1*var(--bs-card-cap-padding-y));margin-left:calc(-0.5*var(--bs-card-cap-padding-x));border-bottom:0}.card-header-tabs .nav-link.active{background-color:var(--bs-card-bg);border-bottom-color:var(--bs-card-bg)}.card-header-pills{margin-right:calc(-0.5*var(--bs-card-cap-padding-x));margin-left:calc(-0.5*var(--bs-card-cap-padding-x))}.card-img-overlay{position:absolute;top:0;right:0;bottom:0;left:0;padding:var(--bs-card-img-overlay-padding);border-radius:var(--bs-card-inner-border-radius)}.card-img,.card-img-top,.card-img-bottom{width:100%}.card-img,.card-img-top{border-top-left-radius:var(--bs-card-inner-border-radius);border-top-right-radius:var(--bs-card-inner-border-radius)}.card-img,.card-img-bottom{border-bottom-right-radius:var(--bs-card-inner-border-radius);border-bottom-left-radius:var(--bs-card-inner-border-radius)}.card-group>.card{margin-bottom:var(--bs-card-group-margin)}@media(min-width: 576px){.card-group{display:flex;flex-flow:row wrap}.card-group>.card{flex:1 0 0%;margin-bottom:0}.card-group>.card+.card{margin-left:0;border-left:0}.card-group>.card:not(:last-child){border-top-right-radius:0;border-bottom-right-radius:0}.card-group>.card:not(:last-child) .card-img-top,.card-group>.card:not(:last-child) .card-header{border-top-right-radius:0}.card-group>.card:not(:last-child) .card-img-bottom,.card-group>.card:not(:last-child) .card-footer{border-bottom-right-radius:0}.card-group>.card:not(:first-child){border-top-left-radius:0;border-bottom-left-radius:0}.card-group>.card:not(:first-child) .card-img-top,.card-group>.card:not(:first-child) .card-header{border-top-left-radius:0}.card-group>.card:not(:first-child) .card-img-bottom,.card-group>.card:not(:first-child) .card-footer{border-bottom-left-radius:0}}.accordion{--bs-accordion-color: #212529;--bs-accordion-bg: #fff;--bs-accordion-transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out, border-radius 0.15s ease;--bs-accordion-border-color: var(--bs-border-color);--bs-accordion-border-width: 1px;--bs-accordion-border-radius: 0.375rem;--bs-accordion-inner-border-radius: calc(0.375rem - 1px);--bs-accordion-btn-padding-x: 1.25rem;--bs-accordion-btn-padding-y: 1rem;--bs-accordion-btn-color: #212529;--bs-accordion-btn-bg: var(--bs-accordion-bg);--bs-accordion-btn-icon: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23212529'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e");--bs-accordion-btn-icon-width: 1.25rem;--bs-accordion-btn-icon-transform: rotate(-180deg);--bs-accordion-btn-icon-transition: transform 0.2s ease-in-out;--bs-accordion-btn-active-icon: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%230c63e4'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e");--bs-accordion-btn-focus-border-color: #86b7fe;--bs-accordion-btn-focus-box-shadow: 0 0 0 0.25rem rgba(13, 110, 253, 0.25);--bs-accordion-body-padding-x: 1.25rem;--bs-accordion-body-padding-y: 1rem;--bs-accordion-active-color: #0c63e4;--bs-accordion-active-bg: #e7f1ff}.accordion-button{position:relative;display:flex;align-items:center;width:100%;padding:var(--bs-accordion-btn-padding-y) var(--bs-accordion-btn-padding-x);font-size:1rem;color:var(--bs-accordion-btn-color);text-align:left;background-color:var(--bs-accordion-btn-bg);border:0;border-radius:0;overflow-anchor:none;transition:var(--bs-accordion-transition)}@media(prefers-reduced-motion: reduce){.accordion-button{transition:none}}.accordion-button:not(.collapsed){color:var(--bs-accordion-active-color);background-color:var(--bs-accordion-active-bg);box-shadow:inset 0 calc(-1*var(--bs-accordion-border-width)) 0 var(--bs-accordion-border-color)}.accordion-button:not(.collapsed)::after{background-image:var(--bs-accordion-btn-active-icon);transform:var(--bs-accordion-btn-icon-transform)}.accordion-button::after{flex-shrink:0;width:var(--bs-accordion-btn-icon-width);height:var(--bs-accordion-btn-icon-width);margin-left:auto;content:"";background-image:var(--bs-accordion-btn-icon);background-repeat:no-repeat;background-size:var(--bs-accordion-btn-icon-width);transition:var(--bs-accordion-btn-icon-transition)}@media(prefers-reduced-motion: reduce){.accordion-button::after{transition:none}}.accordion-button:hover{z-index:2}.accordion-button:focus{z-index:3;border-color:var(--bs-accordion-btn-focus-border-color);outline:0;box-shadow:var(--bs-accordion-btn-focus-box-shadow)}.accordion-header{margin-bottom:0}.accordion-item{color:var(--bs-accordion-color);background-color:var(--bs-accordion-bg);border:var(--bs-accordion-border-width) solid var(--bs-accordion-border-color)}.accordion-item:first-of-type{border-top-left-radius:var(--bs-accordion-border-radius);border-top-right-radius:var(--bs-accordion-border-radius)}.accordion-item:first-of-type .accordion-button{border-top-left-radius:var(--bs-accordion-inner-border-radius);border-top-right-radius:var(--bs-accordion-inner-border-radius)}.accordion-item:not(:first-of-type){border-top:0}.accordion-item:last-of-type{border-bottom-right-radius:var(--bs-accordion-border-radius);border-bottom-left-radius:var(--bs-accordion-border-radius)}.accordion-item:last-of-type .accordion-button.collapsed{border-bottom-right-radius:var(--bs-accordion-inner-border-radius);border-bottom-left-radius:var(--bs-accordion-inner-border-radius)}.accordion-item:last-of-type .accordion-collapse{border-bottom-right-radius:var(--bs-accordion-border-radius);border-bottom-left-radius:var(--bs-accordion-border-radius)}.accordion-body{padding:var(--bs-accordion-body-padding-y) var(--bs-accordion-body-padding-x)}.accordion-flush .accordion-collapse{border-width:0}.accordion-flush .accordion-item{border-right:0;border-left:0;border-radius:0}.accordion-flush .accordion-item:first-child{border-top:0}.accordion-flush .accordion-item:last-child{border-bottom:0}.accordion-flush .accordion-item .accordion-button,.accordion-flush .accordion-item .accordion-button.collapsed{border-radius:0}.breadcrumb{--bs-breadcrumb-padding-x: 0;--bs-breadcrumb-padding-y: 0;--bs-breadcrumb-margin-bottom: 1rem;--bs-breadcrumb-bg: ;--bs-breadcrumb-border-radius: ;--bs-breadcrumb-divider-color: #6c757d;--bs-breadcrumb-item-padding-x: 0.5rem;--bs-breadcrumb-item-active-color: #6c757d;display:flex;flex-wrap:wrap;padding:var(--bs-breadcrumb-padding-y) var(--bs-breadcrumb-padding-x);margin-bottom:var(--bs-breadcrumb-margin-bottom);font-size:var(--bs-breadcrumb-font-size);list-style:none;background-color:var(--bs-breadcrumb-bg);border-radius:var(--bs-breadcrumb-border-radius)}.breadcrumb-item+.breadcrumb-item{padding-left:var(--bs-breadcrumb-item-padding-x)}.breadcrumb-item+.breadcrumb-item::before{float:left;padding-right:var(--bs-breadcrumb-item-padding-x);color:var(--bs-breadcrumb-divider-color);content:var(--bs-breadcrumb-divider, "/") /* rtl: var(--bs-breadcrumb-divider, "/") */}.breadcrumb-item.active{color:var(--bs-breadcrumb-item-active-color)}.pagination{--bs-pagination-padding-x: 0.75rem;--bs-pagination-padding-y: 0.375rem;--bs-pagination-font-size:1rem;--bs-pagination-color: var(--bs-link-color);--bs-pagination-bg: #fff;--bs-pagination-border-width: 1px;--bs-pagination-border-color: #dee2e6;--bs-pagination-border-radius: 0.375rem;--bs-pagination-hover-color: var(--bs-link-hover-color);--bs-pagination-hover-bg: #e9ecef;--bs-pagination-hover-border-color: #dee2e6;--bs-pagination-focus-color: var(--bs-link-hover-color);--bs-pagination-focus-bg: #e9ecef;--bs-pagination-focus-box-shadow: 0 0 0 0.25rem rgba(13, 110, 253, 0.25);--bs-pagination-active-color: #fff;--bs-pagination-active-bg: #0d6efd;--bs-pagination-active-border-color: #0d6efd;--bs-pagination-disabled-color: #6c757d;--bs-pagination-disabled-bg: #fff;--bs-pagination-disabled-border-color: #dee2e6;display:flex;padding-left:0;list-style:none}.page-link{position:relative;display:block;padding:var(--bs-pagination-padding-y) var(--bs-pagination-padding-x);font-size:var(--bs-pagination-font-size);color:var(--bs-pagination-color);text-decoration:none;background-color:var(--bs-pagination-bg);border:var(--bs-pagination-border-width) solid var(--bs-pagination-border-color);transition:color .15s ease-in-out,background-color .15s ease-in-out,border-color .15s ease-in-out,box-shadow .15s ease-in-out}@media(prefers-reduced-motion: reduce){.page-link{transition:none}}.page-link:hover{z-index:2;color:var(--bs-pagination-hover-color);background-color:var(--bs-pagination-hover-bg);border-color:var(--bs-pagination-hover-border-color)}.page-link:focus{z-index:3;color:var(--bs-pagination-focus-color);background-color:var(--bs-pagination-focus-bg);outline:0;box-shadow:var(--bs-pagination-focus-box-shadow)}.page-link.active,.active>.page-link{z-index:3;color:var(--bs-pagination-active-color);background-color:var(--bs-pagination-active-bg);border-color:var(--bs-pagination-active-border-color)}.page-link.disabled,.disabled>.page-link{color:var(--bs-pagination-disabled-color);pointer-events:none;background-color:var(--bs-pagination-disabled-bg);border-color:var(--bs-pagination-disabled-border-color)}.page-item:not(:first-child) .page-link{margin-left:-1px}.page-item:first-child .page-link{border-top-left-radius:var(--bs-pagination-border-radius);border-bottom-left-radius:var(--bs-pagination-border-radius)}.page-item:last-child .page-link{border-top-right-radius:var(--bs-pagination-border-radius);border-bottom-right-radius:var(--bs-pagination-border-radius)}.pagination-lg{--bs-pagination-padding-x: 1.5rem;--bs-pagination-padding-y: 0.75rem;--bs-pagination-font-size:1.25rem;--bs-pagination-border-radius: 0.5rem}.pagination-sm{--bs-pagination-padding-x: 0.5rem;--bs-pagination-padding-y: 0.25rem;--bs-pagination-font-size:0.875rem;--bs-pagination-border-radius: 0.25rem}.badge{--bs-badge-padding-x: 0.65em;--bs-badge-padding-y: 0.35em;--bs-badge-font-size:0.75em;--bs-badge-font-weight: 700;--bs-badge-color: #fff;--bs-badge-border-radius: 0.375rem;display:inline-block;padding:var(--bs-badge-padding-y) var(--bs-badge-padding-x);font-size:var(--bs-badge-font-size);font-weight:var(--bs-badge-font-weight);line-height:1;color:var(--bs-badge-color);text-align:center;white-space:nowrap;vertical-align:baseline;border-radius:var(--bs-badge-border-radius)}.badge:empty{display:none}.btn .badge{position:relative;top:-1px}.alert{--bs-alert-bg: transparent;--bs-alert-padding-x: 1rem;--bs-alert-padding-y: 1rem;--bs-alert-margin-bottom: 1rem;--bs-alert-color: inherit;--bs-alert-border-color: transparent;--bs-alert-border: 1px solid var(--bs-alert-border-color);--bs-alert-border-radius: 0.375rem;position:relative;padding:var(--bs-alert-padding-y) var(--bs-alert-padding-x);margin-bottom:var(--bs-alert-margin-bottom);color:var(--bs-alert-color);background-color:var(--bs-alert-bg);border:var(--bs-alert-border);border-radius:var(--bs-alert-border-radius)}.alert-heading{color:inherit}.alert-link{font-weight:700}.alert-dismissible{padding-right:3rem}.alert-dismissible .btn-close{position:absolute;top:0;right:0;z-index:2;padding:1.25rem 1rem}.alert-primary{--bs-alert-color: #084298;--bs-alert-bg: #cfe2ff;--bs-alert-border-color: #b6d4fe}.alert-primary .alert-link{color:#06357a}.alert-secondary{--bs-alert-color: #41464b;--bs-alert-bg: #e2e3e5;--bs-alert-border-color: #d3d6d8}.alert-secondary .alert-link{color:#34383c}.alert-success{--bs-alert-color: #0f5132;--bs-alert-bg: #d1e7dd;--bs-alert-border-color: #badbcc}.alert-success .alert-link{color:#0c4128}.alert-info{--bs-alert-color: #055160;--bs-alert-bg: #cff4fc;--bs-alert-border-color: #b6effb}.alert-info .alert-link{color:#04414d}.alert-warning{--bs-alert-color: #664d03;--bs-alert-bg: #fff3cd;--bs-alert-border-color: #ffecb5}.alert-warning .alert-link{color:#523e02}.alert-danger{--bs-alert-color: #842029;--bs-alert-bg: #f8d7da;--bs-alert-border-color: #f5c2c7}.alert-danger .alert-link{color:#6a1a21}.alert-light{--bs-alert-color: #636464;--bs-alert-bg: #fefefe;--bs-alert-border-color: #fdfdfe}.alert-light .alert-link{color:#4f5050}.alert-dark{--bs-alert-color: #141619;--bs-alert-bg: #d3d3d4;--bs-alert-border-color: #bcbebf}.alert-dark .alert-link{color:#101214}@keyframes progress-bar-stripes{0%{background-position-x:1rem}}.progress{--bs-progress-height: 1rem;--bs-progress-font-size:0.75rem;--bs-progress-bg: #e9ecef;--bs-progress-border-radius: 0.375rem;--bs-progress-box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.075);--bs-progress-bar-color: #fff;--bs-progress-bar-bg: #0d6efd;--bs-progress-bar-transition: width 0.6s ease;display:flex;height:var(--bs-progress-height);overflow:hidden;font-size:var(--bs-progress-font-size);background-color:var(--bs-progress-bg);border-radius:var(--bs-progress-border-radius)}.progress-bar{display:flex;flex-direction:column;justify-content:center;overflow:hidden;color:var(--bs-progress-bar-color);text-align:center;white-space:nowrap;background-color:var(--bs-progress-bar-bg);transition:var(--bs-progress-bar-transition)}@media(prefers-reduced-motion: reduce){.progress-bar{transition:none}}.progress-bar-striped{background-image:linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);background-size:var(--bs-progress-height) var(--bs-progress-height)}.progress-bar-animated{animation:1s linear infinite progress-bar-stripes}@media(prefers-reduced-motion: reduce){.progress-bar-animated{animation:none}}.list-group{--bs-list-group-color: #212529;--bs-list-group-bg: #fff;--bs-list-group-border-color: rgba(0, 0, 0, 0.125);--bs-list-group-border-width: 1px;--bs-list-group-border-radius: 0.375rem;--bs-list-group-item-padding-x: 1rem;--bs-list-group-item-padding-y: 0.5rem;--bs-list-group-action-color: #495057;--bs-list-group-action-hover-color: #495057;--bs-list-group-action-hover-bg: #f8f9fa;--bs-list-group-action-active-color: #212529;--bs-list-group-action-active-bg: #e9ecef;--bs-list-group-disabled-color: #6c757d;--bs-list-group-disabled-bg: #fff;--bs-list-group-active-color: #fff;--bs-list-group-active-bg: #0d6efd;--bs-list-group-active-border-color: #0d6efd;display:flex;flex-direction:column;padding-left:0;margin-bottom:0;border-radius:var(--bs-list-group-border-radius)}.list-group-numbered{list-style-type:none;counter-reset:section}.list-group-numbered>.list-group-item::before{content:counters(section, ".") ". ";counter-increment:section}.list-group-item-action{width:100%;color:var(--bs-list-group-action-color);text-align:inherit}.list-group-item-action:hover,.list-group-item-action:focus{z-index:1;color:var(--bs-list-group-action-hover-color);text-decoration:none;background-color:var(--bs-list-group-action-hover-bg)}.list-group-item-action:active{color:var(--bs-list-group-action-active-color);background-color:var(--bs-list-group-action-active-bg)}.list-group-item{position:relative;display:block;padding:var(--bs-list-group-item-padding-y) var(--bs-list-group-item-padding-x);color:var(--bs-list-group-color);text-decoration:none;background-color:var(--bs-list-group-bg);border:var(--bs-list-group-border-width) solid var(--bs-list-group-border-color)}.list-group-item:first-child{border-top-left-radius:inherit;border-top-right-radius:inherit}.list-group-item:last-child{border-bottom-right-radius:inherit;border-bottom-left-radius:inherit}.list-group-item.disabled,.list-group-item:disabled{color:var(--bs-list-group-disabled-color);pointer-events:none;background-color:var(--bs-list-group-disabled-bg)}.list-group-item.active{z-index:2;color:var(--bs-list-group-active-color);background-color:var(--bs-list-group-active-bg);border-color:var(--bs-list-group-active-border-color)}.list-group-item+.list-group-item{border-top-width:0}.list-group-item+.list-group-item.active{margin-top:calc(-1*var(--bs-list-group-border-width));border-top-width:var(--bs-list-group-border-width)}.list-group-horizontal{flex-direction:row}.list-group-horizontal>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal>.list-group-item.active{margin-top:0}.list-group-horizontal>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal>.list-group-item+.list-group-item.active{margin-left:calc(-1*var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}@media(min-width: 576px){.list-group-horizontal-sm{flex-direction:row}.list-group-horizontal-sm>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-sm>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-sm>.list-group-item.active{margin-top:0}.list-group-horizontal-sm>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-sm>.list-group-item+.list-group-item.active{margin-left:calc(-1*var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}@media(min-width: 768px){.list-group-horizontal-md{flex-direction:row}.list-group-horizontal-md>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-md>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-md>.list-group-item.active{margin-top:0}.list-group-horizontal-md>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-md>.list-group-item+.list-group-item.active{margin-left:calc(-1*var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}@media(min-width: 992px){.list-group-horizontal-lg{flex-direction:row}.list-group-horizontal-lg>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-lg>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-lg>.list-group-item.active{margin-top:0}.list-group-horizontal-lg>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-lg>.list-group-item+.list-group-item.active{margin-left:calc(-1*var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}@media(min-width: 1200px){.list-group-horizontal-xl{flex-direction:row}.list-group-horizontal-xl>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-xl>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-xl>.list-group-item.active{margin-top:0}.list-group-horizontal-xl>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-xl>.list-group-item+.list-group-item.active{margin-left:calc(-1*var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}@media(min-width: 1400px){.list-group-horizontal-xxl{flex-direction:row}.list-group-horizontal-xxl>.list-group-item:first-child:not(:last-child){border-bottom-left-radius:var(--bs-list-group-border-radius);border-top-right-radius:0}.list-group-horizontal-xxl>.list-group-item:last-child:not(:first-child){border-top-right-radius:var(--bs-list-group-border-radius);border-bottom-left-radius:0}.list-group-horizontal-xxl>.list-group-item.active{margin-top:0}.list-group-horizontal-xxl>.list-group-item+.list-group-item{border-top-width:var(--bs-list-group-border-width);border-left-width:0}.list-group-horizontal-xxl>.list-group-item+.list-group-item.active{margin-left:calc(-1*var(--bs-list-group-border-width));border-left-width:var(--bs-list-group-border-width)}}.list-group-flush{border-radius:0}.list-group-flush>.list-group-item{border-width:0 0 var(--bs-list-group-border-width)}.list-group-flush>.list-group-item:last-child{border-bottom-width:0}.list-group-item-primary{color:#084298;background-color:#cfe2ff}.list-group-item-primary.list-group-item-action:hover,.list-group-item-primary.list-group-item-action:focus{color:#084298;background-color:#bacbe6}.list-group-item-primary.list-group-item-action.active{color:#fff;background-color:#084298;border-color:#084298}.list-group-item-secondary{color:#41464b;background-color:#e2e3e5}.list-group-item-secondary.list-group-item-action:hover,.list-group-item-secondary.list-group-item-action:focus{color:#41464b;background-color:#cbccce}.list-group-item-secondary.list-group-item-action.active{color:#fff;background-color:#41464b;border-color:#41464b}.list-group-item-success{color:#0f5132;background-color:#d1e7dd}.list-group-item-success.list-group-item-action:hover,.list-group-item-success.list-group-item-action:focus{color:#0f5132;background-color:#bcd0c7}.list-group-item-success.list-group-item-action.active{color:#fff;background-color:#0f5132;border-color:#0f5132}.list-group-item-info{color:#055160;background-color:#cff4fc}.list-group-item-info.list-group-item-action:hover,.list-group-item-info.list-group-item-action:focus{color:#055160;background-color:#badce3}.list-group-item-info.list-group-item-action.active{color:#fff;background-color:#055160;border-color:#055160}.list-group-item-warning{color:#664d03;background-color:#fff3cd}.list-group-item-warning.list-group-item-action:hover,.list-group-item-warning.list-group-item-action:focus{color:#664d03;background-color:#e6dbb9}.list-group-item-warning.list-group-item-action.active{color:#fff;background-color:#664d03;border-color:#664d03}.list-group-item-danger{color:#842029;background-color:#f8d7da}.list-group-item-danger.list-group-item-action:hover,.list-group-item-danger.list-group-item-action:focus{color:#842029;background-color:#dfc2c4}.list-group-item-danger.list-group-item-action.active{color:#fff;background-color:#842029;border-color:#842029}.list-group-item-light{color:#636464;background-color:#fefefe}.list-group-item-light.list-group-item-action:hover,.list-group-item-light.list-group-item-action:focus{color:#636464;background-color:#e5e5e5}.list-group-item-light.list-group-item-action.active{color:#fff;background-color:#636464;border-color:#636464}.list-group-item-dark{color:#141619;background-color:#d3d3d4}.list-group-item-dark.list-group-item-action:hover,.list-group-item-dark.list-group-item-action:focus{color:#141619;background-color:#bebebf}.list-group-item-dark.list-group-item-action.active{color:#fff;background-color:#141619;border-color:#141619}.btn-close{box-sizing:content-box;width:1em;height:1em;padding:.25em .25em;color:#000;background:rgba(0,0,0,0) url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23000'%3e%3cpath d='M.293.293a1 1 0 0 1 1.414 0L8 6.586 14.293.293a1 1 0 1 1 1.414 1.414L9.414 8l6.293 6.293a1 1 0 0 1-1.414 1.414L8 9.414l-6.293 6.293a1 1 0 0 1-1.414-1.414L6.586 8 .293 1.707a1 1 0 0 1 0-1.414z'/%3e%3c/svg%3e") center/1em auto no-repeat;border:0;border-radius:.375rem;opacity:.5}.btn-close:hover{color:#000;text-decoration:none;opacity:.75}.btn-close:focus{outline:0;box-shadow:0 0 0 .25rem rgba(13,110,253,.25);opacity:1}.btn-close:disabled,.btn-close.disabled{pointer-events:none;user-select:none;opacity:.25}.btn-close-white{filter:invert(1) grayscale(100%) brightness(200%)}.toast{--bs-toast-zindex: 1090;--bs-toast-padding-x: 0.75rem;--bs-toast-padding-y: 0.5rem;--bs-toast-spacing: 1.5rem;--bs-toast-max-width: 350px;--bs-toast-font-size:0.875rem;--bs-toast-color: ;--bs-toast-bg: rgba(255, 255, 255, 0.85);--bs-toast-border-width: 1px;--bs-toast-border-color: var(--bs-border-color-translucent);--bs-toast-border-radius: 0.375rem;--bs-toast-box-shadow: 0 0.5rem 1rem rgba(0, 0, 0, 0.15);--bs-toast-header-color: #6c757d;--bs-toast-header-bg: rgba(255, 255, 255, 0.85);--bs-toast-header-border-color: rgba(0, 0, 0, 0.05);width:var(--bs-toast-max-width);max-width:100%;font-size:var(--bs-toast-font-size);color:var(--bs-toast-color);pointer-events:auto;background-color:var(--bs-toast-bg);background-clip:padding-box;border:var(--bs-toast-border-width) solid var(--bs-toast-border-color);box-shadow:var(--bs-toast-box-shadow);border-radius:var(--bs-toast-border-radius)}.toast.showing{opacity:0}.toast:not(.show){display:none}.toast-container{--bs-toast-zindex: 1090;position:absolute;z-index:var(--bs-toast-zindex);width:max-content;max-width:100%;pointer-events:none}.toast-container>:not(:last-child){margin-bottom:var(--bs-toast-spacing)}.toast-header{display:flex;align-items:center;padding:var(--bs-toast-padding-y) var(--bs-toast-padding-x);color:var(--bs-toast-header-color);background-color:var(--bs-toast-header-bg);background-clip:padding-box;border-bottom:var(--bs-toast-border-width) solid var(--bs-toast-header-border-color);border-top-left-radius:calc(var(--bs-toast-border-radius) - var(--bs-toast-border-width));border-top-right-radius:calc(var(--bs-toast-border-radius) - var(--bs-toast-border-width))}.toast-header .btn-close{margin-right:calc(-0.5*var(--bs-toast-padding-x));margin-left:var(--bs-toast-padding-x)}.toast-body{padding:var(--bs-toast-padding-x);word-wrap:break-word}.modal{--bs-modal-zindex: 1055;--bs-modal-width: 500px;--bs-modal-padding: 1rem;--bs-modal-margin: 0.5rem;--bs-modal-color: ;--bs-modal-bg: #fff;--bs-modal-border-color: var(--bs-border-color-translucent);--bs-modal-border-width: 1px;--bs-modal-border-radius: 0.5rem;--bs-modal-box-shadow: 0 0.125rem 0.25rem rgba(0, 0, 0, 0.075);--bs-modal-inner-border-radius: calc(0.5rem - 1px);--bs-modal-header-padding-x: 1rem;--bs-modal-header-padding-y: 1rem;--bs-modal-header-padding: 1rem 1rem;--bs-modal-header-border-color: var(--bs-border-color);--bs-modal-header-border-width: 1px;--bs-modal-title-line-height: 1.5;--bs-modal-footer-gap: 0.5rem;--bs-modal-footer-bg: ;--bs-modal-footer-border-color: var(--bs-border-color);--bs-modal-footer-border-width: 1px;position:fixed;top:0;left:0;z-index:var(--bs-modal-zindex);display:none;width:100%;height:100%;overflow-x:hidden;overflow-y:auto;outline:0}.modal-dialog{position:relative;width:auto;margin:var(--bs-modal-margin);pointer-events:none}.modal.fade .modal-dialog{transition:transform .3s ease-out;transform:translate(0, -50px)}@media(prefers-reduced-motion: reduce){.modal.fade .modal-dialog{transition:none}}.modal.show .modal-dialog{transform:none}.modal.modal-static .modal-dialog{transform:scale(1.02)}.modal-dialog-scrollable{height:calc(100% - var(--bs-modal-margin)*2)}.modal-dialog-scrollable .modal-content{max-height:100%;overflow:hidden}.modal-dialog-scrollable .modal-body{overflow-y:auto}.modal-dialog-centered{display:flex;align-items:center;min-height:calc(100% - var(--bs-modal-margin)*2)}.modal-content{position:relative;display:flex;flex-direction:column;width:100%;color:var(--bs-modal-color);pointer-events:auto;background-color:var(--bs-modal-bg);background-clip:padding-box;border:var(--bs-modal-border-width) solid var(--bs-modal-border-color);border-radius:var(--bs-modal-border-radius);outline:0}.modal-backdrop{--bs-backdrop-zindex: 1050;--bs-backdrop-bg: #000;--bs-backdrop-opacity: 0.5;position:fixed;top:0;left:0;z-index:var(--bs-backdrop-zindex);width:100vw;height:100vh;background-color:var(--bs-backdrop-bg)}.modal-backdrop.fade{opacity:0}.modal-backdrop.show{opacity:var(--bs-backdrop-opacity)}.modal-header{display:flex;flex-shrink:0;align-items:center;justify-content:space-between;padding:var(--bs-modal-header-padding);border-bottom:var(--bs-modal-header-border-width) solid var(--bs-modal-header-border-color);border-top-left-radius:var(--bs-modal-inner-border-radius);border-top-right-radius:var(--bs-modal-inner-border-radius)}.modal-header .btn-close{padding:calc(var(--bs-modal-header-padding-y)*.5) calc(var(--bs-modal-header-padding-x)*.5);margin:calc(-0.5*var(--bs-modal-header-padding-y)) calc(-0.5*var(--bs-modal-header-padding-x)) calc(-0.5*var(--bs-modal-header-padding-y)) auto}.modal-title{margin-bottom:0;line-height:var(--bs-modal-title-line-height)}.modal-body{position:relative;flex:1 1 auto;padding:var(--bs-modal-padding)}.modal-footer{display:flex;flex-shrink:0;flex-wrap:wrap;align-items:center;justify-content:flex-end;padding:calc(var(--bs-modal-padding) - var(--bs-modal-footer-gap)*.5);background-color:var(--bs-modal-footer-bg);border-top:var(--bs-modal-footer-border-width) solid var(--bs-modal-footer-border-color);border-bottom-right-radius:var(--bs-modal-inner-border-radius);border-bottom-left-radius:var(--bs-modal-inner-border-radius)}.modal-footer>*{margin:calc(var(--bs-modal-footer-gap)*.5)}@media(min-width: 576px){.modal{--bs-modal-margin: 1.75rem;--bs-modal-box-shadow: 0 0.5rem 1rem rgba(0, 0, 0, 0.15)}.modal-dialog{max-width:var(--bs-modal-width);margin-right:auto;margin-left:auto}.modal-sm{--bs-modal-width: 300px}}@media(min-width: 992px){.modal-lg,.modal-xl{--bs-modal-width: 800px}}@media(min-width: 1200px){.modal-xl{--bs-modal-width: 1140px}}.modal-fullscreen{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen .modal-header,.modal-fullscreen .modal-footer{border-radius:0}.modal-fullscreen .modal-body{overflow-y:auto}@media(max-width: 575.98px){.modal-fullscreen-sm-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-sm-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-sm-down .modal-header,.modal-fullscreen-sm-down .modal-footer{border-radius:0}.modal-fullscreen-sm-down .modal-body{overflow-y:auto}}@media(max-width: 767.98px){.modal-fullscreen-md-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-md-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-md-down .modal-header,.modal-fullscreen-md-down .modal-footer{border-radius:0}.modal-fullscreen-md-down .modal-body{overflow-y:auto}}@media(max-width: 991.98px){.modal-fullscreen-lg-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-lg-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-lg-down .modal-header,.modal-fullscreen-lg-down .modal-footer{border-radius:0}.modal-fullscreen-lg-down .modal-body{overflow-y:auto}}@media(max-width: 1199.98px){.modal-fullscreen-xl-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-xl-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-xl-down .modal-header,.modal-fullscreen-xl-down .modal-footer{border-radius:0}.modal-fullscreen-xl-down .modal-body{overflow-y:auto}}@media(max-width: 1399.98px){.modal-fullscreen-xxl-down{width:100vw;max-width:none;height:100%;margin:0}.modal-fullscreen-xxl-down .modal-content{height:100%;border:0;border-radius:0}.modal-fullscreen-xxl-down .modal-header,.modal-fullscreen-xxl-down .modal-footer{border-radius:0}.modal-fullscreen-xxl-down .modal-body{overflow-y:auto}}.tooltip{--bs-tooltip-zindex: 1080;--bs-tooltip-max-width: 200px;--bs-tooltip-padding-x: 0.5rem;--bs-tooltip-padding-y: 0.25rem;--bs-tooltip-margin: ;--bs-tooltip-font-size:0.875rem;--bs-tooltip-color: #fff;--bs-tooltip-bg: #000;--bs-tooltip-border-radius: 0.375rem;--bs-tooltip-opacity: 0.9;--bs-tooltip-arrow-width: 0.8rem;--bs-tooltip-arrow-height: 0.4rem;z-index:var(--bs-tooltip-zindex);display:block;padding:var(--bs-tooltip-arrow-height);margin:var(--bs-tooltip-margin);font-family:var(--bs-font-sans-serif);font-style:normal;font-weight:400;line-height:1.5;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;white-space:normal;word-spacing:normal;line-break:auto;font-size:var(--bs-tooltip-font-size);word-wrap:break-word;opacity:0}.tooltip.show{opacity:var(--bs-tooltip-opacity)}.tooltip .tooltip-arrow{display:block;width:var(--bs-tooltip-arrow-width);height:var(--bs-tooltip-arrow-height)}.tooltip .tooltip-arrow::before{position:absolute;content:"";border-color:rgba(0,0,0,0);border-style:solid}.bs-tooltip-top .tooltip-arrow,.bs-tooltip-auto[data-popper-placement^=top] .tooltip-arrow{bottom:0}.bs-tooltip-top .tooltip-arrow::before,.bs-tooltip-auto[data-popper-placement^=top] .tooltip-arrow::before{top:-1px;border-width:var(--bs-tooltip-arrow-height) calc(var(--bs-tooltip-arrow-width)*.5) 0;border-top-color:var(--bs-tooltip-bg)}.bs-tooltip-end .tooltip-arrow,.bs-tooltip-auto[data-popper-placement^=right] .tooltip-arrow{left:0;width:var(--bs-tooltip-arrow-height);height:var(--bs-tooltip-arrow-width)}.bs-tooltip-end .tooltip-arrow::before,.bs-tooltip-auto[data-popper-placement^=right] .tooltip-arrow::before{right:-1px;border-width:calc(var(--bs-tooltip-arrow-width)*.5) var(--bs-tooltip-arrow-height) calc(var(--bs-tooltip-arrow-width)*.5) 0;border-right-color:var(--bs-tooltip-bg)}.bs-tooltip-bottom .tooltip-arrow,.bs-tooltip-auto[data-popper-placement^=bottom] .tooltip-arrow{top:0}.bs-tooltip-bottom .tooltip-arrow::before,.bs-tooltip-auto[data-popper-placement^=bottom] .tooltip-arrow::before{bottom:-1px;border-width:0 calc(var(--bs-tooltip-arrow-width)*.5) var(--bs-tooltip-arrow-height);border-bottom-color:var(--bs-tooltip-bg)}.bs-tooltip-start .tooltip-arrow,.bs-tooltip-auto[data-popper-placement^=left] .tooltip-arrow{right:0;width:var(--bs-tooltip-arrow-height);height:var(--bs-tooltip-arrow-width)}.bs-tooltip-start .tooltip-arrow::before,.bs-tooltip-auto[data-popper-placement^=left] .tooltip-arrow::before{left:-1px;border-width:calc(var(--bs-tooltip-arrow-width)*.5) 0 calc(var(--bs-tooltip-arrow-width)*.5) var(--bs-tooltip-arrow-height);border-left-color:var(--bs-tooltip-bg)}.tooltip-inner{max-width:var(--bs-tooltip-max-width);padding:var(--bs-tooltip-padding-y) var(--bs-tooltip-padding-x);color:var(--bs-tooltip-color);text-align:center;background-color:var(--bs-tooltip-bg);border-radius:var(--bs-tooltip-border-radius)}.popover{--bs-popover-zindex: 1070;--bs-popover-max-width: 276px;--bs-popover-font-size:0.875rem;--bs-popover-bg: #fff;--bs-popover-border-width: 1px;--bs-popover-border-color: var(--bs-border-color-translucent);--bs-popover-border-radius: 0.5rem;--bs-popover-inner-border-radius: calc(0.5rem - 1px);--bs-popover-box-shadow: 0 0.5rem 1rem rgba(0, 0, 0, 0.15);--bs-popover-header-padding-x: 1rem;--bs-popover-header-padding-y: 0.5rem;--bs-popover-header-font-size:1rem;--bs-popover-header-color: ;--bs-popover-header-bg: #f0f0f0;--bs-popover-body-padding-x: 1rem;--bs-popover-body-padding-y: 1rem;--bs-popover-body-color: #212529;--bs-popover-arrow-width: 1rem;--bs-popover-arrow-height: 0.5rem;--bs-popover-arrow-border: var(--bs-popover-border-color);z-index:var(--bs-popover-zindex);display:block;max-width:var(--bs-popover-max-width);font-family:var(--bs-font-sans-serif);font-style:normal;font-weight:400;line-height:1.5;text-align:left;text-align:start;text-decoration:none;text-shadow:none;text-transform:none;letter-spacing:normal;word-break:normal;white-space:normal;word-spacing:normal;line-break:auto;font-size:var(--bs-popover-font-size);word-wrap:break-word;background-color:var(--bs-popover-bg);background-clip:padding-box;border:var(--bs-popover-border-width) solid var(--bs-popover-border-color);border-radius:var(--bs-popover-border-radius)}.popover .popover-arrow{display:block;width:var(--bs-popover-arrow-width);height:var(--bs-popover-arrow-height)}.popover .popover-arrow::before,.popover .popover-arrow::after{position:absolute;display:block;content:"";border-color:rgba(0,0,0,0);border-style:solid;border-width:0}.bs-popover-top>.popover-arrow,.bs-popover-auto[data-popper-placement^=top]>.popover-arrow{bottom:calc(-1*(var(--bs-popover-arrow-height)) - var(--bs-popover-border-width))}.bs-popover-top>.popover-arrow::before,.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::before,.bs-popover-top>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::after{border-width:var(--bs-popover-arrow-height) calc(var(--bs-popover-arrow-width)*.5) 0}.bs-popover-top>.popover-arrow::before,.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::before{bottom:0;border-top-color:var(--bs-popover-arrow-border)}.bs-popover-top>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=top]>.popover-arrow::after{bottom:var(--bs-popover-border-width);border-top-color:var(--bs-popover-bg)}.bs-popover-end>.popover-arrow,.bs-popover-auto[data-popper-placement^=right]>.popover-arrow{left:calc(-1*(var(--bs-popover-arrow-height)) - var(--bs-popover-border-width));width:var(--bs-popover-arrow-height);height:var(--bs-popover-arrow-width)}.bs-popover-end>.popover-arrow::before,.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::before,.bs-popover-end>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::after{border-width:calc(var(--bs-popover-arrow-width)*.5) var(--bs-popover-arrow-height) calc(var(--bs-popover-arrow-width)*.5) 0}.bs-popover-end>.popover-arrow::before,.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::before{left:0;border-right-color:var(--bs-popover-arrow-border)}.bs-popover-end>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=right]>.popover-arrow::after{left:var(--bs-popover-border-width);border-right-color:var(--bs-popover-bg)}.bs-popover-bottom>.popover-arrow,.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow{top:calc(-1*(var(--bs-popover-arrow-height)) - var(--bs-popover-border-width))}.bs-popover-bottom>.popover-arrow::before,.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::before,.bs-popover-bottom>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::after{border-width:0 calc(var(--bs-popover-arrow-width)*.5) var(--bs-popover-arrow-height)}.bs-popover-bottom>.popover-arrow::before,.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::before{top:0;border-bottom-color:var(--bs-popover-arrow-border)}.bs-popover-bottom>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=bottom]>.popover-arrow::after{top:var(--bs-popover-border-width);border-bottom-color:var(--bs-popover-bg)}.bs-popover-bottom .popover-header::before,.bs-popover-auto[data-popper-placement^=bottom] .popover-header::before{position:absolute;top:0;left:50%;display:block;width:var(--bs-popover-arrow-width);margin-left:calc(-0.5*var(--bs-popover-arrow-width));content:"";border-bottom:var(--bs-popover-border-width) solid var(--bs-popover-header-bg)}.bs-popover-start>.popover-arrow,.bs-popover-auto[data-popper-placement^=left]>.popover-arrow{right:calc(-1*(var(--bs-popover-arrow-height)) - var(--bs-popover-border-width));width:var(--bs-popover-arrow-height);height:var(--bs-popover-arrow-width)}.bs-popover-start>.popover-arrow::before,.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::before,.bs-popover-start>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::after{border-width:calc(var(--bs-popover-arrow-width)*.5) 0 calc(var(--bs-popover-arrow-width)*.5) var(--bs-popover-arrow-height)}.bs-popover-start>.popover-arrow::before,.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::before{right:0;border-left-color:var(--bs-popover-arrow-border)}.bs-popover-start>.popover-arrow::after,.bs-popover-auto[data-popper-placement^=left]>.popover-arrow::after{right:var(--bs-popover-border-width);border-left-color:var(--bs-popover-bg)}.popover-header{padding:var(--bs-popover-header-padding-y) var(--bs-popover-header-padding-x);margin-bottom:0;font-size:var(--bs-popover-header-font-size);color:var(--bs-popover-header-color);background-color:var(--bs-popover-header-bg);border-bottom:var(--bs-popover-border-width) solid var(--bs-popover-border-color);border-top-left-radius:var(--bs-popover-inner-border-radius);border-top-right-radius:var(--bs-popover-inner-border-radius)}.popover-header:empty{display:none}.popover-body{padding:var(--bs-popover-body-padding-y) var(--bs-popover-body-padding-x);color:var(--bs-popover-body-color)}.carousel{position:relative}.carousel.pointer-event{touch-action:pan-y}.carousel-inner{position:relative;width:100%;overflow:hidden}.carousel-inner::after{display:block;clear:both;content:""}.carousel-item{position:relative;display:none;float:left;width:100%;margin-right:-100%;backface-visibility:hidden;transition:transform .6s ease-in-out}@media(prefers-reduced-motion: reduce){.carousel-item{transition:none}}.carousel-item.active,.carousel-item-next,.carousel-item-prev{display:block}.carousel-item-next:not(.carousel-item-start),.active.carousel-item-end{transform:translateX(100%)}.carousel-item-prev:not(.carousel-item-end),.active.carousel-item-start{transform:translateX(-100%)}.carousel-fade .carousel-item{opacity:0;transition-property:opacity;transform:none}.carousel-fade .carousel-item.active,.carousel-fade .carousel-item-next.carousel-item-start,.carousel-fade .carousel-item-prev.carousel-item-end{z-index:1;opacity:1}.carousel-fade .active.carousel-item-start,.carousel-fade .active.carousel-item-end{z-index:0;opacity:0;transition:opacity 0s .6s}@media(prefers-reduced-motion: reduce){.carousel-fade .active.carousel-item-start,.carousel-fade .active.carousel-item-end{transition:none}}.carousel-control-prev,.carousel-control-next{position:absolute;top:0;bottom:0;z-index:1;display:flex;align-items:center;justify-content:center;width:15%;padding:0;color:#fff;text-align:center;background:none;border:0;opacity:.5;transition:opacity .15s ease}@media(prefers-reduced-motion: reduce){.carousel-control-prev,.carousel-control-next{transition:none}}.carousel-control-prev:hover,.carousel-control-prev:focus,.carousel-control-next:hover,.carousel-control-next:focus{color:#fff;text-decoration:none;outline:0;opacity:.9}.carousel-control-prev{left:0}.carousel-control-next{right:0}.carousel-control-prev-icon,.carousel-control-next-icon{display:inline-block;width:2rem;height:2rem;background-repeat:no-repeat;background-position:50%;background-size:100% 100%}.carousel-control-prev-icon{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23fff'%3e%3cpath d='M11.354 1.646a.5.5 0 0 1 0 .708L5.707 8l5.647 5.646a.5.5 0 0 1-.708.708l-6-6a.5.5 0 0 1 0-.708l6-6a.5.5 0 0 1 .708 0z'/%3e%3c/svg%3e")}.carousel-control-next-icon{background-image:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23fff'%3e%3cpath d='M4.646 1.646a.5.5 0 0 1 .708 0l6 6a.5.5 0 0 1 0 .708l-6 6a.5.5 0 0 1-.708-.708L10.293 8 4.646 2.354a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e")}.carousel-indicators{position:absolute;right:0;bottom:0;left:0;z-index:2;display:flex;justify-content:center;padding:0;margin-right:15%;margin-bottom:1rem;margin-left:15%;list-style:none}.carousel-indicators [data-bs-target]{box-sizing:content-box;flex:0 1 auto;width:30px;height:3px;padding:0;margin-right:3px;margin-left:3px;text-indent:-999px;cursor:pointer;background-color:#fff;background-clip:padding-box;border:0;border-top:10px solid rgba(0,0,0,0);border-bottom:10px solid rgba(0,0,0,0);opacity:.5;transition:opacity .6s ease}@media(prefers-reduced-motion: reduce){.carousel-indicators [data-bs-target]{transition:none}}.carousel-indicators .active{opacity:1}.carousel-caption{position:absolute;right:15%;bottom:1.25rem;left:15%;padding-top:1.25rem;padding-bottom:1.25rem;color:#fff;text-align:center}.carousel-dark .carousel-control-prev-icon,.carousel-dark .carousel-control-next-icon{filter:invert(1) grayscale(100)}.carousel-dark .carousel-indicators [data-bs-target]{background-color:#000}.carousel-dark .carousel-caption{color:#000}.spinner-grow,.spinner-border{display:inline-block;width:var(--bs-spinner-width);height:var(--bs-spinner-height);vertical-align:var(--bs-spinner-vertical-align);border-radius:50%;animation:var(--bs-spinner-animation-speed) linear infinite var(--bs-spinner-animation-name)}@keyframes spinner-border{to{transform:rotate(360deg) /* rtl:ignore */}}.spinner-border{--bs-spinner-width: 2rem;--bs-spinner-height: 2rem;--bs-spinner-vertical-align: -0.125em;--bs-spinner-border-width: 0.25em;--bs-spinner-animation-speed: 0.75s;--bs-spinner-animation-name: spinner-border;border:var(--bs-spinner-border-width) solid currentcolor;border-right-color:rgba(0,0,0,0)}.spinner-border-sm{--bs-spinner-width: 1rem;--bs-spinner-height: 1rem;--bs-spinner-border-width: 0.2em}@keyframes spinner-grow{0%{transform:scale(0)}50%{opacity:1;transform:none}}.spinner-grow{--bs-spinner-width: 2rem;--bs-spinner-height: 2rem;--bs-spinner-vertical-align: -0.125em;--bs-spinner-animation-speed: 0.75s;--bs-spinner-animation-name: spinner-grow;background-color:currentcolor;opacity:0}.spinner-grow-sm{--bs-spinner-width: 1rem;--bs-spinner-height: 1rem}@media(prefers-reduced-motion: reduce){.spinner-border,.spinner-grow{--bs-spinner-animation-speed: 1.5s}}.offcanvas,.offcanvas-xxl,.offcanvas-xl,.offcanvas-lg,.offcanvas-md,.offcanvas-sm{--bs-offcanvas-zindex: 1045;--bs-offcanvas-width: 400px;--bs-offcanvas-height: 30vh;--bs-offcanvas-padding-x: 1rem;--bs-offcanvas-padding-y: 1rem;--bs-offcanvas-color: ;--bs-offcanvas-bg: #fff;--bs-offcanvas-border-width: 1px;--bs-offcanvas-border-color: var(--bs-border-color-translucent);--bs-offcanvas-box-shadow: 0 0.125rem 0.25rem rgba(0, 0, 0, 0.075)}@media(max-width: 575.98px){.offcanvas-sm{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:transform .3s ease-in-out}}@media(max-width: 575.98px)and (prefers-reduced-motion: reduce){.offcanvas-sm{transition:none}}@media(max-width: 575.98px){.offcanvas-sm.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}}@media(max-width: 575.98px){.offcanvas-sm.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}}@media(max-width: 575.98px){.offcanvas-sm.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}}@media(max-width: 575.98px){.offcanvas-sm.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}}@media(max-width: 575.98px){.offcanvas-sm.showing,.offcanvas-sm.show:not(.hiding){transform:none}}@media(max-width: 575.98px){.offcanvas-sm.showing,.offcanvas-sm.hiding,.offcanvas-sm.show{visibility:visible}}@media(min-width: 576px){.offcanvas-sm{--bs-offcanvas-height: auto;--bs-offcanvas-border-width: 0;background-color:rgba(0,0,0,0) !important}.offcanvas-sm .offcanvas-header{display:none}.offcanvas-sm .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:rgba(0,0,0,0) !important}}@media(max-width: 767.98px){.offcanvas-md{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:transform .3s ease-in-out}}@media(max-width: 767.98px)and (prefers-reduced-motion: reduce){.offcanvas-md{transition:none}}@media(max-width: 767.98px){.offcanvas-md.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}}@media(max-width: 767.98px){.offcanvas-md.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}}@media(max-width: 767.98px){.offcanvas-md.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}}@media(max-width: 767.98px){.offcanvas-md.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}}@media(max-width: 767.98px){.offcanvas-md.showing,.offcanvas-md.show:not(.hiding){transform:none}}@media(max-width: 767.98px){.offcanvas-md.showing,.offcanvas-md.hiding,.offcanvas-md.show{visibility:visible}}@media(min-width: 768px){.offcanvas-md{--bs-offcanvas-height: auto;--bs-offcanvas-border-width: 0;background-color:rgba(0,0,0,0) !important}.offcanvas-md .offcanvas-header{display:none}.offcanvas-md .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:rgba(0,0,0,0) !important}}@media(max-width: 991.98px){.offcanvas-lg{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:transform .3s ease-in-out}}@media(max-width: 991.98px)and (prefers-reduced-motion: reduce){.offcanvas-lg{transition:none}}@media(max-width: 991.98px){.offcanvas-lg.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}}@media(max-width: 991.98px){.offcanvas-lg.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}}@media(max-width: 991.98px){.offcanvas-lg.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}}@media(max-width: 991.98px){.offcanvas-lg.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}}@media(max-width: 991.98px){.offcanvas-lg.showing,.offcanvas-lg.show:not(.hiding){transform:none}}@media(max-width: 991.98px){.offcanvas-lg.showing,.offcanvas-lg.hiding,.offcanvas-lg.show{visibility:visible}}@media(min-width: 992px){.offcanvas-lg{--bs-offcanvas-height: auto;--bs-offcanvas-border-width: 0;background-color:rgba(0,0,0,0) !important}.offcanvas-lg .offcanvas-header{display:none}.offcanvas-lg .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:rgba(0,0,0,0) !important}}@media(max-width: 1199.98px){.offcanvas-xl{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:transform .3s ease-in-out}}@media(max-width: 1199.98px)and (prefers-reduced-motion: reduce){.offcanvas-xl{transition:none}}@media(max-width: 1199.98px){.offcanvas-xl.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}}@media(max-width: 1199.98px){.offcanvas-xl.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}}@media(max-width: 1199.98px){.offcanvas-xl.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}}@media(max-width: 1199.98px){.offcanvas-xl.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}}@media(max-width: 1199.98px){.offcanvas-xl.showing,.offcanvas-xl.show:not(.hiding){transform:none}}@media(max-width: 1199.98px){.offcanvas-xl.showing,.offcanvas-xl.hiding,.offcanvas-xl.show{visibility:visible}}@media(min-width: 1200px){.offcanvas-xl{--bs-offcanvas-height: auto;--bs-offcanvas-border-width: 0;background-color:rgba(0,0,0,0) !important}.offcanvas-xl .offcanvas-header{display:none}.offcanvas-xl .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:rgba(0,0,0,0) !important}}@media(max-width: 1399.98px){.offcanvas-xxl{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:transform .3s ease-in-out}}@media(max-width: 1399.98px)and (prefers-reduced-motion: reduce){.offcanvas-xxl{transition:none}}@media(max-width: 1399.98px){.offcanvas-xxl.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}}@media(max-width: 1399.98px){.offcanvas-xxl.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}}@media(max-width: 1399.98px){.offcanvas-xxl.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}}@media(max-width: 1399.98px){.offcanvas-xxl.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}}@media(max-width: 1399.98px){.offcanvas-xxl.showing,.offcanvas-xxl.show:not(.hiding){transform:none}}@media(max-width: 1399.98px){.offcanvas-xxl.showing,.offcanvas-xxl.hiding,.offcanvas-xxl.show{visibility:visible}}@media(min-width: 1400px){.offcanvas-xxl{--bs-offcanvas-height: auto;--bs-offcanvas-border-width: 0;background-color:rgba(0,0,0,0) !important}.offcanvas-xxl .offcanvas-header{display:none}.offcanvas-xxl .offcanvas-body{display:flex;flex-grow:0;padding:0;overflow-y:visible;background-color:rgba(0,0,0,0) !important}}.offcanvas{position:fixed;bottom:0;z-index:var(--bs-offcanvas-zindex);display:flex;flex-direction:column;max-width:100%;color:var(--bs-offcanvas-color);visibility:hidden;background-color:var(--bs-offcanvas-bg);background-clip:padding-box;outline:0;transition:transform .3s ease-in-out}@media(prefers-reduced-motion: reduce){.offcanvas{transition:none}}.offcanvas.offcanvas-start{top:0;left:0;width:var(--bs-offcanvas-width);border-right:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(-100%)}.offcanvas.offcanvas-end{top:0;right:0;width:var(--bs-offcanvas-width);border-left:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateX(100%)}.offcanvas.offcanvas-top{top:0;right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-bottom:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(-100%)}.offcanvas.offcanvas-bottom{right:0;left:0;height:var(--bs-offcanvas-height);max-height:100%;border-top:var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);transform:translateY(100%)}.offcanvas.showing,.offcanvas.show:not(.hiding){transform:none}.offcanvas.showing,.offcanvas.hiding,.offcanvas.show{visibility:visible}.offcanvas-backdrop{position:fixed;top:0;left:0;z-index:1040;width:100vw;height:100vh;background-color:#000}.offcanvas-backdrop.fade{opacity:0}.offcanvas-backdrop.show{opacity:.5}.offcanvas-header{display:flex;align-items:center;justify-content:space-between;padding:var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x)}.offcanvas-header .btn-close{padding:calc(var(--bs-offcanvas-padding-y)*.5) calc(var(--bs-offcanvas-padding-x)*.5);margin-top:calc(-0.5*var(--bs-offcanvas-padding-y));margin-right:calc(-0.5*var(--bs-offcanvas-padding-x));margin-bottom:calc(-0.5*var(--bs-offcanvas-padding-y))}.offcanvas-title{margin-bottom:0;line-height:1.5}.offcanvas-body{flex-grow:1;padding:var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x);overflow-y:auto}.placeholder{display:inline-block;min-height:1em;vertical-align:middle;cursor:wait;background-color:currentcolor;opacity:.5}.placeholder.btn::before{display:inline-block;content:""}.placeholder-xs{min-height:.6em}.placeholder-sm{min-height:.8em}.placeholder-lg{min-height:1.2em}.placeholder-glow .placeholder{animation:placeholder-glow 2s ease-in-out infinite}@keyframes placeholder-glow{50%{opacity:.2}}.placeholder-wave{mask-image:linear-gradient(130deg, #000 55%, rgba(0, 0, 0, 0.8) 75%, #000 95%);mask-size:200% 100%;animation:placeholder-wave 2s linear infinite}@keyframes placeholder-wave{100%{mask-position:-200% 0%}}.clearfix::after{display:block;clear:both;content:""}.text-bg-primary{color:#fff !important;background-color:RGBA(13, 110, 253, var(--bs-bg-opacity, 1)) !important}.text-bg-secondary{color:#fff !important;background-color:RGBA(108, 117, 125, var(--bs-bg-opacity, 1)) !important}.text-bg-success{color:#fff !important;background-color:RGBA(25, 135, 84, var(--bs-bg-opacity, 1)) !important}.text-bg-info{color:#000 !important;background-color:RGBA(13, 202, 240, var(--bs-bg-opacity, 1)) !important}.text-bg-warning{color:#000 !important;background-color:RGBA(255, 193, 7, var(--bs-bg-opacity, 1)) !important}.text-bg-danger{color:#fff !important;background-color:RGBA(220, 53, 69, var(--bs-bg-opacity, 1)) !important}.text-bg-light{color:#000 !important;background-color:RGBA(248, 249, 250, var(--bs-bg-opacity, 1)) !important}.text-bg-dark{color:#fff !important;background-color:RGBA(33, 37, 41, var(--bs-bg-opacity, 1)) !important}.link-primary{color:#0d6efd !important}.link-primary:hover,.link-primary:focus{color:#0a58ca !important}.link-secondary{color:#6c757d !important}.link-secondary:hover,.link-secondary:focus{color:#565e64 !important}.link-success{color:#198754 !important}.link-success:hover,.link-success:focus{color:#146c43 !important}.link-info{color:#0dcaf0 !important}.link-info:hover,.link-info:focus{color:#3dd5f3 !important}.link-warning{color:#ffc107 !important}.link-warning:hover,.link-warning:focus{color:#ffcd39 !important}.link-danger{color:#dc3545 !important}.link-danger:hover,.link-danger:focus{color:#b02a37 !important}.link-light{color:#f8f9fa !important}.link-light:hover,.link-light:focus{color:#f9fafb !important}.link-dark{color:#212529 !important}.link-dark:hover,.link-dark:focus{color:#1a1e21 !important}.ratio{position:relative;width:100%}.ratio::before{display:block;padding-top:var(--bs-aspect-ratio);content:""}.ratio>*{position:absolute;top:0;left:0;width:100%;height:100%}.ratio-1x1{--bs-aspect-ratio: 100%}.ratio-4x3{--bs-aspect-ratio: 75%}.ratio-16x9{--bs-aspect-ratio: 56.25%}.ratio-21x9{--bs-aspect-ratio: 42.8571428571%}.fixed-top{position:fixed;top:0;right:0;left:0;z-index:1030}.fixed-bottom{position:fixed;right:0;bottom:0;left:0;z-index:1030}.sticky-top{position:sticky;top:0;z-index:1020}.sticky-bottom{position:sticky;bottom:0;z-index:1020}@media(min-width: 576px){.sticky-sm-top{position:sticky;top:0;z-index:1020}.sticky-sm-bottom{position:sticky;bottom:0;z-index:1020}}@media(min-width: 768px){.sticky-md-top{position:sticky;top:0;z-index:1020}.sticky-md-bottom{position:sticky;bottom:0;z-index:1020}}@media(min-width: 992px){.sticky-lg-top{position:sticky;top:0;z-index:1020}.sticky-lg-bottom{position:sticky;bottom:0;z-index:1020}}@media(min-width: 1200px){.sticky-xl-top{position:sticky;top:0;z-index:1020}.sticky-xl-bottom{position:sticky;bottom:0;z-index:1020}}@media(min-width: 1400px){.sticky-xxl-top{position:sticky;top:0;z-index:1020}.sticky-xxl-bottom{position:sticky;bottom:0;z-index:1020}}.hstack{display:flex;flex-direction:row;align-items:center;align-self:stretch}.vstack{display:flex;flex:1 1 auto;flex-direction:column;align-self:stretch}.visually-hidden,.visually-hidden-focusable:not(:focus):not(:focus-within){position:absolute !important;width:1px !important;height:1px !important;padding:0 !important;margin:-1px !important;overflow:hidden !important;clip:rect(0, 0, 0, 0) !important;white-space:nowrap !important;border:0 !important}.stretched-link::after{position:absolute;top:0;right:0;bottom:0;left:0;z-index:1;content:""}.text-truncate{overflow:hidden;text-overflow:ellipsis;white-space:nowrap}.vr{display:inline-block;align-self:stretch;width:1px;min-height:1em;background-color:currentcolor;opacity:.25}.align-baseline{vertical-align:baseline !important}.align-top{vertical-align:top !important}.align-middle{vertical-align:middle !important}.align-bottom{vertical-align:bottom !important}.align-text-bottom{vertical-align:text-bottom !important}.align-text-top{vertical-align:text-top !important}.float-start{float:left !important}.float-end{float:right !important}.float-none{float:none !important}.opacity-0{opacity:0 !important}.opacity-25{opacity:.25 !important}.opacity-50{opacity:.5 !important}.opacity-75{opacity:.75 !important}.opacity-100{opacity:1 !important}.overflow-auto{overflow:auto !important}.overflow-hidden{overflow:hidden !important}.overflow-visible{overflow:visible !important}.overflow-scroll{overflow:scroll !important}.d-inline{display:inline !important}.d-inline-block{display:inline-block !important}.d-block{display:block !important}.d-grid{display:grid !important}.d-table{display:table !important}.d-table-row{display:table-row !important}.d-table-cell{display:table-cell !important}.d-flex{display:flex !important}.d-inline-flex{display:inline-flex !important}.d-none{display:none !important}.shadow{box-shadow:0 .5rem 1rem rgba(0,0,0,.15) !important}.shadow-sm{box-shadow:0 .125rem .25rem rgba(0,0,0,.075) !important}.shadow-lg{box-shadow:0 1rem 3rem rgba(0,0,0,.175) !important}.shadow-none{box-shadow:none !important}.position-static{position:static !important}.position-relative{position:relative !important}.position-absolute{position:absolute !important}.position-fixed{position:fixed !important}.position-sticky{position:sticky !important}.top-0{top:0 !important}.top-50{top:50% !important}.top-100{top:100% !important}.bottom-0{bottom:0 !important}.bottom-50{bottom:50% !important}.bottom-100{bottom:100% !important}.start-0{left:0 !important}.start-50{left:50% !important}.start-100{left:100% !important}.end-0{right:0 !important}.end-50{right:50% !important}.end-100{right:100% !important}.translate-middle{transform:translate(-50%, -50%) !important}.translate-middle-x{transform:translateX(-50%) !important}.translate-middle-y{transform:translateY(-50%) !important}.border{border:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color) !important}.border-0{border:0 !important}.border-top{border-top:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color) !important}.border-top-0{border-top:0 !important}.border-end{border-right:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color) !important}.border-end-0{border-right:0 !important}.border-bottom{border-bottom:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color) !important}.border-bottom-0{border-bottom:0 !important}.border-start{border-left:var(--bs-border-width) var(--bs-border-style) var(--bs-border-color) !important}.border-start-0{border-left:0 !important}.border-primary{--bs-border-opacity: 1;border-color:rgba(var(--bs-primary-rgb), var(--bs-border-opacity)) !important}.border-secondary{--bs-border-opacity: 1;border-color:rgba(var(--bs-secondary-rgb), var(--bs-border-opacity)) !important}.border-success{--bs-border-opacity: 1;border-color:rgba(var(--bs-success-rgb), var(--bs-border-opacity)) !important}.border-info{--bs-border-opacity: 1;border-color:rgba(var(--bs-info-rgb), var(--bs-border-opacity)) !important}.border-warning{--bs-border-opacity: 1;border-color:rgba(var(--bs-warning-rgb), var(--bs-border-opacity)) !important}.border-danger{--bs-border-opacity: 1;border-color:rgba(var(--bs-danger-rgb), var(--bs-border-opacity)) !important}.border-light{--bs-border-opacity: 1;border-color:rgba(var(--bs-light-rgb), var(--bs-border-opacity)) !important}.border-dark{--bs-border-opacity: 1;border-color:rgba(var(--bs-dark-rgb), var(--bs-border-opacity)) !important}.border-white{--bs-border-opacity: 1;border-color:rgba(var(--bs-white-rgb), var(--bs-border-opacity)) !important}.border-1{--bs-border-width: 1px}.border-2{--bs-border-width: 2px}.border-3{--bs-border-width: 3px}.border-4{--bs-border-width: 4px}.border-5{--bs-border-width: 5px}.border-opacity-10{--bs-border-opacity: 0.1}.border-opacity-25{--bs-border-opacity: 0.25}.border-opacity-50{--bs-border-opacity: 0.5}.border-opacity-75{--bs-border-opacity: 0.75}.border-opacity-100{--bs-border-opacity: 1}.w-25{width:25% !important}.w-50{width:50% !important}.w-75{width:75% !important}.w-100{width:100% !important}.w-auto{width:auto !important}.mw-100{max-width:100% !important}.vw-100{width:100vw !important}.min-vw-100{min-width:100vw !important}.h-25{height:25% !important}.h-50{height:50% !important}.h-75{height:75% !important}.h-100{height:100% !important}.h-auto{height:auto !important}.mh-100{max-height:100% !important}.vh-100{height:100vh !important}.min-vh-100{min-height:100vh !important}.flex-fill{flex:1 1 auto !important}.flex-row{flex-direction:row !important}.flex-column{flex-direction:column !important}.flex-row-reverse{flex-direction:row-reverse !important}.flex-column-reverse{flex-direction:column-reverse !important}.flex-grow-0{flex-grow:0 !important}.flex-grow-1{flex-grow:1 !important}.flex-shrink-0{flex-shrink:0 !important}.flex-shrink-1{flex-shrink:1 !important}.flex-wrap{flex-wrap:wrap !important}.flex-nowrap{flex-wrap:nowrap !important}.flex-wrap-reverse{flex-wrap:wrap-reverse !important}.justify-content-start{justify-content:flex-start !important}.justify-content-end{justify-content:flex-end !important}.justify-content-center{justify-content:center !important}.justify-content-between{justify-content:space-between !important}.justify-content-around{justify-content:space-around !important}.justify-content-evenly{justify-content:space-evenly !important}.align-items-start{align-items:flex-start !important}.align-items-end{align-items:flex-end !important}.align-items-center{align-items:center !important}.align-items-baseline{align-items:baseline !important}.align-items-stretch{align-items:stretch !important}.align-content-start{align-content:flex-start !important}.align-content-end{align-content:flex-end !important}.align-content-center{align-content:center !important}.align-content-between{align-content:space-between !important}.align-content-around{align-content:space-around !important}.align-content-stretch{align-content:stretch !important}.align-self-auto{align-self:auto !important}.align-self-start{align-self:flex-start !important}.align-self-end{align-self:flex-end !important}.align-self-center{align-self:center !important}.align-self-baseline{align-self:baseline !important}.align-self-stretch{align-self:stretch !important}.order-first{order:-1 !important}.order-0{order:0 !important}.order-1{order:1 !important}.order-2{order:2 !important}.order-3{order:3 !important}.order-4{order:4 !important}.order-5{order:5 !important}.order-last{order:6 !important}.m-0{margin:0 !important}.m-1{margin:.25rem !important}.m-2{margin:.5rem !important}.m-3{margin:1rem !important}.m-4{margin:1.5rem !important}.m-5{margin:3rem !important}.m-auto{margin:auto !important}.mx-0{margin-right:0 !important;margin-left:0 !important}.mx-1{margin-right:.25rem !important;margin-left:.25rem !important}.mx-2{margin-right:.5rem !important;margin-left:.5rem !important}.mx-3{margin-right:1rem !important;margin-left:1rem !important}.mx-4{margin-right:1.5rem !important;margin-left:1.5rem !important}.mx-5{margin-right:3rem !important;margin-left:3rem !important}.mx-auto{margin-right:auto !important;margin-left:auto !important}.my-0{margin-top:0 !important;margin-bottom:0 !important}.my-1{margin-top:.25rem !important;margin-bottom:.25rem !important}.my-2{margin-top:.5rem !important;margin-bottom:.5rem !important}.my-3{margin-top:1rem !important;margin-bottom:1rem !important}.my-4{margin-top:1.5rem !important;margin-bottom:1.5rem !important}.my-5{margin-top:3rem !important;margin-bottom:3rem !important}.my-auto{margin-top:auto !important;margin-bottom:auto !important}.mt-0{margin-top:0 !important}.mt-1{margin-top:.25rem !important}.mt-2{margin-top:.5rem !important}.mt-3{margin-top:1rem !important}.mt-4{margin-top:1.5rem !important}.mt-5{margin-top:3rem !important}.mt-auto{margin-top:auto !important}.me-0{margin-right:0 !important}.me-1{margin-right:.25rem !important}.me-2{margin-right:.5rem !important}.me-3{margin-right:1rem !important}.me-4{margin-right:1.5rem !important}.me-5{margin-right:3rem !important}.me-auto{margin-right:auto !important}.mb-0{margin-bottom:0 !important}.mb-1{margin-bottom:.25rem !important}.mb-2{margin-bottom:.5rem !important}.mb-3{margin-bottom:1rem !important}.mb-4{margin-bottom:1.5rem !important}.mb-5{margin-bottom:3rem !important}.mb-auto{margin-bottom:auto !important}.ms-0{margin-left:0 !important}.ms-1{margin-left:.25rem !important}.ms-2{margin-left:.5rem !important}.ms-3{margin-left:1rem !important}.ms-4{margin-left:1.5rem !important}.ms-5{margin-left:3rem !important}.ms-auto{margin-left:auto !important}.p-0{padding:0 !important}.p-1{padding:.25rem !important}.p-2{padding:.5rem !important}.p-3{padding:1rem !important}.p-4{padding:1.5rem !important}.p-5{padding:3rem !important}.px-0{padding-right:0 !important;padding-left:0 !important}.px-1{padding-right:.25rem !important;padding-left:.25rem !important}.px-2{padding-right:.5rem !important;padding-left:.5rem !important}.px-3{padding-right:1rem !important;padding-left:1rem !important}.px-4{padding-right:1.5rem !important;padding-left:1.5rem !important}.px-5{padding-right:3rem !important;padding-left:3rem !important}.py-0{padding-top:0 !important;padding-bottom:0 !important}.py-1{padding-top:.25rem !important;padding-bottom:.25rem !important}.py-2{padding-top:.5rem !important;padding-bottom:.5rem !important}.py-3{padding-top:1rem !important;padding-bottom:1rem !important}.py-4{padding-top:1.5rem !important;padding-bottom:1.5rem !important}.py-5{padding-top:3rem !important;padding-bottom:3rem !important}.pt-0{padding-top:0 !important}.pt-1{padding-top:.25rem !important}.pt-2{padding-top:.5rem !important}.pt-3{padding-top:1rem !important}.pt-4{padding-top:1.5rem !important}.pt-5{padding-top:3rem !important}.pe-0{padding-right:0 !important}.pe-1{padding-right:.25rem !important}.pe-2{padding-right:.5rem !important}.pe-3{padding-right:1rem !important}.pe-4{padding-right:1.5rem !important}.pe-5{padding-right:3rem !important}.pb-0{padding-bottom:0 !important}.pb-1{padding-bottom:.25rem !important}.pb-2{padding-bottom:.5rem !important}.pb-3{padding-bottom:1rem !important}.pb-4{padding-bottom:1.5rem !important}.pb-5{padding-bottom:3rem !important}.ps-0{padding-left:0 !important}.ps-1{padding-left:.25rem !important}.ps-2{padding-left:.5rem !important}.ps-3{padding-left:1rem !important}.ps-4{padding-left:1.5rem !important}.ps-5{padding-left:3rem !important}.gap-0{gap:0 !important}.gap-1{gap:.25rem !important}.gap-2{gap:.5rem !important}.gap-3{gap:1rem !important}.gap-4{gap:1.5rem !important}.gap-5{gap:3rem !important}.font-monospace{font-family:var(--bs-font-monospace) !important}.fs-1{font-size:calc(1.375rem + 1.5vw) !important}.fs-2{font-size:calc(1.325rem + 0.9vw) !important}.fs-3{font-size:calc(1.3rem + 0.6vw) !important}.fs-4{font-size:calc(1.275rem + 0.3vw) !important}.fs-5{font-size:1.25rem !important}.fs-6{font-size:1rem !important}.fst-italic{font-style:italic !important}.fst-normal{font-style:normal !important}.fw-light{font-weight:300 !important}.fw-lighter{font-weight:lighter !important}.fw-normal{font-weight:400 !important}.fw-bold{font-weight:700 !important}.fw-semibold{font-weight:600 !important}.fw-bolder{font-weight:bolder !important}.lh-1{line-height:1 !important}.lh-sm{line-height:1.25 !important}.lh-base{line-height:1.5 !important}.lh-lg{line-height:2 !important}.text-start{text-align:left !important}.text-end{text-align:right !important}.text-center{text-align:center !important}.text-decoration-none{text-decoration:none !important}.text-decoration-underline{text-decoration:underline !important}.text-decoration-line-through{text-decoration:line-through !important}.text-lowercase{text-transform:lowercase !important}.text-uppercase{text-transform:uppercase !important}.text-capitalize{text-transform:capitalize !important}.text-wrap{white-space:normal !important}.text-nowrap{white-space:nowrap !important}.text-break{word-wrap:break-word !important;word-break:break-word !important}.text-primary{--bs-text-opacity: 1;color:rgba(var(--bs-primary-rgb), var(--bs-text-opacity)) !important}.text-secondary{--bs-text-opacity: 1;color:rgba(var(--bs-secondary-rgb), var(--bs-text-opacity)) !important}.text-success{--bs-text-opacity: 1;color:rgba(var(--bs-success-rgb), var(--bs-text-opacity)) !important}.text-info{--bs-text-opacity: 1;color:rgba(var(--bs-info-rgb), var(--bs-text-opacity)) !important}.text-warning{--bs-text-opacity: 1;color:rgba(var(--bs-warning-rgb), var(--bs-text-opacity)) !important}.text-danger{--bs-text-opacity: 1;color:rgba(var(--bs-danger-rgb), var(--bs-text-opacity)) !important}.text-light{--bs-text-opacity: 1;color:rgba(var(--bs-light-rgb), var(--bs-text-opacity)) !important}.text-dark{--bs-text-opacity: 1;color:rgba(var(--bs-dark-rgb), var(--bs-text-opacity)) !important}.text-black{--bs-text-opacity: 1;color:rgba(var(--bs-black-rgb), var(--bs-text-opacity)) !important}.text-white{--bs-text-opacity: 1;color:rgba(var(--bs-white-rgb), var(--bs-text-opacity)) !important}.text-body{--bs-text-opacity: 1;color:rgba(var(--bs-body-color-rgb), var(--bs-text-opacity)) !important}.text-muted{--bs-text-opacity: 1;color:#6c757d !important}.text-black-50{--bs-text-opacity: 1;color:rgba(0,0,0,.5) !important}.text-white-50{--bs-text-opacity: 1;color:rgba(255,255,255,.5) !important}.text-reset{--bs-text-opacity: 1;color:inherit !important}.text-opacity-25{--bs-text-opacity: 0.25}.text-opacity-50{--bs-text-opacity: 0.5}.text-opacity-75{--bs-text-opacity: 0.75}.text-opacity-100{--bs-text-opacity: 1}.bg-primary{--bs-bg-opacity: 1;background-color:rgba(var(--bs-primary-rgb), var(--bs-bg-opacity)) !important}.bg-secondary{--bs-bg-opacity: 1;background-color:rgba(var(--bs-secondary-rgb), var(--bs-bg-opacity)) !important}.bg-success{--bs-bg-opacity: 1;background-color:rgba(var(--bs-success-rgb), var(--bs-bg-opacity)) !important}.bg-info{--bs-bg-opacity: 1;background-color:rgba(var(--bs-info-rgb), var(--bs-bg-opacity)) !important}.bg-warning{--bs-bg-opacity: 1;background-color:rgba(var(--bs-warning-rgb), var(--bs-bg-opacity)) !important}.bg-danger{--bs-bg-opacity: 1;background-color:rgba(var(--bs-danger-rgb), var(--bs-bg-opacity)) !important}.bg-light{--bs-bg-opacity: 1;background-color:rgba(var(--bs-light-rgb), var(--bs-bg-opacity)) !important}.bg-dark{--bs-bg-opacity: 1;background-color:rgba(var(--bs-dark-rgb), var(--bs-bg-opacity)) !important}.bg-black{--bs-bg-opacity: 1;background-color:rgba(var(--bs-black-rgb), var(--bs-bg-opacity)) !important}.bg-white{--bs-bg-opacity: 1;background-color:rgba(var(--bs-white-rgb), var(--bs-bg-opacity)) !important}.bg-body{--bs-bg-opacity: 1;background-color:rgba(var(--bs-body-bg-rgb), var(--bs-bg-opacity)) !important}.bg-transparent{--bs-bg-opacity: 1;background-color:rgba(0,0,0,0) !important}.bg-opacity-10{--bs-bg-opacity: 0.1}.bg-opacity-25{--bs-bg-opacity: 0.25}.bg-opacity-50{--bs-bg-opacity: 0.5}.bg-opacity-75{--bs-bg-opacity: 0.75}.bg-opacity-100{--bs-bg-opacity: 1}.bg-gradient{background-image:var(--bs-gradient) !important}.user-select-all{user-select:all !important}.user-select-auto{user-select:auto !important}.user-select-none{user-select:none !important}.pe-none{pointer-events:none !important}.pe-auto{pointer-events:auto !important}.rounded{border-radius:var(--bs-border-radius) !important}.rounded-0{border-radius:0 !important}.rounded-1{border-radius:var(--bs-border-radius-sm) !important}.rounded-2{border-radius:var(--bs-border-radius) !important}.rounded-3{border-radius:var(--bs-border-radius-lg) !important}.rounded-4{border-radius:var(--bs-border-radius-xl) !important}.rounded-5{border-radius:var(--bs-border-radius-2xl) !important}.rounded-circle{border-radius:50% !important}.rounded-pill{border-radius:var(--bs-border-radius-pill) !important}.rounded-top{border-top-left-radius:var(--bs-border-radius) !important;border-top-right-radius:var(--bs-border-radius) !important}.rounded-end{border-top-right-radius:var(--bs-border-radius) !important;border-bottom-right-radius:var(--bs-border-radius) !important}.rounded-bottom{border-bottom-right-radius:var(--bs-border-radius) !important;border-bottom-left-radius:var(--bs-border-radius) !important}.rounded-start{border-bottom-left-radius:var(--bs-border-radius) !important;border-top-left-radius:var(--bs-border-radius) !important}.visible{visibility:visible !important}.invisible{visibility:hidden !important}@media(min-width: 576px){.float-sm-start{float:left !important}.float-sm-end{float:right !important}.float-sm-none{float:none !important}.d-sm-inline{display:inline !important}.d-sm-inline-block{display:inline-block !important}.d-sm-block{display:block !important}.d-sm-grid{display:grid !important}.d-sm-table{display:table !important}.d-sm-table-row{display:table-row !important}.d-sm-table-cell{display:table-cell !important}.d-sm-flex{display:flex !important}.d-sm-inline-flex{display:inline-flex !important}.d-sm-none{display:none !important}.flex-sm-fill{flex:1 1 auto !important}.flex-sm-row{flex-direction:row !important}.flex-sm-column{flex-direction:column !important}.flex-sm-row-reverse{flex-direction:row-reverse !important}.flex-sm-column-reverse{flex-direction:column-reverse !important}.flex-sm-grow-0{flex-grow:0 !important}.flex-sm-grow-1{flex-grow:1 !important}.flex-sm-shrink-0{flex-shrink:0 !important}.flex-sm-shrink-1{flex-shrink:1 !important}.flex-sm-wrap{flex-wrap:wrap !important}.flex-sm-nowrap{flex-wrap:nowrap !important}.flex-sm-wrap-reverse{flex-wrap:wrap-reverse !important}.justify-content-sm-start{justify-content:flex-start !important}.justify-content-sm-end{justify-content:flex-end !important}.justify-content-sm-center{justify-content:center !important}.justify-content-sm-between{justify-content:space-between !important}.justify-content-sm-around{justify-content:space-around !important}.justify-content-sm-evenly{justify-content:space-evenly !important}.align-items-sm-start{align-items:flex-start !important}.align-items-sm-end{align-items:flex-end !important}.align-items-sm-center{align-items:center !important}.align-items-sm-baseline{align-items:baseline !important}.align-items-sm-stretch{align-items:stretch !important}.align-content-sm-start{align-content:flex-start !important}.align-content-sm-end{align-content:flex-end !important}.align-content-sm-center{align-content:center !important}.align-content-sm-between{align-content:space-between !important}.align-content-sm-around{align-content:space-around !important}.align-content-sm-stretch{align-content:stretch !important}.align-self-sm-auto{align-self:auto !important}.align-self-sm-start{align-self:flex-start !important}.align-self-sm-end{align-self:flex-end !important}.align-self-sm-center{align-self:center !important}.align-self-sm-baseline{align-self:baseline !important}.align-self-sm-stretch{align-self:stretch !important}.order-sm-first{order:-1 !important}.order-sm-0{order:0 !important}.order-sm-1{order:1 !important}.order-sm-2{order:2 !important}.order-sm-3{order:3 !important}.order-sm-4{order:4 !important}.order-sm-5{order:5 !important}.order-sm-last{order:6 !important}.m-sm-0{margin:0 !important}.m-sm-1{margin:.25rem !important}.m-sm-2{margin:.5rem !important}.m-sm-3{margin:1rem !important}.m-sm-4{margin:1.5rem !important}.m-sm-5{margin:3rem !important}.m-sm-auto{margin:auto !important}.mx-sm-0{margin-right:0 !important;margin-left:0 !important}.mx-sm-1{margin-right:.25rem !important;margin-left:.25rem !important}.mx-sm-2{margin-right:.5rem !important;margin-left:.5rem !important}.mx-sm-3{margin-right:1rem !important;margin-left:1rem !important}.mx-sm-4{margin-right:1.5rem !important;margin-left:1.5rem !important}.mx-sm-5{margin-right:3rem !important;margin-left:3rem !important}.mx-sm-auto{margin-right:auto !important;margin-left:auto !important}.my-sm-0{margin-top:0 !important;margin-bottom:0 !important}.my-sm-1{margin-top:.25rem !important;margin-bottom:.25rem !important}.my-sm-2{margin-top:.5rem !important;margin-bottom:.5rem !important}.my-sm-3{margin-top:1rem !important;margin-bottom:1rem !important}.my-sm-4{margin-top:1.5rem !important;margin-bottom:1.5rem !important}.my-sm-5{margin-top:3rem !important;margin-bottom:3rem !important}.my-sm-auto{margin-top:auto !important;margin-bottom:auto !important}.mt-sm-0{margin-top:0 !important}.mt-sm-1{margin-top:.25rem !important}.mt-sm-2{margin-top:.5rem !important}.mt-sm-3{margin-top:1rem !important}.mt-sm-4{margin-top:1.5rem !important}.mt-sm-5{margin-top:3rem !important}.mt-sm-auto{margin-top:auto !important}.me-sm-0{margin-right:0 !important}.me-sm-1{margin-right:.25rem !important}.me-sm-2{margin-right:.5rem !important}.me-sm-3{margin-right:1rem !important}.me-sm-4{margin-right:1.5rem !important}.me-sm-5{margin-right:3rem !important}.me-sm-auto{margin-right:auto !important}.mb-sm-0{margin-bottom:0 !important}.mb-sm-1{margin-bottom:.25rem !important}.mb-sm-2{margin-bottom:.5rem !important}.mb-sm-3{margin-bottom:1rem !important}.mb-sm-4{margin-bottom:1.5rem !important}.mb-sm-5{margin-bottom:3rem !important}.mb-sm-auto{margin-bottom:auto !important}.ms-sm-0{margin-left:0 !important}.ms-sm-1{margin-left:.25rem !important}.ms-sm-2{margin-left:.5rem !important}.ms-sm-3{margin-left:1rem !important}.ms-sm-4{margin-left:1.5rem !important}.ms-sm-5{margin-left:3rem !important}.ms-sm-auto{margin-left:auto !important}.p-sm-0{padding:0 !important}.p-sm-1{padding:.25rem !important}.p-sm-2{padding:.5rem !important}.p-sm-3{padding:1rem !important}.p-sm-4{padding:1.5rem !important}.p-sm-5{padding:3rem !important}.px-sm-0{padding-right:0 !important;padding-left:0 !important}.px-sm-1{padding-right:.25rem !important;padding-left:.25rem !important}.px-sm-2{padding-right:.5rem !important;padding-left:.5rem !important}.px-sm-3{padding-right:1rem !important;padding-left:1rem !important}.px-sm-4{padding-right:1.5rem !important;padding-left:1.5rem !important}.px-sm-5{padding-right:3rem !important;padding-left:3rem !important}.py-sm-0{padding-top:0 !important;padding-bottom:0 !important}.py-sm-1{padding-top:.25rem !important;padding-bottom:.25rem !important}.py-sm-2{padding-top:.5rem !important;padding-bottom:.5rem !important}.py-sm-3{padding-top:1rem !important;padding-bottom:1rem !important}.py-sm-4{padding-top:1.5rem !important;padding-bottom:1.5rem !important}.py-sm-5{padding-top:3rem !important;padding-bottom:3rem !important}.pt-sm-0{padding-top:0 !important}.pt-sm-1{padding-top:.25rem !important}.pt-sm-2{padding-top:.5rem !important}.pt-sm-3{padding-top:1rem !important}.pt-sm-4{padding-top:1.5rem !important}.pt-sm-5{padding-top:3rem !important}.pe-sm-0{padding-right:0 !important}.pe-sm-1{padding-right:.25rem !important}.pe-sm-2{padding-right:.5rem !important}.pe-sm-3{padding-right:1rem !important}.pe-sm-4{padding-right:1.5rem !important}.pe-sm-5{padding-right:3rem !important}.pb-sm-0{padding-bottom:0 !important}.pb-sm-1{padding-bottom:.25rem !important}.pb-sm-2{padding-bottom:.5rem !important}.pb-sm-3{padding-bottom:1rem !important}.pb-sm-4{padding-bottom:1.5rem !important}.pb-sm-5{padding-bottom:3rem !important}.ps-sm-0{padding-left:0 !important}.ps-sm-1{padding-left:.25rem !important}.ps-sm-2{padding-left:.5rem !important}.ps-sm-3{padding-left:1rem !important}.ps-sm-4{padding-left:1.5rem !important}.ps-sm-5{padding-left:3rem !important}.gap-sm-0{gap:0 !important}.gap-sm-1{gap:.25rem !important}.gap-sm-2{gap:.5rem !important}.gap-sm-3{gap:1rem !important}.gap-sm-4{gap:1.5rem !important}.gap-sm-5{gap:3rem !important}.text-sm-start{text-align:left !important}.text-sm-end{text-align:right !important}.text-sm-center{text-align:center !important}}@media(min-width: 768px){.float-md-start{float:left !important}.float-md-end{float:right !important}.float-md-none{float:none !important}.d-md-inline{display:inline !important}.d-md-inline-block{display:inline-block !important}.d-md-block{display:block !important}.d-md-grid{display:grid !important}.d-md-table{display:table !important}.d-md-table-row{display:table-row !important}.d-md-table-cell{display:table-cell !important}.d-md-flex{display:flex !important}.d-md-inline-flex{display:inline-flex !important}.d-md-none{display:none !important}.flex-md-fill{flex:1 1 auto !important}.flex-md-row{flex-direction:row !important}.flex-md-column{flex-direction:column !important}.flex-md-row-reverse{flex-direction:row-reverse !important}.flex-md-column-reverse{flex-direction:column-reverse !important}.flex-md-grow-0{flex-grow:0 !important}.flex-md-grow-1{flex-grow:1 !important}.flex-md-shrink-0{flex-shrink:0 !important}.flex-md-shrink-1{flex-shrink:1 !important}.flex-md-wrap{flex-wrap:wrap !important}.flex-md-nowrap{flex-wrap:nowrap !important}.flex-md-wrap-reverse{flex-wrap:wrap-reverse !important}.justify-content-md-start{justify-content:flex-start !important}.justify-content-md-end{justify-content:flex-end !important}.justify-content-md-center{justify-content:center !important}.justify-content-md-between{justify-content:space-between !important}.justify-content-md-around{justify-content:space-around !important}.justify-content-md-evenly{justify-content:space-evenly !important}.align-items-md-start{align-items:flex-start !important}.align-items-md-end{align-items:flex-end !important}.align-items-md-center{align-items:center !important}.align-items-md-baseline{align-items:baseline !important}.align-items-md-stretch{align-items:stretch !important}.align-content-md-start{align-content:flex-start !important}.align-content-md-end{align-content:flex-end !important}.align-content-md-center{align-content:center !important}.align-content-md-between{align-content:space-between !important}.align-content-md-around{align-content:space-around !important}.align-content-md-stretch{align-content:stretch !important}.align-self-md-auto{align-self:auto !important}.align-self-md-start{align-self:flex-start !important}.align-self-md-end{align-self:flex-end !important}.align-self-md-center{align-self:center !important}.align-self-md-baseline{align-self:baseline !important}.align-self-md-stretch{align-self:stretch !important}.order-md-first{order:-1 !important}.order-md-0{order:0 !important}.order-md-1{order:1 !important}.order-md-2{order:2 !important}.order-md-3{order:3 !important}.order-md-4{order:4 !important}.order-md-5{order:5 !important}.order-md-last{order:6 !important}.m-md-0{margin:0 !important}.m-md-1{margin:.25rem !important}.m-md-2{margin:.5rem !important}.m-md-3{margin:1rem !important}.m-md-4{margin:1.5rem !important}.m-md-5{margin:3rem !important}.m-md-auto{margin:auto !important}.mx-md-0{margin-right:0 !important;margin-left:0 !important}.mx-md-1{margin-right:.25rem !important;margin-left:.25rem !important}.mx-md-2{margin-right:.5rem !important;margin-left:.5rem !important}.mx-md-3{margin-right:1rem !important;margin-left:1rem !important}.mx-md-4{margin-right:1.5rem !important;margin-left:1.5rem !important}.mx-md-5{margin-right:3rem !important;margin-left:3rem !important}.mx-md-auto{margin-right:auto !important;margin-left:auto !important}.my-md-0{margin-top:0 !important;margin-bottom:0 !important}.my-md-1{margin-top:.25rem !important;margin-bottom:.25rem !important}.my-md-2{margin-top:.5rem !important;margin-bottom:.5rem !important}.my-md-3{margin-top:1rem !important;margin-bottom:1rem !important}.my-md-4{margin-top:1.5rem !important;margin-bottom:1.5rem !important}.my-md-5{margin-top:3rem !important;margin-bottom:3rem !important}.my-md-auto{margin-top:auto !important;margin-bottom:auto !important}.mt-md-0{margin-top:0 !important}.mt-md-1{margin-top:.25rem !important}.mt-md-2{margin-top:.5rem !important}.mt-md-3{margin-top:1rem !important}.mt-md-4{margin-top:1.5rem !important}.mt-md-5{margin-top:3rem !important}.mt-md-auto{margin-top:auto !important}.me-md-0{margin-right:0 !important}.me-md-1{margin-right:.25rem !important}.me-md-2{margin-right:.5rem !important}.me-md-3{margin-right:1rem !important}.me-md-4{margin-right:1.5rem !important}.me-md-5{margin-right:3rem !important}.me-md-auto{margin-right:auto !important}.mb-md-0{margin-bottom:0 !important}.mb-md-1{margin-bottom:.25rem !important}.mb-md-2{margin-bottom:.5rem !important}.mb-md-3{margin-bottom:1rem !important}.mb-md-4{margin-bottom:1.5rem !important}.mb-md-5{margin-bottom:3rem !important}.mb-md-auto{margin-bottom:auto !important}.ms-md-0{margin-left:0 !important}.ms-md-1{margin-left:.25rem !important}.ms-md-2{margin-left:.5rem !important}.ms-md-3{margin-left:1rem !important}.ms-md-4{margin-left:1.5rem !important}.ms-md-5{margin-left:3rem !important}.ms-md-auto{margin-left:auto !important}.p-md-0{padding:0 !important}.p-md-1{padding:.25rem !important}.p-md-2{padding:.5rem !important}.p-md-3{padding:1rem !important}.p-md-4{padding:1.5rem !important}.p-md-5{padding:3rem !important}.px-md-0{padding-right:0 !important;padding-left:0 !important}.px-md-1{padding-right:.25rem !important;padding-left:.25rem !important}.px-md-2{padding-right:.5rem !important;padding-left:.5rem !important}.px-md-3{padding-right:1rem !important;padding-left:1rem !important}.px-md-4{padding-right:1.5rem !important;padding-left:1.5rem !important}.px-md-5{padding-right:3rem !important;padding-left:3rem !important}.py-md-0{padding-top:0 !important;padding-bottom:0 !important}.py-md-1{padding-top:.25rem !important;padding-bottom:.25rem !important}.py-md-2{padding-top:.5rem !important;padding-bottom:.5rem !important}.py-md-3{padding-top:1rem !important;padding-bottom:1rem !important}.py-md-4{padding-top:1.5rem !important;padding-bottom:1.5rem !important}.py-md-5{padding-top:3rem !important;padding-bottom:3rem !important}.pt-md-0{padding-top:0 !important}.pt-md-1{padding-top:.25rem !important}.pt-md-2{padding-top:.5rem !important}.pt-md-3{padding-top:1rem !important}.pt-md-4{padding-top:1.5rem !important}.pt-md-5{padding-top:3rem !important}.pe-md-0{padding-right:0 !important}.pe-md-1{padding-right:.25rem !important}.pe-md-2{padding-right:.5rem !important}.pe-md-3{padding-right:1rem !important}.pe-md-4{padding-right:1.5rem !important}.pe-md-5{padding-right:3rem !important}.pb-md-0{padding-bottom:0 !important}.pb-md-1{padding-bottom:.25rem !important}.pb-md-2{padding-bottom:.5rem !important}.pb-md-3{padding-bottom:1rem !important}.pb-md-4{padding-bottom:1.5rem !important}.pb-md-5{padding-bottom:3rem !important}.ps-md-0{padding-left:0 !important}.ps-md-1{padding-left:.25rem !important}.ps-md-2{padding-left:.5rem !important}.ps-md-3{padding-left:1rem !important}.ps-md-4{padding-left:1.5rem !important}.ps-md-5{padding-left:3rem !important}.gap-md-0{gap:0 !important}.gap-md-1{gap:.25rem !important}.gap-md-2{gap:.5rem !important}.gap-md-3{gap:1rem !important}.gap-md-4{gap:1.5rem !important}.gap-md-5{gap:3rem !important}.text-md-start{text-align:left !important}.text-md-end{text-align:right !important}.text-md-center{text-align:center !important}}@media(min-width: 992px){.float-lg-start{float:left !important}.float-lg-end{float:right !important}.float-lg-none{float:none !important}.d-lg-inline{display:inline !important}.d-lg-inline-block{display:inline-block !important}.d-lg-block{display:block !important}.d-lg-grid{display:grid !important}.d-lg-table{display:table !important}.d-lg-table-row{display:table-row !important}.d-lg-table-cell{display:table-cell !important}.d-lg-flex{display:flex !important}.d-lg-inline-flex{display:inline-flex !important}.d-lg-none{display:none !important}.flex-lg-fill{flex:1 1 auto !important}.flex-lg-row{flex-direction:row !important}.flex-lg-column{flex-direction:column !important}.flex-lg-row-reverse{flex-direction:row-reverse !important}.flex-lg-column-reverse{flex-direction:column-reverse !important}.flex-lg-grow-0{flex-grow:0 !important}.flex-lg-grow-1{flex-grow:1 !important}.flex-lg-shrink-0{flex-shrink:0 !important}.flex-lg-shrink-1{flex-shrink:1 !important}.flex-lg-wrap{flex-wrap:wrap !important}.flex-lg-nowrap{flex-wrap:nowrap !important}.flex-lg-wrap-reverse{flex-wrap:wrap-reverse !important}.justify-content-lg-start{justify-content:flex-start !important}.justify-content-lg-end{justify-content:flex-end !important}.justify-content-lg-center{justify-content:center !important}.justify-content-lg-between{justify-content:space-between !important}.justify-content-lg-around{justify-content:space-around !important}.justify-content-lg-evenly{justify-content:space-evenly !important}.align-items-lg-start{align-items:flex-start !important}.align-items-lg-end{align-items:flex-end !important}.align-items-lg-center{align-items:center !important}.align-items-lg-baseline{align-items:baseline !important}.align-items-lg-stretch{align-items:stretch !important}.align-content-lg-start{align-content:flex-start !important}.align-content-lg-end{align-content:flex-end !important}.align-content-lg-center{align-content:center !important}.align-content-lg-between{align-content:space-between !important}.align-content-lg-around{align-content:space-around !important}.align-content-lg-stretch{align-content:stretch !important}.align-self-lg-auto{align-self:auto !important}.align-self-lg-start{align-self:flex-start !important}.align-self-lg-end{align-self:flex-end !important}.align-self-lg-center{align-self:center !important}.align-self-lg-baseline{align-self:baseline !important}.align-self-lg-stretch{align-self:stretch !important}.order-lg-first{order:-1 !important}.order-lg-0{order:0 !important}.order-lg-1{order:1 !important}.order-lg-2{order:2 !important}.order-lg-3{order:3 !important}.order-lg-4{order:4 !important}.order-lg-5{order:5 !important}.order-lg-last{order:6 !important}.m-lg-0{margin:0 !important}.m-lg-1{margin:.25rem !important}.m-lg-2{margin:.5rem !important}.m-lg-3{margin:1rem !important}.m-lg-4{margin:1.5rem !important}.m-lg-5{margin:3rem !important}.m-lg-auto{margin:auto !important}.mx-lg-0{margin-right:0 !important;margin-left:0 !important}.mx-lg-1{margin-right:.25rem !important;margin-left:.25rem !important}.mx-lg-2{margin-right:.5rem !important;margin-left:.5rem !important}.mx-lg-3{margin-right:1rem !important;margin-left:1rem !important}.mx-lg-4{margin-right:1.5rem !important;margin-left:1.5rem !important}.mx-lg-5{margin-right:3rem !important;margin-left:3rem !important}.mx-lg-auto{margin-right:auto !important;margin-left:auto !important}.my-lg-0{margin-top:0 !important;margin-bottom:0 !important}.my-lg-1{margin-top:.25rem !important;margin-bottom:.25rem !important}.my-lg-2{margin-top:.5rem !important;margin-bottom:.5rem !important}.my-lg-3{margin-top:1rem !important;margin-bottom:1rem !important}.my-lg-4{margin-top:1.5rem !important;margin-bottom:1.5rem !important}.my-lg-5{margin-top:3rem !important;margin-bottom:3rem !important}.my-lg-auto{margin-top:auto !important;margin-bottom:auto !important}.mt-lg-0{margin-top:0 !important}.mt-lg-1{margin-top:.25rem !important}.mt-lg-2{margin-top:.5rem !important}.mt-lg-3{margin-top:1rem !important}.mt-lg-4{margin-top:1.5rem !important}.mt-lg-5{margin-top:3rem !important}.mt-lg-auto{margin-top:auto !important}.me-lg-0{margin-right:0 !important}.me-lg-1{margin-right:.25rem !important}.me-lg-2{margin-right:.5rem !important}.me-lg-3{margin-right:1rem !important}.me-lg-4{margin-right:1.5rem !important}.me-lg-5{margin-right:3rem !important}.me-lg-auto{margin-right:auto !important}.mb-lg-0{margin-bottom:0 !important}.mb-lg-1{margin-bottom:.25rem !important}.mb-lg-2{margin-bottom:.5rem !important}.mb-lg-3{margin-bottom:1rem !important}.mb-lg-4{margin-bottom:1.5rem !important}.mb-lg-5{margin-bottom:3rem !important}.mb-lg-auto{margin-bottom:auto !important}.ms-lg-0{margin-left:0 !important}.ms-lg-1{margin-left:.25rem !important}.ms-lg-2{margin-left:.5rem !important}.ms-lg-3{margin-left:1rem !important}.ms-lg-4{margin-left:1.5rem !important}.ms-lg-5{margin-left:3rem !important}.ms-lg-auto{margin-left:auto !important}.p-lg-0{padding:0 !important}.p-lg-1{padding:.25rem !important}.p-lg-2{padding:.5rem !important}.p-lg-3{padding:1rem !important}.p-lg-4{padding:1.5rem !important}.p-lg-5{padding:3rem !important}.px-lg-0{padding-right:0 !important;padding-left:0 !important}.px-lg-1{padding-right:.25rem !important;padding-left:.25rem !important}.px-lg-2{padding-right:.5rem !important;padding-left:.5rem !important}.px-lg-3{padding-right:1rem !important;padding-left:1rem !important}.px-lg-4{padding-right:1.5rem !important;padding-left:1.5rem !important}.px-lg-5{padding-right:3rem !important;padding-left:3rem !important}.py-lg-0{padding-top:0 !important;padding-bottom:0 !important}.py-lg-1{padding-top:.25rem !important;padding-bottom:.25rem !important}.py-lg-2{padding-top:.5rem !important;padding-bottom:.5rem !important}.py-lg-3{padding-top:1rem !important;padding-bottom:1rem !important}.py-lg-4{padding-top:1.5rem !important;padding-bottom:1.5rem !important}.py-lg-5{padding-top:3rem !important;padding-bottom:3rem !important}.pt-lg-0{padding-top:0 !important}.pt-lg-1{padding-top:.25rem !important}.pt-lg-2{padding-top:.5rem !important}.pt-lg-3{padding-top:1rem !important}.pt-lg-4{padding-top:1.5rem !important}.pt-lg-5{padding-top:3rem !important}.pe-lg-0{padding-right:0 !important}.pe-lg-1{padding-right:.25rem !important}.pe-lg-2{padding-right:.5rem !important}.pe-lg-3{padding-right:1rem !important}.pe-lg-4{padding-right:1.5rem !important}.pe-lg-5{padding-right:3rem !important}.pb-lg-0{padding-bottom:0 !important}.pb-lg-1{padding-bottom:.25rem !important}.pb-lg-2{padding-bottom:.5rem !important}.pb-lg-3{padding-bottom:1rem !important}.pb-lg-4{padding-bottom:1.5rem !important}.pb-lg-5{padding-bottom:3rem !important}.ps-lg-0{padding-left:0 !important}.ps-lg-1{padding-left:.25rem !important}.ps-lg-2{padding-left:.5rem !important}.ps-lg-3{padding-left:1rem !important}.ps-lg-4{padding-left:1.5rem !important}.ps-lg-5{padding-left:3rem !important}.gap-lg-0{gap:0 !important}.gap-lg-1{gap:.25rem !important}.gap-lg-2{gap:.5rem !important}.gap-lg-3{gap:1rem !important}.gap-lg-4{gap:1.5rem !important}.gap-lg-5{gap:3rem !important}.text-lg-start{text-align:left !important}.text-lg-end{text-align:right !important}.text-lg-center{text-align:center !important}}@media(min-width: 1200px){.float-xl-start{float:left !important}.float-xl-end{float:right !important}.float-xl-none{float:none !important}.d-xl-inline{display:inline !important}.d-xl-inline-block{display:inline-block !important}.d-xl-block{display:block !important}.d-xl-grid{display:grid !important}.d-xl-table{display:table !important}.d-xl-table-row{display:table-row !important}.d-xl-table-cell{display:table-cell !important}.d-xl-flex{display:flex !important}.d-xl-inline-flex{display:inline-flex !important}.d-xl-none{display:none !important}.flex-xl-fill{flex:1 1 auto !important}.flex-xl-row{flex-direction:row !important}.flex-xl-column{flex-direction:column !important}.flex-xl-row-reverse{flex-direction:row-reverse !important}.flex-xl-column-reverse{flex-direction:column-reverse !important}.flex-xl-grow-0{flex-grow:0 !important}.flex-xl-grow-1{flex-grow:1 !important}.flex-xl-shrink-0{flex-shrink:0 !important}.flex-xl-shrink-1{flex-shrink:1 !important}.flex-xl-wrap{flex-wrap:wrap !important}.flex-xl-nowrap{flex-wrap:nowrap !important}.flex-xl-wrap-reverse{flex-wrap:wrap-reverse !important}.justify-content-xl-start{justify-content:flex-start !important}.justify-content-xl-end{justify-content:flex-end !important}.justify-content-xl-center{justify-content:center !important}.justify-content-xl-between{justify-content:space-between !important}.justify-content-xl-around{justify-content:space-around !important}.justify-content-xl-evenly{justify-content:space-evenly !important}.align-items-xl-start{align-items:flex-start !important}.align-items-xl-end{align-items:flex-end !important}.align-items-xl-center{align-items:center !important}.align-items-xl-baseline{align-items:baseline !important}.align-items-xl-stretch{align-items:stretch !important}.align-content-xl-start{align-content:flex-start !important}.align-content-xl-end{align-content:flex-end !important}.align-content-xl-center{align-content:center !important}.align-content-xl-between{align-content:space-between !important}.align-content-xl-around{align-content:space-around !important}.align-content-xl-stretch{align-content:stretch !important}.align-self-xl-auto{align-self:auto !important}.align-self-xl-start{align-self:flex-start !important}.align-self-xl-end{align-self:flex-end !important}.align-self-xl-center{align-self:center !important}.align-self-xl-baseline{align-self:baseline !important}.align-self-xl-stretch{align-self:stretch !important}.order-xl-first{order:-1 !important}.order-xl-0{order:0 !important}.order-xl-1{order:1 !important}.order-xl-2{order:2 !important}.order-xl-3{order:3 !important}.order-xl-4{order:4 !important}.order-xl-5{order:5 !important}.order-xl-last{order:6 !important}.m-xl-0{margin:0 !important}.m-xl-1{margin:.25rem !important}.m-xl-2{margin:.5rem !important}.m-xl-3{margin:1rem !important}.m-xl-4{margin:1.5rem !important}.m-xl-5{margin:3rem !important}.m-xl-auto{margin:auto !important}.mx-xl-0{margin-right:0 !important;margin-left:0 !important}.mx-xl-1{margin-right:.25rem !important;margin-left:.25rem !important}.mx-xl-2{margin-right:.5rem !important;margin-left:.5rem !important}.mx-xl-3{margin-right:1rem !important;margin-left:1rem !important}.mx-xl-4{margin-right:1.5rem !important;margin-left:1.5rem !important}.mx-xl-5{margin-right:3rem !important;margin-left:3rem !important}.mx-xl-auto{margin-right:auto !important;margin-left:auto !important}.my-xl-0{margin-top:0 !important;margin-bottom:0 !important}.my-xl-1{margin-top:.25rem !important;margin-bottom:.25rem !important}.my-xl-2{margin-top:.5rem !important;margin-bottom:.5rem !important}.my-xl-3{margin-top:1rem !important;margin-bottom:1rem !important}.my-xl-4{margin-top:1.5rem !important;margin-bottom:1.5rem !important}.my-xl-5{margin-top:3rem !important;margin-bottom:3rem !important}.my-xl-auto{margin-top:auto !important;margin-bottom:auto !important}.mt-xl-0{margin-top:0 !important}.mt-xl-1{margin-top:.25rem !important}.mt-xl-2{margin-top:.5rem !important}.mt-xl-3{margin-top:1rem !important}.mt-xl-4{margin-top:1.5rem !important}.mt-xl-5{margin-top:3rem !important}.mt-xl-auto{margin-top:auto !important}.me-xl-0{margin-right:0 !important}.me-xl-1{margin-right:.25rem !important}.me-xl-2{margin-right:.5rem !important}.me-xl-3{margin-right:1rem !important}.me-xl-4{margin-right:1.5rem !important}.me-xl-5{margin-right:3rem !important}.me-xl-auto{margin-right:auto !important}.mb-xl-0{margin-bottom:0 !important}.mb-xl-1{margin-bottom:.25rem !important}.mb-xl-2{margin-bottom:.5rem !important}.mb-xl-3{margin-bottom:1rem !important}.mb-xl-4{margin-bottom:1.5rem !important}.mb-xl-5{margin-bottom:3rem !important}.mb-xl-auto{margin-bottom:auto !important}.ms-xl-0{margin-left:0 !important}.ms-xl-1{margin-left:.25rem !important}.ms-xl-2{margin-left:.5rem !important}.ms-xl-3{margin-left:1rem !important}.ms-xl-4{margin-left:1.5rem !important}.ms-xl-5{margin-left:3rem !important}.ms-xl-auto{margin-left:auto !important}.p-xl-0{padding:0 !important}.p-xl-1{padding:.25rem !important}.p-xl-2{padding:.5rem !important}.p-xl-3{padding:1rem !important}.p-xl-4{padding:1.5rem !important}.p-xl-5{padding:3rem !important}.px-xl-0{padding-right:0 !important;padding-left:0 !important}.px-xl-1{padding-right:.25rem !important;padding-left:.25rem !important}.px-xl-2{padding-right:.5rem !important;padding-left:.5rem !important}.px-xl-3{padding-right:1rem !important;padding-left:1rem !important}.px-xl-4{padding-right:1.5rem !important;padding-left:1.5rem !important}.px-xl-5{padding-right:3rem !important;padding-left:3rem !important}.py-xl-0{padding-top:0 !important;padding-bottom:0 !important}.py-xl-1{padding-top:.25rem !important;padding-bottom:.25rem !important}.py-xl-2{padding-top:.5rem !important;padding-bottom:.5rem !important}.py-xl-3{padding-top:1rem !important;padding-bottom:1rem !important}.py-xl-4{padding-top:1.5rem !important;padding-bottom:1.5rem !important}.py-xl-5{padding-top:3rem !important;padding-bottom:3rem !important}.pt-xl-0{padding-top:0 !important}.pt-xl-1{padding-top:.25rem !important}.pt-xl-2{padding-top:.5rem !important}.pt-xl-3{padding-top:1rem !important}.pt-xl-4{padding-top:1.5rem !important}.pt-xl-5{padding-top:3rem !important}.pe-xl-0{padding-right:0 !important}.pe-xl-1{padding-right:.25rem !important}.pe-xl-2{padding-right:.5rem !important}.pe-xl-3{padding-right:1rem !important}.pe-xl-4{padding-right:1.5rem !important}.pe-xl-5{padding-right:3rem !important}.pb-xl-0{padding-bottom:0 !important}.pb-xl-1{padding-bottom:.25rem !important}.pb-xl-2{padding-bottom:.5rem !important}.pb-xl-3{padding-bottom:1rem !important}.pb-xl-4{padding-bottom:1.5rem !important}.pb-xl-5{padding-bottom:3rem !important}.ps-xl-0{padding-left:0 !important}.ps-xl-1{padding-left:.25rem !important}.ps-xl-2{padding-left:.5rem !important}.ps-xl-3{padding-left:1rem !important}.ps-xl-4{padding-left:1.5rem !important}.ps-xl-5{padding-left:3rem !important}.gap-xl-0{gap:0 !important}.gap-xl-1{gap:.25rem !important}.gap-xl-2{gap:.5rem !important}.gap-xl-3{gap:1rem !important}.gap-xl-4{gap:1.5rem !important}.gap-xl-5{gap:3rem !important}.text-xl-start{text-align:left !important}.text-xl-end{text-align:right !important}.text-xl-center{text-align:center !important}}@media(min-width: 1400px){.float-xxl-start{float:left !important}.float-xxl-end{float:right !important}.float-xxl-none{float:none !important}.d-xxl-inline{display:inline !important}.d-xxl-inline-block{display:inline-block !important}.d-xxl-block{display:block !important}.d-xxl-grid{display:grid !important}.d-xxl-table{display:table !important}.d-xxl-table-row{display:table-row !important}.d-xxl-table-cell{display:table-cell !important}.d-xxl-flex{display:flex !important}.d-xxl-inline-flex{display:inline-flex !important}.d-xxl-none{display:none !important}.flex-xxl-fill{flex:1 1 auto !important}.flex-xxl-row{flex-direction:row !important}.flex-xxl-column{flex-direction:column !important}.flex-xxl-row-reverse{flex-direction:row-reverse !important}.flex-xxl-column-reverse{flex-direction:column-reverse !important}.flex-xxl-grow-0{flex-grow:0 !important}.flex-xxl-grow-1{flex-grow:1 !important}.flex-xxl-shrink-0{flex-shrink:0 !important}.flex-xxl-shrink-1{flex-shrink:1 !important}.flex-xxl-wrap{flex-wrap:wrap !important}.flex-xxl-nowrap{flex-wrap:nowrap !important}.flex-xxl-wrap-reverse{flex-wrap:wrap-reverse !important}.justify-content-xxl-start{justify-content:flex-start !important}.justify-content-xxl-end{justify-content:flex-end !important}.justify-content-xxl-center{justify-content:center !important}.justify-content-xxl-between{justify-content:space-between !important}.justify-content-xxl-around{justify-content:space-around !important}.justify-content-xxl-evenly{justify-content:space-evenly !important}.align-items-xxl-start{align-items:flex-start !important}.align-items-xxl-end{align-items:flex-end !important}.align-items-xxl-center{align-items:center !important}.align-items-xxl-baseline{align-items:baseline !important}.align-items-xxl-stretch{align-items:stretch !important}.align-content-xxl-start{align-content:flex-start !important}.align-content-xxl-end{align-content:flex-end !important}.align-content-xxl-center{align-content:center !important}.align-content-xxl-between{align-content:space-between !important}.align-content-xxl-around{align-content:space-around !important}.align-content-xxl-stretch{align-content:stretch !important}.align-self-xxl-auto{align-self:auto !important}.align-self-xxl-start{align-self:flex-start !important}.align-self-xxl-end{align-self:flex-end !important}.align-self-xxl-center{align-self:center !important}.align-self-xxl-baseline{align-self:baseline !important}.align-self-xxl-stretch{align-self:stretch !important}.order-xxl-first{order:-1 !important}.order-xxl-0{order:0 !important}.order-xxl-1{order:1 !important}.order-xxl-2{order:2 !important}.order-xxl-3{order:3 !important}.order-xxl-4{order:4 !important}.order-xxl-5{order:5 !important}.order-xxl-last{order:6 !important}.m-xxl-0{margin:0 !important}.m-xxl-1{margin:.25rem !important}.m-xxl-2{margin:.5rem !important}.m-xxl-3{margin:1rem !important}.m-xxl-4{margin:1.5rem !important}.m-xxl-5{margin:3rem !important}.m-xxl-auto{margin:auto !important}.mx-xxl-0{margin-right:0 !important;margin-left:0 !important}.mx-xxl-1{margin-right:.25rem !important;margin-left:.25rem !important}.mx-xxl-2{margin-right:.5rem !important;margin-left:.5rem !important}.mx-xxl-3{margin-right:1rem !important;margin-left:1rem !important}.mx-xxl-4{margin-right:1.5rem !important;margin-left:1.5rem !important}.mx-xxl-5{margin-right:3rem !important;margin-left:3rem !important}.mx-xxl-auto{margin-right:auto !important;margin-left:auto !important}.my-xxl-0{margin-top:0 !important;margin-bottom:0 !important}.my-xxl-1{margin-top:.25rem !important;margin-bottom:.25rem !important}.my-xxl-2{margin-top:.5rem !important;margin-bottom:.5rem !important}.my-xxl-3{margin-top:1rem !important;margin-bottom:1rem !important}.my-xxl-4{margin-top:1.5rem !important;margin-bottom:1.5rem !important}.my-xxl-5{margin-top:3rem !important;margin-bottom:3rem !important}.my-xxl-auto{margin-top:auto !important;margin-bottom:auto !important}.mt-xxl-0{margin-top:0 !important}.mt-xxl-1{margin-top:.25rem !important}.mt-xxl-2{margin-top:.5rem !important}.mt-xxl-3{margin-top:1rem !important}.mt-xxl-4{margin-top:1.5rem !important}.mt-xxl-5{margin-top:3rem !important}.mt-xxl-auto{margin-top:auto !important}.me-xxl-0{margin-right:0 !important}.me-xxl-1{margin-right:.25rem !important}.me-xxl-2{margin-right:.5rem !important}.me-xxl-3{margin-right:1rem !important}.me-xxl-4{margin-right:1.5rem !important}.me-xxl-5{margin-right:3rem !important}.me-xxl-auto{margin-right:auto !important}.mb-xxl-0{margin-bottom:0 !important}.mb-xxl-1{margin-bottom:.25rem !important}.mb-xxl-2{margin-bottom:.5rem !important}.mb-xxl-3{margin-bottom:1rem !important}.mb-xxl-4{margin-bottom:1.5rem !important}.mb-xxl-5{margin-bottom:3rem !important}.mb-xxl-auto{margin-bottom:auto !important}.ms-xxl-0{margin-left:0 !important}.ms-xxl-1{margin-left:.25rem !important}.ms-xxl-2{margin-left:.5rem !important}.ms-xxl-3{margin-left:1rem !important}.ms-xxl-4{margin-left:1.5rem !important}.ms-xxl-5{margin-left:3rem !important}.ms-xxl-auto{margin-left:auto !important}.p-xxl-0{padding:0 !important}.p-xxl-1{padding:.25rem !important}.p-xxl-2{padding:.5rem !important}.p-xxl-3{padding:1rem !important}.p-xxl-4{padding:1.5rem !important}.p-xxl-5{padding:3rem !important}.px-xxl-0{padding-right:0 !important;padding-left:0 !important}.px-xxl-1{padding-right:.25rem !important;padding-left:.25rem !important}.px-xxl-2{padding-right:.5rem !important;padding-left:.5rem !important}.px-xxl-3{padding-right:1rem !important;padding-left:1rem !important}.px-xxl-4{padding-right:1.5rem !important;padding-left:1.5rem !important}.px-xxl-5{padding-right:3rem !important;padding-left:3rem !important}.py-xxl-0{padding-top:0 !important;padding-bottom:0 !important}.py-xxl-1{padding-top:.25rem !important;padding-bottom:.25rem !important}.py-xxl-2{padding-top:.5rem !important;padding-bottom:.5rem !important}.py-xxl-3{padding-top:1rem !important;padding-bottom:1rem !important}.py-xxl-4{padding-top:1.5rem !important;padding-bottom:1.5rem !important}.py-xxl-5{padding-top:3rem !important;padding-bottom:3rem !important}.pt-xxl-0{padding-top:0 !important}.pt-xxl-1{padding-top:.25rem !important}.pt-xxl-2{padding-top:.5rem !important}.pt-xxl-3{padding-top:1rem !important}.pt-xxl-4{padding-top:1.5rem !important}.pt-xxl-5{padding-top:3rem !important}.pe-xxl-0{padding-right:0 !important}.pe-xxl-1{padding-right:.25rem !important}.pe-xxl-2{padding-right:.5rem !important}.pe-xxl-3{padding-right:1rem !important}.pe-xxl-4{padding-right:1.5rem !important}.pe-xxl-5{padding-right:3rem !important}.pb-xxl-0{padding-bottom:0 !important}.pb-xxl-1{padding-bottom:.25rem !important}.pb-xxl-2{padding-bottom:.5rem !important}.pb-xxl-3{padding-bottom:1rem !important}.pb-xxl-4{padding-bottom:1.5rem !important}.pb-xxl-5{padding-bottom:3rem !important}.ps-xxl-0{padding-left:0 !important}.ps-xxl-1{padding-left:.25rem !important}.ps-xxl-2{padding-left:.5rem !important}.ps-xxl-3{padding-left:1rem !important}.ps-xxl-4{padding-left:1.5rem !important}.ps-xxl-5{padding-left:3rem !important}.gap-xxl-0{gap:0 !important}.gap-xxl-1{gap:.25rem !important}.gap-xxl-2{gap:.5rem !important}.gap-xxl-3{gap:1rem !important}.gap-xxl-4{gap:1.5rem !important}.gap-xxl-5{gap:3rem !important}.text-xxl-start{text-align:left !important}.text-xxl-end{text-align:right !important}.text-xxl-center{text-align:center !important}}@media(min-width: 1200px){.fs-1{font-size:2.5rem !important}.fs-2{font-size:2rem !important}.fs-3{font-size:1.75rem !important}.fs-4{font-size:1.5rem !important}}@media print{.d-print-inline{display:inline !important}.d-print-inline-block{display:inline-block !important}.d-print-block{display:block !important}.d-print-grid{display:grid !important}.d-print-table{display:table !important}.d-print-table-row{display:table-row !important}.d-print-table-cell{display:table-cell !important}.d-print-flex{display:flex !important}.d-print-inline-flex{display:inline-flex !important}.d-print-none{display:none !important}}.test1{background-color:aqua}.test2{background-color:red}
:root{--cc-bg:#fff;--cc-text:#2d4156;--cc-btn-primary-bg:#2d4156;--cc-btn-primary-text:var(--cc-bg);--cc-btn-primary-hover-bg:#1d2e38;--cc-btn-secondary-bg:#eaeff2;--cc-btn-secondary-text:var(--cc-text);--cc-btn-secondary-hover-bg:#d8e0e6;--cc-toggle-bg-off:#919ea6;--cc-toggle-bg-on:var(--cc-btn-primary-bg);--cc-toggle-bg-readonly:#d5dee2;--cc-toggle-knob-bg:#fff;--cc-toggle-knob-icon-color:#ecf2fa;--cc-block-text:var(--cc-text);--cc-cookie-category-block-bg:#f0f4f7;--cc-cookie-category-block-bg-hover:#e9eff4;--cc-section-border:#f1f3f5;--cc-cookie-table-border:#e9edf2;--cc-overlay-bg:rgba(4, 6, 8, .85);--cc-webkit-scrollbar-bg:#cfd5db;--cc-webkit-scrollbar-bg-hover:#9199a0}.c_darkmode{--cc-bg:#181b1d;--cc-text:#d8e5ea;--cc-btn-primary-bg:#a6c4dd;--cc-btn-primary-text:#000;--cc-btn-primary-hover-bg:#c2dff7;--cc-btn-secondary-bg:#33383c;--cc-btn-secondary-text:var(--cc-text);--cc-btn-secondary-hover-bg:#3e454a;--cc-toggle-bg-off:#667481;--cc-toggle-bg-on:var(--cc-btn-primary-bg);--cc-toggle-bg-readonly:#454c54;--cc-toggle-knob-bg:var(--cc-cookie-category-block-bg);--cc-toggle-knob-icon-color:var(--cc-bg);--cc-block-text:#b3bfc5;--cc-cookie-category-block-bg:#23272a;--cc-cookie-category-block-bg-hover:#2b3035;--cc-section-border:#292d31;--cc-cookie-table-border:#2b3035;--cc-webkit-scrollbar-bg:#667481;--cc-webkit-scrollbar-bg-hover:#9199a0}.cc_div *,.cc_div :after,.cc_div :before{-webkit-box-sizing:border-box;box-sizing:border-box;float:none;font-style:inherit;font-variant:normal;font-weight:inherit;font-family:inherit;line-height:1.2;font-size:1em;transition:none;animation:none;margin:0;padding:0;text-transform:none;letter-spacing:unset;color:inherit;background:0 0;border:none;box-shadow:none;text-decoration:none;text-align:left;visibility:unset}.cc_div{font-size:16px;font-weight:400;font-family:-apple-system,BlinkMacSystemFont,"Segoe UI",Roboto,Helvetica,Arial,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol";-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale;text-rendering:optimizeLegibility;color:#2d4156;color:var(--cc-text)}#c-ttl,#s-bl td:before,#s-ttl,.cc_div .b-tl,.cc_div .c-bn{font-weight:600}#cm,#s-bl .act .b-acc,#s-inr,.cc_div .b-tl,.cc_div .c-bl{border-radius:.35em}#s-bl .act .b-acc{border-top-left-radius:0;border-top-right-radius:0}.cc_div a,.cc_div button,.cc_div input{-webkit-appearance:none;-moz-appearance:none;appearance:none}.cc_div a{border-bottom:1px solid}.cc_div a:hover{text-decoration:none;border-color:transparent}#cm-ov,#cs-ov,.c--anim #cm,.c--anim #s-cnt,.c--anim #s-inr{transition:visibility .25s linear,opacity .25s ease,transform .25s ease!important}.c--anim .c-bn{transition:background-color .25s ease!important}.c--anim #cm.bar.slide,.c--anim .bar.slide #s-inr{transition:visibility .4s ease,opacity .4s ease,transform .4s ease!important}.c--anim #cm.bar.slide+#cm-ov,.c--anim .bar.slide+#cs-ov{transition:visibility .4s ease,opacity .4s ease,transform .4s ease!important}#cm.bar.slide,.cc_div .bar.slide #s-inr{transform:translateX(100%);opacity:1}#cm.bar.top.slide,.cc_div .bar.left.slide #s-inr{transform:translateX(-100%);opacity:1}#cm.slide,.cc_div .slide #s-inr{transform:translateY(1.6em)}#cm.top.slide{transform:translateY(-1.6em)}#cm.bar.slide{transform:translateY(100%)}#cm.bar.top.slide{transform:translateY(-100%)}.show--consent .c--anim #cm,.show--consent .c--anim #cm.bar,.show--settings .c--anim #s-inr,.show--settings .c--anim .bar.slide #s-inr{opacity:1;transform:scale(1);visibility:visible!important}.show--consent .c--anim #cm.box.middle,.show--consent .c--anim #cm.cloud.middle{transform:scale(1) translateY(-50%)}.show--settings .c--anim #s-cnt{visibility:visible!important}.force--consent.show--consent .c--anim #cm-ov,.show--settings .c--anim #cs-ov{visibility:visible!important;opacity:1!important}#cm{font-family:inherit;padding:1.1em 1.8em 1.4em 1.8em;position:fixed;z-index:1;background:#fff;background:var(--cc-bg);max-width:24.2em;width:100%;bottom:1.25em;right:1.25em;box-shadow:0 .625em 1.875em #000;box-shadow:0 .625em 1.875em rgba(2,2,3,.28);opacity:0;visibility:hidden;transform:scale(.95);line-height:initial}#cc_div #cm{display:block!important}#c-ttl{margin-bottom:.7em;font-size:1.05em}.cloud #c-ttl{margin-top:-.15em}#c-txt{font-size:.9em;line-height:1.5em}.cc_div #c-bns{display:flex;justify-content:space-between;margin-top:1.4em}.cc_div .c-bn{color:#40505a;color:var(--cc-btn-secondary-text);background:#e5ebef;background:var(--cc-btn-secondary-bg);padding:1em 1.7em;display:inline-block;cursor:pointer;font-size:.82em;-moz-user-select:none;-khtml-user-select:none;-webkit-user-select:none;-o-user-select:none;user-select:none;text-align:center;border-radius:4px;flex:1}#c-bns button+button,#s-c-bn,#s-cnt button+button{float:right;margin-left:1em}#s-cnt #s-rall-bn{float:none}#cm .c_link:active,#cm .c_link:hover,#s-c-bn:active,#s-c-bn:hover,#s-cnt button+button:active,#s-cnt button+button:hover{background:#d8e0e6;background:var(--cc-btn-secondary-hover-bg)}#s-cnt{position:fixed;top:0;left:0;width:100%;z-index:101;display:table;height:100%;visibility:hidden}#s-bl{outline:0}#s-bl .title{margin-top:1.4em}#s-bl .title:first-child{margin-top:0}#s-bl .b-bn{margin-top:0}#s-bl .b-acc .p{margin-top:0;padding:1em}#s-cnt .b-bn .b-tl{display:block;font-family:inherit;font-size:.95em;width:100%;position:relative;padding:1.3em 6.4em 1.3em 2.7em;background:0 0;transition:background-color .25s ease}#s-cnt .b-bn .b-tl.exp{cursor:pointer}#s-cnt .act .b-bn .b-tl{border-bottom-right-radius:0;border-bottom-left-radius:0}#s-cnt .b-bn .b-tl:active,#s-cnt .b-bn .b-tl:hover{background:#e9eff4;background:var(--cc-cookie-category-block-bg-hover)}#s-bl .b-bn{position:relative}#s-bl .c-bl{padding:1em;margin-bottom:.5em;border:1px solid #f1f3f5;border-color:var(--cc-section-border);transition:background-color .25s ease}#s-bl .c-bl:hover{background:#f0f4f7;background:var(--cc-cookie-category-block-bg)}#s-bl .c-bl:last-child{margin-bottom:.5em}#s-bl .c-bl:first-child{transition:none;padding:0;margin-top:0;border:none;margin-bottom:2em}#s-bl .c-bl:not(.b-ex):first-child:hover{background:0 0;background:unset}#s-bl .c-bl.b-ex{padding:0;border:none;background:#f0f4f7;background:var(--cc-cookie-category-block-bg);transition:none}#s-bl .c-bl.b-ex+.c-bl{margin-top:2em}#s-bl .c-bl.b-ex+.c-bl.b-ex{margin-top:0}#s-bl .c-bl.b-ex:first-child{margin-bottom:1em}#s-bl .c-bl.b-ex:first-child{margin-bottom:.5em}#s-bl .b-acc{max-height:0;overflow:hidden;padding-top:0;margin-bottom:0;display:none}#s-bl .act .b-acc{max-height:100%;display:block;overflow:hidden}#s-cnt .p{font-size:.9em;line-height:1.5em;margin-top:.85em;color:#2d4156;color:var(--cc-block-text)}.cc_div .b-tg .c-tgl:disabled{cursor:not-allowed}#c-vln{display:table-cell;vertical-align:middle;position:relative}#cs{padding:0 1.7em;width:100%;position:fixed;left:0;right:0;top:0;bottom:0;height:100%}#s-inr{height:100%;position:relative;max-width:45em;margin:0 auto;transform:scale(.96);opacity:0;padding-top:4.75em;padding-bottom:4.75em;position:relative;height:100%;overflow:hidden;visibility:hidden;box-shadow:rgba(3,6,9,.26) 0 13px 27px -5px}#s-bns,#s-hdr,#s-inr{background:#fff;background:var(--cc-bg)}#s-bl{overflow-y:auto;overflow-y:overlay;overflow-x:hidden;height:100%;padding:1.3em 2.1em;display:block;width:100%}#s-bns{position:absolute;bottom:0;left:0;right:0;padding:1em 2.1em;border-top:1px solid #f1f3f5;border-color:var(--cc-section-border);height:4.75em}.cc_div .cc-link{color:#253b48;color:var(--cc-btn-primary-bg);border-bottom:1px solid #253b48;border-color:var(--cc-btn-primary-bg);display:inline;padding-bottom:0;text-decoration:none;cursor:pointer;font-weight:600}.cc_div .cc-link:active,.cc_div .cc-link:hover{border-color:transparent}#c-bns button:first-child,#s-bns button:first-child{color:#fff;color:var(--cc-btn-primary-text);background:#253b48;background:var(--cc-btn-primary-bg)}#c-bns.swap button:first-child{color:#40505a;color:var(--cc-btn-secondary-text);background:#e5ebef;background:var(--cc-btn-secondary-bg)}#c-bns.swap button:last-child{color:#fff;color:var(--cc-btn-primary-text);background:#253b48;background:var(--cc-btn-primary-bg)}.cc_div .b-tg .c-tgl:checked~.c-tg{background:#253b48;background:var(--cc-toggle-bg-on)}#c-bns button:first-child:active,#c-bns button:first-child:hover,#c-bns.swap button:last-child:active,#c-bns.swap button:last-child:hover,#s-bns button:first-child:active,#s-bns button:first-child:hover{background:#1d2e38;background:var(--cc-btn-primary-hover-bg)}#c-bns.swap button:first-child:active,#c-bns.swap button:first-child:hover{background:#d8e0e6;background:var(--cc-btn-secondary-hover-bg)}#s-hdr{position:absolute;top:0;width:100%;display:table;padding:0 2.1em;height:4.75em;vertical-align:middle;z-index:2;border-bottom:1px solid #f1f3f5;border-color:var(--cc-section-border)}#s-ttl{display:table-cell;vertical-align:middle;font-size:1em}#s-c-bn{padding:0;width:1.7em;height:1.7em;font-size:1.45em;margin:0;font-weight:initial;position:relative}#s-c-bnc{display:table-cell;vertical-align:middle}.cc_div span.t-lb{position:absolute;top:0;z-index:-1;opacity:0;pointer-events:none;overflow:hidden}#c_policy__text{height:31.25em;overflow-y:auto;margin-top:1.25em}#c-s-in{position:relative;transform:translateY(-50%);top:50%;height:100%;height:calc(100% - 2.5em);max-height:37.5em}@media screen and (min-width:688px){#s-bl::-webkit-scrollbar{width:.9em;height:100%;background:0 0;border-radius:0 .25em .25em 0}#s-bl::-webkit-scrollbar-thumb{border:.25em solid var(--cc-bg);background:#cfd5db;background:var(--cc-webkit-scrollbar-bg);border-radius:100em}#s-bl::-webkit-scrollbar-thumb:hover{background:#9199a0;background:var(--cc-webkit-scrollbar-bg-hover)}#s-bl::-webkit-scrollbar-button{width:10px;height:5px}}.cc_div .b-tg{position:absolute;right:0;top:0;bottom:0;display:inline-block;margin:auto;right:1.2em;cursor:pointer;-webkit-user-select:none;-moz-user-select:none;-ms-user-select:none;user-select:none;vertical-align:middle}.cc_div .b-tg .c-tgl{position:absolute;cursor:pointer;display:block;top:0;left:0;margin:0;border:0}.cc_div .b-tg .c-tg{position:absolute;background:#919ea6;background:var(--cc-toggle-bg-off);transition:background-color .25s ease,box-shadow .25s ease;pointer-events:none}.cc_div .b-tg,.cc_div .b-tg .c-tg,.cc_div .b-tg .c-tgl,.cc_div span.t-lb{width:3.4em;height:1.5em;border-radius:4em}.cc_div .b-tg .c-tg.c-ro{cursor:not-allowed}.cc_div .b-tg .c-tgl~.c-tg.c-ro{background:#d5dee2;background:var(--cc-toggle-bg-readonly)}.cc_div .b-tg .c-tgl~.c-tg.c-ro:after{box-shadow:none}.cc_div .b-tg .c-tg:after{content:"";position:relative;display:block;left:.125em;top:.125em;width:1.25em;height:1.25em;border:none;box-sizing:content-box;background:#fff;background:var(--cc-toggle-knob-bg);box-shadow:0 1px 2px rgba(24,32,35,.36);transition:transform .25s ease;border-radius:100%}.cc_div .b-tg .c-tgl:checked~.c-tg:after{transform:translateX(1.9em)}#s-bl table,#s-bl td,#s-bl th{border:none}#s-bl tbody tr{transition:background-color .25s ease}#s-bl tbody tr:hover{background:#e9eff4;background:var(--cc-cookie-category-block-bg-hover)}#s-bl table{text-align:left;border-collapse:collapse;width:100%;padding:0;margin:0;overflow:hidden}#s-bl td,#s-bl th{padding:.8em .625em;text-align:left;vertical-align:top;font-size:.8em;padding-left:1.2em}#s-bl th{font-family:inherit;padding:1.2em 1.2em}#s-bl thead tr:first-child{border-bottom:1px solid #e9edf2;border-color:var(--cc-cookie-table-border)}.force--consent #cs,.force--consent #s-cnt{width:100vw}#cm-ov,#cs-ov{position:fixed;left:0;right:0;top:0;bottom:0;visibility:hidden;opacity:0;background:#070707;background:rgba(4,6,8,.85);background:var(--cc-overlay-bg);display:none;transition:none}.c--anim #cs-ov,.force--consent .c--anim #cm-ov,.force--consent.show--consent #cm-ov,.show--settings #cs-ov{display:block}#cs-ov{z-index:2}.force--consent .cc_div{position:fixed;top:0;left:0;bottom:0;width:100%;width:100vw;visibility:hidden;transition:visibility .25s linear}.force--consent.show--consent .c--anim .cc_div,.force--consent.show--settings .c--anim .cc_div{visibility:visible}.force--consent #cm{position:absolute}.force--consent #cm.bar{width:100vw;max-width:100vw}html.force--consent.show--consent{overflow-y:hidden!important}html.force--consent.show--consent,html.force--consent.show--consent body{height:auto!important;overflow-x:hidden!important}.cc_div .act .b-bn .b-tl.exp::before,.cc_div .b-bn .b-tl.exp::before{border:solid #2d4156;border-color:var(--cc-btn-secondary-text);border-width:0 2px 2px 0;padding:.2em;display:inline-block;position:absolute;content:'';margin-right:15px;position:absolute;transform:translateY(-50%) rotate(45deg);left:1.2em;top:50%}.cc_div .act .b-bn .b-tl::before{transform:translateY(-20%) rotate(225deg)}.cc_div .on-i::before{border:solid #fff;border-color:var(--cc-toggle-knob-icon-color);border-width:0 2px 2px 0;padding:.1em;display:inline-block;padding-bottom:.45em;content:'';margin:0 auto;transform:rotate(45deg);top:.37em;left:.75em;position:absolute}#s-c-bn::after,#s-c-bn::before{content:'';position:absolute;left:.82em;top:.58em;height:.6em;width:1.5px;background:#444d53;background:var(--cc-btn-secondary-text);transform:rotate(45deg);border-radius:1em;margin:0 auto}#s-c-bn::after{transform:rotate(-45deg)}.cc_div .off-i,.cc_div .on-i{height:100%;width:50%;position:absolute;right:0;display:block;text-align:center;transition:opacity .15s ease}.cc_div .on-i{left:0;opacity:0}.cc_div .off-i::after,.cc_div .off-i::before{right:.8em;top:.42em;content:' ';height:.7em;width:.09375em;display:block;background:#cdd6dc;background:var(--cc-toggle-knob-icon-color);margin:0 auto;position:absolute;transform-origin:center}.cc_div .off-i::before{transform:rotate(45deg)}.cc_div .off-i::after{transform:rotate(-45deg)}.cc_div .b-tg .c-tgl:checked~.c-tg .on-i{opacity:1}.cc_div .b-tg .c-tgl:checked~.c-tg .off-i{opacity:0}#cm.box.middle,#cm.cloud.middle{top:50%;transform:translateY(-37%);bottom:auto}#cm.box.middle.zoom,#cm.cloud.middle.zoom{transform:scale(.95) translateY(-50%)}#cm.box.center{left:1em;right:1em;margin:0 auto}#cm.cloud{max-width:50em;margin:0 auto;text-align:center;left:1em;right:1em;overflow:hidden;padding:1.3em 2em;width:unset}.cc_div .cloud #c-inr{display:table;width:100%}.cc_div .cloud #c-inr-i{width:70%;display:table-cell;vertical-align:top;padding-right:2.4em}.cc_div .cloud #c-txt{font-size:.85em}.cc_div .cloud #c-bns{min-width:170px;display:table-cell;vertical-align:middle}#cm.cloud .c-bn{margin:.625em 0 0 0;width:100%}#cm.cloud .c-bn:first-child{margin:0}#cm.cloud.left{margin-right:1.25em}#cm.cloud.right{margin-left:1.25em}#cm.bar{width:100%;max-width:100%;left:0;right:0;bottom:0;border-radius:0;position:fixed;padding:2em}#cm.bar #c-inr{max-width:32em;margin:0 auto}#cm.bar #c-bns{max-width:33.75em}#cm.bar #cs{padding:0}.cc_div .bar #c-s-in{top:0;transform:none;height:100%;max-height:100%}.cc_div .bar #s-bl,.cc_div .bar #s-bns,.cc_div .bar #s-hdr{padding-left:1.6em;padding-right:1.6em}.cc_div .bar #cs{padding:0}.cc_div .bar #s-inr{margin:0;margin-left:auto;margin-right:0;border-radius:0;max-width:32em}.cc_div .bar.left #s-inr{margin-left:0;margin-right:auto}.cc_div .bar #s-bl table,.cc_div .bar #s-bl tbody,.cc_div .bar #s-bl td,.cc_div .bar #s-bl th,.cc_div .bar #s-bl thead,.cc_div .bar #s-bl tr,.cc_div .bar #s-cnt{display:block}.cc_div .bar #s-bl thead tr{position:absolute;top:-9999px;left:-9999px}.cc_div .bar #s-bl tr{border-top:1px solid #e3e7ed;border-color:var(--cc-cookie-table-border)}.cc_div .bar #s-bl td{border:none;position:relative;padding-left:35%}.cc_div .bar #s-bl td:before{position:absolute;left:1em;padding-right:.625em;white-space:nowrap;content:attr(data-column);color:#000;color:var(--cc-text);overflow:hidden;text-overflow:ellipsis}#cm.top{bottom:auto;top:1.25em}#cm.left{right:auto;left:1.25em}#cm.right{left:auto;right:1.25em}#cm.bar.left,#cm.bar.right{left:0;right:0}#cm.bar.top{top:0}@media screen and (max-width:688px){#cm,#cm.cloud,#cm.left,#cm.right{width:auto;max-width:100%;margin:0;padding:1.4em!important;right:1em;left:1em;bottom:1em;display:block}.force--consent #cm,.force--consent #cm.cloud{width:auto;max-width:100vw}#cm.top{top:1em;bottom:auto}#cm.bottom{bottom:1em;top:auto}#cm.bar.bottom{bottom:0}#cm.cloud .c-bn{font-size:.85em}#s-bns,.cc_div .bar #s-bns{padding:1em 1.3em}.cc_div .bar #s-inr{max-width:100%;width:100%}.cc_div .cloud #c-inr-i{padding-right:0}#cs{border-radius:0;padding:0}#c-s-in{max-height:100%;height:100%;top:0;transform:none}.cc_div .b-tg{transform:scale(1.1);right:1.1em}#s-inr{margin:0;padding-bottom:7.9em;border-radius:0}#s-bns{height:7.9em}#s-bl,.cc_div .bar #s-bl{padding:1.3em}#s-hdr,.cc_div .bar #s-hdr{padding:0 1.3em}#s-bl table{width:100%}#s-inr.bns-t{padding-bottom:10.5em}.bns-t #s-bns{height:10.5em}.cc_div .bns-t .c-bn{font-size:.83em;padding:.9em 1.6em}#s-cnt .b-bn .b-tl{padding-top:1.2em;padding-bottom:1.2em}#s-bl table,#s-bl tbody,#s-bl td,#s-bl th,#s-bl thead,#s-bl tr,#s-cnt{display:block}#s-bl thead tr{position:absolute;top:-9999px;left:-9999px}#s-bl tr{border-top:1px solid #e3e7ed;border-color:var(--cc-cookie-table-border)}#s-bl td{border:none;position:relative;padding-left:35%}#s-bl td:before{position:absolute;left:1em;padding-right:.625em;white-space:nowrap;content:attr(data-column);color:#000;color:var(--cc-text);overflow:hidden;text-overflow:ellipsis}#cm .c-bn,.cc_div .c-bn{width:100%;margin-right:0}#s-cnt #s-rall-bn{margin-left:0}.cc_div #c-bns{flex-direction:column}#c-bns button+button,#s-cnt button+button{margin-top:.625em;margin-left:0;float:unset}#cm.box,#cm.cloud{left:1em;right:1em;width:auto}#cm.cloud.left,#cm.cloud.right{margin:0}.cc_div .cloud #c-bns,.cc_div .cloud #c-inr,.cc_div .cloud #c-inr-i{display:block;width:auto;min-width:unset}.cc_div .cloud #c-txt{font-size:.9em}.cc_div .cloud #c-bns{margin-top:1.625em}}.cc_div.ie #c-vln{height:100%;padding-top:5.62em}.cc_div.ie .bar #c-vln{padding-top:0}.cc_div.ie #cs{max-height:37.5em;position:relative;top:0;margin-top:-5.625em}.cc_div.ie .bar #cs{margin-top:0;max-height:100%}.cc_div.ie #cm{border:1px solid #dee6e9}.cc_div.ie #c-s-in{top:0}.cc_div.ie .b-tg{padding-left:1em;margin-bottom:.7em}.cc_div.ie .b-tg .c-tgl:checked~.c-tg:after{left:1.95em}.cc_div.ie #s-bl table{overflow:auto}.cc_div.ie .b-tg .c-tg{display:none}.cc_div.ie .b-tg .c-tgl{position:relative;display:inline-block;vertical-align:middle;margin-bottom:.2em;height:auto}.cc_div.ie #s-cnt .b-bn .b-tl{padding:1.3em 6.4em 1.3em 1.4em}.cc_div.ie .bar #s-bl td:before{display:none}.cc_div.ie .bar #s-bl td{padding:.8em .625em .8em 1.2em}.cc_div.ie .bar #s-bl thead tr{position:relative}.cc_div.ie .b-tg .t-lb{filter: alpha(opacity=0);}.cc_div.ie #cm-ov,.cc_div.ie #cs-ov{filter: alpha(opacity=80);}